@charset "UTF-8";
@import url("https://fonts.googleapis.com/css2?family=DM+Sans:wght@400;500;700&display=swap");
@import url("https://fonts.googleapis.com/css2?family=Oswald:wght@400;500;600;700&display=swap");
/*!
 * Bootstrap  v5.3.0-alpha1 (https://getbootstrap.com/)
 * Copyright 2011-2022 The Bootstrap Authors
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */:root, [data-bs-theme=light] {
--bs-blue:#0d6efd;
--bs-indigo:#6610f2;
--bs-purple:#6f42c1;
--bs-pink:#d63384;
--bs-red:#dc3545;
--bs-orange:#fd7e14;
--bs-yellow:#ffc107;
--bs-green:#198754;
--bs-teal:#20c997;
--bs-cyan:#0dcaf0;
--bs-black:#000;
--bs-white:#fff;
--bs-gray:#6c757d;
--bs-gray-dark:#343a40;
--bs-gray-100:#f8f9fa;
--bs-gray-200:#e9ecef;
--bs-gray-300:#dee2e6;
--bs-gray-400:#ced4da;
--bs-gray-500:#adb5bd;
--bs-gray-600:#6c757d;
--bs-gray-700:#495057;
--bs-gray-800:#343a40;
--bs-gray-900:#212529;
--bs-primary:#0d6efd;
--bs-secondary:#6c757d;
--bs-success:#198754;
--bs-info:#0dcaf0;
--bs-warning:#ffc107;
--bs-danger:#dc3545;
--bs-light:#f8f9fa;
--bs-dark:#212529;
--bs-primary-rgb:13, 110, 253;
--bs-secondary-rgb:108, 117, 125;
--bs-success-rgb:25, 135, 84;
--bs-info-rgb:13, 202, 240;
--bs-warning-rgb:255, 193, 7;
--bs-danger-rgb:220, 53, 69;
--bs-light-rgb:248, 249, 250;
--bs-dark-rgb:33, 37, 41;
--bs-primary-text:#0a58ca;
--bs-secondary-text:#6c757d;
--bs-success-text:#146c43;
--bs-info-text:#087990;
--bs-warning-text:#997404;
--bs-danger-text:#b02a37;
--bs-light-text:#6c757d;
--bs-dark-text:#495057;
--bs-primary-bg-subtle:#cfe2ff;
--bs-secondary-bg-subtle:#f8f9fa;
--bs-success-bg-subtle:#d1e7dd;
--bs-info-bg-subtle:#cff4fc;
--bs-warning-bg-subtle:#fff3cd;
--bs-danger-bg-subtle:#f8d7da;
--bs-light-bg-subtle:#fcfcfd;
--bs-dark-bg-subtle:#ced4da;
--bs-primary-border-subtle:#9ec5fe;
--bs-secondary-border-subtle:#e9ecef;
--bs-success-border-subtle:#a3cfbb;
--bs-info-border-subtle:#9eeaf9;
--bs-warning-border-subtle:#ffe69c;
--bs-danger-border-subtle:#f1aeb5;
--bs-light-border-subtle:#e9ecef;
--bs-dark-border-subtle:#adb5bd;
--bs-white-rgb:255, 255, 255;
--bs-black-rgb:0, 0, 0;
--bs-body-color-rgb:33, 37, 41;
--bs-body-bg-rgb:255, 255, 255;
--bs-font-sans-serif:system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
--bs-font-monospace:SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));
--bs-body-font-family:var(--bs-font-sans-serif);
--bs-body-font-size:1rem;
--bs-body-font-weight:400;
--bs-body-line-height:1.5;
--bs-body-color:#212529;
--bs-emphasis-color:#000;
--bs-emphasis-color-rgb:0, 0, 0;
--bs-secondary-color:rgba(33, 37, 41, 0.75);
--bs-secondary-color-rgb:33, 37, 41;
--bs-secondary-bg:#e9ecef;
--bs-secondary-bg-rgb:233, 236, 239;
--bs-tertiary-color:rgba(33, 37, 41, 0.5);
--bs-tertiary-color-rgb:33, 37, 41;
--bs-tertiary-bg:#f8f9fa;
--bs-tertiary-bg-rgb:248, 249, 250;
--bs-body-bg:#fff;
--bs-body-bg-rgb:255, 255, 255;
--bs-link-color:#0d6efd;
--bs-link-color-rgb:13, 110, 253;
--bs-link-decoration:underline;
--bs-link-hover-color:#0a58ca;
--bs-link-hover-color-rgb:10, 88, 202;
--bs-code-color:#d63384;
--bs-highlight-bg:#fff3cd;
--bs-border-width:1px;
--bs-border-style:solid;
--bs-border-color:#dee2e6;
--bs-border-color-translucent:rgba(0, 0, 0, 0.175);
--bs-border-radius:0.375rem;
--bs-border-radius-sm:0.25rem;
--bs-border-radius-lg:0.5rem;
--bs-border-radius-xl:1rem;
--bs-border-radius-2xl:2rem;
--bs-border-radius-pill:50rem;
--bs-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15);
--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(var(--bs-body-color-rgb), 0.075);
--bs-box-shadow-lg:0 1rem 3rem rgba(var(--bs-body-color-rgb), 0.175);
--bs-box-shadow-inset:inset 0 1px 2px rgba(var(--bs-body-color-rgb), 0.075);
--bs-emphasis-color:#000;
--bs-form-control-bg:var(--bs-body-bg);
--bs-form-control-disabled-bg:var(--bs-secondary-bg);
--bs-highlight-bg:#fff3cd;
--bs-breakpoint-xs:0;
--bs-breakpoint-sm:576px;
--bs-breakpoint-md:768px;
--bs-breakpoint-lg:992px;
--bs-breakpoint-xl:1200px;
--bs-breakpoint-xxl:1400px
}
[data-bs-theme=dark] {
--bs-body-color:#adb5bd;
--bs-body-color-rgb:173, 181, 189;
--bs-body-bg:#212529;
--bs-body-bg-rgb:33, 37, 41;
--bs-emphasis-color:#f8f9fa;
--bs-emphasis-color-rgb:248, 249, 250;
--bs-secondary-color:rgba(173, 181, 189, 0.75);
--bs-secondary-color-rgb:173, 181, 189;
--bs-secondary-bg:#343a40;
--bs-secondary-bg-rgb:52, 58, 64;
--bs-tertiary-color:rgba(173, 181, 189, 0.5);
--bs-tertiary-color-rgb:173, 181, 189;
--bs-tertiary-bg:#2b3035;
--bs-tertiary-bg-rgb:43, 48, 53;
--bs-emphasis-color:#fff;
--bs-primary-text:#6ea8fe;
--bs-secondary-text:#dee2e6;
--bs-success-text:#75b798;
--bs-info-text:#6edff6;
--bs-warning-text:#ffda6a;
--bs-danger-text:#ea868f;
--bs-light-text:#f8f9fa;
--bs-dark-text:#dee2e6;
--bs-primary-bg-subtle:#031633;
--bs-secondary-bg-subtle:#212529;
--bs-success-bg-subtle:#051b11;
--bs-info-bg-subtle:#032830;
--bs-warning-bg-subtle:#332701;
--bs-danger-bg-subtle:#2c0b0e;
--bs-light-bg-subtle:#343a40;
--bs-dark-bg-subtle:#1a1d20;
--bs-primary-border-subtle:#084298;
--bs-secondary-border-subtle:#495057;
--bs-success-border-subtle:#0f5132;
--bs-info-border-subtle:#055160;
--bs-warning-border-subtle:#664d03;
--bs-danger-border-subtle:#842029;
--bs-light-border-subtle:#495057;
--bs-dark-border-subtle:#343a40;
--bs-heading-color:#fff;
--bs-link-color:#6ea8fe;
--bs-link-hover-color:#9ec5fe;
--bs-link-color-rgb:110, 168, 254;
--bs-link-hover-color-rgb:158, 197, 254;
--bs-code-color:#e685b5;
--bs-border-color:#495057;
--bs-border-color-translucent:rgba(255, 255, 255, 0.15)
}
*, ::after, ::before {
	box-sizing: border-box
}

@media (prefers-reduced-motion:no-preference) {
:root {
	scroll-behavior: smooth
}
}
body {
	margin: 0;
	font-family: var(--bs-body-font-family);
	font-size: var(--bs-body-font-size);
	font-weight: var(--bs-body-font-weight);
	line-height: var(--bs-body-line-height);
	color: var(--bs-body-color);
	text-align: var(--bs-body-text-align);
	background-color: var(--bs-body-bg);
	-webkit-text-size-adjust: 100%;
	-webkit-tap-highlight-color: transparent
}
hr {
	margin: 1rem 0;
	color: inherit;
	border: 0;
	border-top: var(--bs-border-width) solid;
	opacity: .25
}
.h1, .h2, .h3, .h4, .h5, .h6, h1, h2, h3, h4, h5, h6 {
	margin-top: 0;
	margin-bottom: .5rem;
	font-weight: 500;
	line-height: 1.2;
	color: var(--bs-heading-color, inherit)
}
.h1, h1 {
	font-size: calc(1.375rem + 1.5vw)
}

@media (min-width:1200px) {
.h1, h1 {
	font-size: 2.5rem
}
}
.h2, h2 {
	font-size: calc(1.325rem + .9vw)
}

@media (min-width:1200px) {
.h2, h2 {
	font-size: 2rem
}
}
.h3, h3 {
	font-size: calc(1.3rem + .6vw)
}

@media (min-width:1200px) {
.h3, h3 {
	font-size: 1.75rem
}
}
.h4, h4 {
	font-size: calc(1.275rem + .3vw)
}

@media (min-width:1200px) {
.h4, h4 {
	font-size: 1.5rem
}
}
.h5, h5 {
	font-size: 1.25rem
}
.h6, h6 {
	font-size: 1rem
}
p {
	margin-top: 0;
	margin-bottom: 1rem
}
abbr[title] {
	-webkit-text-decoration: underline dotted;
	text-decoration: underline dotted;
	cursor: help;
	-webkit-text-decoration-skip-ink: none;
	text-decoration-skip-ink: none
}
address {
	margin-bottom: 1rem;
	font-style: normal;
	line-height: inherit
}
ol, ul {
	padding-left: 2rem
}
dl, ol, ul {
	margin-top: 0;
	margin-bottom: 1rem
}
ol ol, ol ul, ul ol, ul ul {
	margin-bottom: 0
}
dt {
	font-weight: 700
}
dd {
	margin-bottom: .5rem;
	margin-left: 0
}
blockquote {
	margin: 0 0 1rem
}
b, strong {
	font-weight: bolder
}
.small, small {
	font-size: .875em
}
.mark, mark {
	padding: .1875em;
	background-color: var(--bs-highlight-bg)
}
sub, sup {
	position: relative;
	font-size: .75em;
	line-height: 0;
	vertical-align: baseline
}
sub {
	bottom: -.25em
}
sup {
	top: -.5em
}
a {
	color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));
	text-decoration: underline
}
a:hover {
--bs-link-color-rgb:var(--bs-link-hover-color-rgb)
}
a:not([href]):not([class]), a:not([href]):not([class]):hover {
	color: inherit;
	text-decoration: none
}
code, kbd, pre, samp {
	font-family: var(--bs-font-monospace);
	font-size: 1em
}
pre {
	display: block;
	margin-top: 0;
	margin-bottom: 1rem;
	overflow: auto;
	font-size: .875em
}
pre code {
	font-size: inherit;
	color: inherit;
	word-break: normal
}
code {
	font-size: .875em;
	color: var(--bs-code-color);
	word-wrap: break-word
}
a>code {
	color: inherit
}
kbd {
	padding: .1875rem .375rem;
	font-size: .875em;
	color: var(--bs-body-bg);
	background-color: var(--bs-body-color);
	border-radius: .25rem
}
kbd kbd {
	padding: 0;
	font-size: 1em
}
figure {
	margin: 0 0 1rem
}
img, svg {
	vertical-align: middle
}
table {
	caption-side: bottom;
	border-collapse: collapse
}
caption {
	padding-top: .5rem;
	padding-bottom: .5rem;
	color: var(--bs-secondary-color);
	text-align: left
}
th {
	text-align: inherit;
	text-align: -webkit-match-parent
}
tbody, td, tfoot, th, thead, tr {
	border-color: inherit;
	border-style: solid;
	border-width: 0
}
label {
	display: inline-block
}
button {
	border-radius: 0
}
button:focus:not(:focus-visible) {
	outline: 0
}
button, input, optgroup, select, textarea {
	margin: 0;
	font-family: inherit;
	font-size: inherit;
	line-height: inherit
}
button, select {
	text-transform: none
}
[role=button] {
	cursor: pointer
}
select {
	word-wrap: normal
}
select:disabled {
	opacity: 1
}
[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator {
display:none!important
}
[type=button], [type=reset], [type=submit], button {
	-webkit-appearance: button
}
[type=button]:not(:disabled), [type=reset]:not(:disabled), [type=submit]:not(:disabled), button:not(:disabled) {
	cursor: pointer
}
::-moz-focus-inner {
padding:0;
border-style:none
}
textarea {
	resize: vertical
}
fieldset {
	min-width: 0;
	padding: 0;
	margin: 0;
	border: 0
}
legend {
	float: left;
	width: 100%;
	padding: 0;
	margin-bottom: .5rem;
	font-size: calc(1.275rem + .3vw);
	line-height: inherit
}

@media (min-width:1200px) {
legend {
	font-size: 1.5rem
}
}
legend+* {
	clear: left
}
::-webkit-datetime-edit-day-field, ::-webkit-datetime-edit-fields-wrapper, ::-webkit-datetime-edit-hour-field, ::-webkit-datetime-edit-minute, ::-webkit-datetime-edit-month-field, ::-webkit-datetime-edit-text, ::-webkit-datetime-edit-year-field {
padding:0
}
::-webkit-inner-spin-button {
height:auto
}
[type=search] {
	outline-offset: -2px;
	-webkit-appearance: textfield
}
::-webkit-search-decoration {
-webkit-appearance:none
}
::-webkit-color-swatch-wrapper {
padding:0
}
::-webkit-file-upload-button {
font:inherit;
-webkit-appearance:button
}
::file-selector-button {
font:inherit;
-webkit-appearance:button
}
output {
	display: inline-block
}
iframe {
	border: 0
}
summary {
	display: list-item;
	cursor: pointer
}
progress {
	vertical-align: baseline
}
[hidden] {
	display: none!important
}
.lead {
	font-size: 1.25rem;
	font-weight: 300
}
.display-1 {
	font-size: calc(1.625rem + 4.5vw);
	font-weight: 300;
	line-height: 1.2
}

@media (min-width:1200px) {
.display-1 {
	font-size: 5rem
}
}
.display-2 {
	font-size: calc(1.575rem + 3.9vw);
	font-weight: 300;
	line-height: 1.2
}

@media (min-width:1200px) {
.display-2 {
	font-size: 3.5rem
}
}
.display-3 {
	font-size: calc(1.525rem + 3.3vw);
	font-weight: 300;
	line-height: 1.2
}

@media (min-width:1200px) {
.display-3 {
	font-size: 4rem
}
}
.display-4 {
	font-size: calc(1.475rem + 2.7vw);
	font-weight: 300;
	line-height: 1.2
}

@media (min-width:1200px) {
.display-4 {
	font-size: 3.5rem
}
}
.display-5 {
	font-size: calc(1.425rem + 2.1vw);
	font-weight: 300;
	line-height: 1.2
}

@media (min-width:1200px) {
.display-5 {
	font-size: 3rem
}
}
.display-6 {
	font-size: calc(1.375rem + 1.5vw);
	font-weight: 300;
	line-height: 1.2
}

@media (min-width:1200px) {
.display-6 {
	font-size: 2.5rem
}
}
.list-unstyled {
	padding-left: 0;
	list-style: none
}
.list-inline {
	padding-left: 0;
	list-style: none
}
.list-inline-item {
	display: inline-block
}
.list-inline-item:not(:last-child) {
	margin-right: .5rem
}
.initialism {
	font-size: .875em;
	text-transform: uppercase
}
.blockquote {
	margin-bottom: 1rem;
	font-size: 1.25rem
}
.blockquote>:last-child {
	margin-bottom: 0
}
.blockquote-footer {
	margin-top: -1rem;
	margin-bottom: 1rem;
	font-size: .875em;
	color: #6c757d
}
.blockquote-footer::before {
	content: "— "
}
.img-fluid {
	max-width: 100%;
	height: auto
}
.img-thumbnail {
	padding: .25rem;
	background-color: var(--bs-body-bg);
	border: var(--bs-border-width) solid var(--bs-border-color);
	border-radius: var(--bs-border-radius);
	max-width: 100%;
	height: auto
}
.figure {
	display: inline-block
}
.figure-img {
	margin-bottom: .5rem;
	line-height: 1
}
.figure-caption {
	font-size: .875em;
	color: var(--bs-secondary-color)
}
.container, .container-fluid, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
--bs-gutter-x:1.5rem;
--bs-gutter-y:0;
	width: 100%;
padding-right:calc(var(--bs-gutter-x) * .5);
padding-left:calc(var(--bs-gutter-x) * .5);
	margin-right: auto;
	margin-left: auto
}

@media (min-width:576px) {
.container, .container-sm {
	max-width: 540px
}
}

@media (min-width:768px) {
.container, .container-md, .container-sm {
	max-width: 720px
}
}

@media (min-width:992px) {
.container, .container-lg, .container-md, .container-sm {
	max-width: 960px
}
}

@media (min-width:1200px) {
.container, .container-lg, .container-md, .container-sm, .container-xl {
	max-width: 1140px
}
}

@media (min-width:1400px) {
.container, .container-lg, .container-md, .container-sm, .container-xl, .container-xxl {
	max-width: 1320px
}
}
.row {
--bs-gutter-x:1.5rem;
--bs-gutter-y:0;
	display: flex;
	flex-wrap: wrap;
margin-top:calc(-1 * var(--bs-gutter-y));
margin-right:calc(-.5 * var(--bs-gutter-x));
margin-left:calc(-.5 * var(--bs-gutter-x))
}
.row>* {
	flex-shrink: 0;
	width: 100%;
	max-width: 100%;
padding-right:calc(var(--bs-gutter-x) * .5);
padding-left:calc(var(--bs-gutter-x) * .5);
	margin-top: var(--bs-gutter-y)
}
.col {
	flex: 1 0 0%
}
.row-cols-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-3>* {
	flex: 0 0 auto;
	width: 33.3333333333%
}
.row-cols-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-6>* {
	flex: 0 0 auto;
	width: 16.6666666667%
}
.col-auto {
	flex: 0 0 auto;
	width: auto
}
.col-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-1 {
	margin-left: 8.33333333%
}
.offset-2 {
	margin-left: 16.66666667%
}
.offset-3 {
	margin-left: 25%
}
.offset-4 {
	margin-left: 33.33333333%
}
.offset-5 {
	margin-left: 41.66666667%
}
.offset-6 {
	margin-left: 50%
}
.offset-7 {
	margin-left: 58.33333333%
}
.offset-8 {
	margin-left: 66.66666667%
}
.offset-9 {
	margin-left: 75%
}
.offset-10 {
	margin-left: 83.33333333%
}
.offset-11 {
	margin-left: 91.66666667%
}
.g-0, .gx-0 {
--bs-gutter-x:0
}
.g-0, .gy-0 {
--bs-gutter-y:0
}
.g-1, .gx-1 {
--bs-gutter-x:0.25rem
}
.g-1, .gy-1 {
--bs-gutter-y:0.25rem
}
.g-2, .gx-2 {
--bs-gutter-x:0.5rem
}
.g-2, .gy-2 {
--bs-gutter-y:0.5rem
}
.g-3, .gx-3 {
--bs-gutter-x:1rem
}
.g-3, .gy-3 {
--bs-gutter-y:1rem
}
.g-4, .gx-4 {
--bs-gutter-x:1.5rem
}
.g-4, .gy-4 {
--bs-gutter-y:1.5rem
}
.g-5, .gx-5 {
--bs-gutter-x:3rem
}
.g-5, .gy-5 {
--bs-gutter-y:3rem
}

@media (min-width:576px) {
.col-sm {
	flex: 1 0 0%
}
.row-cols-sm-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-sm-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-sm-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-sm-3>* {
	flex: 0 0 auto;
	width: 33.3333333333%
}
.row-cols-sm-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-sm-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-sm-6>* {
	flex: 0 0 auto;
	width: 16.6666666667%
}
.col-sm-auto {
	flex: 0 0 auto;
	width: auto
}
.col-sm-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-sm-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-sm-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-sm-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-sm-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-sm-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-sm-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-sm-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-sm-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-sm-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-sm-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-sm-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-sm-0 {
	margin-left: 0
}
.offset-sm-1 {
	margin-left: 8.33333333%
}
.offset-sm-2 {
	margin-left: 16.66666667%
}
.offset-sm-3 {
	margin-left: 25%
}
.offset-sm-4 {
	margin-left: 33.33333333%
}
.offset-sm-5 {
	margin-left: 41.66666667%
}
.offset-sm-6 {
	margin-left: 50%
}
.offset-sm-7 {
	margin-left: 58.33333333%
}
.offset-sm-8 {
	margin-left: 66.66666667%
}
.offset-sm-9 {
	margin-left: 75%
}
.offset-sm-10 {
	margin-left: 83.33333333%
}
.offset-sm-11 {
	margin-left: 91.66666667%
}
.g-sm-0, .gx-sm-0 {
--bs-gutter-x:0
}
.g-sm-0, .gy-sm-0 {
--bs-gutter-y:0
}
.g-sm-1, .gx-sm-1 {
--bs-gutter-x:0.25rem
}
.g-sm-1, .gy-sm-1 {
--bs-gutter-y:0.25rem
}
.g-sm-2, .gx-sm-2 {
--bs-gutter-x:0.5rem
}
.g-sm-2, .gy-sm-2 {
--bs-gutter-y:0.5rem
}
.g-sm-3, .gx-sm-3 {
--bs-gutter-x:1rem
}
.g-sm-3, .gy-sm-3 {
--bs-gutter-y:1rem
}
.g-sm-4, .gx-sm-4 {
--bs-gutter-x:1.5rem
}
.g-sm-4, .gy-sm-4 {
--bs-gutter-y:1.5rem
}
.g-sm-5, .gx-sm-5 {
--bs-gutter-x:3rem
}
.g-sm-5, .gy-sm-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:768px) {
.col-md {
	flex: 1 0 0%
}
.row-cols-md-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-md-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-md-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-md-3>* {
	flex: 0 0 auto;
	width: 33.3333333333%
}
.row-cols-md-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-md-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-md-6>* {
	flex: 0 0 auto;
	width: 16.6666666667%
}
.col-md-auto {
	flex: 0 0 auto;
	width: auto
}
.col-md-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-md-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-md-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-md-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-md-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-md-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-md-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-md-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-md-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-md-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-md-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-md-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-md-0 {
	margin-left: 0
}
.offset-md-1 {
	margin-left: 8.33333333%
}
.offset-md-2 {
	margin-left: 16.66666667%
}
.offset-md-3 {
	margin-left: 25%
}
.offset-md-4 {
	margin-left: 33.33333333%
}
.offset-md-5 {
	margin-left: 41.66666667%
}
.offset-md-6 {
	margin-left: 50%
}
.offset-md-7 {
	margin-left: 58.33333333%
}
.offset-md-8 {
	margin-left: 66.66666667%
}
.offset-md-9 {
	margin-left: 75%
}
.offset-md-10 {
	margin-left: 83.33333333%
}
.offset-md-11 {
	margin-left: 91.66666667%
}
.g-md-0, .gx-md-0 {
--bs-gutter-x:0
}
.g-md-0, .gy-md-0 {
--bs-gutter-y:0
}
.g-md-1, .gx-md-1 {
--bs-gutter-x:0.25rem
}
.g-md-1, .gy-md-1 {
--bs-gutter-y:0.25rem
}
.g-md-2, .gx-md-2 {
--bs-gutter-x:0.5rem
}
.g-md-2, .gy-md-2 {
--bs-gutter-y:0.5rem
}
.g-md-3, .gx-md-3 {
--bs-gutter-x:1rem
}
.g-md-3, .gy-md-3 {
--bs-gutter-y:1rem
}
.g-md-4, .gx-md-4 {
--bs-gutter-x:1.5rem
}
.g-md-4, .gy-md-4 {
--bs-gutter-y:1.5rem
}
.g-md-5, .gx-md-5 {
--bs-gutter-x:3rem
}
.g-md-5, .gy-md-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:992px) {
.col-lg {
	flex: 1 0 0%
}
.row-cols-lg-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-lg-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-lg-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-lg-3>* {
	flex: 0 0 auto;
	width: 33.3333333333%
}
.row-cols-lg-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-lg-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-lg-6>* {
	flex: 0 0 auto;
	width: 16.6666666667%
}
.col-lg-auto {
	flex: 0 0 auto;
	width: auto
}
.col-lg-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-lg-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-lg-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-lg-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-lg-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-lg-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-lg-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-lg-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-lg-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-lg-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-lg-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-lg-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-lg-0 {
	margin-left: 0
}
.offset-lg-1 {
	margin-left: 8.33333333%
}
.offset-lg-2 {
	margin-left: 16.66666667%
}
.offset-lg-3 {
	margin-left: 25%
}
.offset-lg-4 {
	margin-left: 33.33333333%
}
.offset-lg-5 {
	margin-left: 41.66666667%
}
.offset-lg-6 {
	margin-left: 50%
}
.offset-lg-7 {
	margin-left: 58.33333333%
}
.offset-lg-8 {
	margin-left: 66.66666667%
}
.offset-lg-9 {
	margin-left: 75%
}
.offset-lg-10 {
	margin-left: 83.33333333%
}
.offset-lg-11 {
	margin-left: 91.66666667%
}
.g-lg-0, .gx-lg-0 {
--bs-gutter-x:0
}
.g-lg-0, .gy-lg-0 {
--bs-gutter-y:0
}
.g-lg-1, .gx-lg-1 {
--bs-gutter-x:0.25rem
}
.g-lg-1, .gy-lg-1 {
--bs-gutter-y:0.25rem
}
.g-lg-2, .gx-lg-2 {
--bs-gutter-x:0.5rem
}
.g-lg-2, .gy-lg-2 {
--bs-gutter-y:0.5rem
}
.g-lg-3, .gx-lg-3 {
--bs-gutter-x:1rem
}
.g-lg-3, .gy-lg-3 {
--bs-gutter-y:1rem
}
.g-lg-4, .gx-lg-4 {
--bs-gutter-x:1.5rem
}
.g-lg-4, .gy-lg-4 {
--bs-gutter-y:1.5rem
}
.g-lg-5, .gx-lg-5 {
--bs-gutter-x:3rem
}
.g-lg-5, .gy-lg-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:1200px) {
.col-xl {
	flex: 1 0 0%
}
.row-cols-xl-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-xl-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-xl-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-xl-3>* {
	flex: 0 0 auto;
	width: 33.3333333333%
}
.row-cols-xl-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-xl-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-xl-6>* {
	flex: 0 0 auto;
	width: 16.6666666667%
}
.col-xl-auto {
	flex: 0 0 auto;
	width: auto
}
.col-xl-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-xl-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-xl-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-xl-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-xl-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-xl-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-xl-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-xl-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-xl-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-xl-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-xl-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-xl-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-xl-0 {
	margin-left: 0
}
.offset-xl-1 {
	margin-left: 8.33333333%
}
.offset-xl-2 {
	margin-left: 16.66666667%
}
.offset-xl-3 {
	margin-left: 25%
}
.offset-xl-4 {
	margin-left: 33.33333333%
}
.offset-xl-5 {
	margin-left: 41.66666667%
}
.offset-xl-6 {
	margin-left: 50%
}
.offset-xl-7 {
	margin-left: 58.33333333%
}
.offset-xl-8 {
	margin-left: 66.66666667%
}
.offset-xl-9 {
	margin-left: 75%
}
.offset-xl-10 {
	margin-left: 83.33333333%
}
.offset-xl-11 {
	margin-left: 91.66666667%
}
.g-xl-0, .gx-xl-0 {
--bs-gutter-x:0
}
.g-xl-0, .gy-xl-0 {
--bs-gutter-y:0
}
.g-xl-1, .gx-xl-1 {
--bs-gutter-x:0.25rem
}
.g-xl-1, .gy-xl-1 {
--bs-gutter-y:0.25rem
}
.g-xl-2, .gx-xl-2 {
--bs-gutter-x:0.5rem
}
.g-xl-2, .gy-xl-2 {
--bs-gutter-y:0.5rem
}
.g-xl-3, .gx-xl-3 {
--bs-gutter-x:1rem
}
.g-xl-3, .gy-xl-3 {
--bs-gutter-y:1rem
}
.g-xl-4, .gx-xl-4 {
--bs-gutter-x:1.5rem
}
.g-xl-4, .gy-xl-4 {
--bs-gutter-y:1.5rem
}
.g-xl-5, .gx-xl-5 {
--bs-gutter-x:3rem
}
.g-xl-5, .gy-xl-5 {
--bs-gutter-y:3rem
}
}

@media (min-width:1400px) {
.col-xxl {
	flex: 1 0 0%
}
.row-cols-xxl-auto>* {
	flex: 0 0 auto;
	width: auto
}
.row-cols-xxl-1>* {
	flex: 0 0 auto;
	width: 100%
}
.row-cols-xxl-2>* {
	flex: 0 0 auto;
	width: 50%
}
.row-cols-xxl-3>* {
	flex: 0 0 auto;
	width: 33.3333333333%
}
.row-cols-xxl-4>* {
	flex: 0 0 auto;
	width: 25%
}
.row-cols-xxl-5>* {
	flex: 0 0 auto;
	width: 20%
}
.row-cols-xxl-6>* {
	flex: 0 0 auto;
	width: 16.6666666667%
}
.col-xxl-auto {
	flex: 0 0 auto;
	width: auto
}
.col-xxl-1 {
	flex: 0 0 auto;
	width: 8.33333333%
}
.col-xxl-2 {
	flex: 0 0 auto;
	width: 16.66666667%
}
.col-xxl-3 {
	flex: 0 0 auto;
	width: 25%
}
.col-xxl-4 {
	flex: 0 0 auto;
	width: 33.33333333%
}
.col-xxl-5 {
	flex: 0 0 auto;
	width: 41.66666667%
}
.col-xxl-6 {
	flex: 0 0 auto;
	width: 50%
}
.col-xxl-7 {
	flex: 0 0 auto;
	width: 58.33333333%
}
.col-xxl-8 {
	flex: 0 0 auto;
	width: 66.66666667%
}
.col-xxl-9 {
	flex: 0 0 auto;
	width: 75%
}
.col-xxl-10 {
	flex: 0 0 auto;
	width: 83.33333333%
}
.col-xxl-11 {
	flex: 0 0 auto;
	width: 91.66666667%
}
.col-xxl-12 {
	flex: 0 0 auto;
	width: 100%
}
.offset-xxl-0 {
	margin-left: 0
}
.offset-xxl-1 {
	margin-left: 8.33333333%
}
.offset-xxl-2 {
	margin-left: 16.66666667%
}
.offset-xxl-3 {
	margin-left: 25%
}
.offset-xxl-4 {
	margin-left: 33.33333333%
}
.offset-xxl-5 {
	margin-left: 41.66666667%
}
.offset-xxl-6 {
	margin-left: 50%
}
.offset-xxl-7 {
	margin-left: 58.33333333%
}
.offset-xxl-8 {
	margin-left: 66.66666667%
}
.offset-xxl-9 {
	margin-left: 75%
}
.offset-xxl-10 {
	margin-left: 83.33333333%
}
.offset-xxl-11 {
	margin-left: 91.66666667%
}
.g-xxl-0, .gx-xxl-0 {
--bs-gutter-x:0
}
.g-xxl-0, .gy-xxl-0 {
--bs-gutter-y:0
}
.g-xxl-1, .gx-xxl-1 {
--bs-gutter-x:0.25rem
}
.g-xxl-1, .gy-xxl-1 {
--bs-gutter-y:0.25rem
}
.g-xxl-2, .gx-xxl-2 {
--bs-gutter-x:0.5rem
}
.g-xxl-2, .gy-xxl-2 {
--bs-gutter-y:0.5rem
}
.g-xxl-3, .gx-xxl-3 {
--bs-gutter-x:1rem
}
.g-xxl-3, .gy-xxl-3 {
--bs-gutter-y:1rem
}
.g-xxl-4, .gx-xxl-4 {
--bs-gutter-x:1.5rem
}
.g-xxl-4, .gy-xxl-4 {
--bs-gutter-y:1.5rem
}
.g-xxl-5, .gx-xxl-5 {
--bs-gutter-x:3rem
}
.g-xxl-5, .gy-xxl-5 {
--bs-gutter-y:3rem
}
}
.table {
--bs-table-color:var(--bs-body-color);
--bs-table-bg:transparent;
--bs-table-border-color:var(--bs-border-color);
--bs-table-accent-bg:transparent;
--bs-table-striped-color:var(--bs-body-color);
--bs-table-striped-bg:rgba(0, 0, 0, 0.05);
--bs-table-active-color:var(--bs-body-color);
--bs-table-active-bg:rgba(0, 0, 0, 0.1);
--bs-table-hover-color:var(--bs-body-color);
--bs-table-hover-bg:rgba(0, 0, 0, 0.075);
	width: 100%;
	margin-bottom: 1rem;
	color: var(--bs-table-color);
	vertical-align: top;
	border-color: var(--bs-table-border-color)
}
.table>:not(caption)>*>* {
	padding: .5rem .5rem;
	background-color: var(--bs-table-bg);
	border-bottom-width: var(--bs-border-width);
	box-shadow: inset 0 0 0 9999px var(--bs-table-accent-bg)
}
.table>tbody {
	vertical-align: inherit
}
.table>thead {
	vertical-align: bottom
}
.table-group-divider {
border-top:calc(var(--bs-border-width) * 2) solid currentcolor
}
.caption-top {
	caption-side: top
}
.table-sm>:not(caption)>*>* {
	padding: .25rem .25rem
}
.table-bordered>:not(caption)>* {
	border-width: var(--bs-border-width) 0
}
.table-bordered>:not(caption)>*>* {
	border-width: 0 var(--bs-border-width)
}
.table-borderless>:not(caption)>*>* {
	border-bottom-width: 0
}
.table-borderless>:not(:first-child) {
	border-top-width: 0
}
.table-striped>tbody>tr:nth-of-type(odd)>* {
--bs-table-accent-bg:var(--bs-table-striped-bg);
	color: var(--bs-table-striped-color)
}
.table-striped-columns>:not(caption)>tr>:nth-child(2n) {
--bs-table-accent-bg:var(--bs-table-striped-bg);
	color: var(--bs-table-striped-color)
}
.table-active {
--bs-table-accent-bg:var(--bs-table-active-bg);
	color: var(--bs-table-active-color)
}
.table-hover>tbody>tr:hover>* {
--bs-table-accent-bg:var(--bs-table-hover-bg);
	color: var(--bs-table-hover-color)
}
.table-primary {
--bs-table-color:#000;
--bs-table-bg:#cfe2ff;
--bs-table-border-color:#bacbe6;
--bs-table-striped-bg:#c5d7f2;
--bs-table-striped-color:#000;
--bs-table-active-bg:#bacbe6;
--bs-table-active-color:#000;
--bs-table-hover-bg:#bfd1ec;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-secondary {
--bs-table-color:#000;
--bs-table-bg:#e2e3e5;
--bs-table-border-color:#cbccce;
--bs-table-striped-bg:#d7d8da;
--bs-table-striped-color:#000;
--bs-table-active-bg:#cbccce;
--bs-table-active-color:#000;
--bs-table-hover-bg:#d1d2d4;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-success {
--bs-table-color:#000;
--bs-table-bg:#d1e7dd;
--bs-table-border-color:#bcd0c7;
--bs-table-striped-bg:#c7dbd2;
--bs-table-striped-color:#000;
--bs-table-active-bg:#bcd0c7;
--bs-table-active-color:#000;
--bs-table-hover-bg:#c1d6cc;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-info {
--bs-table-color:#000;
--bs-table-bg:#cff4fc;
--bs-table-border-color:#badce3;
--bs-table-striped-bg:#c5e8ef;
--bs-table-striped-color:#000;
--bs-table-active-bg:#badce3;
--bs-table-active-color:#000;
--bs-table-hover-bg:#bfe2e9;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-warning {
--bs-table-color:#000;
--bs-table-bg:#fff3cd;
--bs-table-border-color:#e6dbb9;
--bs-table-striped-bg:#f2e7c3;
--bs-table-striped-color:#000;
--bs-table-active-bg:#e6dbb9;
--bs-table-active-color:#000;
--bs-table-hover-bg:#ece1be;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-danger {
--bs-table-color:#000;
--bs-table-bg:#f8d7da;
--bs-table-border-color:#dfc2c4;
--bs-table-striped-bg:#eccccf;
--bs-table-striped-color:#000;
--bs-table-active-bg:#dfc2c4;
--bs-table-active-color:#000;
--bs-table-hover-bg:#e5c7ca;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-light {
--bs-table-color:#000;
--bs-table-bg:#f8f9fa;
--bs-table-border-color:#dfe0e1;
--bs-table-striped-bg:#ecedee;
--bs-table-striped-color:#000;
--bs-table-active-bg:#dfe0e1;
--bs-table-active-color:#000;
--bs-table-hover-bg:#e5e6e7;
--bs-table-hover-color:#000;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-dark {
--bs-table-color:#fff;
--bs-table-bg:#212529;
--bs-table-border-color:#373b3e;
--bs-table-striped-bg:#2c3034;
--bs-table-striped-color:#fff;
--bs-table-active-bg:#373b3e;
--bs-table-active-color:#fff;
--bs-table-hover-bg:#323539;
--bs-table-hover-color:#fff;
	color: var(--bs-table-color);
	border-color: var(--bs-table-border-color)
}
.table-responsive {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}

@media (max-width:575.98px) {
.table-responsive-sm {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:767.98px) {
.table-responsive-md {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:991.98px) {
.table-responsive-lg {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:1199.98px) {
.table-responsive-xl {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}

@media (max-width:1399.98px) {
.table-responsive-xxl {
	overflow-x: auto;
	-webkit-overflow-scrolling: touch
}
}
.form-label {
	margin-bottom: .5rem
}
.col-form-label {
	padding-top: calc(.375rem + var(--bs-border-width));
	padding-bottom: calc(.375rem + var(--bs-border-width));
	margin-bottom: 0;
	font-size: inherit;
	line-height: 1.5
}
.col-form-label-lg {
	padding-top: calc(.5rem + var(--bs-border-width));
	padding-bottom: calc(.5rem + var(--bs-border-width));
	font-size: 1.25rem
}
.col-form-label-sm {
	padding-top: calc(.25rem + var(--bs-border-width));
	padding-bottom: calc(.25rem + var(--bs-border-width));
	font-size: .875rem
}
.form-text {
	margin-top: .25rem;
	font-size: .875em;
	color: var(--bs-secondary-color)
}
.form-control {
	display: block;
	width: 100%;
	padding: .375rem .75rem;
	font-size: 1rem;
	font-weight: 400;
	line-height: 1.5;
	color: var(--bs-body-color);
	background-color: var(--bs-form-control-bg);
	background-clip: padding-box;
	border: var(--bs-border-width) solid var(--bs-border-color);
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
	border-radius: .375rem;
	transition: border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-control {
	transition: none
}
}
.form-control[type=file] {
	overflow: hidden
}
.form-control[type=file]:not(:disabled):not([readonly]) {
	cursor: pointer
}
.form-control:focus {
	color: var(--bs-body-color);
	background-color: var(--bs-form-control-bg);
	border-color: #86b7fe;
	outline: 0;
	box-shadow: 0 0 0 .25rem rgba(13,110,253,.25)
}
.form-control::-webkit-date-and-time-value {
height:1.5em
}
.form-control::-webkit-datetime-edit {
display:block;
padding:0
}
.form-control::-moz-placeholder {
color:var(--bs-secondary-color);
opacity:1
}
.form-control::placeholder {
color:var(--bs-secondary-color);
opacity:1
}
.form-control:disabled {
	background-color: var(--bs-form-control-disabled-bg);
	opacity: 1
}
.form-control::-webkit-file-upload-button {
padding:.375rem .75rem;
margin:-.375rem -.75rem;
-webkit-margin-end:.75rem;
margin-inline-end:.75rem;
color:var(--bs-body-color);
background-color:var(--bs-tertiary-bg);
pointer-events:none;
border-color:inherit;
border-style:solid;
border-width:0;
border-inline-end-width:var(--bs-border-width);
border-radius:0;
-webkit-transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}
.form-control::file-selector-button {
padding:.375rem .75rem;
margin:-.375rem -.75rem;
-webkit-margin-end:.75rem;
margin-inline-end:.75rem;
color:var(--bs-body-color);
background-color:var(--bs-tertiary-bg);
pointer-events:none;
border-color:inherit;
border-style:solid;
border-width:0;
border-inline-end-width:var(--bs-border-width);
border-radius:0;
transition:color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-control::-webkit-file-upload-button {
-webkit-transition:none;
transition:none
}
.form-control::file-selector-button {
transition:none
}
}
.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button {
background-color:var(--bs-secondary-bg)
}
.form-control:hover:not(:disabled):not([readonly])::file-selector-button {
background-color:var(--bs-secondary-bg)
}
.form-control-plaintext {
	display: block;
	width: 100%;
	padding: .375rem 0;
	margin-bottom: 0;
	line-height: 1.5;
	color: var(--bs-body-color);
	background-color: transparent;
	border: solid transparent;
	border-width: var(--bs-border-width) 0
}
.form-control-plaintext:focus {
	outline: 0
}
.form-control-plaintext.form-control-lg, .form-control-plaintext.form-control-sm {
	padding-right: 0;
	padding-left: 0
}
.form-control-sm {
min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));
	padding: .25rem .5rem;
	font-size: .875rem;
	border-radius: .25rem
}
.form-control-sm::-webkit-file-upload-button {
padding:.25rem .5rem;
margin:-.25rem -.5rem;
-webkit-margin-end:.5rem;
margin-inline-end:.5rem
}
.form-control-sm::file-selector-button {
padding:.25rem .5rem;
margin:-.25rem -.5rem;
-webkit-margin-end:.5rem;
margin-inline-end:.5rem
}
.form-control-lg {
min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
	padding: .5rem 1rem;
	font-size: 1.25rem;
	border-radius: .5rem
}
.form-control-lg::-webkit-file-upload-button {
padding:.5rem 1rem;
margin:-.5rem -1rem;
-webkit-margin-end:1rem;
margin-inline-end:1rem
}
.form-control-lg::file-selector-button {
padding:.5rem 1rem;
margin:-.5rem -1rem;
-webkit-margin-end:1rem;
margin-inline-end:1rem
}
textarea.form-control {
min-height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2))
}
textarea.form-control-sm {
min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))
}
textarea.form-control-lg {
min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))
}
.form-control-color {
	width: 3rem;
height:calc(1.5em + .75rem + calc(var(--bs-border-width) * 2));
	padding: .375rem
}
.form-control-color:not(:disabled):not([readonly]) {
	cursor: pointer
}
.form-control-color::-moz-color-swatch {
border:0!important;
border-radius:.375rem
}
.form-control-color::-webkit-color-swatch {
border-radius:.375rem
}
.form-control-color.form-control-sm {
height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))
}
.form-control-color.form-control-lg {
height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))
}
.form-select {
--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
	display: block;
	width: 100%;
	padding: .375rem 2.25rem .375rem .75rem;
	-moz-padding-start: calc(0.75rem - 3px);
	font-size: 1rem;
	font-weight: 400;
	line-height: 1.5;
	color: var(--bs-body-color);
	background-color: var(--bs-form-control-bg);
	background-image: var(--bs-form-select-bg-img), var(--bs-form-select-bg-icon, none);
	background-repeat: no-repeat;
	background-position: right .75rem center;
	background-size: 16px 12px;
	border: var(--bs-border-width) solid var(--bs-border-color);
	border-radius: .375rem;
	transition: border-color .15s ease-in-out, box-shadow .15s ease-in-out;
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none
}

@media (prefers-reduced-motion:reduce) {
.form-select {
	transition: none
}
}
.form-select:focus {
	border-color: #86b7fe;
	outline: 0;
	box-shadow: 0 0 0 .25rem rgba(13,110,253,.25)
}
.form-select[multiple], .form-select[size]:not([size="1"]) {
	padding-right: .75rem;
	background-image: none
}
.form-select:disabled {
	background-color: var(--bs-form-control-disabled-bg)
}
.form-select:-moz-focusring {
color:transparent;
text-shadow:0 0 0 var(--bs-body-color)
}
.form-select-sm {
	padding-top: .25rem;
	padding-bottom: .25rem;
	padding-left: .5rem;
	font-size: .875rem;
	border-radius: .25rem
}
.form-select-lg {
	padding-top: .5rem;
	padding-bottom: .5rem;
	padding-left: 1rem;
	font-size: 1.25rem;
	border-radius: .5rem
}
[data-bs-theme=dark] .form-select {
--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23adb5bd' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")
}
.form-check {
	display: block;
	min-height: 1.5rem;
	padding-left: 1.5em;
	margin-bottom: .125rem
}
.form-check .form-check-input {
	float: left;
	margin-left: -1.5em
}
.form-check-reverse {
	padding-right: 1.5em;
	padding-left: 0;
	text-align: right
}
.form-check-reverse .form-check-input {
	float: right;
	margin-right: -1.5em;
	margin-left: 0
}
.form-check-input {
--bs-form-check-bg:var(--bs-form-control-bg);
	width: 1em;
	height: 1em;
	margin-top: .25em;
	vertical-align: top;
	background-color: var(--bs-form-check-bg);
	background-image: var(--bs-form-check-bg-image);
	background-repeat: no-repeat;
	background-position: center;
	background-size: contain;
	border: var(--bs-border-width) solid var(--bs-border-color);
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none;
	-webkit-print-color-adjust: exact;
	color-adjust: exact;
	print-color-adjust: exact
}
.form-check-input[type=checkbox] {
	border-radius: .25em
}
.form-check-input[type=radio] {
	border-radius: 50%
}
.form-check-input:active {
	filter: brightness(90%)
}
.form-check-input:focus {
	border-color: #86b7fe;
	outline: 0;
	box-shadow: 0 0 0 .25rem rgba(13,110,253,.25)
}
.form-check-input:checked {
	background-color: #0d6efd;
	border-color: #0d6efd
}
.form-check-input:checked[type=checkbox] {
--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")
}
.form-check-input:checked[type=radio] {
--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")
}
.form-check-input[type=checkbox]:indeterminate {
	background-color: #0d6efd;
	border-color: #0d6efd;
--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")
}
.form-check-input:disabled {
	pointer-events: none;
	filter: none;
	opacity: .5
}
.form-check-input:disabled~.form-check-label, .form-check-input[disabled]~.form-check-label {
	cursor: default;
	opacity: .5
}
.form-switch {
	padding-left: 2.5em
}
.form-switch .form-check-input {
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");
	width: 2em;
	margin-left: -2.5em;
	background-image: var(--bs-form-switch-bg);
	background-position: left center;
	border-radius: 2em;
	transition: background-position .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-switch .form-check-input {
	transition: none
}
}
.form-switch .form-check-input:focus {
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")
}
.form-switch .form-check-input:checked {
	background-position: right center;
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")
}
.form-switch.form-check-reverse {
	padding-right: 2.5em;
	padding-left: 0
}
.form-switch.form-check-reverse .form-check-input {
	margin-right: -2.5em;
	margin-left: 0
}
.form-check-inline {
	display: inline-block;
	margin-right: 1rem
}
.btn-check {
	position: absolute;
	clip: rect(0,0,0,0);
	pointer-events: none
}
.btn-check:disabled+.btn, .btn-check[disabled]+.btn {
	pointer-events: none;
	filter: none;
	opacity: .65
}
[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus) {
--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")
}
.form-range {
	width: 100%;
	height: 1.5rem;
	padding: 0;
	background-color: transparent;
	-webkit-appearance: none;
	-moz-appearance: none;
	appearance: none
}
.form-range:focus {
	outline: 0
}
.form-range:focus::-webkit-slider-thumb {
box-shadow:0 0 0 1px #fff, 0 0 0 .25rem rgba(13,110,253,.25)
}
.form-range:focus::-moz-range-thumb {
box-shadow:0 0 0 1px #fff, 0 0 0 .25rem rgba(13,110,253,.25)
}
.form-range::-moz-focus-outer {
border:0
}
.form-range::-webkit-slider-thumb {
width:1rem;
height:1rem;
margin-top:-.25rem;
background-color:#0d6efd;
border:0;
border-radius:1rem;
-webkit-transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
-webkit-appearance:none;
appearance:none
}

@media (prefers-reduced-motion:reduce) {
.form-range::-webkit-slider-thumb {
-webkit-transition:none;
transition:none
}
}
.form-range::-webkit-slider-thumb:active {
background-color:#b6d4fe
}
.form-range::-webkit-slider-runnable-track {
width:100%;
height:.5rem;
color:transparent;
cursor:pointer;
background-color:var(--bs-tertiary-bg);
border-color:transparent;
border-radius:1rem
}
.form-range::-moz-range-thumb {
width:1rem;
height:1rem;
background-color:#0d6efd;
border:0;
border-radius:1rem;
-moz-transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
transition:background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out;
-moz-appearance:none;
appearance:none
}

@media (prefers-reduced-motion:reduce) {
.form-range::-moz-range-thumb {
-moz-transition:none;
transition:none
}
}
.form-range::-moz-range-thumb:active {
background-color:#b6d4fe
}
.form-range::-moz-range-track {
width:100%;
height:.5rem;
color:transparent;
cursor:pointer;
background-color:var(--bs-tertiary-bg);
border-color:transparent;
border-radius:1rem
}
.form-range:disabled {
	pointer-events: none
}
.form-range:disabled::-webkit-slider-thumb {
background-color:var(--bs-secondary-color)
}
.form-range:disabled::-moz-range-thumb {
background-color:var(--bs-secondary-color)
}
.form-floating {
	position: relative
}
.form-floating::before:not(.form-control:disabled) {
position:absolute;
top:var(--bs-border-width);
left:var(--bs-border-width);
width:calc(100% - (calc(calc(.375em + .1875rem) + calc(.75em + .375rem))));
height:1.875em;
content:"";
background-color:var(--bs-form-control-bg);
border-radius:.375rem
}
.form-floating>.form-control, .form-floating>.form-control-plaintext, .form-floating>.form-select {
height:calc(3.5rem + calc(var(--bs-border-width) * 2));
	line-height: 1.25
}
.form-floating>label {
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	padding: 1rem .75rem;
	overflow: hidden;
	text-align: start;
	text-overflow: ellipsis;
	white-space: nowrap;
	pointer-events: none;
	border: var(--bs-border-width) solid transparent;
	transform-origin: 0 0;
	transition: opacity .1s ease-in-out, transform .1s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.form-floating>label {
	transition: none
}
}
.form-floating>.form-control, .form-floating>.form-control-plaintext {
	padding: 1rem .75rem
}
.form-floating>.form-control-plaintext::-moz-placeholder, .form-floating>.form-control::-moz-placeholder {
color:transparent
}
.form-floating>.form-control-plaintext::placeholder, .form-floating>.form-control::placeholder {
color:transparent
}
.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown), .form-floating>.form-control:not(:-moz-placeholder-shown) {
	padding-top: 1.625rem;
	padding-bottom: .625rem
}
.form-floating>.form-control-plaintext:focus, .form-floating>.form-control-plaintext:not(:placeholder-shown), .form-floating>.form-control:focus, .form-floating>.form-control:not(:placeholder-shown) {
	padding-top: 1.625rem;
	padding-bottom: .625rem
}
.form-floating>.form-control-plaintext:-webkit-autofill, .form-floating>.form-control:-webkit-autofill {
padding-top:1.625rem;
padding-bottom:.625rem
}
.form-floating>.form-select {
	padding-top: 1.625rem;
	padding-bottom: .625rem
}
.form-floating>.form-control:not(:-moz-placeholder-shown)~label {
	opacity: .65;
	transform: scale(.85) translateY(-.5rem) translateX(.15rem)
}
.form-floating>.form-control-plaintext~label, .form-floating>.form-control:focus~label, .form-floating>.form-control:not(:placeholder-shown)~label, .form-floating>.form-select~label {
	opacity: .65;
	transform: scale(.85) translateY(-.5rem) translateX(.15rem)
}
.form-floating>.form-control:-webkit-autofill~label {
opacity:.65;
transform:scale(.85) translateY(-.5rem) translateX(.15rem)
}
.form-floating>.form-control-plaintext~label {
	border-width: var(--bs-border-width) 0
}
.form-floating>.form-control:disabled~label {
	color: #6c757d
}
.input-group {
	position: relative;
	display: flex;
	flex-wrap: wrap;
	align-items: stretch;
	width: 100%
}
.input-group>.form-control, .input-group>.form-floating, .input-group>.form-select {
	position: relative;
	flex: 1 1 auto;
	width: 1%;
	min-width: 0
}
.input-group>.form-control:focus, .input-group>.form-floating:focus-within, .input-group>.form-select:focus {
z-index:5
}
.input-group .btn {
	position: relative;
	z-index: 2
}
.input-group .btn:focus {
	z-index: 5
}
.input-group-text {
	display: flex;
	align-items: center;
	padding: .375rem .75rem;
	font-size: 1rem;
	font-weight: 400;
	line-height: 1.5;
	color: var(--bs-body-color);
	text-align: center;
	white-space: nowrap;
	background-color: var(--bs-tertiary-bg);
	border: var(--bs-border-width) solid var(--bs-border-color);
	border-radius: .375rem
}
.input-group-lg>.btn, .input-group-lg>.form-control, .input-group-lg>.form-select, .input-group-lg>.input-group-text {
	padding: .5rem 1rem;
	font-size: 1.25rem;
	border-radius: .5rem
}
.input-group-sm>.btn, .input-group-sm>.form-control, .input-group-sm>.form-select, .input-group-sm>.input-group-text {
	padding: .25rem .5rem;
	font-size: .875rem;
	border-radius: .25rem
}
.input-group-lg>.form-select, .input-group-sm>.form-select {
	padding-right: 3rem
}
.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3), .input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control, .input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select, .input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4), .input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control, .input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select, .input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) {
margin-left:calc(var(--bs-border-width) * -1);
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.input-group>.form-floating:not(:first-child)>.form-control, .input-group>.form-floating:not(:first-child)>.form-select {
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.valid-feedback {
	display: none;
	width: 100%;
	margin-top: .25rem;
	font-size: .875em;
	color: var(--bs-success-text)
}
.valid-tooltip {
	position: absolute;
	top: 100%;
	z-index: 5;
	display: none;
	max-width: 100%;
	padding: .25rem .5rem;
	margin-top: .1rem;
	font-size: .875rem;
	color: #fff;
	background-color: var(--bs-success);
	border-radius: var(--bs-border-radius)
}
.is-valid~.valid-feedback, .is-valid~.valid-tooltip, .was-validated :valid~.valid-feedback, .was-validated :valid~.valid-tooltip {
display:block
}
.form-control.is-valid, .was-validated .form-control:valid {
border-color:var(--bs-success);
padding-right:calc(1.5em + .75rem);
background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
background-repeat:no-repeat;
background-position:right calc(.375em + .1875rem) center;
background-size:calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-control.is-valid:focus, .was-validated .form-control:valid:focus {
border-color:var(--bs-success);
box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), .25)
}
.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
padding-right:calc(1.5em + .75rem);
background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)
}
.form-select.is-valid, .was-validated .form-select:valid {
border-color:var(--bs-success)
}
.form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"], .was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"] {
--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
padding-right:4.125rem;
background-position:right .75rem center, center right 2.25rem;
background-size:16px 12px, calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-select.is-valid:focus, .was-validated .form-select:valid:focus {
border-color:var(--bs-success);
box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), .25)
}
.form-control-color.is-valid, .was-validated .form-control-color:valid {
width:calc(3rem + calc(1.5em + .75rem))
}
.form-check-input.is-valid, .was-validated .form-check-input:valid {
border-color:var(--bs-success)
}
.form-check-input.is-valid:checked, .was-validated .form-check-input:valid:checked {
background-color:var(--bs-success-text)
}
.form-check-input.is-valid:focus, .was-validated .form-check-input:valid:focus {
box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb), .25)
}
.form-check-input.is-valid~.form-check-label, .was-validated .form-check-input:valid~.form-check-label {
color:var(--bs-success-text)
}
.form-check-inline .form-check-input~.valid-feedback {
	margin-left: .5em
}
.input-group>.form-control:not(:focus).is-valid, .input-group>.form-floating:not(:focus-within).is-valid, .input-group>.form-select:not(:focus).is-valid, .was-validated .input-group>.form-control:not(:focus):valid, .was-validated .input-group>.form-floating:not(:focus-within):valid, .was-validated .input-group>.form-select:not(:focus):valid {
z-index:3
}
.invalid-feedback {
	display: none;
	width: 100%;
	margin-top: .25rem;
	font-size: .875em;
	color: var(--bs-danger-text)
}
.invalid-tooltip {
	position: absolute;
	top: 100%;
	z-index: 5;
	display: none;
	max-width: 100%;
	padding: .25rem .5rem;
	margin-top: .1rem;
	font-size: .875rem;
	color: #fff;
	background-color: var(--bs-danger);
	border-radius: var(--bs-border-radius)
}
.is-invalid~.invalid-feedback, .is-invalid~.invalid-tooltip, .was-validated :invalid~.invalid-feedback, .was-validated :invalid~.invalid-tooltip {
display:block
}
.form-control.is-invalid, .was-validated .form-control:invalid {
border-color:var(--bs-danger);
padding-right:calc(1.5em + .75rem);
background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
background-repeat:no-repeat;
background-position:right calc(.375em + .1875rem) center;
background-size:calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-control.is-invalid:focus, .was-validated .form-control:invalid:focus {
border-color:var(--bs-danger);
box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), .25)
}
.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
padding-right:calc(1.5em + .75rem);
background-position:top calc(.375em + .1875rem) right calc(.375em + .1875rem)
}
.form-select.is-invalid, .was-validated .form-select:invalid {
border-color:var(--bs-danger)
}
.form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"], .was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"] {
--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
padding-right:4.125rem;
background-position:right .75rem center, center right 2.25rem;
background-size:16px 12px, calc(.75em + .375rem) calc(.75em + .375rem)
}
.form-select.is-invalid:focus, .was-validated .form-select:invalid:focus {
border-color:var(--bs-danger);
box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), .25)
}
.form-control-color.is-invalid, .was-validated .form-control-color:invalid {
width:calc(3rem + calc(1.5em + .75rem))
}
.form-check-input.is-invalid, .was-validated .form-check-input:invalid {
border-color:var(--bs-danger)
}
.form-check-input.is-invalid:checked, .was-validated .form-check-input:invalid:checked {
background-color:var(--bs-danger-text)
}
.form-check-input.is-invalid:focus, .was-validated .form-check-input:invalid:focus {
box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb), .25)
}
.form-check-input.is-invalid~.form-check-label, .was-validated .form-check-input:invalid~.form-check-label {
color:var(--bs-danger-text)
}
.form-check-inline .form-check-input~.invalid-feedback {
	margin-left: .5em
}
.input-group>.form-control:not(:focus).is-invalid, .input-group>.form-floating:not(:focus-within).is-invalid, .input-group>.form-select:not(:focus).is-invalid, .was-validated .input-group>.form-control:not(:focus):invalid, .was-validated .input-group>.form-floating:not(:focus-within):invalid, .was-validated .input-group>.form-select:not(:focus):invalid {
z-index:4
}
.btn {
--bs-btn-padding-x:0.75rem;
--bs-btn-padding-y:0.375rem;
--bs-btn-font-family:;
--bs-btn-font-size:1rem;
--bs-btn-font-weight:400;
--bs-btn-line-height:1.5;
--bs-btn-color:#212529;
--bs-btn-bg:transparent;
--bs-btn-border-width:var(--bs-border-width);
--bs-btn-border-color:transparent;
--bs-btn-border-radius:0.375rem;
--bs-btn-hover-border-color:transparent;
--bs-btn-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075);
--bs-btn-disabled-opacity:0.65;
--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);
	display: inline-block;
	padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x);
	font-family: var(--bs-btn-font-family);
	font-size: var(--bs-btn-font-size);
	font-weight: var(--bs-btn-font-weight);
	line-height: var(--bs-btn-line-height);
	color: var(--bs-btn-color);
	text-align: center;
	text-decoration: none;
	vertical-align: middle;
	cursor: pointer;
	-webkit-user-select: none;
	-moz-user-select: none;
	user-select: none;
	border: var(--bs-btn-border-width) solid var(--bs-btn-border-color);
	border-radius: var(--bs-btn-border-radius);
	background-color: var(--bs-btn-bg);
	transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.btn {
	transition: none
}
}
.btn:hover {
	color: var(--bs-btn-hover-color);
	background-color: var(--bs-btn-hover-bg);
	border-color: var(--bs-btn-hover-border-color)
}
.btn-check+.btn:hover {
	color: var(--bs-btn-color);
	background-color: var(--bs-btn-bg);
	border-color: var(--bs-btn-border-color)
}
.btn:focus-visible {
color:var(--bs-btn-hover-color);
background-color:var(--bs-btn-hover-bg);
border-color:var(--bs-btn-hover-border-color);
outline:0;
box-shadow:var(--bs-btn-focus-box-shadow)
}
.btn-check:focus-visible+.btn {
border-color:var(--bs-btn-hover-border-color);
outline:0;
box-shadow:var(--bs-btn-focus-box-shadow)
}
.btn-check:checked+.btn, .btn.active, .btn.show, .btn:first-child:active, :not(.btn-check)+.btn:active {
	color: var(--bs-btn-active-color);
	background-color: var(--bs-btn-active-bg);
	border-color: var(--bs-btn-active-border-color)
}
.btn-check:checked+.btn:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible, .btn:first-child:active:focus-visible, :not(.btn-check)+.btn:active:focus-visible {
box-shadow:var(--bs-btn-focus-box-shadow)
}
.btn.disabled, .btn:disabled, fieldset:disabled .btn {
	color: var(--bs-btn-disabled-color);
	pointer-events: none;
	background-color: var(--bs-btn-disabled-bg);
	border-color: var(--bs-btn-disabled-border-color);
	opacity: var(--bs-btn-disabled-opacity)
}
.btn-primary {
--bs-btn-color:#fff;
--bs-btn-bg:#0d6efd;
--bs-btn-border-color:#0d6efd;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#0b5ed7;
--bs-btn-hover-border-color:#0a58ca;
--bs-btn-focus-shadow-rgb:49, 132, 253;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#0a58ca;
--bs-btn-active-border-color:#0a53be;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#0d6efd;
--bs-btn-disabled-border-color:#0d6efd
}
.btn-secondary {
--bs-btn-color:#fff;
--bs-btn-bg:#6c757d;
--bs-btn-border-color:#6c757d;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#5c636a;
--bs-btn-hover-border-color:#565e64;
--bs-btn-focus-shadow-rgb:130, 138, 145;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#565e64;
--bs-btn-active-border-color:#51585e;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#6c757d;
--bs-btn-disabled-border-color:#6c757d
}
.btn-success {
--bs-btn-color:#fff;
--bs-btn-bg:#198754;
--bs-btn-border-color:#198754;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#157347;
--bs-btn-hover-border-color:#146c43;
--bs-btn-focus-shadow-rgb:60, 153, 110;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#146c43;
--bs-btn-active-border-color:#13653f;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#198754;
--bs-btn-disabled-border-color:#198754
}
.btn-info {
--bs-btn-color:#000;
--bs-btn-bg:#0dcaf0;
--bs-btn-border-color:#0dcaf0;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#31d2f2;
--bs-btn-hover-border-color:#25cff2;
--bs-btn-focus-shadow-rgb:11, 172, 204;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#3dd5f3;
--bs-btn-active-border-color:#25cff2;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#000;
--bs-btn-disabled-bg:#0dcaf0;
--bs-btn-disabled-border-color:#0dcaf0
}
.btn-warning {
--bs-btn-color:#000;
--bs-btn-bg:#ffc107;
--bs-btn-border-color:#ffc107;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#ffca2c;
--bs-btn-hover-border-color:#ffc720;
--bs-btn-focus-shadow-rgb:217, 164, 6;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#ffcd39;
--bs-btn-active-border-color:#ffc720;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#000;
--bs-btn-disabled-bg:#ffc107;
--bs-btn-disabled-border-color:#ffc107
}
.btn-danger {
--bs-btn-color:#fff;
--bs-btn-bg:#dc3545;
--bs-btn-border-color:#dc3545;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#bb2d3b;
--bs-btn-hover-border-color:#b02a37;
--bs-btn-focus-shadow-rgb:225, 83, 97;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#b02a37;
--bs-btn-active-border-color:#a52834;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#dc3545;
--bs-btn-disabled-border-color:#dc3545
}
.btn-light {
--bs-btn-color:#000;
--bs-btn-bg:#f8f9fa;
--bs-btn-border-color:#f8f9fa;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#d3d4d5;
--bs-btn-hover-border-color:#c6c7c8;
--bs-btn-focus-shadow-rgb:211, 212, 213;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#c6c7c8;
--bs-btn-active-border-color:#babbbc;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#000;
--bs-btn-disabled-bg:#f8f9fa;
--bs-btn-disabled-border-color:#f8f9fa
}
.btn-dark {
--bs-btn-color:#fff;
--bs-btn-bg:#212529;
--bs-btn-border-color:#212529;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#424649;
--bs-btn-hover-border-color:#373b3e;
--bs-btn-focus-shadow-rgb:66, 70, 73;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#4d5154;
--bs-btn-active-border-color:#373b3e;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#fff;
--bs-btn-disabled-bg:#212529;
--bs-btn-disabled-border-color:#212529
}
.btn-outline-primary {
--bs-btn-color:#0d6efd;
--bs-btn-border-color:#0d6efd;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#0d6efd;
--bs-btn-hover-border-color:#0d6efd;
--bs-btn-focus-shadow-rgb:13, 110, 253;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#0d6efd;
--bs-btn-active-border-color:#0d6efd;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#0d6efd;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#0d6efd;
--bs-gradient:none
}
.btn-outline-secondary {
--bs-btn-color:#6c757d;
--bs-btn-border-color:#6c757d;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#6c757d;
--bs-btn-hover-border-color:#6c757d;
--bs-btn-focus-shadow-rgb:108, 117, 125;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#6c757d;
--bs-btn-active-border-color:#6c757d;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#6c757d;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#6c757d;
--bs-gradient:none
}
.btn-outline-success {
--bs-btn-color:#198754;
--bs-btn-border-color:#198754;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#198754;
--bs-btn-hover-border-color:#198754;
--bs-btn-focus-shadow-rgb:25, 135, 84;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#198754;
--bs-btn-active-border-color:#198754;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#198754;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#198754;
--bs-gradient:none
}
.btn-outline-info {
--bs-btn-color:#0dcaf0;
--bs-btn-border-color:#0dcaf0;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#0dcaf0;
--bs-btn-hover-border-color:#0dcaf0;
--bs-btn-focus-shadow-rgb:13, 202, 240;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#0dcaf0;
--bs-btn-active-border-color:#0dcaf0;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#0dcaf0;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#0dcaf0;
--bs-gradient:none
}
.btn-outline-warning {
--bs-btn-color:#ffc107;
--bs-btn-border-color:#ffc107;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#ffc107;
--bs-btn-hover-border-color:#ffc107;
--bs-btn-focus-shadow-rgb:255, 193, 7;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#ffc107;
--bs-btn-active-border-color:#ffc107;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#ffc107;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#ffc107;
--bs-gradient:none
}
.btn-outline-danger {
--bs-btn-color:#dc3545;
--bs-btn-border-color:#dc3545;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#dc3545;
--bs-btn-hover-border-color:#dc3545;
--bs-btn-focus-shadow-rgb:220, 53, 69;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#dc3545;
--bs-btn-active-border-color:#dc3545;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#dc3545;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#dc3545;
--bs-gradient:none
}
.btn-outline-light {
--bs-btn-color:#f8f9fa;
--bs-btn-border-color:#f8f9fa;
--bs-btn-hover-color:#000;
--bs-btn-hover-bg:#f8f9fa;
--bs-btn-hover-border-color:#f8f9fa;
--bs-btn-focus-shadow-rgb:248, 249, 250;
--bs-btn-active-color:#000;
--bs-btn-active-bg:#f8f9fa;
--bs-btn-active-border-color:#f8f9fa;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#f8f9fa;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#f8f9fa;
--bs-gradient:none
}
.btn-outline-dark {
--bs-btn-color:#212529;
--bs-btn-border-color:#212529;
--bs-btn-hover-color:#fff;
--bs-btn-hover-bg:#212529;
--bs-btn-hover-border-color:#212529;
--bs-btn-focus-shadow-rgb:33, 37, 41;
--bs-btn-active-color:#fff;
--bs-btn-active-bg:#212529;
--bs-btn-active-border-color:#212529;
--bs-btn-active-shadow:inset 0 3px 5px rgba(0, 0, 0, 0.125);
--bs-btn-disabled-color:#212529;
--bs-btn-disabled-bg:transparent;
--bs-btn-disabled-border-color:#212529;
--bs-gradient:none
}
.btn-link {
--bs-btn-font-weight:400;
--bs-btn-color:var(--bs-link-color);
--bs-btn-bg:transparent;
--bs-btn-border-color:transparent;
--bs-btn-hover-color:var(--bs-link-hover-color);
--bs-btn-hover-border-color:transparent;
--bs-btn-active-color:var(--bs-link-hover-color);
--bs-btn-active-border-color:transparent;
--bs-btn-disabled-color:#6c757d;
--bs-btn-disabled-border-color:transparent;
--bs-btn-box-shadow:none;
--bs-btn-focus-shadow-rgb:49, 132, 253;
	text-decoration: underline
}
.btn-link:focus-visible {
color:var(--bs-btn-color)
}
.btn-link:hover {
	color: var(--bs-btn-hover-color)
}
.btn-group-lg>.btn, .btn-lg {
--bs-btn-padding-y:0.5rem;
--bs-btn-padding-x:1rem;
--bs-btn-font-size:1.25rem;
--bs-btn-border-radius:0.5rem
}
.btn-group-sm>.btn, .btn-sm {
--bs-btn-padding-y:0.25rem;
--bs-btn-padding-x:0.5rem;
--bs-btn-font-size:0.875rem;
--bs-btn-border-radius:0.25rem
}
.fade {
	transition: opacity .15s linear
}

@media (prefers-reduced-motion:reduce) {
.fade {
	transition: none
}
}
.fade:not(.show) {
	opacity: 0
}
.collapse:not(.show) {
	display: none
}
.collapsing {
	height: 0;
	overflow: hidden;
	transition: height .35s ease
}

@media (prefers-reduced-motion:reduce) {
.collapsing {
	transition: none
}
}
.collapsing.collapse-horizontal {
	width: 0;
	height: auto;
	transition: width .35s ease
}

@media (prefers-reduced-motion:reduce) {
.collapsing.collapse-horizontal {
	transition: none
}
}
.dropdown, .dropdown-center, .dropend, .dropstart, .dropup, .dropup-center {
	position: relative
}
.dropdown-toggle {
	white-space: nowrap
}
.dropdown-toggle::after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: "";
	border-top: .3em solid;
	border-right: .3em solid transparent;
	border-bottom: 0;
	border-left: .3em solid transparent
}
.dropdown-toggle:empty::after {
	margin-left: 0
}
.dropdown-menu {
--bs-dropdown-zindex:1000;
--bs-dropdown-min-width:10rem;
--bs-dropdown-padding-x:0;
--bs-dropdown-padding-y:0.5rem;
--bs-dropdown-spacer:0.125rem;
--bs-dropdown-font-size:1rem;
--bs-dropdown-color:var(--bs-body-color);
--bs-dropdown-bg:var(--bs-body-bg);
--bs-dropdown-border-color:var(--bs-border-color-translucent);
--bs-dropdown-border-radius:0.375rem;
--bs-dropdown-border-width:var(--bs-border-width);
--bs-dropdown-inner-border-radius:calc(0.375rem - var(--bs-border-width));
--bs-dropdown-divider-bg:var(--bs-border-color-translucent);
--bs-dropdown-divider-margin-y:0.5rem;
--bs-dropdown-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15);
--bs-dropdown-link-color:var(--bs-body-color);
--bs-dropdown-link-hover-color:var(--bs-body-color);
--bs-dropdown-link-hover-bg:var(--bs-tertiary-bg);
--bs-dropdown-link-active-color:#fff;
--bs-dropdown-link-active-bg:#0d6efd;
--bs-dropdown-link-disabled-color:#adb5bd;
--bs-dropdown-item-padding-x:1rem;
--bs-dropdown-item-padding-y:0.25rem;
--bs-dropdown-header-color:#6c757d;
--bs-dropdown-header-padding-x:1rem;
--bs-dropdown-header-padding-y:0.5rem;
	position: absolute;
	z-index: var(--bs-dropdown-zindex);
	display: none;
	min-width: var(--bs-dropdown-min-width);
	padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);
	margin: 0;
	font-size: var(--bs-dropdown-font-size);
	color: var(--bs-dropdown-color);
	text-align: left;
	list-style: none;
	background-color: var(--bs-dropdown-bg);
	background-clip: padding-box;
	border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);
	border-radius: var(--bs-dropdown-border-radius)
}
.dropdown-menu[data-bs-popper] {
	top: 100%;
	left: 0;
	margin-top: var(--bs-dropdown-spacer)
}
.dropdown-menu-start {
--bs-position:start
}
.dropdown-menu-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-end {
--bs-position:end
}
.dropdown-menu-end[data-bs-popper] {
	right: 0;
	left: auto
}

@media (min-width:576px) {
.dropdown-menu-sm-start {
--bs-position:start
}
.dropdown-menu-sm-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-sm-end {
--bs-position:end
}
.dropdown-menu-sm-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:768px) {
.dropdown-menu-md-start {
--bs-position:start
}
.dropdown-menu-md-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-md-end {
--bs-position:end
}
.dropdown-menu-md-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:992px) {
.dropdown-menu-lg-start {
--bs-position:start
}
.dropdown-menu-lg-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-lg-end {
--bs-position:end
}
.dropdown-menu-lg-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:1200px) {
.dropdown-menu-xl-start {
--bs-position:start
}
.dropdown-menu-xl-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-xl-end {
--bs-position:end
}
.dropdown-menu-xl-end[data-bs-popper] {
	right: 0;
	left: auto
}
}

@media (min-width:1400px) {
.dropdown-menu-xxl-start {
--bs-position:start
}
.dropdown-menu-xxl-start[data-bs-popper] {
	right: auto;
	left: 0
}
.dropdown-menu-xxl-end {
--bs-position:end
}
.dropdown-menu-xxl-end[data-bs-popper] {
	right: 0;
	left: auto
}
}
.dropup .dropdown-menu[data-bs-popper] {
	top: auto;
	bottom: 100%;
	margin-top: 0;
	margin-bottom: var(--bs-dropdown-spacer)
}
.dropup .dropdown-toggle::after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: "";
	border-top: 0;
	border-right: .3em solid transparent;
	border-bottom: .3em solid;
	border-left: .3em solid transparent
}
.dropup .dropdown-toggle:empty::after {
	margin-left: 0
}
.dropend .dropdown-menu[data-bs-popper] {
	top: 0;
	right: auto;
	left: 100%;
	margin-top: 0;
	margin-left: var(--bs-dropdown-spacer)
}
.dropend .dropdown-toggle::after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: "";
	border-top: .3em solid transparent;
	border-right: 0;
	border-bottom: .3em solid transparent;
	border-left: .3em solid
}
.dropend .dropdown-toggle:empty::after {
	margin-left: 0
}
.dropend .dropdown-toggle::after {
	vertical-align: 0
}
.dropstart .dropdown-menu[data-bs-popper] {
	top: 0;
	right: 100%;
	left: auto;
	margin-top: 0;
	margin-right: var(--bs-dropdown-spacer)
}
.dropstart .dropdown-toggle::after {
	display: inline-block;
	margin-left: .255em;
	vertical-align: .255em;
	content: ""
}
.dropstart .dropdown-toggle::after {
	display: none
}
.dropstart .dropdown-toggle::before {
	display: inline-block;
	margin-right: .255em;
	vertical-align: .255em;
	content: "";
	border-top: .3em solid transparent;
	border-right: .3em solid;
	border-bottom: .3em solid transparent
}
.dropstart .dropdown-toggle:empty::after {
	margin-left: 0
}
.dropstart .dropdown-toggle::before {
	vertical-align: 0
}
.dropdown-divider {
	height: 0;
	margin: var(--bs-dropdown-divider-margin-y) 0;
	overflow: hidden;
	border-top: 1px solid var(--bs-dropdown-divider-bg);
	opacity: 1
}
.dropdown-item {
	display: block;
	width: 100%;
	padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
	clear: both;
	font-weight: 400;
	color: var(--bs-dropdown-link-color);
	text-align: inherit;
	text-decoration: none;
	white-space: nowrap;
	background-color: transparent;
	border: 0;
	border-radius: var(--bs-dropdown-item-border-radius, 0)
}
.dropdown-item:focus, .dropdown-item:hover {
	color: var(--bs-dropdown-link-hover-color);
	background-color: var(--bs-dropdown-link-hover-bg)
}
.dropdown-item.active, .dropdown-item:active {
	color: var(--bs-dropdown-link-active-color);
	text-decoration: none;
	background-color: var(--bs-dropdown-link-active-bg)
}
.dropdown-item.disabled, .dropdown-item:disabled {
	color: var(--bs-dropdown-link-disabled-color);
	pointer-events: none;
	background-color: transparent
}
.dropdown-menu.show {
	display: block
}
.dropdown-header {
	display: block;
	padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);
	margin-bottom: 0;
	font-size: .875rem;
	color: var(--bs-dropdown-header-color);
	white-space: nowrap
}
.dropdown-item-text {
	display: block;
	padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
	color: var(--bs-dropdown-link-color)
}
.dropdown-menu-dark {
--bs-dropdown-color:#dee2e6;
--bs-dropdown-bg:#343a40;
--bs-dropdown-border-color:var(--bs-border-color-translucent);
--bs-dropdown-box-shadow:;
--bs-dropdown-link-color:#dee2e6;
--bs-dropdown-link-hover-color:#fff;
--bs-dropdown-divider-bg:var(--bs-border-color-translucent);
--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);
--bs-dropdown-link-active-color:#fff;
--bs-dropdown-link-active-bg:#0d6efd;
--bs-dropdown-link-disabled-color:#adb5bd;
--bs-dropdown-header-color:#adb5bd
}
.btn-group, .btn-group-vertical {
	position: relative;
	display: inline-flex;
	vertical-align: middle
}
.btn-group-vertical>.btn, .btn-group>.btn {
	position: relative;
	flex: 1 1 auto
}
.btn-group-vertical>.btn-check:checked+.btn, .btn-group-vertical>.btn-check:focus+.btn, .btn-group-vertical>.btn.active, .btn-group-vertical>.btn:active, .btn-group-vertical>.btn:focus, .btn-group-vertical>.btn:hover, .btn-group>.btn-check:checked+.btn, .btn-group>.btn-check:focus+.btn, .btn-group>.btn.active, .btn-group>.btn:active, .btn-group>.btn:focus, .btn-group>.btn:hover {
	z-index: 1
}
.btn-toolbar {
	display: flex;
	flex-wrap: wrap;
	justify-content: flex-start
}
.btn-toolbar .input-group {
	width: auto
}
.btn-group {
	border-radius: .375rem
}
.btn-group>.btn-group:not(:first-child), .btn-group>:not(.btn-check:first-child)+.btn {
margin-left:calc(var(--bs-border-width) * -1)
}
.btn-group>.btn-group:not(:last-child)>.btn, .btn-group>.btn.dropdown-toggle-split:first-child, .btn-group>.btn:not(:last-child):not(.dropdown-toggle) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.btn-group>.btn-group:not(:first-child)>.btn, .btn-group>.btn:nth-child(n+3), .btn-group>:not(.btn-check)+.btn {
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.dropdown-toggle-split {
	padding-right: .5625rem;
	padding-left: .5625rem
}
.dropdown-toggle-split::after, .dropend .dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after {
	margin-left: 0
}
.dropstart .dropdown-toggle-split::before {
	margin-right: 0
}
.btn-group-sm>.btn+.dropdown-toggle-split, .btn-sm+.dropdown-toggle-split {
	padding-right: .375rem;
	padding-left: .375rem
}
.btn-group-lg>.btn+.dropdown-toggle-split, .btn-lg+.dropdown-toggle-split {
	padding-right: .75rem;
	padding-left: .75rem
}
.btn-group-vertical {
	flex-direction: column;
	align-items: flex-start;
	justify-content: center
}
.btn-group-vertical>.btn, .btn-group-vertical>.btn-group {
	width: 100%
}
.btn-group-vertical>.btn-group:not(:first-child), .btn-group-vertical>.btn:not(:first-child) {
margin-top:calc(var(--bs-border-width) * -1)
}
.btn-group-vertical>.btn-group:not(:last-child)>.btn, .btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle) {
	border-bottom-right-radius: 0;
	border-bottom-left-radius: 0
}
.btn-group-vertical>.btn-group:not(:first-child)>.btn, .btn-group-vertical>.btn~.btn {
	border-top-left-radius: 0;
	border-top-right-radius: 0
}
.nav {
--bs-nav-link-padding-x:1rem;
--bs-nav-link-padding-y:0.5rem;
--bs-nav-link-font-weight:;
--bs-nav-link-color:var(--bs-link-color);
--bs-nav-link-hover-color:var(--bs-link-hover-color);
--bs-nav-link-disabled-color:var(--bs-secondary-color);
	display: flex;
	flex-wrap: wrap;
	padding-left: 0;
	margin-bottom: 0;
	list-style: none
}
.nav-link {
	display: block;
	padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);
	font-size: var(--bs-nav-link-font-size);
	font-weight: var(--bs-nav-link-font-weight);
	color: var(--bs-nav-link-color);
	text-decoration: none;
	transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.nav-link {
	transition: none
}
}
.nav-link:focus, .nav-link:hover {
	color: var(--bs-nav-link-hover-color)
}
.nav-link.disabled {
	color: var(--bs-nav-link-disabled-color);
	pointer-events: none;
	cursor: default
}
.nav-tabs {
--bs-nav-tabs-border-width:var(--bs-border-width);
--bs-nav-tabs-border-color:var(--bs-border-color);
--bs-nav-tabs-border-radius:var(--bs-border-radius);
--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);
--bs-nav-tabs-link-active-color:var(--bs-emphasis-color);
--bs-nav-tabs-link-active-bg:var(--bs-body-bg);
--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);
	border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)
}
.nav-tabs .nav-link {
margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));
	background: 0 0;
	border: var(--bs-nav-tabs-border-width) solid transparent;
	border-top-left-radius: var(--bs-nav-tabs-border-radius);
	border-top-right-radius: var(--bs-nav-tabs-border-radius)
}
.nav-tabs .nav-link:focus, .nav-tabs .nav-link:hover {
	isolation: isolate;
	border-color: var(--bs-nav-tabs-link-hover-border-color)
}
.nav-tabs .nav-link.disabled, .nav-tabs .nav-link:disabled {
	color: var(--bs-nav-link-disabled-color);
	background-color: transparent;
	border-color: transparent
}
.nav-tabs .nav-item.show .nav-link, .nav-tabs .nav-link.active {
	color: var(--bs-nav-tabs-link-active-color);
	background-color: var(--bs-nav-tabs-link-active-bg);
	border-color: var(--bs-nav-tabs-link-active-border-color)
}
.nav-tabs .dropdown-menu {
margin-top:calc(-1 * var(--bs-nav-tabs-border-width));
	border-top-left-radius: 0;
	border-top-right-radius: 0
}
.nav-pills {
--bs-nav-pills-border-radius:0.375rem;
--bs-nav-pills-link-active-color:#fff;
--bs-nav-pills-link-active-bg:#0d6efd
}
.nav-pills .nav-link {
	background: 0 0;
	border: 0;
	border-radius: var(--bs-nav-pills-border-radius)
}
.nav-pills .nav-link:disabled {
	color: var(--bs-nav-link-disabled-color);
	background-color: transparent;
	border-color: transparent
}
.nav-pills .nav-link.active, .nav-pills .show>.nav-link {
	color: var(--bs-nav-pills-link-active-color);
	background-color: var(--bs-nav-pills-link-active-bg)
}
.nav-fill .nav-item, .nav-fill>.nav-link {
	flex: 1 1 auto;
	text-align: center
}
.nav-justified .nav-item, .nav-justified>.nav-link {
	flex-basis: 0;
	flex-grow: 1;
	text-align: center
}
.nav-fill .nav-item .nav-link, .nav-justified .nav-item .nav-link {
	width: 100%
}
.tab-content>.tab-pane {
	display: none
}
.tab-content>.active {
	display: block
}
.navbar {
--bs-navbar-padding-x:0;
--bs-navbar-padding-y:0.5rem;
--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);
--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);
--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);
--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);
--bs-navbar-brand-padding-y:0.3125rem;
--bs-navbar-brand-margin-end:1rem;
--bs-navbar-brand-font-size:1.25rem;
--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);
--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);
--bs-navbar-nav-link-padding-x:0.5rem;
--bs-navbar-toggler-padding-y:0.25rem;
--bs-navbar-toggler-padding-x:0.75rem;
--bs-navbar-toggler-font-size:1.25rem;
--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);
--bs-navbar-toggler-border-radius:0.375rem;
--bs-navbar-toggler-focus-width:0.25rem;
--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;
	position: relative;
	display: flex;
	flex-wrap: wrap;
	align-items: center;
	justify-content: space-between;
	padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)
}
.navbar>.container, .navbar>.container-fluid, .navbar>.container-lg, .navbar>.container-md, .navbar>.container-sm, .navbar>.container-xl, .navbar>.container-xxl {
	display: flex;
	flex-wrap: inherit;
	align-items: center;
	justify-content: space-between
}
.navbar-brand {
	padding-top: var(--bs-navbar-brand-padding-y);
	padding-bottom: var(--bs-navbar-brand-padding-y);
	margin-right: var(--bs-navbar-brand-margin-end);
	font-size: var(--bs-navbar-brand-font-size);
	color: var(--bs-navbar-brand-color);
	text-decoration: none;
	white-space: nowrap
}
.navbar-brand:focus, .navbar-brand:hover {
	color: var(--bs-navbar-brand-hover-color)
}
.navbar-nav {
--bs-nav-link-padding-x:0;
--bs-nav-link-padding-y:0.5rem;
--bs-nav-link-font-weight:;
--bs-nav-link-color:var(--bs-navbar-color);
--bs-nav-link-hover-color:var(--bs-navbar-hover-color);
--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);
	display: flex;
	flex-direction: column;
	padding-left: 0;
	margin-bottom: 0;
	list-style: none
}
.navbar-nav .nav-link.active, .navbar-nav .show>.nav-link {
	color: var(--bs-navbar-active-color)
}
.navbar-nav .dropdown-menu {
	position: static
}
.navbar-text {
	padding-top: .5rem;
	padding-bottom: .5rem;
	color: var(--bs-navbar-color)
}
.navbar-text a, .navbar-text a:focus, .navbar-text a:hover {
	color: var(--bs-navbar-active-color)
}
.navbar-collapse {
	flex-basis: 100%;
	flex-grow: 1;
	align-items: center
}
.navbar-toggler {
	padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);
	font-size: var(--bs-navbar-toggler-font-size);
	line-height: 1;
	color: var(--bs-navbar-color);
	background-color: transparent;
	border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);
	border-radius: var(--bs-navbar-toggler-border-radius);
	transition: var(--bs-navbar-toggler-transition)
}

@media (prefers-reduced-motion:reduce) {
.navbar-toggler {
	transition: none
}
}
.navbar-toggler:hover {
	text-decoration: none
}
.navbar-toggler:focus {
	text-decoration: none;
	outline: 0;
	box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width)
}
.navbar-toggler-icon {
	display: inline-block;
	width: 1.5em;
	height: 1.5em;
	vertical-align: middle;
	background-image: var(--bs-navbar-toggler-icon-bg);
	background-repeat: no-repeat;
	background-position: center;
	background-size: 100%
}
.navbar-nav-scroll {
	max-height: var(--bs-scroll-height, 75vh);
	overflow-y: auto
}

@media (min-width:576px) {
.navbar-expand-sm {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-sm .navbar-nav {
	flex-direction: row
}
.navbar-expand-sm .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-sm .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-sm .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-sm .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-sm .navbar-toggler {
	display: none
}
.navbar-expand-sm .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-sm .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-sm .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:768px) {
.navbar-expand-md {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-md .navbar-nav {
	flex-direction: row
}
.navbar-expand-md .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-md .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-md .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-md .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-md .navbar-toggler {
	display: none
}
.navbar-expand-md .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-md .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-md .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:992px) {
.navbar-expand-lg {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-lg .navbar-nav {
	flex-direction: row
}
.navbar-expand-lg .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-lg .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-lg .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-lg .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-lg .navbar-toggler {
	display: none
}
.navbar-expand-lg .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-lg .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-lg .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:1200px) {
.navbar-expand-xl {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-xl .navbar-nav {
	flex-direction: row
}
.navbar-expand-xl .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-xl .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-xl .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-xl .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-xl .navbar-toggler {
	display: none
}
.navbar-expand-xl .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-xl .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-xl .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}

@media (min-width:1400px) {
.navbar-expand-xxl {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand-xxl .navbar-nav {
	flex-direction: row
}
.navbar-expand-xxl .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand-xxl .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand-xxl .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand-xxl .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand-xxl .navbar-toggler {
	display: none
}
.navbar-expand-xxl .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand-xxl .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand-xxl .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
}
.navbar-expand {
	flex-wrap: nowrap;
	justify-content: flex-start
}
.navbar-expand .navbar-nav {
	flex-direction: row
}
.navbar-expand .navbar-nav .dropdown-menu {
	position: absolute
}
.navbar-expand .navbar-nav .nav-link {
	padding-right: var(--bs-navbar-nav-link-padding-x);
	padding-left: var(--bs-navbar-nav-link-padding-x)
}
.navbar-expand .navbar-nav-scroll {
	overflow: visible
}
.navbar-expand .navbar-collapse {
	display: flex!important;
	flex-basis: auto
}
.navbar-expand .navbar-toggler {
	display: none
}
.navbar-expand .offcanvas {
	position: static;
	z-index: auto;
	flex-grow: 1;
	width: auto!important;
	height: auto!important;
	visibility: visible!important;
	background-color: transparent!important;
	border: 0!important;
	transform: none!important;
	transition: none
}
.navbar-expand .offcanvas .offcanvas-header {
	display: none
}
.navbar-expand .offcanvas .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible
}
.navbar-dark {
--bs-navbar-color:rgba(255, 255, 255, 0.55);
--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);
--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);
--bs-navbar-active-color:#fff;
--bs-navbar-brand-color:#fff;
--bs-navbar-brand-hover-color:#fff;
--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);
--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")
}
[data-bs-theme=dark] .navbar {
--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")
}
.card {
--bs-card-spacer-y:1rem;
--bs-card-spacer-x:1rem;
--bs-card-title-spacer-y:0.5rem;
--bs-card-title-color:;
--bs-card-subtitle-color:;
--bs-card-border-width:var(--bs-border-width);
--bs-card-border-color:var(--bs-border-color-translucent);
--bs-card-border-radius:var(--bs-border-radius);
--bs-card-box-shadow:;
--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));
--bs-card-cap-padding-y:0.5rem;
--bs-card-cap-padding-x:1rem;
--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);
--bs-card-cap-color:;
--bs-card-height:;
--bs-card-color:;
--bs-card-bg:var(--bs-body-bg);
--bs-card-img-overlay-padding:1rem;
--bs-card-group-margin:0.75rem;
	position: relative;
	display: flex;
	flex-direction: column;
	min-width: 0;
	height: var(--bs-card-height);
	word-wrap: break-word;
	background-color: var(--bs-card-bg);
	background-clip: border-box;
	border: var(--bs-card-border-width) solid var(--bs-card-border-color);
	border-radius: var(--bs-card-border-radius)
}
.card>hr {
	margin-right: 0;
	margin-left: 0
}
.card>.list-group {
	border-top: inherit;
	border-bottom: inherit
}
.card>.list-group:first-child {
	border-top-width: 0;
	border-top-left-radius: var(--bs-card-inner-border-radius);
	border-top-right-radius: var(--bs-card-inner-border-radius)
}
.card>.list-group:last-child {
	border-bottom-width: 0;
	border-bottom-right-radius: var(--bs-card-inner-border-radius);
	border-bottom-left-radius: var(--bs-card-inner-border-radius)
}
.card>.card-header+.list-group, .card>.list-group+.card-footer {
	border-top: 0
}
.card-body {
	flex: 1 1 auto;
	padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x);
	color: var(--bs-card-color)
}
.card-title {
	margin-bottom: var(--bs-card-title-spacer-y);
	color: var(--bs-card-title-color)
}
.card-subtitle {
margin-top:calc(-.5 * var(--bs-card-title-spacer-y));
	margin-bottom: 0;
	color: var(--bs-card-subtitle-color)
}
.card-text:last-child {
	margin-bottom: 0
}
.card-link+.card-link {
	margin-left: var(--bs-card-spacer-x)
}
.card-header {
	padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
	margin-bottom: 0;
	color: var(--bs-card-cap-color);
	background-color: var(--bs-card-cap-bg);
	border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color)
}
.card-header:first-child {
	border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0
}
.card-footer {
	padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
	color: var(--bs-card-cap-color);
	background-color: var(--bs-card-cap-bg);
	border-top: var(--bs-card-border-width) solid var(--bs-card-border-color)
}
.card-footer:last-child {
	border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)
}
.card-header-tabs {
margin-right:calc(-.5 * var(--bs-card-cap-padding-x));
margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));
margin-left:calc(-.5 * var(--bs-card-cap-padding-x));
	border-bottom: 0
}
.card-header-tabs .nav-link.active {
	background-color: var(--bs-card-bg);
	border-bottom-color: var(--bs-card-bg)
}
.card-header-pills {
margin-right:calc(-.5 * var(--bs-card-cap-padding-x));
margin-left:calc(-.5 * var(--bs-card-cap-padding-x))
}
.card-img-overlay {
	position: absolute;
	top: 0;
	right: 0;
	bottom: 0;
	left: 0;
	padding: var(--bs-card-img-overlay-padding);
	border-radius: var(--bs-card-inner-border-radius)
}
.card-img, .card-img-bottom, .card-img-top {
	width: 100%
}
.card-img, .card-img-top {
	border-top-left-radius: var(--bs-card-inner-border-radius);
	border-top-right-radius: var(--bs-card-inner-border-radius)
}
.card-img, .card-img-bottom {
	border-bottom-right-radius: var(--bs-card-inner-border-radius);
	border-bottom-left-radius: var(--bs-card-inner-border-radius)
}
.card-group>.card {
	margin-bottom: var(--bs-card-group-margin)
}

@media (min-width:576px) {
.card-group {
	display: flex;
	flex-flow: row wrap
}
.card-group>.card {
	flex: 1 0 0%;
	margin-bottom: 0
}
.card-group>.card+.card {
	margin-left: 0;
	border-left: 0
}
.card-group>.card:not(:last-child) {
	border-top-right-radius: 0;
	border-bottom-right-radius: 0
}
.card-group>.card:not(:last-child) .card-header, .card-group>.card:not(:last-child) .card-img-top {
	border-top-right-radius: 0
}
.card-group>.card:not(:last-child) .card-footer, .card-group>.card:not(:last-child) .card-img-bottom {
	border-bottom-right-radius: 0
}
.card-group>.card:not(:first-child) {
	border-top-left-radius: 0;
	border-bottom-left-radius: 0
}
.card-group>.card:not(:first-child) .card-header, .card-group>.card:not(:first-child) .card-img-top {
	border-top-left-radius: 0
}
.card-group>.card:not(:first-child) .card-footer, .card-group>.card:not(:first-child) .card-img-bottom {
	border-bottom-left-radius: 0
}
}
.accordion {
--bs-accordion-color:var(--bs-body-color);
--bs-accordion-bg:var(--bs-body-bg);
--bs-accordion-transition:color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease;
--bs-accordion-border-color:var(--bs-border-color);
--bs-accordion-border-width:var(--bs-border-width);
--bs-accordion-border-radius:var(--bs-border-radius);
--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));
--bs-accordion-btn-padding-x:1.25rem;
--bs-accordion-btn-padding-y:1rem;
--bs-accordion-btn-color:var(--bs-body-color);
--bs-accordion-btn-bg:var(--bs-accordion-bg);
--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
--bs-accordion-btn-icon-width:1.25rem;
--bs-accordion-btn-icon-transform:rotate(-180deg);
--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;
--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230a58ca'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
--bs-accordion-btn-focus-border-color:#86b7fe;
--bs-accordion-btn-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);
--bs-accordion-body-padding-x:1.25rem;
--bs-accordion-body-padding-y:1rem;
--bs-accordion-active-color:var(--bs-primary-text);
--bs-accordion-active-bg:var(--bs-primary-bg-subtle)
}
.accordion-button {
	position: relative;
	display: flex;
	align-items: center;
	width: 100%;
	padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);
	font-size: 1rem;
	color: var(--bs-accordion-btn-color);
	text-align: left;
	background-color: var(--bs-accordion-btn-bg);
	border: 0;
	border-radius: 0;
	overflow-anchor: none;
	transition: var(--bs-accordion-transition)
}

@media (prefers-reduced-motion:reduce) {
.accordion-button {
	transition: none
}
}
.accordion-button:not(.collapsed) {
	color: var(--bs-accordion-active-color);
	background-color: var(--bs-accordion-active-bg);
box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)
}
.accordion-button:not(.collapsed)::after {
	background-image: var(--bs-accordion-btn-active-icon);
	transform: var(--bs-accordion-btn-icon-transform)
}
.accordion-button::after {
	flex-shrink: 0;
	width: var(--bs-accordion-btn-icon-width);
	height: var(--bs-accordion-btn-icon-width);
	margin-left: auto;
	content: "";
	background-image: var(--bs-accordion-btn-icon);
	background-repeat: no-repeat;
	background-size: var(--bs-accordion-btn-icon-width);
	transition: var(--bs-accordion-btn-icon-transition)
}

@media (prefers-reduced-motion:reduce) {
.accordion-button::after {
	transition: none
}
}
.accordion-button:hover {
	z-index: 2
}
.accordion-button:focus {
	z-index: 3;
	border-color: var(--bs-accordion-btn-focus-border-color);
	outline: 0;
	box-shadow: var(--bs-accordion-btn-focus-box-shadow)
}
.accordion-header {
	margin-bottom: 0
}
.accordion-item {
	color: var(--bs-accordion-color);
	background-color: var(--bs-accordion-bg);
	border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)
}
.accordion-item:first-of-type {
	border-top-left-radius: var(--bs-accordion-border-radius);
	border-top-right-radius: var(--bs-accordion-border-radius)
}
.accordion-item:first-of-type .accordion-button {
	border-top-left-radius: var(--bs-accordion-inner-border-radius);
	border-top-right-radius: var(--bs-accordion-inner-border-radius)
}
.accordion-item:not(:first-of-type) {
	border-top: 0
}
.accordion-item:last-of-type {
	border-bottom-right-radius: var(--bs-accordion-border-radius);
	border-bottom-left-radius: var(--bs-accordion-border-radius)
}
.accordion-item:last-of-type .accordion-button.collapsed {
	border-bottom-right-radius: var(--bs-accordion-inner-border-radius);
	border-bottom-left-radius: var(--bs-accordion-inner-border-radius)
}
.accordion-item:last-of-type .accordion-collapse {
	border-bottom-right-radius: var(--bs-accordion-border-radius);
	border-bottom-left-radius: var(--bs-accordion-border-radius)
}
.accordion-body {
	padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)
}
.accordion-flush .accordion-collapse {
	border-width: 0
}
.accordion-flush .accordion-item {
	border-right: 0;
	border-left: 0;
	border-radius: 0
}
.accordion-flush .accordion-item:first-child {
	border-top: 0
}
.accordion-flush .accordion-item:last-child {
	border-bottom: 0
}
.accordion-flush .accordion-item .accordion-button, .accordion-flush .accordion-item .accordion-button.collapsed {
	border-radius: 0
}
[data-bs-theme=dark] .accordion-button::after {
--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%236ea8fe'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")
}
.breadcrumb {
--bs-breadcrumb-padding-x:0;
--bs-breadcrumb-padding-y:0;
--bs-breadcrumb-margin-bottom:1rem;
--bs-breadcrumb-bg:;
--bs-breadcrumb-border-radius:;
--bs-breadcrumb-divider-color:var(--bs-secondary-color);
--bs-breadcrumb-item-padding-x:0.5rem;
--bs-breadcrumb-item-active-color:var(--bs-secondary-color);
	display: flex;
	flex-wrap: wrap;
	padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);
	margin-bottom: var(--bs-breadcrumb-margin-bottom);
	font-size: var(--bs-breadcrumb-font-size);
	list-style: none;
	background-color: var(--bs-breadcrumb-bg);
	border-radius: var(--bs-breadcrumb-border-radius)
}
.breadcrumb-item+.breadcrumb-item {
	padding-left: var(--bs-breadcrumb-item-padding-x)
}
.breadcrumb-item+.breadcrumb-item::before {
	float: left;
	padding-right: var(--bs-breadcrumb-item-padding-x);
	color: var(--bs-breadcrumb-divider-color);
	content: var(--bs-breadcrumb-divider, "../index-2.html")
}
.breadcrumb-item.active {
	color: var(--bs-breadcrumb-item-active-color)
}
.pagination {
--bs-pagination-padding-x:0.75rem;
--bs-pagination-padding-y:0.375rem;
--bs-pagination-font-size:1rem;
--bs-pagination-color:var(--bs-link-color);
--bs-pagination-bg:var(--bs-body-bg);
--bs-pagination-border-width:var(--bs-border-width);
--bs-pagination-border-color:var(--bs-border-color);
--bs-pagination-border-radius:var(--bs-border-radius);
--bs-pagination-hover-color:var(--bs-link-hover-color);
--bs-pagination-hover-bg:var(--bs-tertiary-bg);
--bs-pagination-hover-border-color:var(--bs-border-color);
--bs-pagination-focus-color:var(--bs-link-hover-color);
--bs-pagination-focus-bg:var(--bs-secondary-bg);
--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);
--bs-pagination-active-color:#fff;
--bs-pagination-active-bg:#0d6efd;
--bs-pagination-active-border-color:#0d6efd;
--bs-pagination-disabled-color:var(--bs-secondary-color);
--bs-pagination-disabled-bg:var(--bs-secondary-bg);
--bs-pagination-disabled-border-color:var(--bs-border-color);
	display: flex;
	padding-left: 0;
	list-style: none
}
.page-link {
	position: relative;
	display: block;
	padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);
	font-size: var(--bs-pagination-font-size);
	color: var(--bs-pagination-color);
	text-decoration: none;
	background-color: var(--bs-pagination-bg);
	border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);
	transition: color .15s ease-in-out, background-color .15s ease-in-out, border-color .15s ease-in-out, box-shadow .15s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.page-link {
	transition: none
}
}
.page-link:hover {
	z-index: 2;
	color: var(--bs-pagination-hover-color);
	background-color: var(--bs-pagination-hover-bg);
	border-color: var(--bs-pagination-hover-border-color)
}
.page-link:focus {
	z-index: 3;
	color: var(--bs-pagination-focus-color);
	background-color: var(--bs-pagination-focus-bg);
	outline: 0;
	box-shadow: var(--bs-pagination-focus-box-shadow)
}
.active>.page-link, .page-link.active {
	z-index: 3;
	color: var(--bs-pagination-active-color);
	background-color: var(--bs-pagination-active-bg);
	border-color: var(--bs-pagination-active-border-color)
}
.disabled>.page-link, .page-link.disabled {
	color: var(--bs-pagination-disabled-color);
	pointer-events: none;
	background-color: var(--bs-pagination-disabled-bg);
	border-color: var(--bs-pagination-disabled-border-color)
}
.page-item:not(:first-child) .page-link {
margin-left:calc(var(--bs-border-width) * -1)
}
.page-item:first-child .page-link {
	border-top-left-radius: var(--bs-pagination-border-radius);
	border-bottom-left-radius: var(--bs-pagination-border-radius)
}
.page-item:last-child .page-link {
	border-top-right-radius: var(--bs-pagination-border-radius);
	border-bottom-right-radius: var(--bs-pagination-border-radius)
}
.pagination-lg {
--bs-pagination-padding-x:1.5rem;
--bs-pagination-padding-y:0.75rem;
--bs-pagination-font-size:1.25rem;
--bs-pagination-border-radius:0.5rem
}
.pagination-sm {
--bs-pagination-padding-x:0.5rem;
--bs-pagination-padding-y:0.25rem;
--bs-pagination-font-size:0.875rem;
--bs-pagination-border-radius:0.25rem
}
.badge {
--bs-badge-padding-x:0.65em;
--bs-badge-padding-y:0.35em;
--bs-badge-font-size:0.75em;
--bs-badge-font-weight:700;
--bs-badge-color:#fff;
--bs-badge-border-radius:0.375rem;
	display: inline-block;
	padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x);
	font-size: var(--bs-badge-font-size);
	font-weight: var(--bs-badge-font-weight);
	line-height: 1;
	color: var(--bs-badge-color);
	text-align: center;
	white-space: nowrap;
	vertical-align: baseline;
	border-radius: var(--bs-badge-border-radius)
}
.badge:empty {
	display: none
}
.btn .badge {
	position: relative;
	top: -1px
}
.alert {
--bs-alert-bg:transparent;
--bs-alert-padding-x:1rem;
--bs-alert-padding-y:1rem;
--bs-alert-margin-bottom:1rem;
--bs-alert-color:inherit;
--bs-alert-border-color:transparent;
--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);
--bs-alert-border-radius:0.375rem;
--bs-alert-link-color:inherit;
	position: relative;
	padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x);
	margin-bottom: var(--bs-alert-margin-bottom);
	color: var(--bs-alert-color);
	background-color: var(--bs-alert-bg);
	border: var(--bs-alert-border);
	border-radius: var(--bs-alert-border-radius)
}
.alert-heading {
	color: inherit
}
.alert-link {
	font-weight: 700;
	color: var(--bs-alert-link-color)
}
.alert-dismissible {
	padding-right: 3rem
}
.alert-dismissible .btn-close {
	position: absolute;
	top: 0;
	right: 0;
	z-index: 2;
	padding: 1.25rem 1rem
}
.alert-primary {
--bs-alert-color:var(--bs-primary-text);
--bs-alert-bg:var(--bs-primary-bg-subtle);
--bs-alert-border-color:var(--bs-primary-border-subtle);
--bs-alert-link-color:var(--bs-primary-text)
}
.alert-secondary {
--bs-alert-color:var(--bs-secondary-text);
--bs-alert-bg:var(--bs-secondary-bg-subtle);
--bs-alert-border-color:var(--bs-secondary-border-subtle);
--bs-alert-link-color:var(--bs-secondary-text)
}
.alert-success {
--bs-alert-color:var(--bs-success-text);
--bs-alert-bg:var(--bs-success-bg-subtle);
--bs-alert-border-color:var(--bs-success-border-subtle);
--bs-alert-link-color:var(--bs-success-text)
}
.alert-info {
--bs-alert-color:var(--bs-info-text);
--bs-alert-bg:var(--bs-info-bg-subtle);
--bs-alert-border-color:var(--bs-info-border-subtle);
--bs-alert-link-color:var(--bs-info-text)
}
.alert-warning {
--bs-alert-color:var(--bs-warning-text);
--bs-alert-bg:var(--bs-warning-bg-subtle);
--bs-alert-border-color:var(--bs-warning-border-subtle);
--bs-alert-link-color:var(--bs-warning-text)
}
.alert-danger {
--bs-alert-color:var(--bs-danger-text);
--bs-alert-bg:var(--bs-danger-bg-subtle);
--bs-alert-border-color:var(--bs-danger-border-subtle);
--bs-alert-link-color:var(--bs-danger-text)
}
.alert-light {
--bs-alert-color:var(--bs-light-text);
--bs-alert-bg:var(--bs-light-bg-subtle);
--bs-alert-border-color:var(--bs-light-border-subtle);
--bs-alert-link-color:var(--bs-light-text)
}
.alert-dark {
--bs-alert-color:var(--bs-dark-text);
--bs-alert-bg:var(--bs-dark-bg-subtle);
--bs-alert-border-color:var(--bs-dark-border-subtle);
--bs-alert-link-color:var(--bs-dark-text)
}
@keyframes progress-bar-stripes {
0% {
background-position-x:1rem
}
}
.progress, .progress-stacked {
--bs-progress-height:1rem;
--bs-progress-font-size:0.75rem;
--bs-progress-bg:var(--bs-secondary-bg);
--bs-progress-border-radius:var(--bs-border-radius);
--bs-progress-box-shadow:var(--bs-box-shadow-inset);
--bs-progress-bar-color:#fff;
--bs-progress-bar-bg:#0d6efd;
--bs-progress-bar-transition:width 0.6s ease;
	display: flex;
	height: var(--bs-progress-height);
	overflow: hidden;
	font-size: var(--bs-progress-font-size);
	background-color: var(--bs-progress-bg);
	border-radius: var(--bs-progress-border-radius)
}
.progress-bar {
	display: flex;
	flex-direction: column;
	justify-content: center;
	overflow: hidden;
	color: var(--bs-progress-bar-color);
	text-align: center;
	white-space: nowrap;
	background-color: var(--bs-progress-bar-bg);
	transition: var(--bs-progress-bar-transition)
}

@media (prefers-reduced-motion:reduce) {
.progress-bar {
	transition: none
}
}
.progress-bar-striped {
	background-image: linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent);
	background-size: var(--bs-progress-height) var(--bs-progress-height)
}
.progress-stacked>.progress {
	overflow: visible
}
.progress-stacked>.progress>.progress-bar {
	width: 100%
}
.progress-bar-animated {
	animation: 1s linear infinite progress-bar-stripes
}

@media (prefers-reduced-motion:reduce) {
.progress-bar-animated {
	animation: none
}
}
.list-group {
--bs-list-group-color:var(--bs-body-color);
--bs-list-group-bg:var(--bs-body-bg);
--bs-list-group-border-color:var(--bs-border-color);
--bs-list-group-border-width:var(--bs-border-width);
--bs-list-group-border-radius:var(--bs-border-radius);
--bs-list-group-item-padding-x:1rem;
--bs-list-group-item-padding-y:0.5rem;
--bs-list-group-action-color:var(--bs-secondary-color);
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);
--bs-list-group-action-active-color:var(--bs-body-color);
--bs-list-group-action-active-bg:var(--bs-secondary-bg);
--bs-list-group-disabled-color:var(--bs-secondary-color);
--bs-list-group-disabled-bg:var(--bs-body-bg);
--bs-list-group-active-color:#fff;
--bs-list-group-active-bg:#0d6efd;
--bs-list-group-active-border-color:#0d6efd;
	display: flex;
	flex-direction: column;
	padding-left: 0;
	margin-bottom: 0;
	border-radius: var(--bs-list-group-border-radius)
}
.list-group-numbered {
	list-style-type: none;
	counter-reset: section
}
.list-group-numbered>.list-group-item::before {
	content: counters(section, ".") ". ";
	counter-increment: section
}
.list-group-item-action {
	width: 100%;
	color: var(--bs-list-group-action-color);
	text-align: inherit
}
.list-group-item-action:focus, .list-group-item-action:hover {
	z-index: 1;
	color: var(--bs-list-group-action-hover-color);
	text-decoration: none;
	background-color: var(--bs-list-group-action-hover-bg)
}
.list-group-item-action:active {
	color: var(--bs-list-group-action-active-color);
	background-color: var(--bs-list-group-action-active-bg)
}
.list-group-item {
	position: relative;
	display: block;
	padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);
	color: var(--bs-list-group-color);
	text-decoration: none;
	background-color: var(--bs-list-group-bg);
	border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)
}
.list-group-item:first-child {
	border-top-left-radius: inherit;
	border-top-right-radius: inherit
}
.list-group-item:last-child {
	border-bottom-right-radius: inherit;
	border-bottom-left-radius: inherit
}
.list-group-item.disabled, .list-group-item:disabled {
	color: var(--bs-list-group-disabled-color);
	pointer-events: none;
	background-color: var(--bs-list-group-disabled-bg)
}
.list-group-item.active {
	z-index: 2;
	color: var(--bs-list-group-active-color);
	background-color: var(--bs-list-group-active-bg);
	border-color: var(--bs-list-group-active-border-color)
}
.list-group-item+.list-group-item {
	border-top-width: 0
}
.list-group-item+.list-group-item.active {
margin-top:calc(-1 * var(--bs-list-group-border-width));
	border-top-width: var(--bs-list-group-border-width)
}
.list-group-horizontal {
	flex-direction: row
}
.list-group-horizontal>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}

@media (min-width:576px) {
.list-group-horizontal-sm {
	flex-direction: row
}
.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-sm>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-sm>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-sm>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:768px) {
.list-group-horizontal-md {
	flex-direction: row
}
.list-group-horizontal-md>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-md>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-md>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-md>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-md>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:992px) {
.list-group-horizontal-lg {
	flex-direction: row
}
.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-lg>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-lg>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-lg>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:1200px) {
.list-group-horizontal-xl {
	flex-direction: row
}
.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-xl>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-xl>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-xl>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}

@media (min-width:1400px) {
.list-group-horizontal-xxl {
	flex-direction: row
}
.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child) {
	border-bottom-left-radius: var(--bs-list-group-border-radius);
	border-top-right-radius: 0
}
.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child) {
	border-top-right-radius: var(--bs-list-group-border-radius);
	border-bottom-left-radius: 0
}
.list-group-horizontal-xxl>.list-group-item.active {
	margin-top: 0
}
.list-group-horizontal-xxl>.list-group-item+.list-group-item {
	border-top-width: var(--bs-list-group-border-width);
	border-left-width: 0
}
.list-group-horizontal-xxl>.list-group-item+.list-group-item.active {
margin-left:calc(-1 * var(--bs-list-group-border-width));
	border-left-width: var(--bs-list-group-border-width)
}
}
.list-group-flush {
	border-radius: 0
}
.list-group-flush>.list-group-item {
	border-width: 0 0 var(--bs-list-group-border-width)
}
.list-group-flush>.list-group-item:last-child {
	border-bottom-width: 0
}
.list-group-item-primary {
--bs-list-group-color:var(--bs-primary-text);
--bs-list-group-bg:var(--bs-primary-bg-subtle);
--bs-list-group-border-color:var(--bs-primary-border-subtle)
}
.list-group-item-primary.list-group-item-action:focus, .list-group-item-primary.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle)
}
.list-group-item-primary.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-primary-text);
--bs-list-group-active-border-color:var(--bs-primary-text)
}
.list-group-item-secondary {
--bs-list-group-color:var(--bs-secondary-text);
--bs-list-group-bg:var(--bs-secondary-bg-subtle);
--bs-list-group-border-color:var(--bs-secondary-border-subtle)
}
.list-group-item-secondary.list-group-item-action:focus, .list-group-item-secondary.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle)
}
.list-group-item-secondary.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-secondary-text);
--bs-list-group-active-border-color:var(--bs-secondary-text)
}
.list-group-item-success {
--bs-list-group-color:var(--bs-success-text);
--bs-list-group-bg:var(--bs-success-bg-subtle);
--bs-list-group-border-color:var(--bs-success-border-subtle)
}
.list-group-item-success.list-group-item-action:focus, .list-group-item-success.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-success-border-subtle)
}
.list-group-item-success.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-success-text);
--bs-list-group-active-border-color:var(--bs-success-text)
}
.list-group-item-info {
--bs-list-group-color:var(--bs-info-text);
--bs-list-group-bg:var(--bs-info-bg-subtle);
--bs-list-group-border-color:var(--bs-info-border-subtle)
}
.list-group-item-info.list-group-item-action:focus, .list-group-item-info.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-info-border-subtle)
}
.list-group-item-info.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-info-text);
--bs-list-group-active-border-color:var(--bs-info-text)
}
.list-group-item-warning {
--bs-list-group-color:var(--bs-warning-text);
--bs-list-group-bg:var(--bs-warning-bg-subtle);
--bs-list-group-border-color:var(--bs-warning-border-subtle)
}
.list-group-item-warning.list-group-item-action:focus, .list-group-item-warning.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle)
}
.list-group-item-warning.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-warning-text);
--bs-list-group-active-border-color:var(--bs-warning-text)
}
.list-group-item-danger {
--bs-list-group-color:var(--bs-danger-text);
--bs-list-group-bg:var(--bs-danger-bg-subtle);
--bs-list-group-border-color:var(--bs-danger-border-subtle)
}
.list-group-item-danger.list-group-item-action:focus, .list-group-item-danger.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle)
}
.list-group-item-danger.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-danger-text);
--bs-list-group-active-border-color:var(--bs-danger-text)
}
.list-group-item-light {
--bs-list-group-color:var(--bs-light-text);
--bs-list-group-bg:var(--bs-light-bg-subtle);
--bs-list-group-border-color:var(--bs-light-border-subtle)
}
.list-group-item-light.list-group-item-action:focus, .list-group-item-light.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-light-border-subtle)
}
.list-group-item-light.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-light-text);
--bs-list-group-active-border-color:var(--bs-light-text)
}
.list-group-item-dark {
--bs-list-group-color:var(--bs-dark-text);
--bs-list-group-bg:var(--bs-dark-bg-subtle);
--bs-list-group-border-color:var(--bs-dark-border-subtle)
}
.list-group-item-dark.list-group-item-action:focus, .list-group-item-dark.list-group-item-action:hover {
--bs-list-group-action-hover-color:var(--bs-emphasis-color);
--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle)
}
.list-group-item-dark.list-group-item-action:active {
--bs-list-group-active-color:var(--bs-emphasis-color);
--bs-list-group-active-bg:var(--bs-dark-text);
--bs-list-group-active-border-color:var(--bs-dark-text)
}
.btn-close {
--bs-btn-close-color:#000;
--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");
--bs-btn-close-opacity:0.5;
--bs-btn-close-hover-opacity:0.75;
--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(13, 110, 253, 0.25);
--bs-btn-close-focus-opacity:1;
--bs-btn-close-disabled-opacity:0.25;
--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);
	box-sizing: content-box;
	width: 1em;
	height: 1em;
	padding: .25em .25em;
	color: var(--bs-btn-close-color);
	background: transparent var(--bs-btn-close-bg) center/1em auto no-repeat;
	border: 0;
	border-radius: .375rem;
	opacity: var(--bs-btn-close-opacity)
}
.btn-close:hover {
	color: var(--bs-btn-close-color);
	text-decoration: none;
	opacity: var(--bs-btn-close-hover-opacity)
}
.btn-close:focus {
	outline: 0;
	box-shadow: var(--bs-btn-close-focus-shadow);
	opacity: var(--bs-btn-close-focus-opacity)
}
.btn-close.disabled, .btn-close:disabled {
	pointer-events: none;
	-webkit-user-select: none;
	-moz-user-select: none;
	user-select: none;
	opacity: var(--bs-btn-close-disabled-opacity)
}
.btn-close-white {
	filter: var(--bs-btn-close-white-filter)
}
[data-bs-theme=dark] .btn-close {
	filter: var(--bs-btn-close-white-filter)
}
.toast {
--bs-toast-zindex:1090;
--bs-toast-padding-x:0.75rem;
--bs-toast-padding-y:0.5rem;
--bs-toast-spacing:1.5rem;
--bs-toast-max-width:350px;
--bs-toast-font-size:0.875rem;
--bs-toast-color:;
--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);
--bs-toast-border-width:var(--bs-border-width);
--bs-toast-border-color:var(--bs-border-color-translucent);
--bs-toast-border-radius:var(--bs-border-radius);
--bs-toast-box-shadow:var(--bs-box-shadow);
--bs-toast-header-color:var(--bs-secondary-color);
--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);
--bs-toast-header-border-color:var(--bs-border-color-translucent);
	width: var(--bs-toast-max-width);
	max-width: 100%;
	font-size: var(--bs-toast-font-size);
	color: var(--bs-toast-color);
	pointer-events: auto;
	background-color: var(--bs-toast-bg);
	background-clip: padding-box;
	border: var(--bs-toast-border-width) solid var(--bs-toast-border-color);
	box-shadow: var(--bs-toast-box-shadow);
	border-radius: var(--bs-toast-border-radius)
}
.toast.showing {
	opacity: 0
}
.toast:not(.show) {
	display: none
}
.toast-container {
--bs-toast-zindex:1090;
	position: absolute;
	z-index: var(--bs-toast-zindex);
	width: -webkit-max-content;
	width: -moz-max-content;
	width: max-content;
	max-width: 100%;
	pointer-events: none
}
.toast-container>:not(:last-child) {
	margin-bottom: var(--bs-toast-spacing)
}
.toast-header {
	display: flex;
	align-items: center;
	padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x);
	color: var(--bs-toast-header-color);
	background-color: var(--bs-toast-header-bg);
	background-clip: padding-box;
	border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);
	border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
	border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))
}
.toast-header .btn-close {
margin-right:calc(-.5 * var(--bs-toast-padding-x));
	margin-left: var(--bs-toast-padding-x)
}
.toast-body {
	padding: var(--bs-toast-padding-x);
	word-wrap: break-word
}
.modal {
--bs-modal-zindex:1055;
--bs-modal-width:500px;
--bs-modal-padding:1rem;
--bs-modal-margin:0.5rem;
--bs-modal-color:;
--bs-modal-bg:var(--bs-body-bg);
--bs-modal-border-color:var(--bs-border-color-translucent);
--bs-modal-border-width:var(--bs-border-width);
--bs-modal-border-radius:var(--bs-border-radius-lg);
--bs-modal-box-shadow:0 0.125rem 0.25rem rgba(var(--bs-body-color-rgb), 0.075);
--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));
--bs-modal-header-padding-x:1rem;
--bs-modal-header-padding-y:1rem;
--bs-modal-header-padding:1rem 1rem;
--bs-modal-header-border-color:var(--bs-border-color);
--bs-modal-header-border-width:var(--bs-border-width);
--bs-modal-title-line-height:1.5;
--bs-modal-footer-gap:0.5rem;
--bs-modal-footer-bg:;
--bs-modal-footer-border-color:var(--bs-border-color);
--bs-modal-footer-border-width:var(--bs-border-width);
	position: fixed;
	top: 0;
	left: 0;
	z-index: var(--bs-modal-zindex);
	display: none;
	width: 100%;
	height: 100%;
	overflow-x: hidden;
	overflow-y: auto;
	outline: 0
}
.modal-dialog {
	position: relative;
	width: auto;
	margin: var(--bs-modal-margin);
	pointer-events: none
}
.modal.fade .modal-dialog {
	transition: transform .3s ease-out;
	transform: translate(0, -50px)
}

@media (prefers-reduced-motion:reduce) {
.modal.fade .modal-dialog {
	transition: none
}
}
.modal.show .modal-dialog {
	transform: none
}
.modal.modal-static .modal-dialog {
	transform: scale(1.02)
}
.modal-dialog-scrollable {
height:calc(100% - var(--bs-modal-margin) * 2)
}
.modal-dialog-scrollable .modal-content {
	max-height: 100%;
	overflow: hidden
}
.modal-dialog-scrollable .modal-body {
	overflow-y: auto
}
.modal-dialog-centered {
	display: flex;
	align-items: center;
min-height:calc(100% - var(--bs-modal-margin) * 2)
}
.modal-content {
	position: relative;
	display: flex;
	flex-direction: column;
	width: 100%;
	color: var(--bs-modal-color);
	pointer-events: auto;
	background-color: var(--bs-modal-bg);
	background-clip: padding-box;
	border: var(--bs-modal-border-width) solid var(--bs-modal-border-color);
	border-radius: var(--bs-modal-border-radius);
	outline: 0
}
.modal-backdrop {
--bs-backdrop-zindex:1050;
--bs-backdrop-bg:#000;
--bs-backdrop-opacity:0.5;
	position: fixed;
	top: 0;
	left: 0;
	z-index: var(--bs-backdrop-zindex);
	width: 100vw;
	height: 100vh;
	background-color: var(--bs-backdrop-bg)
}
.modal-backdrop.fade {
	opacity: 0
}
.modal-backdrop.show {
	opacity: var(--bs-backdrop-opacity)
}
.modal-header {
	display: flex;
	flex-shrink: 0;
	align-items: center;
	justify-content: space-between;
	padding: var(--bs-modal-header-padding);
	border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);
	border-top-left-radius: var(--bs-modal-inner-border-radius);
	border-top-right-radius: var(--bs-modal-inner-border-radius)
}
.modal-header .btn-close {
padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);
margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto
}
.modal-title {
	margin-bottom: 0;
	line-height: var(--bs-modal-title-line-height)
}
.modal-body {
	position: relative;
	flex: 1 1 auto;
	padding: var(--bs-modal-padding)
}
.modal-footer {
	display: flex;
	flex-shrink: 0;
	flex-wrap: wrap;
	align-items: center;
	justify-content: flex-end;
padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);
	background-color: var(--bs-modal-footer-bg);
	border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);
	border-bottom-right-radius: var(--bs-modal-inner-border-radius);
	border-bottom-left-radius: var(--bs-modal-inner-border-radius)
}
.modal-footer>* {
margin:calc(var(--bs-modal-footer-gap) * .5)
}

@media (min-width:576px) {
.modal {
--bs-modal-margin:1.75rem;
--bs-modal-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15)
}
.modal-dialog {
	max-width: var(--bs-modal-width);
	margin-right: auto;
	margin-left: auto
}
.modal-sm {
--bs-modal-width:300px
}
}

@media (min-width:992px) {
.modal-lg, .modal-xl {
--bs-modal-width:800px
}
}

@media (min-width:1200px) {
.modal-xl {
--bs-modal-width:1140px
}
}
.modal-fullscreen {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen .modal-footer, .modal-fullscreen .modal-header {
	border-radius: 0
}
.modal-fullscreen .modal-body {
	overflow-y: auto
}

@media (max-width:575.98px) {
.modal-fullscreen-sm-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-sm-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-sm-down .modal-footer, .modal-fullscreen-sm-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-sm-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:767.98px) {
.modal-fullscreen-md-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-md-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-md-down .modal-footer, .modal-fullscreen-md-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-md-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:991.98px) {
.modal-fullscreen-lg-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-lg-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-lg-down .modal-footer, .modal-fullscreen-lg-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-lg-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:1199.98px) {
.modal-fullscreen-xl-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-xl-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-xl-down .modal-footer, .modal-fullscreen-xl-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-xl-down .modal-body {
	overflow-y: auto
}
}

@media (max-width:1399.98px) {
.modal-fullscreen-xxl-down {
	width: 100vw;
	max-width: none;
	height: 100%;
	margin: 0
}
.modal-fullscreen-xxl-down .modal-content {
	height: 100%;
	border: 0;
	border-radius: 0
}
.modal-fullscreen-xxl-down .modal-footer, .modal-fullscreen-xxl-down .modal-header {
	border-radius: 0
}
.modal-fullscreen-xxl-down .modal-body {
	overflow-y: auto
}
}
.tooltip {
--bs-tooltip-zindex:1080;
--bs-tooltip-max-width:200px;
--bs-tooltip-padding-x:0.5rem;
--bs-tooltip-padding-y:0.25rem;
--bs-tooltip-margin:;
--bs-tooltip-font-size:0.875rem;
--bs-tooltip-color:var(--bs-body-bg);
--bs-tooltip-bg:var(--bs-emphasis-color);
--bs-tooltip-border-radius:var(--bs-border-radius);
--bs-tooltip-opacity:0.9;
--bs-tooltip-arrow-width:0.8rem;
--bs-tooltip-arrow-height:0.4rem;
	z-index: var(--bs-tooltip-zindex);
	display: block;
	padding: var(--bs-tooltip-arrow-height);
	margin: var(--bs-tooltip-margin);
	font-family: var(--bs-font-sans-serif);
	font-style: normal;
	font-weight: 400;
	line-height: 1.5;
	text-align: left;
	text-align: start;
	text-decoration: none;
	text-shadow: none;
	text-transform: none;
	letter-spacing: normal;
	word-break: normal;
	white-space: normal;
	word-spacing: normal;
	line-break: auto;
	font-size: var(--bs-tooltip-font-size);
	word-wrap: break-word;
	opacity: 0
}
.tooltip.show {
	opacity: var(--bs-tooltip-opacity)
}
.tooltip .tooltip-arrow {
	display: block;
	width: var(--bs-tooltip-arrow-width);
	height: var(--bs-tooltip-arrow-height)
}
.tooltip .tooltip-arrow::before {
	position: absolute;
	content: "";
	border-color: transparent;
	border-style: solid
}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow, .bs-tooltip-top .tooltip-arrow {
	bottom: 0
}
.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before, .bs-tooltip-top .tooltip-arrow::before {
	top: -1px;
border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;
	border-top-color: var(--bs-tooltip-bg)
}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow, .bs-tooltip-end .tooltip-arrow {
	left: 0;
	width: var(--bs-tooltip-arrow-height);
	height: var(--bs-tooltip-arrow-width)
}
.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before, .bs-tooltip-end .tooltip-arrow::before {
	right: -1px;
border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;
	border-right-color: var(--bs-tooltip-bg)
}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow, .bs-tooltip-bottom .tooltip-arrow {
	top: 0
}
.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before, .bs-tooltip-bottom .tooltip-arrow::before {
	bottom: -1px;
border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);
	border-bottom-color: var(--bs-tooltip-bg)
}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow, .bs-tooltip-start .tooltip-arrow {
	right: 0;
	width: var(--bs-tooltip-arrow-height);
	height: var(--bs-tooltip-arrow-width)
}
.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before, .bs-tooltip-start .tooltip-arrow::before {
	left: -1px;
border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);
	border-left-color: var(--bs-tooltip-bg)
}
.tooltip-inner {
	max-width: var(--bs-tooltip-max-width);
	padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);
	color: var(--bs-tooltip-color);
	text-align: center;
	background-color: var(--bs-tooltip-bg);
	border-radius: var(--bs-tooltip-border-radius)
}
.popover {
--bs-popover-zindex:1070;
--bs-popover-max-width:276px;
--bs-popover-font-size:0.875rem;
--bs-popover-bg:var(--bs-body-bg);
--bs-popover-border-width:var(--bs-border-width);
--bs-popover-border-color:var(--bs-border-color-translucent);
--bs-popover-border-radius:var(--bs-border-radius-lg);
--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));
--bs-popover-box-shadow:0 0.5rem 1rem rgba(var(--bs-body-color-rgb), 0.15);
--bs-popover-header-padding-x:1rem;
--bs-popover-header-padding-y:0.5rem;
--bs-popover-header-font-size:1rem;
--bs-popover-header-color:;
--bs-popover-header-bg:var(--bs-secondary-bg);
--bs-popover-body-padding-x:1rem;
--bs-popover-body-padding-y:1rem;
--bs-popover-body-color:var(--bs-body-color);
--bs-popover-arrow-width:1rem;
--bs-popover-arrow-height:0.5rem;
--bs-popover-arrow-border:var(--bs-popover-border-color);
	z-index: var(--bs-popover-zindex);
	display: block;
	max-width: var(--bs-popover-max-width);
	font-family: var(--bs-font-sans-serif);
	font-style: normal;
	font-weight: 400;
	line-height: 1.5;
	text-align: left;
	text-align: start;
	text-decoration: none;
	text-shadow: none;
	text-transform: none;
	letter-spacing: normal;
	word-break: normal;
	white-space: normal;
	word-spacing: normal;
	line-break: auto;
	font-size: var(--bs-popover-font-size);
	word-wrap: break-word;
	background-color: var(--bs-popover-bg);
	background-clip: padding-box;
	border: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
	border-radius: var(--bs-popover-border-radius)
}
.popover .popover-arrow {
	display: block;
	width: var(--bs-popover-arrow-width);
	height: var(--bs-popover-arrow-height)
}
.popover .popover-arrow::after, .popover .popover-arrow::before {
	position: absolute;
	display: block;
	content: "";
	border-color: transparent;
	border-style: solid;
	border-width: 0
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow, .bs-popover-top>.popover-arrow {
bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after, .bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before, .bs-popover-top>.popover-arrow::after, .bs-popover-top>.popover-arrow::before {
border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before, .bs-popover-top>.popover-arrow::before {
	bottom: 0;
	border-top-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after, .bs-popover-top>.popover-arrow::after {
	bottom: var(--bs-popover-border-width);
	border-top-color: var(--bs-popover-bg)
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow, .bs-popover-end>.popover-arrow {
left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
	width: var(--bs-popover-arrow-height);
	height: var(--bs-popover-arrow-width)
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after, .bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before, .bs-popover-end>.popover-arrow::after, .bs-popover-end>.popover-arrow::before {
border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before, .bs-popover-end>.popover-arrow::before {
	left: 0;
	border-right-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after, .bs-popover-end>.popover-arrow::after {
	left: var(--bs-popover-border-width);
	border-right-color: var(--bs-popover-bg)
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow, .bs-popover-bottom>.popover-arrow {
top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before, .bs-popover-bottom>.popover-arrow::after, .bs-popover-bottom>.popover-arrow::before {
border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before, .bs-popover-bottom>.popover-arrow::before {
	top: 0;
	border-bottom-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after, .bs-popover-bottom>.popover-arrow::after {
	top: var(--bs-popover-border-width);
	border-bottom-color: var(--bs-popover-bg)
}
.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before, .bs-popover-bottom .popover-header::before {
	position: absolute;
	top: 0;
	left: 50%;
	display: block;
	width: var(--bs-popover-arrow-width);
margin-left:calc(-.5 * var(--bs-popover-arrow-width));
	content: "";
	border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow, .bs-popover-start>.popover-arrow {
right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
	width: var(--bs-popover-arrow-height);
	height: var(--bs-popover-arrow-width)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after, .bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before, .bs-popover-start>.popover-arrow::after, .bs-popover-start>.popover-arrow::before {
border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before, .bs-popover-start>.popover-arrow::before {
	right: 0;
	border-left-color: var(--bs-popover-arrow-border)
}
.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after, .bs-popover-start>.popover-arrow::after {
	right: var(--bs-popover-border-width);
	border-left-color: var(--bs-popover-bg)
}
.popover-header {
	padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);
	margin-bottom: 0;
	font-size: var(--bs-popover-header-font-size);
	color: var(--bs-popover-header-color);
	background-color: var(--bs-popover-header-bg);
	border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
	border-top-left-radius: var(--bs-popover-inner-border-radius);
	border-top-right-radius: var(--bs-popover-inner-border-radius)
}
.popover-header:empty {
	display: none
}
.popover-body {
	padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);
	color: var(--bs-popover-body-color)
}
.carousel {
	position: relative
}
.carousel.pointer-event {
	touch-action: pan-y
}
.carousel-inner {
	position: relative;
	width: 100%;
	overflow: hidden
}
.carousel-inner::after {
	display: block;
	clear: both;
	content: ""
}
.carousel-item {
	position: relative;
	display: none;
	float: left;
	width: 100%;
	margin-right: -100%;
	-webkit-backface-visibility: hidden;
	backface-visibility: hidden;
	transition: transform .6s ease-in-out
}

@media (prefers-reduced-motion:reduce) {
.carousel-item {
	transition: none
}
}
.carousel-item-next, .carousel-item-prev, .carousel-item.active {
	display: block
}
.active.carousel-item-end, .carousel-item-next:not(.carousel-item-start) {
	transform: translateX(100%)
}
.active.carousel-item-start, .carousel-item-prev:not(.carousel-item-end) {
	transform: translateX(-100%)
}
.carousel-fade .carousel-item {
	opacity: 0;
	transition-property: opacity;
	transform: none
}
.carousel-fade .carousel-item-next.carousel-item-start, .carousel-fade .carousel-item-prev.carousel-item-end, .carousel-fade .carousel-item.active {
	z-index: 1;
	opacity: 1
}
.carousel-fade .active.carousel-item-end, .carousel-fade .active.carousel-item-start {
	z-index: 0;
	opacity: 0;
	transition: opacity 0s .6s
}

@media (prefers-reduced-motion:reduce) {
.carousel-fade .active.carousel-item-end, .carousel-fade .active.carousel-item-start {
	transition: none
}
}
.carousel-control-next, .carousel-control-prev {
	position: absolute;
	top: 0;
	bottom: 0;
	z-index: 1;
	display: flex;
	align-items: center;
	justify-content: center;
	width: 15%;
	padding: 0;
	color: #fff;
	text-align: center;
	background: 0 0;
	border: 0;
	opacity: .5;
	transition: opacity .15s ease
}

@media (prefers-reduced-motion:reduce) {
.carousel-control-next, .carousel-control-prev {
	transition: none
}
}
.carousel-control-next:focus, .carousel-control-next:hover, .carousel-control-prev:focus, .carousel-control-prev:hover {
	color: #fff;
	text-decoration: none;
	outline: 0;
	opacity: .9
}
.carousel-control-prev {
	left: 0
}
.carousel-control-next {
	right: 0
}
.carousel-control-next-icon, .carousel-control-prev-icon {
	display: inline-block;
	width: 2rem;
	height: 2rem;
	background-repeat: no-repeat;
	background-position: 50%;
	background-size: 100% 100%
}
.carousel-control-prev-icon {
	background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")
}
.carousel-control-next-icon {
	background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")
}
.carousel-indicators {
	position: absolute;
	right: 0;
	bottom: 0;
	left: 0;
	z-index: 2;
	display: flex;
	justify-content: center;
	padding: 0;
	margin-right: 15%;
	margin-bottom: 1rem;
	margin-left: 15%;
	list-style: none
}
.carousel-indicators [data-bs-target] {
	box-sizing: content-box;
	flex: 0 1 auto;
	width: 30px;
	height: 3px;
	padding: 0;
	margin-right: 3px;
	margin-left: 3px;
	text-indent: -999px;
	cursor: pointer;
	background-color: #fff;
	background-clip: padding-box;
	border: 0;
	border-top: 10px solid transparent;
	border-bottom: 10px solid transparent;
	opacity: .5;
	transition: opacity .6s ease
}

@media (prefers-reduced-motion:reduce) {
.carousel-indicators [data-bs-target] {
	transition: none
}
}
.carousel-indicators .active {
	opacity: 1
}
.carousel-caption {
	position: absolute;
	right: 15%;
	bottom: 1.25rem;
	left: 15%;
	padding-top: 1.25rem;
	padding-bottom: 1.25rem;
	color: #fff;
	text-align: center
}
.carousel-dark .carousel-control-next-icon, .carousel-dark .carousel-control-prev-icon {
	filter: invert(1) grayscale(100)
}
.carousel-dark .carousel-indicators [data-bs-target] {
	background-color: #000
}
.carousel-dark .carousel-caption {
	color: #000
}
[data-bs-theme=dark] .carousel .carousel-control-next-icon, [data-bs-theme=dark] .carousel .carousel-control-prev-icon {
	filter: invert(1) grayscale(100)
}
[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target] {
	background-color: #000
}
[data-bs-theme=dark] .carousel .carousel-caption {
	color: #000
}
.spinner-border, .spinner-grow {
	display: inline-block;
	width: var(--bs-spinner-width);
	height: var(--bs-spinner-height);
	vertical-align: var(--bs-spinner-vertical-align);
	border-radius: 50%;
	animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)
}
@keyframes spinner-border {
to {
transform:rotate(360deg)
}
}
.spinner-border {
--bs-spinner-width:2rem;
--bs-spinner-height:2rem;
--bs-spinner-vertical-align:-0.125em;
--bs-spinner-border-width:0.25em;
--bs-spinner-animation-speed:0.75s;
--bs-spinner-animation-name:spinner-border;
	border: var(--bs-spinner-border-width) solid currentcolor;
	border-right-color: transparent
}
.spinner-border-sm {
--bs-spinner-width:1rem;
--bs-spinner-height:1rem;
--bs-spinner-border-width:0.2em
}
@keyframes spinner-grow {
0% {
transform:scale(0)
}
50% {
opacity:1;
transform:none
}
}
.spinner-grow {
--bs-spinner-width:2rem;
--bs-spinner-height:2rem;
--bs-spinner-vertical-align:-0.125em;
--bs-spinner-animation-speed:0.75s;
--bs-spinner-animation-name:spinner-grow;
	background-color: currentcolor;
	opacity: 0
}
.spinner-grow-sm {
--bs-spinner-width:1rem;
--bs-spinner-height:1rem
}

@media (prefers-reduced-motion:reduce) {
.spinner-border, .spinner-grow {
--bs-spinner-animation-speed:1.5s
}
}
.offcanvas, .offcanvas-lg, .offcanvas-md, .offcanvas-sm, .offcanvas-xl, .offcanvas-xxl {
--bs-offcanvas-zindex:1045;
--bs-offcanvas-width:400px;
--bs-offcanvas-height:30vh;
--bs-offcanvas-padding-x:1rem;
--bs-offcanvas-padding-y:1rem;
--bs-offcanvas-color:var(--bs-body-color);
--bs-offcanvas-bg:var(--bs-body-bg);
--bs-offcanvas-border-width:var(--bs-border-width);
--bs-offcanvas-border-color:var(--bs-border-color-translucent);
--bs-offcanvas-box-shadow:0 0.125rem 0.25rem rgba(var(--bs-body-color-rgb), 0.075);
--bs-offcanvas-transition:transform 0.3s ease-in-out;
--bs-offcanvas-title-line-height:1.5
}

@media (max-width:575.98px) {
.offcanvas-sm {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:575.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-sm {
	transition: none
}
}

@media (max-width:575.98px) {
.offcanvas-sm.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(-100%)
}
}

@media (max-width:575.98px) {
.offcanvas-sm.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(100%)
}
}

@media (max-width:575.98px) {
.offcanvas-sm.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
}

@media (max-width:575.98px) {
.offcanvas-sm.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
}

@media (max-width:575.98px) {
.offcanvas-sm.show:not(.hiding), .offcanvas-sm.showing {
	transform: none
}
}

@media (max-width:575.98px) {
.offcanvas-sm.hiding, .offcanvas-sm.show, .offcanvas-sm.showing {
	visibility: visible
}
}

@media (min-width:576px) {
.offcanvas-sm {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-sm .offcanvas-header {
	display: none
}
.offcanvas-sm .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:767.98px) {
.offcanvas-md {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:767.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-md {
	transition: none
}
}

@media (max-width:767.98px) {
.offcanvas-md.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(-100%)
}
}

@media (max-width:767.98px) {
.offcanvas-md.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(100%)
}
}

@media (max-width:767.98px) {
.offcanvas-md.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
}

@media (max-width:767.98px) {
.offcanvas-md.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
}

@media (max-width:767.98px) {
.offcanvas-md.show:not(.hiding), .offcanvas-md.showing {
	transform: none
}
}

@media (max-width:767.98px) {
.offcanvas-md.hiding, .offcanvas-md.show, .offcanvas-md.showing {
	visibility: visible
}
}

@media (min-width:768px) {
.offcanvas-md {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-md .offcanvas-header {
	display: none
}
.offcanvas-md .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:991.98px) {
.offcanvas-lg {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:991.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-lg {
	transition: none
}
}

@media (max-width:991.98px) {
.offcanvas-lg.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(-100%)
}
}

@media (max-width:991.98px) {
.offcanvas-lg.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(100%)
}
}

@media (max-width:991.98px) {
.offcanvas-lg.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
}

@media (max-width:991.98px) {
.offcanvas-lg.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
}

@media (max-width:991.98px) {
.offcanvas-lg.show:not(.hiding), .offcanvas-lg.showing {
	transform: none
}
}

@media (max-width:991.98px) {
.offcanvas-lg.hiding, .offcanvas-lg.show, .offcanvas-lg.showing {
	visibility: visible
}
}

@media (min-width:992px) {
.offcanvas-lg {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-lg .offcanvas-header {
	display: none
}
.offcanvas-lg .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:1199.98px) {
.offcanvas-xl {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:1199.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-xl {
	transition: none
}
}

@media (max-width:1199.98px) {
.offcanvas-xl.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(-100%)
}
}

@media (max-width:1199.98px) {
.offcanvas-xl.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(100%)
}
}

@media (max-width:1199.98px) {
.offcanvas-xl.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
}

@media (max-width:1199.98px) {
.offcanvas-xl.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
}

@media (max-width:1199.98px) {
.offcanvas-xl.show:not(.hiding), .offcanvas-xl.showing {
	transform: none
}
}

@media (max-width:1199.98px) {
.offcanvas-xl.hiding, .offcanvas-xl.show, .offcanvas-xl.showing {
	visibility: visible
}
}

@media (min-width:1200px) {
.offcanvas-xl {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-xl .offcanvas-header {
	display: none
}
.offcanvas-xl .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}
}

@media (max-width:1399.98px) and (prefers-reduced-motion:reduce) {
.offcanvas-xxl {
	transition: none
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(-100%)
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(100%)
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl.show:not(.hiding), .offcanvas-xxl.showing {
	transform: none
}
}

@media (max-width:1399.98px) {
.offcanvas-xxl.hiding, .offcanvas-xxl.show, .offcanvas-xxl.showing {
	visibility: visible
}
}

@media (min-width:1400px) {
.offcanvas-xxl {
--bs-offcanvas-height:auto;
--bs-offcanvas-border-width:0;
	background-color: transparent!important
}
.offcanvas-xxl .offcanvas-header {
	display: none
}
.offcanvas-xxl .offcanvas-body {
	display: flex;
	flex-grow: 0;
	padding: 0;
	overflow-y: visible;
	background-color: transparent!important
}
}
.offcanvas {
	position: fixed;
	bottom: 0;
	z-index: var(--bs-offcanvas-zindex);
	display: flex;
	flex-direction: column;
	max-width: 100%;
	color: var(--bs-offcanvas-color);
	visibility: hidden;
	background-color: var(--bs-offcanvas-bg);
	background-clip: padding-box;
	outline: 0;
	transition: var(--bs-offcanvas-transition)
}

@media (prefers-reduced-motion:reduce) {
.offcanvas {
	transition: none
}
}
.offcanvas.offcanvas-start {
	top: 0;
	left: 0;
	width: var(--bs-offcanvas-width);
	border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(-100%)
}
.offcanvas.offcanvas-end {
	top: 0;
	right: 0;
	width: var(--bs-offcanvas-width);
	border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateX(100%)
}
.offcanvas.offcanvas-top {
	top: 0;
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(-100%)
}
.offcanvas.offcanvas-bottom {
	right: 0;
	left: 0;
	height: var(--bs-offcanvas-height);
	max-height: 100%;
	border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
	transform: translateY(100%)
}
.offcanvas.show:not(.hiding), .offcanvas.showing {
	transform: none
}
.offcanvas.hiding, .offcanvas.show, .offcanvas.showing {
	visibility: visible
}
.offcanvas-backdrop {
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1040;
	width: 100vw;
	height: 100vh;
	background-color: #000
}
.offcanvas-backdrop.fade {
	opacity: 0
}
.offcanvas-backdrop.show {
	opacity: .5
}
.offcanvas-header {
	display: flex;
	align-items: center;
	justify-content: space-between;
	padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)
}
.offcanvas-header .btn-close {
padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);
margin-top:calc(-.5 * var(--bs-offcanvas-padding-y));
margin-right:calc(-.5 * var(--bs-offcanvas-padding-x));
margin-bottom:calc(-.5 * var(--bs-offcanvas-padding-y))
}
.offcanvas-title {
	margin-bottom: 0;
	line-height: var(--bs-offcanvas-title-line-height)
}
.offcanvas-body {
	flex-grow: 1;
	padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
	overflow-y: auto
}
.placeholder {
	display: inline-block;
	min-height: 1em;
	vertical-align: middle;
	cursor: wait;
	background-color: currentcolor;
	opacity: .5
}
.placeholder.btn::before {
	display: inline-block;
	content: ""
}
.placeholder-xs {
	min-height: .6em
}
.placeholder-sm {
	min-height: .8em
}
.placeholder-lg {
	min-height: 1.2em
}
.placeholder-glow .placeholder {
	animation: placeholder-glow 2s ease-in-out infinite
}
@keyframes placeholder-glow {
50% {
opacity:.2
}
}
.placeholder-wave {
	-webkit-mask-image: linear-gradient(130deg, #000 55%, rgba(0,0,0,0.8) 75%, #000 95%);
	mask-image: linear-gradient(130deg, #000 55%, rgba(0,0,0,0.8) 75%, #000 95%);
	-webkit-mask-size: 200% 100%;
	mask-size: 200% 100%;
	animation: placeholder-wave 2s linear infinite
}
@keyframes placeholder-wave {
100% {
-webkit-mask-position:-200% 0%;
mask-position:-200% 0%
}
}
.clearfix::after {
	display: block;
	clear: both;
	content: ""
}
.text-bg-primary {
	color: #fff!important;
	background-color: RGBA(13, 110, 253, var(--bs-bg-opacity, 1))!important
}
.text-bg-secondary {
	color: #fff!important;
	background-color: RGBA(108, 117, 125, var(--bs-bg-opacity, 1))!important
}
.text-bg-success {
	color: #fff!important;
	background-color: RGBA(25, 135, 84, var(--bs-bg-opacity, 1))!important
}
.text-bg-info {
	color: #000!important;
	background-color: RGBA(13, 202, 240, var(--bs-bg-opacity, 1))!important
}
.text-bg-warning {
	color: #000!important;
	background-color: RGBA(255, 193, 7, var(--bs-bg-opacity, 1))!important
}
.text-bg-danger {
	color: #fff!important;
	background-color: RGBA(220, 53, 69, var(--bs-bg-opacity, 1))!important
}
.text-bg-light {
	color: #000!important;
	background-color: RGBA(248, 249, 250, var(--bs-bg-opacity, 1))!important
}
.text-bg-dark {
	color: #fff!important;
	background-color: RGBA(33, 37, 41, var(--bs-bg-opacity, 1))!important
}
.link-primary {
	color: #0d6efd!important
}
.link-primary:focus, .link-primary:hover {
	color: #0a58ca!important
}
.link-secondary {
	color: #6c757d!important
}
.link-secondary:focus, .link-secondary:hover {
	color: #565e64!important
}
.link-success {
	color: #198754!important
}
.link-success:focus, .link-success:hover {
	color: #146c43!important
}
.link-info {
	color: #0dcaf0!important
}
.link-info:focus, .link-info:hover {
	color: #3dd5f3!important
}
.link-warning {
	color: #ffc107!important
}
.link-warning:focus, .link-warning:hover {
	color: #ffcd39!important
}
.link-danger {
	color: #dc3545!important
}
.link-danger:focus, .link-danger:hover {
	color: #b02a37!important
}
.link-light {
	color: #f8f9fa!important
}
.link-light:focus, .link-light:hover {
	color: #f9fafb!important
}
.link-dark {
	color: #212529!important
}
.link-dark:focus, .link-dark:hover {
	color: #1a1e21!important
}
.ratio {
	position: relative;
	width: 100%
}
.ratio::before {
	display: block;
	padding-top: var(--bs-aspect-ratio);
	content: ""
}
.ratio>* {
	position: absolute;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%
}
.ratio-1x1 {
--bs-aspect-ratio:100%
}
.ratio-4x3 {
--bs-aspect-ratio:75%
}
.ratio-16x9 {
--bs-aspect-ratio:56.25%
}
.ratio-21x9 {
--bs-aspect-ratio:42.8571428571%
}
.fixed-top {
	position: fixed;
	top: 0;
	right: 0;
	left: 0;
	z-index: 1030
}
.fixed-bottom {
	position: fixed;
	right: 0;
	bottom: 0;
	left: 0;
	z-index: 1030
}
.sticky-top {
	position: -webkit-sticky;
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-bottom {
	position: -webkit-sticky;
	position: sticky;
	bottom: 0;
	z-index: 1020
}

@media (min-width:576px) {
.sticky-sm-top {
	position: -webkit-sticky;
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-sm-bottom {
	position: -webkit-sticky;
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:768px) {
.sticky-md-top {
	position: -webkit-sticky;
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-md-bottom {
	position: -webkit-sticky;
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:992px) {
.sticky-lg-top {
	position: -webkit-sticky;
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-lg-bottom {
	position: -webkit-sticky;
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:1200px) {
.sticky-xl-top {
	position: -webkit-sticky;
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-xl-bottom {
	position: -webkit-sticky;
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}

@media (min-width:1400px) {
.sticky-xxl-top {
	position: -webkit-sticky;
	position: sticky;
	top: 0;
	z-index: 1020
}
.sticky-xxl-bottom {
	position: -webkit-sticky;
	position: sticky;
	bottom: 0;
	z-index: 1020
}
}
.hstack {
	display: flex;
	flex-direction: row;
	align-items: center;
	align-self: stretch
}
.vstack {
	display: flex;
	flex: 1 1 auto;
	flex-direction: column;
	align-self: stretch
}
.visually-hidden, .visually-hidden-focusable:not(:focus):not(:focus-within) {
	position: absolute!important;
	width: 1px!important;
	height: 1px!important;
	padding: 0!important;
	margin: -1px!important;
	overflow: hidden!important;
	clip: rect(0,0,0,0)!important;
	white-space: nowrap!important;
	border: 0!important
}
.stretched-link::after {
	position: absolute;
	top: 0;
	right: 0;
	bottom: 0;
	left: 0;
	z-index: 1;
	content: ""
}
.text-truncate {
	overflow: hidden;
	text-overflow: ellipsis;
	white-space: nowrap
}
.vr {
	display: inline-block;
	align-self: stretch;
	width: 1px;
	min-height: 1em;
	background-color: currentcolor;
	opacity: .25
}
.align-baseline {
	vertical-align: baseline!important
}
.align-top {
	vertical-align: top!important
}
.align-middle {
	vertical-align: middle!important
}
.align-bottom {
	vertical-align: bottom!important
}
.align-text-bottom {
	vertical-align: text-bottom!important
}
.align-text-top {
	vertical-align: text-top!important
}
.float-start {
	float: left!important
}
.float-end {
	float: right!important
}
.float-none {
	float: none!important
}
.object-fit-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.opacity-0 {
	opacity: 0!important
}
.opacity-25 {
	opacity: .25!important
}
.opacity-50 {
	opacity: .5!important
}
.opacity-75 {
	opacity: .75!important
}
.opacity-100 {
	opacity: 1!important
}
.overflow-auto {
	overflow: auto!important
}
.overflow-hidden {
	overflow: hidden!important
}
.overflow-visible {
	overflow: visible!important
}
.overflow-scroll {
	overflow: scroll!important
}
.overflow-x-auto {
	overflow-x: auto!important
}
.overflow-x-hidden {
	overflow-x: hidden!important
}
.overflow-x-visible {
	overflow-x: visible!important
}
.overflow-x-scroll {
	overflow-x: scroll!important
}
.overflow-y-auto {
	overflow-y: auto!important
}
.overflow-y-hidden {
	overflow-y: hidden!important
}
.overflow-y-visible {
	overflow-y: visible!important
}
.overflow-y-scroll {
	overflow-y: scroll!important
}
.d-inline {
	display: inline!important
}
.d-inline-block {
	display: inline-block!important
}
.d-block {
	display: block!important
}
.d-grid {
	display: grid!important
}
.d-table {
	display: table!important
}
.d-table-row {
	display: table-row!important
}
.d-table-cell {
	display: table-cell!important
}
.d-flex {
	display: flex!important
}
.d-inline-flex {
	display: inline-flex!important
}
.d-none {
	display: none!important
}
.shadow {
	box-shadow: 0 .5rem 1rem rgba(var(--bs-body-color-rgb), .15)!important
}
.shadow-sm {
	box-shadow: 0 .125rem .25rem rgba(var(--bs-body-color-rgb), .075)!important
}
.shadow-lg {
	box-shadow: 0 1rem 3rem rgba(var(--bs-body-color-rgb), .175)!important
}
.shadow-none {
	box-shadow: none!important
}
.position-static {
	position: static!important
}
.position-relative {
	position: relative!important
}
.position-absolute {
	position: absolute!important
}
.position-fixed {
	position: fixed!important
}
.position-sticky {
	position: -webkit-sticky!important;
	position: sticky!important
}
.top-0 {
	top: 0!important
}
.top-50 {
	top: 50%!important
}
.top-100 {
	top: 100%!important
}
.bottom-0 {
	bottom: 0!important
}
.bottom-50 {
	bottom: 50%!important
}
.bottom-100 {
	bottom: 100%!important
}
.start-0 {
	left: 0!important
}
.start-50 {
	left: 50%!important
}
.start-100 {
	left: 100%!important
}
.end-0 {
	right: 0!important
}
.end-50 {
	right: 50%!important
}
.end-100 {
	right: 100%!important
}
.translate-middle {
	transform: translate(-50%, -50%)!important
}
.translate-middle-x {
	transform: translateX(-50%)!important
}
.translate-middle-y {
	transform: translateY(-50%)!important
}
.border {
	border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-0 {
	border: 0!important
}
.border-top {
	border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-top-0 {
	border-top: 0!important
}
.border-end {
	border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-end-0 {
	border-right: 0!important
}
.border-bottom {
	border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-bottom-0 {
	border-bottom: 0!important
}
.border-start {
	border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important
}
.border-start-0 {
	border-left: 0!important
}
.border-primary {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity))!important
}
.border-secondary {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-secondary-rgb), var(--bs-border-opacity))!important
}
.border-success {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-success-rgb), var(--bs-border-opacity))!important
}
.border-info {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-info-rgb), var(--bs-border-opacity))!important
}
.border-warning {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-warning-rgb), var(--bs-border-opacity))!important
}
.border-danger {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-danger-rgb), var(--bs-border-opacity))!important
}
.border-light {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-light-rgb), var(--bs-border-opacity))!important
}
.border-dark {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-dark-rgb), var(--bs-border-opacity))!important
}
.border-white {
--bs-border-opacity:1;
	border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity))!important
}
.border-primary-subtle {
	border-color: var(--bs-primary-border-subtle)!important
}
.border-secondary-subtle {
	border-color: var(--bs-secondary-border-subtle)!important
}
.border-success-subtle {
	border-color: var(--bs-success-border-subtle)!important
}
.border-info-subtle {
	border-color: var(--bs-info-border-subtle)!important
}
.border-warning-subtle {
	border-color: var(--bs-warning-border-subtle)!important
}
.border-danger-subtle {
	border-color: var(--bs-danger-border-subtle)!important
}
.border-light-subtle {
	border-color: var(--bs-light-border-subtle)!important
}
.border-dark-subtle {
	border-color: var(--bs-dark-border-subtle)!important
}
.border-1 {
--bs-border-width:1px
}
.border-2 {
--bs-border-width:2px
}
.border-3 {
--bs-border-width:3px
}
.border-4 {
--bs-border-width:4px
}
.border-5 {
--bs-border-width:5px
}
.border-opacity-10 {
--bs-border-opacity:0.1
}
.border-opacity-25 {
--bs-border-opacity:0.25
}
.border-opacity-50 {
--bs-border-opacity:0.5
}
.border-opacity-75 {
--bs-border-opacity:0.75
}
.border-opacity-100 {
--bs-border-opacity:1
}
.w-25 {
	width: 25%!important
}
.w-50 {
	width: 50%!important
}
.w-75 {
	width: 75%!important
}
.w-100 {
	width: 100%!important
}
.w-auto {
	width: auto!important
}
.mw-100 {
	max-width: 100%!important
}
.vw-100 {
	width: 100vw!important
}
.min-vw-100 {
	min-width: 100vw!important
}
.h-25 {
	height: 25%!important
}
.h-50 {
	height: 50%!important
}
.h-75 {
	height: 75%!important
}
.h-100 {
	height: 100%!important
}
.h-auto {
	height: auto!important
}
.mh-100 {
	max-height: 100%!important
}
.vh-100 {
	height: 100vh!important
}
.min-vh-100 {
	min-height: 100vh!important
}
.flex-fill {
	flex: 1 1 auto!important
}
.flex-row {
	flex-direction: row!important
}
.flex-column {
	flex-direction: column!important
}
.flex-row-reverse {
	flex-direction: row-reverse!important
}
.flex-column-reverse {
	flex-direction: column-reverse!important
}
.flex-grow-0 {
	flex-grow: 0!important
}
.flex-grow-1 {
	flex-grow: 1!important
}
.flex-shrink-0 {
	flex-shrink: 0!important
}
.flex-shrink-1 {
	flex-shrink: 1!important
}
.flex-wrap {
	flex-wrap: wrap!important
}
.flex-nowrap {
	flex-wrap: nowrap!important
}
.flex-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-start {
	justify-content: flex-start!important
}
.justify-content-end {
	justify-content: flex-end!important
}
.justify-content-center {
	justify-content: center!important
}
.justify-content-between {
	justify-content: space-between!important
}
.justify-content-around {
	justify-content: space-around!important
}
.justify-content-evenly {
	justify-content: space-evenly!important
}
.align-items-start {
	align-items: flex-start!important
}
.align-items-end {
	align-items: flex-end!important
}
.align-items-center {
	align-items: center!important
}
.align-items-baseline {
	align-items: baseline!important
}
.align-items-stretch {
	align-items: stretch!important
}
.align-content-start {
	align-content: flex-start!important
}
.align-content-end {
	align-content: flex-end!important
}
.align-content-center {
	align-content: center!important
}
.align-content-between {
	align-content: space-between!important
}
.align-content-around {
	align-content: space-around!important
}
.align-content-stretch {
	align-content: stretch!important
}
.align-self-auto {
	align-self: auto!important
}
.align-self-start {
	align-self: flex-start!important
}
.align-self-end {
	align-self: flex-end!important
}
.align-self-center {
	align-self: center!important
}
.align-self-baseline {
	align-self: baseline!important
}
.align-self-stretch {
	align-self: stretch!important
}
.order-first {
	order: -1!important
}
.order-0 {
	order: 0!important
}
.order-1 {
	order: 1!important
}
.order-2 {
	order: 2!important
}
.order-3 {
	order: 3!important
}
.order-4 {
	order: 4!important
}
.order-5 {
	order: 5!important
}
.order-last {
	order: 6!important
}
.m-0 {
	margin: 0!important
}
.m-1 {
	margin: .25rem!important
}
.m-2 {
	margin: .5rem!important
}
.m-3 {
	margin: 1rem!important
}
.m-4 {
	margin: 1.5rem!important
}
.m-5 {
	margin: 3rem!important
}
.m-auto {
	margin: auto!important
}
.mx-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-0 {
	margin-top: 0!important
}
.mt-1 {
	margin-top: .25rem!important
}
.mt-2 {
	margin-top: .5rem!important
}
.mt-3 {
	margin-top: 1rem!important
}
.mt-4 {
	margin-top: 1.5rem!important
}
.mt-5 {
	margin-top: 3rem!important
}
.mt-auto {
	margin-top: auto!important
}
.me-0 {
	margin-right: 0!important
}
.me-1 {
	margin-right: .25rem!important
}
.me-2 {
	margin-right: .5rem!important
}
.me-3 {
	margin-right: 1rem!important
}
.me-4 {
	margin-right: 1.5rem!important
}
.me-5 {
	margin-right: 3rem!important
}
.me-auto {
	margin-right: auto!important
}
.mb-0 {
	margin-bottom: 0!important
}
.mb-1 {
	margin-bottom: .25rem!important
}
.mb-2 {
	margin-bottom: .5rem!important
}
.mb-3 {
	margin-bottom: 1rem!important
}
.mb-4 {
	margin-bottom: 1.5rem!important
}
.mb-5 {
	margin-bottom: 3rem!important
}
.mb-auto {
	margin-bottom: auto!important
}
.ms-0 {
	margin-left: 0!important
}
.ms-1 {
	margin-left: .25rem!important
}
.ms-2 {
	margin-left: .5rem!important
}
.ms-3 {
	margin-left: 1rem!important
}
.ms-4 {
	margin-left: 1.5rem!important
}
.ms-5 {
	margin-left: 3rem!important
}
.ms-auto {
	margin-left: auto!important
}
.p-0 {
	padding: 0!important
}
.p-1 {
	padding: .25rem!important
}
.p-2 {
	padding: .5rem!important
}
.p-3 {
	padding: 1rem!important
}
.p-4 {
	padding: 1.5rem!important
}
.p-5 {
	padding: 3rem!important
}
.px-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-0 {
	padding-top: 0!important
}
.pt-1 {
	padding-top: .25rem!important
}
.pt-2 {
	padding-top: .5rem!important
}
.pt-3 {
	padding-top: 1rem!important
}
.pt-4 {
	padding-top: 1.5rem!important
}
.pt-5 {
	padding-top: 3rem!important
}
.pe-0 {
	padding-right: 0!important
}
.pe-1 {
	padding-right: .25rem!important
}
.pe-2 {
	padding-right: .5rem!important
}
.pe-3 {
	padding-right: 1rem!important
}
.pe-4 {
	padding-right: 1.5rem!important
}
.pe-5 {
	padding-right: 3rem!important
}
.pb-0 {
	padding-bottom: 0!important
}
.pb-1 {
	padding-bottom: .25rem!important
}
.pb-2 {
	padding-bottom: .5rem!important
}
.pb-3 {
	padding-bottom: 1rem!important
}
.pb-4 {
	padding-bottom: 1.5rem!important
}
.pb-5 {
	padding-bottom: 3rem!important
}
.ps-0 {
	padding-left: 0!important
}
.ps-1 {
	padding-left: .25rem!important
}
.ps-2 {
	padding-left: .5rem!important
}
.ps-3 {
	padding-left: 1rem!important
}
.ps-4 {
	padding-left: 1.5rem!important
}
.ps-5 {
	padding-left: 3rem!important
}
.gap-0 {
	gap: 0!important
}
.gap-1 {
	gap: .25rem!important
}
.gap-2 {
	gap: .5rem!important
}
.gap-3 {
	gap: 1rem!important
}
.gap-4 {
	gap: 1.5rem!important
}
.gap-5 {
	gap: 3rem!important
}
.row-gap-0 {
	row-gap: 0!important
}
.row-gap-1 {
	row-gap: .25rem!important
}
.row-gap-2 {
	row-gap: .5rem!important
}
.row-gap-3 {
	row-gap: 1rem!important
}
.row-gap-4 {
	row-gap: 1.5rem!important
}
.row-gap-5 {
	row-gap: 3rem!important
}
.column-gap-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-1 {
	-moz-column-gap: 0.25rem!important;
	column-gap: .25rem!important
}
.column-gap-2 {
	-moz-column-gap: 0.5rem!important;
	column-gap: .5rem!important
}
.column-gap-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.font-monospace {
	font-family: var(--bs-font-monospace)!important
}
.fs-1 {
	font-size: calc(1.375rem + 1.5vw)!important
}
.fs-2 {
	font-size: calc(1.325rem + .9vw)!important
}
.fs-3 {
	font-size: calc(1.3rem + .6vw)!important
}
.fs-4 {
	font-size: calc(1.275rem + .3vw)!important
}
.fs-5 {
	font-size: 1.25rem!important
}
.fs-6 {
	font-size: 1rem!important
}
.fst-italic {
	font-style: italic!important
}
.fst-normal {
	font-style: normal!important
}
.fw-lighter {
	font-weight: lighter!important
}
.fw-light {
	font-weight: 300!important
}
.fw-normal {
	font-weight: 400!important
}
.fw-medium {
	font-weight: 500!important
}
.fw-semibold {
	font-weight: 600!important
}
.fw-bold {
	font-weight: 700!important
}
.fw-bolder {
	font-weight: bolder!important
}
.lh-1 {
	line-height: 1!important
}
.lh-sm {
	line-height: 1.25!important
}
.lh-base {
	line-height: 1.5!important
}
.lh-lg {
	line-height: 2!important
}
.text-start {
	text-align: left!important
}
.text-end {
	text-align: right!important
}
.text-center {
	text-align: center!important
}
.text-decoration-none {
	text-decoration: none!important
}
.text-decoration-underline {
	text-decoration: underline!important
}
.text-decoration-line-through {
	text-decoration: line-through!important
}
.text-lowercase {
	text-transform: lowercase!important
}
.text-uppercase {
	text-transform: uppercase!important
}
.text-capitalize {
	text-transform: capitalize!important
}
.text-wrap {
	white-space: normal!important
}
.text-nowrap {
	white-space: nowrap!important
}
.text-break {
	word-wrap: break-word!important;
	word-break: break-word!important
}
.text-primary {
--bs-text-opacity:1;
	color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity))!important
}
.text-secondary {
--bs-text-opacity:1;
	color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity))!important
}
.text-success {
--bs-text-opacity:1;
	color: rgba(var(--bs-success-rgb), var(--bs-text-opacity))!important
}
.text-info {
--bs-text-opacity:1;
	color: rgba(var(--bs-info-rgb), var(--bs-text-opacity))!important
}
.text-warning {
--bs-text-opacity:1;
	color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity))!important
}
.text-danger {
--bs-text-opacity:1;
	color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity))!important
}
.text-light {
--bs-text-opacity:1;
	color: rgba(var(--bs-light-rgb), var(--bs-text-opacity))!important
}
.text-dark {
--bs-text-opacity:1;
	color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity))!important
}
.text-black {
--bs-text-opacity:1;
	color: rgba(var(--bs-black-rgb), var(--bs-text-opacity))!important
}
.text-white {
--bs-text-opacity:1;
	color: rgba(var(--bs-white-rgb), var(--bs-text-opacity))!important
}
.text-body {
--bs-text-opacity:1;
	color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity))!important
}
.text-muted {
--bs-text-opacity:1;
	color: var(--bs-secondary-color)!important
}
.text-black-50 {
--bs-text-opacity:1;
	color: rgba(0,0,0,.5)!important
}
.text-white-50 {
--bs-text-opacity:1;
	color: rgba(255,255,255,.5)!important
}
.text-body-secondary {
--bs-text-opacity:1;
	color: var(--bs-secondary-color)!important
}
.text-body-tertiary {
--bs-text-opacity:1;
	color: var(--bs-tertiary-color)!important
}
.text-body-emphasis {
--bs-text-opacity:1;
	color: var(--bs-emphasis-color)!important
}
.text-reset {
--bs-text-opacity:1;
	color: inherit!important
}
.text-opacity-25 {
--bs-text-opacity:0.25
}
.text-opacity-50 {
--bs-text-opacity:0.5
}
.text-opacity-75 {
--bs-text-opacity:0.75
}
.text-opacity-100 {
--bs-text-opacity:1
}
.text-primary-emphasis {
	color: var(--bs-primary-text)!important
}
.text-secondary-emphasis {
	color: var(--bs-secondary-text)!important
}
.text-success-emphasis {
	color: var(--bs-success-text)!important
}
.text-info-emphasis {
	color: var(--bs-info-text)!important
}
.text-warning-emphasis {
	color: var(--bs-warning-text)!important
}
.text-danger-emphasis {
	color: var(--bs-danger-text)!important
}
.text-light-emphasis {
	color: var(--bs-light-text)!important
}
.text-dark-emphasis {
	color: var(--bs-dark-text)!important
}
.bg-primary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity))!important
}
.bg-secondary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity))!important
}
.bg-success {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity))!important
}
.bg-info {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity))!important
}
.bg-warning {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity))!important
}
.bg-danger {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity))!important
}
.bg-light {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity))!important
}
.bg-dark {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity))!important
}
.bg-black {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity))!important
}
.bg-white {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity))!important
}
.bg-body {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity))!important
}
.bg-transparent {
--bs-bg-opacity:1;
	background-color: transparent!important
}
.bg-body-secondary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity))!important
}
.bg-body-tertiary {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity))!important
}
.bg-body-emphasis {
--bs-bg-opacity:1;
	background-color: rgba(var(--bs-emphasis-bg-rgb), var(--bs-bg-opacity))!important
}
.bg-opacity-10 {
--bs-bg-opacity:0.1
}
.bg-opacity-25 {
--bs-bg-opacity:0.25
}
.bg-opacity-50 {
--bs-bg-opacity:0.5
}
.bg-opacity-75 {
--bs-bg-opacity:0.75
}
.bg-opacity-100 {
--bs-bg-opacity:1
}
.bg-primary-subtle {
	background-color: var(--bs-primary-bg-subtle)!important
}
.bg-secondary-subtle {
	background-color: var(--bs-secondary-bg-subtle)!important
}
.bg-success-subtle {
	background-color: var(--bs-success-bg-subtle)!important
}
.bg-info-subtle {
	background-color: var(--bs-info-bg-subtle)!important
}
.bg-warning-subtle {
	background-color: var(--bs-warning-bg-subtle)!important
}
.bg-danger-subtle {
	background-color: var(--bs-danger-bg-subtle)!important
}
.bg-light-subtle {
	background-color: var(--bs-light-bg-subtle)!important
}
.bg-dark-subtle {
	background-color: var(--bs-dark-bg-subtle)!important
}
.bg-gradient {
	background-image: var(--bs-gradient)!important
}
.user-select-all {
	-webkit-user-select: all!important;
	-moz-user-select: all!important;
	user-select: all!important
}
.user-select-auto {
	-webkit-user-select: auto!important;
	-moz-user-select: auto!important;
	user-select: auto!important
}
.user-select-none {
	-webkit-user-select: none!important;
	-moz-user-select: none!important;
	user-select: none!important
}
.pe-none {
	pointer-events: none!important
}
.pe-auto {
	pointer-events: auto!important
}
.rounded {
	border-radius: var(--bs-border-radius)!important
}
.rounded-0 {
	border-radius: 0!important
}
.rounded-1 {
	border-radius: var(--bs-border-radius-sm)!important
}
.rounded-2 {
	border-radius: var(--bs-border-radius)!important
}
.rounded-3 {
	border-radius: var(--bs-border-radius-lg)!important
}
.rounded-4 {
	border-radius: var(--bs-border-radius-xl)!important
}
.rounded-5 {
	border-radius: var(--bs-border-radius-2xl)!important
}
.rounded-circle {
	border-radius: 50%!important
}
.rounded-pill {
	border-radius: var(--bs-border-radius-pill)!important
}
.rounded-top {
	border-top-left-radius: var(--bs-border-radius)!important;
	border-top-right-radius: var(--bs-border-radius)!important
}
.rounded-top-0 {
	border-top-left-radius: 0!important;
	border-top-right-radius: 0!important
}
.rounded-top-1 {
	border-top-left-radius: var(--bs-border-radius-sm)!important;
	border-top-right-radius: var(--bs-border-radius-sm)!important
}
.rounded-top-2 {
	border-top-left-radius: var(--bs-border-radius)!important;
	border-top-right-radius: var(--bs-border-radius)!important
}
.rounded-top-3 {
	border-top-left-radius: var(--bs-border-radius-lg)!important;
	border-top-right-radius: var(--bs-border-radius-lg)!important
}
.rounded-top-4 {
	border-top-left-radius: var(--bs-border-radius-xl)!important;
	border-top-right-radius: var(--bs-border-radius-xl)!important
}
.rounded-top-5 {
	border-top-left-radius: var(--bs-border-radius-2xl)!important;
	border-top-right-radius: var(--bs-border-radius-2xl)!important
}
.rounded-top-circle {
	border-top-left-radius: 50%!important;
	border-top-right-radius: 50%!important
}
.rounded-top-pill {
	border-top-left-radius: var(--bs-border-radius-pill)!important;
	border-top-right-radius: var(--bs-border-radius-pill)!important
}
.rounded-end {
	border-top-right-radius: var(--bs-border-radius)!important;
	border-bottom-right-radius: var(--bs-border-radius)!important
}
.rounded-end-0 {
	border-top-right-radius: 0!important;
	border-bottom-right-radius: 0!important
}
.rounded-end-1 {
	border-top-right-radius: var(--bs-border-radius-sm)!important;
	border-bottom-right-radius: var(--bs-border-radius-sm)!important
}
.rounded-end-2 {
	border-top-right-radius: var(--bs-border-radius)!important;
	border-bottom-right-radius: var(--bs-border-radius)!important
}
.rounded-end-3 {
	border-top-right-radius: var(--bs-border-radius-lg)!important;
	border-bottom-right-radius: var(--bs-border-radius-lg)!important
}
.rounded-end-4 {
	border-top-right-radius: var(--bs-border-radius-xl)!important;
	border-bottom-right-radius: var(--bs-border-radius-xl)!important
}
.rounded-end-5 {
	border-top-right-radius: var(--bs-border-radius-2xl)!important;
	border-bottom-right-radius: var(--bs-border-radius-2xl)!important
}
.rounded-end-circle {
	border-top-right-radius: 50%!important;
	border-bottom-right-radius: 50%!important
}
.rounded-end-pill {
	border-top-right-radius: var(--bs-border-radius-pill)!important;
	border-bottom-right-radius: var(--bs-border-radius-pill)!important
}
.rounded-bottom {
	border-bottom-right-radius: var(--bs-border-radius)!important;
	border-bottom-left-radius: var(--bs-border-radius)!important
}
.rounded-bottom-0 {
	border-bottom-right-radius: 0!important;
	border-bottom-left-radius: 0!important
}
.rounded-bottom-1 {
	border-bottom-right-radius: var(--bs-border-radius-sm)!important;
	border-bottom-left-radius: var(--bs-border-radius-sm)!important
}
.rounded-bottom-2 {
	border-bottom-right-radius: var(--bs-border-radius)!important;
	border-bottom-left-radius: var(--bs-border-radius)!important
}
.rounded-bottom-3 {
	border-bottom-right-radius: var(--bs-border-radius-lg)!important;
	border-bottom-left-radius: var(--bs-border-radius-lg)!important
}
.rounded-bottom-4 {
	border-bottom-right-radius: var(--bs-border-radius-xl)!important;
	border-bottom-left-radius: var(--bs-border-radius-xl)!important
}
.rounded-bottom-5 {
	border-bottom-right-radius: var(--bs-border-radius-2xl)!important;
	border-bottom-left-radius: var(--bs-border-radius-2xl)!important
}
.rounded-bottom-circle {
	border-bottom-right-radius: 50%!important;
	border-bottom-left-radius: 50%!important
}
.rounded-bottom-pill {
	border-bottom-right-radius: var(--bs-border-radius-pill)!important;
	border-bottom-left-radius: var(--bs-border-radius-pill)!important
}
.rounded-start {
	border-bottom-left-radius: var(--bs-border-radius)!important;
	border-top-left-radius: var(--bs-border-radius)!important
}
.rounded-start-0 {
	border-bottom-left-radius: 0!important;
	border-top-left-radius: 0!important
}
.rounded-start-1 {
	border-bottom-left-radius: var(--bs-border-radius-sm)!important;
	border-top-left-radius: var(--bs-border-radius-sm)!important
}
.rounded-start-2 {
	border-bottom-left-radius: var(--bs-border-radius)!important;
	border-top-left-radius: var(--bs-border-radius)!important
}
.rounded-start-3 {
	border-bottom-left-radius: var(--bs-border-radius-lg)!important;
	border-top-left-radius: var(--bs-border-radius-lg)!important
}
.rounded-start-4 {
	border-bottom-left-radius: var(--bs-border-radius-xl)!important;
	border-top-left-radius: var(--bs-border-radius-xl)!important
}
.rounded-start-5 {
	border-bottom-left-radius: var(--bs-border-radius-2xl)!important;
	border-top-left-radius: var(--bs-border-radius-2xl)!important
}
.rounded-start-circle {
	border-bottom-left-radius: 50%!important;
	border-top-left-radius: 50%!important
}
.rounded-start-pill {
	border-bottom-left-radius: var(--bs-border-radius-pill)!important;
	border-top-left-radius: var(--bs-border-radius-pill)!important
}
.visible {
	visibility: visible!important
}
.invisible {
	visibility: hidden!important
}
.z-n1 {
	z-index: -1!important
}
.z-0 {
	z-index: 0!important
}
.z-1 {
	z-index: 1!important
}
.z-2 {
	z-index: 2!important
}
.z-3 {
	z-index: 3!important
}

@media (min-width:576px) {
.float-sm-start {
	float: left!important
}
.float-sm-end {
	float: right!important
}
.float-sm-none {
	float: none!important
}
.object-fit-sm-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-sm-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-sm-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-sm-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-sm-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-sm-inline {
	display: inline!important
}
.d-sm-inline-block {
	display: inline-block!important
}
.d-sm-block {
	display: block!important
}
.d-sm-grid {
	display: grid!important
}
.d-sm-table {
	display: table!important
}
.d-sm-table-row {
	display: table-row!important
}
.d-sm-table-cell {
	display: table-cell!important
}
.d-sm-flex {
	display: flex!important
}
.d-sm-inline-flex {
	display: inline-flex!important
}
.d-sm-none {
	display: none!important
}
.flex-sm-fill {
	flex: 1 1 auto!important
}
.flex-sm-row {
	flex-direction: row!important
}
.flex-sm-column {
	flex-direction: column!important
}
.flex-sm-row-reverse {
	flex-direction: row-reverse!important
}
.flex-sm-column-reverse {
	flex-direction: column-reverse!important
}
.flex-sm-grow-0 {
	flex-grow: 0!important
}
.flex-sm-grow-1 {
	flex-grow: 1!important
}
.flex-sm-shrink-0 {
	flex-shrink: 0!important
}
.flex-sm-shrink-1 {
	flex-shrink: 1!important
}
.flex-sm-wrap {
	flex-wrap: wrap!important
}
.flex-sm-nowrap {
	flex-wrap: nowrap!important
}
.flex-sm-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-sm-start {
	justify-content: flex-start!important
}
.justify-content-sm-end {
	justify-content: flex-end!important
}
.justify-content-sm-center {
	justify-content: center!important
}
.justify-content-sm-between {
	justify-content: space-between!important
}
.justify-content-sm-around {
	justify-content: space-around!important
}
.justify-content-sm-evenly {
	justify-content: space-evenly!important
}
.align-items-sm-start {
	align-items: flex-start!important
}
.align-items-sm-end {
	align-items: flex-end!important
}
.align-items-sm-center {
	align-items: center!important
}
.align-items-sm-baseline {
	align-items: baseline!important
}
.align-items-sm-stretch {
	align-items: stretch!important
}
.align-content-sm-start {
	align-content: flex-start!important
}
.align-content-sm-end {
	align-content: flex-end!important
}
.align-content-sm-center {
	align-content: center!important
}
.align-content-sm-between {
	align-content: space-between!important
}
.align-content-sm-around {
	align-content: space-around!important
}
.align-content-sm-stretch {
	align-content: stretch!important
}
.align-self-sm-auto {
	align-self: auto!important
}
.align-self-sm-start {
	align-self: flex-start!important
}
.align-self-sm-end {
	align-self: flex-end!important
}
.align-self-sm-center {
	align-self: center!important
}
.align-self-sm-baseline {
	align-self: baseline!important
}
.align-self-sm-stretch {
	align-self: stretch!important
}
.order-sm-first {
	order: -1!important
}
.order-sm-0 {
	order: 0!important
}
.order-sm-1 {
	order: 1!important
}
.order-sm-2 {
	order: 2!important
}
.order-sm-3 {
	order: 3!important
}
.order-sm-4 {
	order: 4!important
}
.order-sm-5 {
	order: 5!important
}
.order-sm-last {
	order: 6!important
}
.m-sm-0 {
	margin: 0!important
}
.m-sm-1 {
	margin: .25rem!important
}
.m-sm-2 {
	margin: .5rem!important
}
.m-sm-3 {
	margin: 1rem!important
}
.m-sm-4 {
	margin: 1.5rem!important
}
.m-sm-5 {
	margin: 3rem!important
}
.m-sm-auto {
	margin: auto!important
}
.mx-sm-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-sm-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-sm-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-sm-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-sm-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-sm-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-sm-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-sm-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-sm-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-sm-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-sm-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-sm-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-sm-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-sm-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-sm-0 {
	margin-top: 0!important
}
.mt-sm-1 {
	margin-top: .25rem!important
}
.mt-sm-2 {
	margin-top: .5rem!important
}
.mt-sm-3 {
	margin-top: 1rem!important
}
.mt-sm-4 {
	margin-top: 1.5rem!important
}
.mt-sm-5 {
	margin-top: 3rem!important
}
.mt-sm-auto {
	margin-top: auto!important
}
.me-sm-0 {
	margin-right: 0!important
}
.me-sm-1 {
	margin-right: .25rem!important
}
.me-sm-2 {
	margin-right: .5rem!important
}
.me-sm-3 {
	margin-right: 1rem!important
}
.me-sm-4 {
	margin-right: 1.5rem!important
}
.me-sm-5 {
	margin-right: 3rem!important
}
.me-sm-auto {
	margin-right: auto!important
}
.mb-sm-0 {
	margin-bottom: 0!important
}
.mb-sm-1 {
	margin-bottom: .25rem!important
}
.mb-sm-2 {
	margin-bottom: .5rem!important
}
.mb-sm-3 {
	margin-bottom: 1rem!important
}
.mb-sm-4 {
	margin-bottom: 1.5rem!important
}
.mb-sm-5 {
	margin-bottom: 3rem!important
}
.mb-sm-auto {
	margin-bottom: auto!important
}
.ms-sm-0 {
	margin-left: 0!important
}
.ms-sm-1 {
	margin-left: .25rem!important
}
.ms-sm-2 {
	margin-left: .5rem!important
}
.ms-sm-3 {
	margin-left: 1rem!important
}
.ms-sm-4 {
	margin-left: 1.5rem!important
}
.ms-sm-5 {
	margin-left: 3rem!important
}
.ms-sm-auto {
	margin-left: auto!important
}
.p-sm-0 {
	padding: 0!important
}
.p-sm-1 {
	padding: .25rem!important
}
.p-sm-2 {
	padding: .5rem!important
}
.p-sm-3 {
	padding: 1rem!important
}
.p-sm-4 {
	padding: 1.5rem!important
}
.p-sm-5 {
	padding: 3rem!important
}
.px-sm-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-sm-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-sm-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-sm-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-sm-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-sm-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-sm-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-sm-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-sm-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-sm-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-sm-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-sm-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-sm-0 {
	padding-top: 0!important
}
.pt-sm-1 {
	padding-top: .25rem!important
}
.pt-sm-2 {
	padding-top: .5rem!important
}
.pt-sm-3 {
	padding-top: 1rem!important
}
.pt-sm-4 {
	padding-top: 1.5rem!important
}
.pt-sm-5 {
	padding-top: 3rem!important
}
.pe-sm-0 {
	padding-right: 0!important
}
.pe-sm-1 {
	padding-right: .25rem!important
}
.pe-sm-2 {
	padding-right: .5rem!important
}
.pe-sm-3 {
	padding-right: 1rem!important
}
.pe-sm-4 {
	padding-right: 1.5rem!important
}
.pe-sm-5 {
	padding-right: 3rem!important
}
.pb-sm-0 {
	padding-bottom: 0!important
}
.pb-sm-1 {
	padding-bottom: .25rem!important
}
.pb-sm-2 {
	padding-bottom: .5rem!important
}
.pb-sm-3 {
	padding-bottom: 1rem!important
}
.pb-sm-4 {
	padding-bottom: 1.5rem!important
}
.pb-sm-5 {
	padding-bottom: 3rem!important
}
.ps-sm-0 {
	padding-left: 0!important
}
.ps-sm-1 {
	padding-left: .25rem!important
}
.ps-sm-2 {
	padding-left: .5rem!important
}
.ps-sm-3 {
	padding-left: 1rem!important
}
.ps-sm-4 {
	padding-left: 1.5rem!important
}
.ps-sm-5 {
	padding-left: 3rem!important
}
.gap-sm-0 {
	gap: 0!important
}
.gap-sm-1 {
	gap: .25rem!important
}
.gap-sm-2 {
	gap: .5rem!important
}
.gap-sm-3 {
	gap: 1rem!important
}
.gap-sm-4 {
	gap: 1.5rem!important
}
.gap-sm-5 {
	gap: 3rem!important
}
.row-gap-sm-0 {
	row-gap: 0!important
}
.row-gap-sm-1 {
	row-gap: .25rem!important
}
.row-gap-sm-2 {
	row-gap: .5rem!important
}
.row-gap-sm-3 {
	row-gap: 1rem!important
}
.row-gap-sm-4 {
	row-gap: 1.5rem!important
}
.row-gap-sm-5 {
	row-gap: 3rem!important
}
.column-gap-sm-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-sm-1 {
	-moz-column-gap: 0.25rem!important;
	column-gap: .25rem!important
}
.column-gap-sm-2 {
	-moz-column-gap: 0.5rem!important;
	column-gap: .5rem!important
}
.column-gap-sm-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-sm-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-sm-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-sm-start {
	text-align: left!important
}
.text-sm-end {
	text-align: right!important
}
.text-sm-center {
	text-align: center!important
}
}

@media (min-width:768px) {
.float-md-start {
	float: left!important
}
.float-md-end {
	float: right!important
}
.float-md-none {
	float: none!important
}
.object-fit-md-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-md-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-md-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-md-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-md-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-md-inline {
	display: inline!important
}
.d-md-inline-block {
	display: inline-block!important
}
.d-md-block {
	display: block!important
}
.d-md-grid {
	display: grid!important
}
.d-md-table {
	display: table!important
}
.d-md-table-row {
	display: table-row!important
}
.d-md-table-cell {
	display: table-cell!important
}
.d-md-flex {
	display: flex!important
}
.d-md-inline-flex {
	display: inline-flex!important
}
.d-md-none {
	display: none!important
}
.flex-md-fill {
	flex: 1 1 auto!important
}
.flex-md-row {
	flex-direction: row!important
}
.flex-md-column {
	flex-direction: column!important
}
.flex-md-row-reverse {
	flex-direction: row-reverse!important
}
.flex-md-column-reverse {
	flex-direction: column-reverse!important
}
.flex-md-grow-0 {
	flex-grow: 0!important
}
.flex-md-grow-1 {
	flex-grow: 1!important
}
.flex-md-shrink-0 {
	flex-shrink: 0!important
}
.flex-md-shrink-1 {
	flex-shrink: 1!important
}
.flex-md-wrap {
	flex-wrap: wrap!important
}
.flex-md-nowrap {
	flex-wrap: nowrap!important
}
.flex-md-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-md-start {
	justify-content: flex-start!important
}
.justify-content-md-end {
	justify-content: flex-end!important
}
.justify-content-md-center {
	justify-content: center!important
}
.justify-content-md-between {
	justify-content: space-between!important
}
.justify-content-md-around {
	justify-content: space-around!important
}
.justify-content-md-evenly {
	justify-content: space-evenly!important
}
.align-items-md-start {
	align-items: flex-start!important
}
.align-items-md-end {
	align-items: flex-end!important
}
.align-items-md-center {
	align-items: center!important
}
.align-items-md-baseline {
	align-items: baseline!important
}
.align-items-md-stretch {
	align-items: stretch!important
}
.align-content-md-start {
	align-content: flex-start!important
}
.align-content-md-end {
	align-content: flex-end!important
}
.align-content-md-center {
	align-content: center!important
}
.align-content-md-between {
	align-content: space-between!important
}
.align-content-md-around {
	align-content: space-around!important
}
.align-content-md-stretch {
	align-content: stretch!important
}
.align-self-md-auto {
	align-self: auto!important
}
.align-self-md-start {
	align-self: flex-start!important
}
.align-self-md-end {
	align-self: flex-end!important
}
.align-self-md-center {
	align-self: center!important
}
.align-self-md-baseline {
	align-self: baseline!important
}
.align-self-md-stretch {
	align-self: stretch!important
}
.order-md-first {
	order: -1!important
}
.order-md-0 {
	order: 0!important
}
.order-md-1 {
	order: 1!important
}
.order-md-2 {
	order: 2!important
}
.order-md-3 {
	order: 3!important
}
.order-md-4 {
	order: 4!important
}
.order-md-5 {
	order: 5!important
}
.order-md-last {
	order: 6!important
}
.m-md-0 {
	margin: 0!important
}
.m-md-1 {
	margin: .25rem!important
}
.m-md-2 {
	margin: .5rem!important
}
.m-md-3 {
	margin: 1rem!important
}
.m-md-4 {
	margin: 1.5rem!important
}
.m-md-5 {
	margin: 3rem!important
}
.m-md-auto {
	margin: auto!important
}
.mx-md-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-md-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-md-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-md-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-md-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-md-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-md-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-md-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-md-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-md-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-md-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-md-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-md-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-md-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-md-0 {
	margin-top: 0!important
}
.mt-md-1 {
	margin-top: .25rem!important
}
.mt-md-2 {
	margin-top: .5rem!important
}
.mt-md-3 {
	margin-top: 1rem!important
}
.mt-md-4 {
	margin-top: 1.5rem!important
}
.mt-md-5 {
	margin-top: 3rem!important
}
.mt-md-auto {
	margin-top: auto!important
}
.me-md-0 {
	margin-right: 0!important
}
.me-md-1 {
	margin-right: .25rem!important
}
.me-md-2 {
	margin-right: .5rem!important
}
.me-md-3 {
	margin-right: 1rem!important
}
.me-md-4 {
	margin-right: 1.5rem!important
}
.me-md-5 {
	margin-right: 3rem!important
}
.me-md-auto {
	margin-right: auto!important
}
.mb-md-0 {
	margin-bottom: 0!important
}
.mb-md-1 {
	margin-bottom: .25rem!important
}
.mb-md-2 {
	margin-bottom: .5rem!important
}
.mb-md-3 {
	margin-bottom: 1rem!important
}
.mb-md-4 {
	margin-bottom: 1.5rem!important
}
.mb-md-5 {
	margin-bottom: 3rem!important
}
.mb-md-auto {
	margin-bottom: auto!important
}
.ms-md-0 {
	margin-left: 0!important
}
.ms-md-1 {
	margin-left: .25rem!important
}
.ms-md-2 {
	margin-left: .5rem!important
}
.ms-md-3 {
	margin-left: 1rem!important
}
.ms-md-4 {
	margin-left: 1.5rem!important
}
.ms-md-5 {
	margin-left: 3rem!important
}
.ms-md-auto {
	margin-left: auto!important
}
.p-md-0 {
	padding: 0!important
}
.p-md-1 {
	padding: .25rem!important
}
.p-md-2 {
	padding: .5rem!important
}
.p-md-3 {
	padding: 1rem!important
}
.p-md-4 {
	padding: 1.5rem!important
}
.p-md-5 {
	padding: 3rem!important
}
.px-md-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-md-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-md-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-md-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-md-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-md-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-md-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-md-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-md-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-md-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-md-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-md-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-md-0 {
	padding-top: 0!important
}
.pt-md-1 {
	padding-top: .25rem!important
}
.pt-md-2 {
	padding-top: .5rem!important
}
.pt-md-3 {
	padding-top: 1rem!important
}
.pt-md-4 {
	padding-top: 1.5rem!important
}
.pt-md-5 {
	padding-top: 3rem!important
}
.pe-md-0 {
	padding-right: 0!important
}
.pe-md-1 {
	padding-right: .25rem!important
}
.pe-md-2 {
	padding-right: .5rem!important
}
.pe-md-3 {
	padding-right: 1rem!important
}
.pe-md-4 {
	padding-right: 1.5rem!important
}
.pe-md-5 {
	padding-right: 3rem!important
}
.pb-md-0 {
	padding-bottom: 0!important
}
.pb-md-1 {
	padding-bottom: .25rem!important
}
.pb-md-2 {
	padding-bottom: .5rem!important
}
.pb-md-3 {
	padding-bottom: 1rem!important
}
.pb-md-4 {
	padding-bottom: 1.5rem!important
}
.pb-md-5 {
	padding-bottom: 3rem!important
}
.ps-md-0 {
	padding-left: 0!important
}
.ps-md-1 {
	padding-left: .25rem!important
}
.ps-md-2 {
	padding-left: .5rem!important
}
.ps-md-3 {
	padding-left: 1rem!important
}
.ps-md-4 {
	padding-left: 1.5rem!important
}
.ps-md-5 {
	padding-left: 3rem!important
}
.gap-md-0 {
	gap: 0!important
}
.gap-md-1 {
	gap: .25rem!important
}
.gap-md-2 {
	gap: .5rem!important
}
.gap-md-3 {
	gap: 1rem!important
}
.gap-md-4 {
	gap: 1.5rem!important
}
.gap-md-5 {
	gap: 3rem!important
}
.row-gap-md-0 {
	row-gap: 0!important
}
.row-gap-md-1 {
	row-gap: .25rem!important
}
.row-gap-md-2 {
	row-gap: .5rem!important
}
.row-gap-md-3 {
	row-gap: 1rem!important
}
.row-gap-md-4 {
	row-gap: 1.5rem!important
}
.row-gap-md-5 {
	row-gap: 3rem!important
}
.column-gap-md-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-md-1 {
	-moz-column-gap: 0.25rem!important;
	column-gap: .25rem!important
}
.column-gap-md-2 {
	-moz-column-gap: 0.5rem!important;
	column-gap: .5rem!important
}
.column-gap-md-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-md-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-md-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-md-start {
	text-align: left!important
}
.text-md-end {
	text-align: right!important
}
.text-md-center {
	text-align: center!important
}
}

@media (min-width:992px) {
.float-lg-start {
	float: left!important
}
.float-lg-end {
	float: right!important
}
.float-lg-none {
	float: none!important
}
.object-fit-lg-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-lg-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-lg-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-lg-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-lg-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-lg-inline {
	display: inline!important
}
.d-lg-inline-block {
	display: inline-block!important
}
.d-lg-block {
	display: block!important
}
.d-lg-grid {
	display: grid!important
}
.d-lg-table {
	display: table!important
}
.d-lg-table-row {
	display: table-row!important
}
.d-lg-table-cell {
	display: table-cell!important
}
.d-lg-flex {
	display: flex!important
}
.d-lg-inline-flex {
	display: inline-flex!important
}
.d-lg-none {
	display: none!important
}
.flex-lg-fill {
	flex: 1 1 auto!important
}
.flex-lg-row {
	flex-direction: row!important
}
.flex-lg-column {
	flex-direction: column!important
}
.flex-lg-row-reverse {
	flex-direction: row-reverse!important
}
.flex-lg-column-reverse {
	flex-direction: column-reverse!important
}
.flex-lg-grow-0 {
	flex-grow: 0!important
}
.flex-lg-grow-1 {
	flex-grow: 1!important
}
.flex-lg-shrink-0 {
	flex-shrink: 0!important
}
.flex-lg-shrink-1 {
	flex-shrink: 1!important
}
.flex-lg-wrap {
	flex-wrap: wrap!important
}
.flex-lg-nowrap {
	flex-wrap: nowrap!important
}
.flex-lg-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-lg-start {
	justify-content: flex-start!important
}
.justify-content-lg-end {
	justify-content: flex-end!important
}
.justify-content-lg-center {
	justify-content: center!important
}
.justify-content-lg-between {
	justify-content: space-between!important
}
.justify-content-lg-around {
	justify-content: space-around!important
}
.justify-content-lg-evenly {
	justify-content: space-evenly!important
}
.align-items-lg-start {
	align-items: flex-start!important
}
.align-items-lg-end {
	align-items: flex-end!important
}
.align-items-lg-center {
	align-items: center!important
}
.align-items-lg-baseline {
	align-items: baseline!important
}
.align-items-lg-stretch {
	align-items: stretch!important
}
.align-content-lg-start {
	align-content: flex-start!important
}
.align-content-lg-end {
	align-content: flex-end!important
}
.align-content-lg-center {
	align-content: center!important
}
.align-content-lg-between {
	align-content: space-between!important
}
.align-content-lg-around {
	align-content: space-around!important
}
.align-content-lg-stretch {
	align-content: stretch!important
}
.align-self-lg-auto {
	align-self: auto!important
}
.align-self-lg-start {
	align-self: flex-start!important
}
.align-self-lg-end {
	align-self: flex-end!important
}
.align-self-lg-center {
	align-self: center!important
}
.align-self-lg-baseline {
	align-self: baseline!important
}
.align-self-lg-stretch {
	align-self: stretch!important
}
.order-lg-first {
	order: -1!important
}
.order-lg-0 {
	order: 0!important
}
.order-lg-1 {
	order: 1!important
}
.order-lg-2 {
	order: 2!important
}
.order-lg-3 {
	order: 3!important
}
.order-lg-4 {
	order: 4!important
}
.order-lg-5 {
	order: 5!important
}
.order-lg-last {
	order: 6!important
}
.m-lg-0 {
	margin: 0!important
}
.m-lg-1 {
	margin: .25rem!important
}
.m-lg-2 {
	margin: .5rem!important
}
.m-lg-3 {
	margin: 1rem!important
}
.m-lg-4 {
	margin: 1.5rem!important
}
.m-lg-5 {
	margin: 3rem!important
}
.m-lg-auto {
	margin: auto!important
}
.mx-lg-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-lg-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-lg-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-lg-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-lg-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-lg-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-lg-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-lg-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-lg-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-lg-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-lg-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-lg-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-lg-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-lg-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-lg-0 {
	margin-top: 0!important
}
.mt-lg-1 {
	margin-top: .25rem!important
}
.mt-lg-2 {
	margin-top: .5rem!important
}
.mt-lg-3 {
	margin-top: 1rem!important
}
.mt-lg-4 {
	margin-top: 1.5rem!important
}
.mt-lg-5 {
	margin-top: 3rem!important
}
.mt-lg-auto {
	margin-top: auto!important
}
.me-lg-0 {
	margin-right: 0!important
}
.me-lg-1 {
	margin-right: .25rem!important
}
.me-lg-2 {
	margin-right: .5rem!important
}
.me-lg-3 {
	margin-right: 1rem!important
}
.me-lg-4 {
	margin-right: 1.5rem!important
}
.me-lg-5 {
	margin-right: 3rem!important
}
.me-lg-auto {
	margin-right: auto!important
}
.mb-lg-0 {
	margin-bottom: 0!important
}
.mb-lg-1 {
	margin-bottom: .25rem!important
}
.mb-lg-2 {
	margin-bottom: .5rem!important
}
.mb-lg-3 {
	margin-bottom: 1rem!important
}
.mb-lg-4 {
	margin-bottom: 1.5rem!important
}
.mb-lg-5 {
	margin-bottom: 3rem!important
}
.mb-lg-auto {
	margin-bottom: auto!important
}
.ms-lg-0 {
	margin-left: 0!important
}
.ms-lg-1 {
	margin-left: .25rem!important
}
.ms-lg-2 {
	margin-left: .5rem!important
}
.ms-lg-3 {
	margin-left: 1rem!important
}
.ms-lg-4 {
	margin-left: 1.5rem!important
}
.ms-lg-5 {
	margin-left: 3rem!important
}
.ms-lg-auto {
	margin-left: auto!important
}
.p-lg-0 {
	padding: 0!important
}
.p-lg-1 {
	padding: .25rem!important
}
.p-lg-2 {
	padding: .5rem!important
}
.p-lg-3 {
	padding: 1rem!important
}
.p-lg-4 {
	padding: 1.5rem!important
}
.p-lg-5 {
	padding: 3rem!important
}
.px-lg-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-lg-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-lg-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-lg-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-lg-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-lg-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-lg-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-lg-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-lg-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-lg-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-lg-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-lg-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-lg-0 {
	padding-top: 0!important
}
.pt-lg-1 {
	padding-top: .25rem!important
}
.pt-lg-2 {
	padding-top: .5rem!important
}
.pt-lg-3 {
	padding-top: 1rem!important
}
.pt-lg-4 {
	padding-top: 1.5rem!important
}
.pt-lg-5 {
	padding-top: 3rem!important
}
.pe-lg-0 {
	padding-right: 0!important
}
.pe-lg-1 {
	padding-right: .25rem!important
}
.pe-lg-2 {
	padding-right: .5rem!important
}
.pe-lg-3 {
	padding-right: 1rem!important
}
.pe-lg-4 {
	padding-right: 1.5rem!important
}
.pe-lg-5 {
	padding-right: 3rem!important
}
.pb-lg-0 {
	padding-bottom: 0!important
}
.pb-lg-1 {
	padding-bottom: .25rem!important
}
.pb-lg-2 {
	padding-bottom: .5rem!important
}
.pb-lg-3 {
	padding-bottom: 1rem!important
}
.pb-lg-4 {
	padding-bottom: 1.5rem!important
}
.pb-lg-5 {
	padding-bottom: 3rem!important
}
.ps-lg-0 {
	padding-left: 0!important
}
.ps-lg-1 {
	padding-left: .25rem!important
}
.ps-lg-2 {
	padding-left: .5rem!important
}
.ps-lg-3 {
	padding-left: 1rem!important
}
.ps-lg-4 {
	padding-left: 1.5rem!important
}
.ps-lg-5 {
	padding-left: 3rem!important
}
.gap-lg-0 {
	gap: 0!important
}
.gap-lg-1 {
	gap: .25rem!important
}
.gap-lg-2 {
	gap: .5rem!important
}
.gap-lg-3 {
	gap: 1rem!important
}
.gap-lg-4 {
	gap: 1.5rem!important
}
.gap-lg-5 {
	gap: 3rem!important
}
.row-gap-lg-0 {
	row-gap: 0!important
}
.row-gap-lg-1 {
	row-gap: .25rem!important
}
.row-gap-lg-2 {
	row-gap: .5rem!important
}
.row-gap-lg-3 {
	row-gap: 1rem!important
}
.row-gap-lg-4 {
	row-gap: 1.5rem!important
}
.row-gap-lg-5 {
	row-gap: 3rem!important
}
.column-gap-lg-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-lg-1 {
	-moz-column-gap: 0.25rem!important;
	column-gap: .25rem!important
}
.column-gap-lg-2 {
	-moz-column-gap: 0.5rem!important;
	column-gap: .5rem!important
}
.column-gap-lg-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-lg-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-lg-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-lg-start {
	text-align: left!important
}
.text-lg-end {
	text-align: right!important
}
.text-lg-center {
	text-align: center!important
}
}

@media (min-width:1200px) {
.float-xl-start {
	float: left!important
}
.float-xl-end {
	float: right!important
}
.float-xl-none {
	float: none!important
}
.object-fit-xl-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-xl-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-xl-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-xl-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-xl-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-xl-inline {
	display: inline!important
}
.d-xl-inline-block {
	display: inline-block!important
}
.d-xl-block {
	display: block!important
}
.d-xl-grid {
	display: grid!important
}
.d-xl-table {
	display: table!important
}
.d-xl-table-row {
	display: table-row!important
}
.d-xl-table-cell {
	display: table-cell!important
}
.d-xl-flex {
	display: flex!important
}
.d-xl-inline-flex {
	display: inline-flex!important
}
.d-xl-none {
	display: none!important
}
.flex-xl-fill {
	flex: 1 1 auto!important
}
.flex-xl-row {
	flex-direction: row!important
}
.flex-xl-column {
	flex-direction: column!important
}
.flex-xl-row-reverse {
	flex-direction: row-reverse!important
}
.flex-xl-column-reverse {
	flex-direction: column-reverse!important
}
.flex-xl-grow-0 {
	flex-grow: 0!important
}
.flex-xl-grow-1 {
	flex-grow: 1!important
}
.flex-xl-shrink-0 {
	flex-shrink: 0!important
}
.flex-xl-shrink-1 {
	flex-shrink: 1!important
}
.flex-xl-wrap {
	flex-wrap: wrap!important
}
.flex-xl-nowrap {
	flex-wrap: nowrap!important
}
.flex-xl-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-xl-start {
	justify-content: flex-start!important
}
.justify-content-xl-end {
	justify-content: flex-end!important
}
.justify-content-xl-center {
	justify-content: center!important
}
.justify-content-xl-between {
	justify-content: space-between!important
}
.justify-content-xl-around {
	justify-content: space-around!important
}
.justify-content-xl-evenly {
	justify-content: space-evenly!important
}
.align-items-xl-start {
	align-items: flex-start!important
}
.align-items-xl-end {
	align-items: flex-end!important
}
.align-items-xl-center {
	align-items: center!important
}
.align-items-xl-baseline {
	align-items: baseline!important
}
.align-items-xl-stretch {
	align-items: stretch!important
}
.align-content-xl-start {
	align-content: flex-start!important
}
.align-content-xl-end {
	align-content: flex-end!important
}
.align-content-xl-center {
	align-content: center!important
}
.align-content-xl-between {
	align-content: space-between!important
}
.align-content-xl-around {
	align-content: space-around!important
}
.align-content-xl-stretch {
	align-content: stretch!important
}
.align-self-xl-auto {
	align-self: auto!important
}
.align-self-xl-start {
	align-self: flex-start!important
}
.align-self-xl-end {
	align-self: flex-end!important
}
.align-self-xl-center {
	align-self: center!important
}
.align-self-xl-baseline {
	align-self: baseline!important
}
.align-self-xl-stretch {
	align-self: stretch!important
}
.order-xl-first {
	order: -1!important
}
.order-xl-0 {
	order: 0!important
}
.order-xl-1 {
	order: 1!important
}
.order-xl-2 {
	order: 2!important
}
.order-xl-3 {
	order: 3!important
}
.order-xl-4 {
	order: 4!important
}
.order-xl-5 {
	order: 5!important
}
.order-xl-last {
	order: 6!important
}
.m-xl-0 {
	margin: 0!important
}
.m-xl-1 {
	margin: .25rem!important
}
.m-xl-2 {
	margin: .5rem!important
}
.m-xl-3 {
	margin: 1rem!important
}
.m-xl-4 {
	margin: 1.5rem!important
}
.m-xl-5 {
	margin: 3rem!important
}
.m-xl-auto {
	margin: auto!important
}
.mx-xl-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-xl-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-xl-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-xl-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-xl-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-xl-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-xl-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-xl-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-xl-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-xl-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-xl-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-xl-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-xl-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-xl-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-xl-0 {
	margin-top: 0!important
}
.mt-xl-1 {
	margin-top: .25rem!important
}
.mt-xl-2 {
	margin-top: .5rem!important
}
.mt-xl-3 {
	margin-top: 1rem!important
}
.mt-xl-4 {
	margin-top: 1.5rem!important
}
.mt-xl-5 {
	margin-top: 3rem!important
}
.mt-xl-auto {
	margin-top: auto!important
}
.me-xl-0 {
	margin-right: 0!important
}
.me-xl-1 {
	margin-right: .25rem!important
}
.me-xl-2 {
	margin-right: .5rem!important
}
.me-xl-3 {
	margin-right: 1rem!important
}
.me-xl-4 {
	margin-right: 1.5rem!important
}
.me-xl-5 {
	margin-right: 3rem!important
}
.me-xl-auto {
	margin-right: auto!important
}
.mb-xl-0 {
	margin-bottom: 0!important
}
.mb-xl-1 {
	margin-bottom: .25rem!important
}
.mb-xl-2 {
	margin-bottom: .5rem!important
}
.mb-xl-3 {
	margin-bottom: 1rem!important
}
.mb-xl-4 {
	margin-bottom: 1.5rem!important
}
.mb-xl-5 {
	margin-bottom: 3rem!important
}
.mb-xl-auto {
	margin-bottom: auto!important
}
.ms-xl-0 {
	margin-left: 0!important
}
.ms-xl-1 {
	margin-left: .25rem!important
}
.ms-xl-2 {
	margin-left: .5rem!important
}
.ms-xl-3 {
	margin-left: 1rem!important
}
.ms-xl-4 {
	margin-left: 1.5rem!important
}
.ms-xl-5 {
	margin-left: 3rem!important
}
.ms-xl-auto {
	margin-left: auto!important
}
.p-xl-0 {
	padding: 0!important
}
.p-xl-1 {
	padding: .25rem!important
}
.p-xl-2 {
	padding: .5rem!important
}
.p-xl-3 {
	padding: 1rem!important
}
.p-xl-4 {
	padding: 1.5rem!important
}
.p-xl-5 {
	padding: 3rem!important
}
.px-xl-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-xl-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-xl-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-xl-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-xl-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-xl-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-xl-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-xl-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-xl-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-xl-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-xl-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-xl-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-xl-0 {
	padding-top: 0!important
}
.pt-xl-1 {
	padding-top: .25rem!important
}
.pt-xl-2 {
	padding-top: .5rem!important
}
.pt-xl-3 {
	padding-top: 1rem!important
}
.pt-xl-4 {
	padding-top: 1.5rem!important
}
.pt-xl-5 {
	padding-top: 3rem!important
}
.pe-xl-0 {
	padding-right: 0!important
}
.pe-xl-1 {
	padding-right: .25rem!important
}
.pe-xl-2 {
	padding-right: .5rem!important
}
.pe-xl-3 {
	padding-right: 1rem!important
}
.pe-xl-4 {
	padding-right: 1.5rem!important
}
.pe-xl-5 {
	padding-right: 3rem!important
}
.pb-xl-0 {
	padding-bottom: 0!important
}
.pb-xl-1 {
	padding-bottom: .25rem!important
}
.pb-xl-2 {
	padding-bottom: .5rem!important
}
.pb-xl-3 {
	padding-bottom: 1rem!important
}
.pb-xl-4 {
	padding-bottom: 1.5rem!important
}
.pb-xl-5 {
	padding-bottom: 3rem!important
}
.ps-xl-0 {
	padding-left: 0!important
}
.ps-xl-1 {
	padding-left: .25rem!important
}
.ps-xl-2 {
	padding-left: .5rem!important
}
.ps-xl-3 {
	padding-left: 1rem!important
}
.ps-xl-4 {
	padding-left: 1.5rem!important
}
.ps-xl-5 {
	padding-left: 3rem!important
}
.gap-xl-0 {
	gap: 0!important
}
.gap-xl-1 {
	gap: .25rem!important
}
.gap-xl-2 {
	gap: .5rem!important
}
.gap-xl-3 {
	gap: 1rem!important
}
.gap-xl-4 {
	gap: 1.5rem!important
}
.gap-xl-5 {
	gap: 3rem!important
}
.row-gap-xl-0 {
	row-gap: 0!important
}
.row-gap-xl-1 {
	row-gap: .25rem!important
}
.row-gap-xl-2 {
	row-gap: .5rem!important
}
.row-gap-xl-3 {
	row-gap: 1rem!important
}
.row-gap-xl-4 {
	row-gap: 1.5rem!important
}
.row-gap-xl-5 {
	row-gap: 3rem!important
}
.column-gap-xl-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-xl-1 {
	-moz-column-gap: 0.25rem!important;
	column-gap: .25rem!important
}
.column-gap-xl-2 {
	-moz-column-gap: 0.5rem!important;
	column-gap: .5rem!important
}
.column-gap-xl-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-xl-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-xl-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-xl-start {
	text-align: left!important
}
.text-xl-end {
	text-align: right!important
}
.text-xl-center {
	text-align: center!important
}
}

@media (min-width:1400px) {
.float-xxl-start {
	float: left!important
}
.float-xxl-end {
	float: right!important
}
.float-xxl-none {
	float: none!important
}
.object-fit-xxl-contain {
	-o-object-fit: contain!important;
	object-fit: contain!important
}
.object-fit-xxl-cover {
	-o-object-fit: cover!important;
	object-fit: cover!important
}
.object-fit-xxl-fill {
	-o-object-fit: fill!important;
	object-fit: fill!important
}
.object-fit-xxl-scale {
	-o-object-fit: scale-down!important;
	object-fit: scale-down!important
}
.object-fit-xxl-none {
	-o-object-fit: none!important;
	object-fit: none!important
}
.d-xxl-inline {
	display: inline!important
}
.d-xxl-inline-block {
	display: inline-block!important
}
.d-xxl-block {
	display: block!important
}
.d-xxl-grid {
	display: grid!important
}
.d-xxl-table {
	display: table!important
}
.d-xxl-table-row {
	display: table-row!important
}
.d-xxl-table-cell {
	display: table-cell!important
}
.d-xxl-flex {
	display: flex!important
}
.d-xxl-inline-flex {
	display: inline-flex!important
}
.d-xxl-none {
	display: none!important
}
.flex-xxl-fill {
	flex: 1 1 auto!important
}
.flex-xxl-row {
	flex-direction: row!important
}
.flex-xxl-column {
	flex-direction: column!important
}
.flex-xxl-row-reverse {
	flex-direction: row-reverse!important
}
.flex-xxl-column-reverse {
	flex-direction: column-reverse!important
}
.flex-xxl-grow-0 {
	flex-grow: 0!important
}
.flex-xxl-grow-1 {
	flex-grow: 1!important
}
.flex-xxl-shrink-0 {
	flex-shrink: 0!important
}
.flex-xxl-shrink-1 {
	flex-shrink: 1!important
}
.flex-xxl-wrap {
	flex-wrap: wrap!important
}
.flex-xxl-nowrap {
	flex-wrap: nowrap!important
}
.flex-xxl-wrap-reverse {
	flex-wrap: wrap-reverse!important
}
.justify-content-xxl-start {
	justify-content: flex-start!important
}
.justify-content-xxl-end {
	justify-content: flex-end!important
}
.justify-content-xxl-center {
	justify-content: center!important
}
.justify-content-xxl-between {
	justify-content: space-between!important
}
.justify-content-xxl-around {
	justify-content: space-around!important
}
.justify-content-xxl-evenly {
	justify-content: space-evenly!important
}
.align-items-xxl-start {
	align-items: flex-start!important
}
.align-items-xxl-end {
	align-items: flex-end!important
}
.align-items-xxl-center {
	align-items: center!important
}
.align-items-xxl-baseline {
	align-items: baseline!important
}
.align-items-xxl-stretch {
	align-items: stretch!important
}
.align-content-xxl-start {
	align-content: flex-start!important
}
.align-content-xxl-end {
	align-content: flex-end!important
}
.align-content-xxl-center {
	align-content: center!important
}
.align-content-xxl-between {
	align-content: space-between!important
}
.align-content-xxl-around {
	align-content: space-around!important
}
.align-content-xxl-stretch {
	align-content: stretch!important
}
.align-self-xxl-auto {
	align-self: auto!important
}
.align-self-xxl-start {
	align-self: flex-start!important
}
.align-self-xxl-end {
	align-self: flex-end!important
}
.align-self-xxl-center {
	align-self: center!important
}
.align-self-xxl-baseline {
	align-self: baseline!important
}
.align-self-xxl-stretch {
	align-self: stretch!important
}
.order-xxl-first {
	order: -1!important
}
.order-xxl-0 {
	order: 0!important
}
.order-xxl-1 {
	order: 1!important
}
.order-xxl-2 {
	order: 2!important
}
.order-xxl-3 {
	order: 3!important
}
.order-xxl-4 {
	order: 4!important
}
.order-xxl-5 {
	order: 5!important
}
.order-xxl-last {
	order: 6!important
}
.m-xxl-0 {
	margin: 0!important
}
.m-xxl-1 {
	margin: .25rem!important
}
.m-xxl-2 {
	margin: .5rem!important
}
.m-xxl-3 {
	margin: 1rem!important
}
.m-xxl-4 {
	margin: 1.5rem!important
}
.m-xxl-5 {
	margin: 3rem!important
}
.m-xxl-auto {
	margin: auto!important
}
.mx-xxl-0 {
	margin-right: 0!important;
	margin-left: 0!important
}
.mx-xxl-1 {
	margin-right: .25rem!important;
	margin-left: .25rem!important
}
.mx-xxl-2 {
	margin-right: .5rem!important;
	margin-left: .5rem!important
}
.mx-xxl-3 {
	margin-right: 1rem!important;
	margin-left: 1rem!important
}
.mx-xxl-4 {
	margin-right: 1.5rem!important;
	margin-left: 1.5rem!important
}
.mx-xxl-5 {
	margin-right: 3rem!important;
	margin-left: 3rem!important
}
.mx-xxl-auto {
	margin-right: auto!important;
	margin-left: auto!important
}
.my-xxl-0 {
	margin-top: 0!important;
	margin-bottom: 0!important
}
.my-xxl-1 {
	margin-top: .25rem!important;
	margin-bottom: .25rem!important
}
.my-xxl-2 {
	margin-top: .5rem!important;
	margin-bottom: .5rem!important
}
.my-xxl-3 {
	margin-top: 1rem!important;
	margin-bottom: 1rem!important
}
.my-xxl-4 {
	margin-top: 1.5rem!important;
	margin-bottom: 1.5rem!important
}
.my-xxl-5 {
	margin-top: 3rem!important;
	margin-bottom: 3rem!important
}
.my-xxl-auto {
	margin-top: auto!important;
	margin-bottom: auto!important
}
.mt-xxl-0 {
	margin-top: 0!important
}
.mt-xxl-1 {
	margin-top: .25rem!important
}
.mt-xxl-2 {
	margin-top: .5rem!important
}
.mt-xxl-3 {
	margin-top: 1rem!important
}
.mt-xxl-4 {
	margin-top: 1.5rem!important
}
.mt-xxl-5 {
	margin-top: 3rem!important
}
.mt-xxl-auto {
	margin-top: auto!important
}
.me-xxl-0 {
	margin-right: 0!important
}
.me-xxl-1 {
	margin-right: .25rem!important
}
.me-xxl-2 {
	margin-right: .5rem!important
}
.me-xxl-3 {
	margin-right: 1rem!important
}
.me-xxl-4 {
	margin-right: 1.5rem!important
}
.me-xxl-5 {
	margin-right: 3rem!important
}
.me-xxl-auto {
	margin-right: auto!important
}
.mb-xxl-0 {
	margin-bottom: 0!important
}
.mb-xxl-1 {
	margin-bottom: .25rem!important
}
.mb-xxl-2 {
	margin-bottom: .5rem!important
}
.mb-xxl-3 {
	margin-bottom: 1rem!important
}
.mb-xxl-4 {
	margin-bottom: 1.5rem!important
}
.mb-xxl-5 {
	margin-bottom: 3rem!important
}
.mb-xxl-auto {
	margin-bottom: auto!important
}
.ms-xxl-0 {
	margin-left: 0!important
}
.ms-xxl-1 {
	margin-left: .25rem!important
}
.ms-xxl-2 {
	margin-left: .5rem!important
}
.ms-xxl-3 {
	margin-left: 1rem!important
}
.ms-xxl-4 {
	margin-left: 1.5rem!important
}
.ms-xxl-5 {
	margin-left: 3rem!important
}
.ms-xxl-auto {
	margin-left: auto!important
}
.p-xxl-0 {
	padding: 0!important
}
.p-xxl-1 {
	padding: .25rem!important
}
.p-xxl-2 {
	padding: .5rem!important
}
.p-xxl-3 {
	padding: 1rem!important
}
.p-xxl-4 {
	padding: 1.5rem!important
}
.p-xxl-5 {
	padding: 3rem!important
}
.px-xxl-0 {
	padding-right: 0!important;
	padding-left: 0!important
}
.px-xxl-1 {
	padding-right: .25rem!important;
	padding-left: .25rem!important
}
.px-xxl-2 {
	padding-right: .5rem!important;
	padding-left: .5rem!important
}
.px-xxl-3 {
	padding-right: 1rem!important;
	padding-left: 1rem!important
}
.px-xxl-4 {
	padding-right: 1.5rem!important;
	padding-left: 1.5rem!important
}
.px-xxl-5 {
	padding-right: 3rem!important;
	padding-left: 3rem!important
}
.py-xxl-0 {
	padding-top: 0!important;
	padding-bottom: 0!important
}
.py-xxl-1 {
	padding-top: .25rem!important;
	padding-bottom: .25rem!important
}
.py-xxl-2 {
	padding-top: .5rem!important;
	padding-bottom: .5rem!important
}
.py-xxl-3 {
	padding-top: 1rem!important;
	padding-bottom: 1rem!important
}
.py-xxl-4 {
	padding-top: 1.5rem!important;
	padding-bottom: 1.5rem!important
}
.py-xxl-5 {
	padding-top: 3rem!important;
	padding-bottom: 3rem!important
}
.pt-xxl-0 {
	padding-top: 0!important
}
.pt-xxl-1 {
	padding-top: .25rem!important
}
.pt-xxl-2 {
	padding-top: .5rem!important
}
.pt-xxl-3 {
	padding-top: 1rem!important
}
.pt-xxl-4 {
	padding-top: 1.5rem!important
}
.pt-xxl-5 {
	padding-top: 3rem!important
}
.pe-xxl-0 {
	padding-right: 0!important
}
.pe-xxl-1 {
	padding-right: .25rem!important
}
.pe-xxl-2 {
	padding-right: .5rem!important
}
.pe-xxl-3 {
	padding-right: 1rem!important
}
.pe-xxl-4 {
	padding-right: 1.5rem!important
}
.pe-xxl-5 {
	padding-right: 3rem!important
}
.pb-xxl-0 {
	padding-bottom: 0!important
}
.pb-xxl-1 {
	padding-bottom: .25rem!important
}
.pb-xxl-2 {
	padding-bottom: .5rem!important
}
.pb-xxl-3 {
	padding-bottom: 1rem!important
}
.pb-xxl-4 {
	padding-bottom: 1.5rem!important
}
.pb-xxl-5 {
	padding-bottom: 3rem!important
}
.ps-xxl-0 {
	padding-left: 0!important
}
.ps-xxl-1 {
	padding-left: .25rem!important
}
.ps-xxl-2 {
	padding-left: .5rem!important
}
.ps-xxl-3 {
	padding-left: 1rem!important
}
.ps-xxl-4 {
	padding-left: 1.5rem!important
}
.ps-xxl-5 {
	padding-left: 3rem!important
}
.gap-xxl-0 {
	gap: 0!important
}
.gap-xxl-1 {
	gap: .25rem!important
}
.gap-xxl-2 {
	gap: .5rem!important
}
.gap-xxl-3 {
	gap: 1rem!important
}
.gap-xxl-4 {
	gap: 1.5rem!important
}
.gap-xxl-5 {
	gap: 3rem!important
}
.row-gap-xxl-0 {
	row-gap: 0!important
}
.row-gap-xxl-1 {
	row-gap: .25rem!important
}
.row-gap-xxl-2 {
	row-gap: .5rem!important
}
.row-gap-xxl-3 {
	row-gap: 1rem!important
}
.row-gap-xxl-4 {
	row-gap: 1.5rem!important
}
.row-gap-xxl-5 {
	row-gap: 3rem!important
}
.column-gap-xxl-0 {
	-moz-column-gap: 0!important;
	column-gap: 0!important
}
.column-gap-xxl-1 {
	-moz-column-gap: 0.25rem!important;
	column-gap: .25rem!important
}
.column-gap-xxl-2 {
	-moz-column-gap: 0.5rem!important;
	column-gap: .5rem!important
}
.column-gap-xxl-3 {
	-moz-column-gap: 1rem!important;
	column-gap: 1rem!important
}
.column-gap-xxl-4 {
	-moz-column-gap: 1.5rem!important;
	column-gap: 1.5rem!important
}
.column-gap-xxl-5 {
	-moz-column-gap: 3rem!important;
	column-gap: 3rem!important
}
.text-xxl-start {
	text-align: left!important
}
.text-xxl-end {
	text-align: right!important
}
.text-xxl-center {
	text-align: center!important
}
}

@media (min-width:1200px) {
.fs-1 {
	font-size: 2.5rem!important
}
.fs-2 {
	font-size: 2rem!important
}
.fs-3 {
	font-size: 1.75rem!important
}
.fs-4 {
	font-size: 1.5rem!important
}
}

@media print {
.d-print-inline {
	display: inline!important
}
.d-print-inline-block {
	display: inline-block!important
}
.d-print-block {
	display: block!important
}
.d-print-grid {
	display: grid!important
}
.d-print-table {
	display: table!important
}
.d-print-table-row {
	display: table-row!important
}
.d-print-table-cell {
	display: table-cell!important
}
.d-print-flex {
	display: flex!important
}
.d-print-inline-flex {
	display: inline-flex!important
}
.d-print-none {
	display: none!important
}
}
/*!
 * Font Awesome Free 6.1.1 by @fontawesome - https://fontawesome.com
 * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
 * Copyright 2022 Fonticons, Inc.
 */.fa {
	font-family: var(--fa-style-family, "Font Awesome 6 Free");
	font-weight: var(--fa-style, 900)
}
.fa, .fa-brands, .fa-duotone, .fa-light, .fa-regular, .fa-solid, .fa-thin, .fab, .fad, .fal, .far, .fas, .fat {
	-moz-osx-font-smoothing: grayscale;
	-webkit-font-smoothing: antialiased;
	display: var(--fa-display, inline-block);
	font-style: normal;
	font-variant: normal;
	line-height: 1;
	text-rendering: auto
}
.fa-1x {
	font-size: 1em
}
.fa-2x {
	font-size: 2em
}
.fa-3x {
	font-size: 3em
}
.fa-4x {
	font-size: 4em
}
.fa-5x {
	font-size: 5em
}
.fa-6x {
	font-size: 6em
}
.fa-7x {
	font-size: 7em
}
.fa-8x {
	font-size: 8em
}
.fa-9x {
	font-size: 9em
}
.fa-10x {
	font-size: 10em
}
.fa-2xs {
	font-size: .625em;
	line-height: .1em;
	vertical-align: .225em
}
.fa-xs {
	font-size: .75em;
	line-height: .08333em;
	vertical-align: .125em
}
.fa-sm {
	font-size: .875em;
	line-height: .07143em;
	vertical-align: .05357em
}
.fa-lg {
	font-size: 1.25em;
	line-height: .05em;
	vertical-align: -.075em
}
.fa-xl {
	font-size: 1.5em;
	line-height: .04167em;
	vertical-align: -.125em
}
.fa-2xl {
	font-size: 2em;
	line-height: .03125em;
	vertical-align: -.1875em
}
.fa-fw {
	text-align: center;
	width: 1.25em
}
.fa-ul {
	list-style-type: none;
	margin-left: var(--fa-li-margin, 2.5em);
	padding-left: 0
}
.fa-ul>li {
	position: relative
}
.fa-li {
left:calc(var(--fa-li-width, 2em)*-1);
	position: absolute;
	text-align: center;
	width: var(--fa-li-width, 2em);
	line-height: inherit
}
.fa-border {
	border-radius: var(--fa-border-radius, 0.1em);
	border: var(--fa-border-width, 0.08em) var(--fa-border-style, solid) var(--fa-border-color, #eee);
	padding: var(--fa-border-padding, 0.2em 0.25em 0.15em)
}
.fa-pull-left {
	float: left;
	margin-right: var(--fa-pull-margin, 0.3em)
}
.fa-pull-right {
	float: right;
	margin-left: var(--fa-pull-margin, 0.3em)
}
.fa-beat {
	-webkit-animation-name: fa-beat;
	animation-name: fa-beat;
	-webkit-animation-delay: var(--fa-animation-delay, 0);
	animation-delay: var(--fa-animation-delay, 0);
	-webkit-animation-direction: var(--fa-animation-direction, normal);
	animation-direction: var(--fa-animation-direction, normal);
	-webkit-animation-duration: var(--fa-animation-duration, 1s);
	animation-duration: var(--fa-animation-duration, 1s);
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out);
	animation-timing-function: var(--fa-animation-timing, ease-in-out)
}
.fa-bounce {
	-webkit-animation-name: fa-bounce;
	animation-name: fa-bounce;
	-webkit-animation-delay: var(--fa-animation-delay, 0);
	animation-delay: var(--fa-animation-delay, 0);
	-webkit-animation-direction: var(--fa-animation-direction, normal);
	animation-direction: var(--fa-animation-direction, normal);
	-webkit-animation-duration: var(--fa-animation-duration, 1s);
	animation-duration: var(--fa-animation-duration, 1s);
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.28, 0.84, 0.42, 1));
	animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.28, 0.84, 0.42, 1))
}
.fa-fade {
	-webkit-animation-name: fa-fade;
	animation-name: fa-fade;
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1));
	animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1))
}
.fa-beat-fade, .fa-fade {
	-webkit-animation-delay: var(--fa-animation-delay, 0);
	animation-delay: var(--fa-animation-delay, 0);
	-webkit-animation-direction: var(--fa-animation-direction, normal);
	animation-direction: var(--fa-animation-direction, normal);
	-webkit-animation-duration: var(--fa-animation-duration, 1s);
	animation-duration: var(--fa-animation-duration, 1s)
}
.fa-beat-fade {
	-webkit-animation-name: fa-beat-fade;
	animation-name: fa-beat-fade;
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1));
	animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1))
}
.fa-flip {
	-webkit-animation-name: fa-flip;
	animation-name: fa-flip;
	-webkit-animation-delay: var(--fa-animation-delay, 0);
	animation-delay: var(--fa-animation-delay, 0);
	-webkit-animation-direction: var(--fa-animation-direction, normal);
	animation-direction: var(--fa-animation-direction, normal);
	-webkit-animation-duration: var(--fa-animation-duration, 1s);
	animation-duration: var(--fa-animation-duration, 1s);
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out);
	animation-timing-function: var(--fa-animation-timing, ease-in-out)
}
.fa-shake {
	-webkit-animation-name: fa-shake;
	animation-name: fa-shake;
	-webkit-animation-duration: var(--fa-animation-duration, 1s);
	animation-duration: var(--fa-animation-duration, 1s);
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, linear);
	animation-timing-function: var(--fa-animation-timing, linear)
}
.fa-shake, .fa-spin {
	-webkit-animation-delay: var(--fa-animation-delay, 0);
	animation-delay: var(--fa-animation-delay, 0);
	-webkit-animation-direction: var(--fa-animation-direction, normal);
	animation-direction: var(--fa-animation-direction, normal)
}
.fa-spin {
	-webkit-animation-name: fa-spin;
	animation-name: fa-spin;
	-webkit-animation-duration: var(--fa-animation-duration, 2s);
	animation-duration: var(--fa-animation-duration, 2s);
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, linear);
	animation-timing-function: var(--fa-animation-timing, linear)
}
.fa-spin-reverse {
--fa-animation-direction:reverse
}
.fa-pulse, .fa-spin-pulse {
	-webkit-animation-name: fa-spin;
	animation-name: fa-spin;
	-webkit-animation-direction: var(--fa-animation-direction, normal);
	animation-direction: var(--fa-animation-direction, normal);
	-webkit-animation-duration: var(--fa-animation-duration, 1s);
	animation-duration: var(--fa-animation-duration, 1s);
	-webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	animation-iteration-count: var(--fa-animation-iteration-count, infinite);
	-webkit-animation-timing-function: var(--fa-animation-timing, steps(8));
	animation-timing-function: var(--fa-animation-timing, steps(8))
}

@media (prefers-reduced-motion: reduce) {
.fa-beat, .fa-beat-fade, .fa-bounce, .fa-fade, .fa-flip, .fa-pulse, .fa-shake, .fa-spin, .fa-spin-pulse {
	-webkit-animation-delay: -1ms;
	animation-delay: -1ms;
	-webkit-animation-duration: 1ms;
	animation-duration: 1ms;
	-webkit-animation-iteration-count: 1;
	animation-iteration-count: 1;
	transition-delay: 0s;
	transition-duration: 0s
}
}
@-webkit-keyframes fa-beat {
0%, 90% {
-webkit-transform:scale(1);
transform:scale(1)
}
45% {
-webkit-transform:scale(var(--fa-beat-scale, 1.25));
transform:scale(var(--fa-beat-scale, 1.25))
}
}
@keyframes fa-beat {
0%, 90% {
-webkit-transform:scale(1);
transform:scale(1)
}
45% {
-webkit-transform:scale(var(--fa-beat-scale, 1.25));
transform:scale(var(--fa-beat-scale, 1.25))
}
}
@-webkit-keyframes fa-bounce {
0% {
-webkit-transform:scale(1) translateY(0);
transform:scale(1) translateY(0)
}
10% {
-webkit-transform:scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0);
transform:scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0)
}
30% {
-webkit-transform:scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em));
transform:scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em))
}
50% {
-webkit-transform:scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0);
transform:scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0)
}
57% {
-webkit-transform:scale(1) translateY(var(--fa-bounce-rebound, -0.125em));
transform:scale(1) translateY(var(--fa-bounce-rebound, -0.125em))
}
64% {
-webkit-transform:scale(1) translateY(0);
transform:scale(1) translateY(0)
}
to {
-webkit-transform:scale(1) translateY(0);
transform:scale(1) translateY(0)
}
}
@keyframes fa-bounce {
0% {
-webkit-transform:scale(1) translateY(0);
transform:scale(1) translateY(0)
}
10% {
-webkit-transform:scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0);
transform:scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0)
}
30% {
-webkit-transform:scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em));
transform:scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em))
}
50% {
-webkit-transform:scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0);
transform:scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0)
}
57% {
-webkit-transform:scale(1) translateY(var(--fa-bounce-rebound, -0.125em));
transform:scale(1) translateY(var(--fa-bounce-rebound, -0.125em))
}
64% {
-webkit-transform:scale(1) translateY(0);
transform:scale(1) translateY(0)
}
to {
-webkit-transform:scale(1) translateY(0);
transform:scale(1) translateY(0)
}
}
@-webkit-keyframes fa-fade {
50% {
opacity:var(--fa-fade-opacity, 0.4)
}
}
@keyframes fa-fade {
50% {
opacity:var(--fa-fade-opacity, 0.4)
}
}
@-webkit-keyframes fa-beat-fade {
0%, to {
opacity:var(--fa-beat-fade-opacity, 0.4);
-webkit-transform:scale(1);
transform:scale(1)
}
50% {
opacity:1;
-webkit-transform:scale(var(--fa-beat-fade-scale, 1.125));
transform:scale(var(--fa-beat-fade-scale, 1.125))
}
}
@keyframes fa-beat-fade {
0%, to {
opacity:var(--fa-beat-fade-opacity, 0.4);
-webkit-transform:scale(1);
transform:scale(1)
}
50% {
opacity:1;
-webkit-transform:scale(var(--fa-beat-fade-scale, 1.125));
transform:scale(var(--fa-beat-fade-scale, 1.125))
}
}
@-webkit-keyframes fa-flip {
50% {
-webkit-transform:rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg));
transform:rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg))
}
}
@keyframes fa-flip {
50% {
-webkit-transform:rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg));
transform:rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg))
}
}
@-webkit-keyframes fa-shake {
0% {
-webkit-transform:rotate(-15deg);
transform:rotate(-15deg)
}
4% {
-webkit-transform:rotate(15deg);
transform:rotate(15deg)
}
8%, 24% {
-webkit-transform:rotate(-18deg);
transform:rotate(-18deg)
}
12%, 28% {
-webkit-transform:rotate(18deg);
transform:rotate(18deg)
}
16% {
-webkit-transform:rotate(-22deg);
transform:rotate(-22deg)
}
20% {
-webkit-transform:rotate(22deg);
transform:rotate(22deg)
}
32% {
-webkit-transform:rotate(-12deg);
transform:rotate(-12deg)
}
36% {
-webkit-transform:rotate(12deg);
transform:rotate(12deg)
}
40%, to {
-webkit-transform:rotate(0deg);
transform:rotate(0deg)
}
}
@keyframes fa-shake {
0% {
-webkit-transform:rotate(-15deg);
transform:rotate(-15deg)
}
4% {
-webkit-transform:rotate(15deg);
transform:rotate(15deg)
}
8%, 24% {
-webkit-transform:rotate(-18deg);
transform:rotate(-18deg)
}
12%, 28% {
-webkit-transform:rotate(18deg);
transform:rotate(18deg)
}
16% {
-webkit-transform:rotate(-22deg);
transform:rotate(-22deg)
}
20% {
-webkit-transform:rotate(22deg);
transform:rotate(22deg)
}
32% {
-webkit-transform:rotate(-12deg);
transform:rotate(-12deg)
}
36% {
-webkit-transform:rotate(12deg);
transform:rotate(12deg)
}
40%, to {
-webkit-transform:rotate(0deg);
transform:rotate(0deg)
}
}
@-webkit-keyframes fa-spin {
0% {
-webkit-transform:rotate(0deg);
transform:rotate(0deg)
}
to {
-webkit-transform:rotate(1turn);
transform:rotate(1turn)
}
}
@keyframes fa-spin {
0% {
-webkit-transform:rotate(0deg);
transform:rotate(0deg)
}
to {
-webkit-transform:rotate(1turn);
transform:rotate(1turn)
}
}
.fa-rotate-90 {
	-webkit-transform: rotate(90deg);
	transform: rotate(90deg)
}
.fa-rotate-180 {
	-webkit-transform: rotate(180deg);
	transform: rotate(180deg)
}
.fa-rotate-270 {
	-webkit-transform: rotate(270deg);
	transform: rotate(270deg)
}
.fa-flip-horizontal {
	-webkit-transform: scaleX(-1);
	transform: scaleX(-1)
}
.fa-flip-vertical {
	-webkit-transform: scaleY(-1);
	transform: scaleY(-1)
}
.fa-flip-both, .fa-flip-horizontal.fa-flip-vertical {
	-webkit-transform: scale(-1);
	transform: scale(-1)
}
.fa-rotate-by {
	-webkit-transform: rotate(var(--fa-rotate-angle, none));
	transform: rotate(var(--fa-rotate-angle, none))
}
.fa-stack {
	display: inline-block;
	height: 2em;
	line-height: 2em;
	position: relative;
	vertical-align: middle;
	width: 2.5em
}
.fa-stack-1x, .fa-stack-2x {
	left: 0;
	position: absolute;
	text-align: center;
	width: 100%;
	z-index: var(--fa-stack-z-index, auto)
}
.fa-stack-1x {
	line-height: inherit
}
.fa-stack-2x {
	font-size: 2em
}
.fa-inverse {
	color: var(--fa-inverse, #fff)
}
.fa-0:before {
	content: "\30"
}
.fa-1:before {
	content: "\31"
}
.fa-2:before {
	content: "\32"
}
.fa-3:before {
	content: "\33"
}
.fa-4:before {
	content: "\34"
}
.fa-5:before {
	content: "\35"
}
.fa-6:before {
	content: "\36"
}
.fa-7:before {
	content: "\37"
}
.fa-8:before {
	content: "\38"
}
.fa-9:before {
	content: "\39"
}
.fa-a:before {
	content: "\41"
}
.fa-address-book:before, .fa-contact-book:before {
	content: "\f2b9"
}
.fa-address-card:before, .fa-contact-card:before, .fa-vcard:before {
	content: "\f2bb"
}
.fa-align-center:before {
	content: "\f037"
}
.fa-align-justify:before {
	content: "\f039"
}
.fa-align-left:before {
	content: "\f036"
}
.fa-align-right:before {
	content: "\f038"
}
.fa-anchor:before {
	content: "\f13d"
}
.fa-anchor-circle-check:before {
	content: "\e4aa"
}
.fa-anchor-circle-exclamation:before {
	content: "\e4ab"
}
.fa-anchor-circle-xmark:before {
	content: "\e4ac"
}
.fa-anchor-lock:before {
	content: "\e4ad"
}
.fa-angle-down:before {
	content: "\f107"
}
.fa-angle-left:before {
	content: "\f104"
}
.fa-angle-right:before {
	content: "\f105"
}
.fa-angle-up:before {
	content: "\f106"
}
.fa-angle-double-down:before, .fa-angles-down:before {
	content: "\f103"
}
.fa-angle-double-left:before, .fa-angles-left:before {
	content: "\f100"
}
.fa-angle-double-right:before, .fa-angles-right:before {
	content: "\f101"
}
.fa-angle-double-up:before, .fa-angles-up:before {
	content: "\f102"
}
.fa-ankh:before {
	content: "\f644"
}
.fa-apple-alt:before, .fa-apple-whole:before {
	content: "\f5d1"
}
.fa-archway:before {
	content: "\f557"
}
.fa-arrow-down:before {
	content: "\f063"
}
.fa-arrow-down-1-9:before, .fa-sort-numeric-asc:before, .fa-sort-numeric-down:before {
	content: "\f162"
}
.fa-arrow-down-9-1:before, .fa-sort-numeric-desc:before, .fa-sort-numeric-down-alt:before {
	content: "\f886"
}
.fa-arrow-down-a-z:before, .fa-sort-alpha-asc:before, .fa-sort-alpha-down:before {
	content: "\f15d"
}
.fa-arrow-down-long:before, .fa-long-arrow-down:before {
	content: "\f175"
}
.fa-arrow-down-short-wide:before, .fa-sort-amount-desc:before, .fa-sort-amount-down-alt:before {
	content: "\f884"
}
.fa-arrow-down-up-across-line:before {
	content: "\e4af"
}
.fa-arrow-down-up-lock:before {
	content: "\e4b0"
}
.fa-arrow-down-wide-short:before, .fa-sort-amount-asc:before, .fa-sort-amount-down:before {
	content: "\f160"
}
.fa-arrow-down-z-a:before, .fa-sort-alpha-desc:before, .fa-sort-alpha-down-alt:before {
	content: "\f881"
}
.fa-arrow-left:before {
	content: "\f060"
}
.fa-arrow-left-long:before, .fa-long-arrow-left:before {
	content: "\f177"
}
.fa-arrow-pointer:before, .fa-mouse-pointer:before {
	content: "\f245"
}
.fa-arrow-right:before {
	content: "\f061"
}
.fa-arrow-right-arrow-left:before, .fa-exchange:before {
	content: "\f0ec"
}
.fa-arrow-right-from-bracket:before, .fa-sign-out:before {
	content: "\f08b"
}
.fa-arrow-right-long:before, .fa-long-arrow-right:before {
	content: "\f178"
}
.fa-arrow-right-to-bracket:before, .fa-sign-in:before {
	content: "\f090"
}
.fa-arrow-right-to-city:before {
	content: "\e4b3"
}
.fa-arrow-left-rotate:before, .fa-arrow-rotate-back:before, .fa-arrow-rotate-backward:before, .fa-arrow-rotate-left:before, .fa-undo:before {
	content: "\f0e2"
}
.fa-arrow-right-rotate:before, .fa-arrow-rotate-forward:before, .fa-arrow-rotate-right:before, .fa-redo:before {
	content: "\f01e"
}
.fa-arrow-trend-down:before {
	content: "\e097"
}
.fa-arrow-trend-up:before {
	content: "\e098"
}
.fa-arrow-turn-down:before, .fa-level-down:before {
	content: "\f149"
}
.fa-arrow-turn-up:before, .fa-level-up:before {
	content: "\f148"
}
.fa-arrow-up:before {
	content: "\f062"
}
.fa-arrow-up-1-9:before, .fa-sort-numeric-up:before {
	content: "\f163"
}
.fa-arrow-up-9-1:before, .fa-sort-numeric-up-alt:before {
	content: "\f887"
}
.fa-arrow-up-a-z:before, .fa-sort-alpha-up:before {
	content: "\f15e"
}
.fa-arrow-up-from-bracket:before {
	content: "\e09a"
}
.fa-arrow-up-from-ground-water:before {
	content: "\e4b5"
}
.fa-arrow-up-from-water-pump:before {
	content: "\e4b6"
}
.fa-arrow-up-long:before, .fa-long-arrow-up:before {
	content: "\f176"
}
.fa-arrow-up-right-dots:before {
	content: "\e4b7"
}
.fa-arrow-up-right-from-square:before, .fa-external-link:before {
	content: "\f08e"
}
.fa-arrow-up-short-wide:before, .fa-sort-amount-up-alt:before {
	content: "\f885"
}
.fa-arrow-up-wide-short:before, .fa-sort-amount-up:before {
	content: "\f161"
}
.fa-arrow-up-z-a:before, .fa-sort-alpha-up-alt:before {
	content: "\f882"
}
.fa-arrows-down-to-line:before {
	content: "\e4b8"
}
.fa-arrows-down-to-people:before {
	content: "\e4b9"
}
.fa-arrows-h:before, .fa-arrows-left-right:before {
	content: "\f07e"
}
.fa-arrows-left-right-to-line:before {
	content: "\e4ba"
}
.fa-arrows-rotate:before, .fa-refresh:before, .fa-sync:before {
	content: "\f021"
}
.fa-arrows-spin:before {
	content: "\e4bb"
}
.fa-arrows-split-up-and-left:before {
	content: "\e4bc"
}
.fa-arrows-to-circle:before {
	content: "\e4bd"
}
.fa-arrows-to-dot:before {
	content: "\e4be"
}
.fa-arrows-to-eye:before {
	content: "\e4bf"
}
.fa-arrows-turn-right:before {
	content: "\e4c0"
}
.fa-arrows-turn-to-dots:before {
	content: "\e4c1"
}
.fa-arrows-up-down:before, .fa-arrows-v:before {
	content: "\f07d"
}
.fa-arrows-up-down-left-right:before, .fa-arrows:before {
	content: "\f047"
}
.fa-arrows-up-to-line:before {
	content: "\e4c2"
}
.fa-asterisk:before {
	content: "\2a"
}
.fa-at:before {
	content: "\40"
}
.fa-atom:before {
	content: "\f5d2"
}
.fa-audio-description:before {
	content: "\f29e"
}
.fa-austral-sign:before {
	content: "\e0a9"
}
.fa-award:before {
	content: "\f559"
}
.fa-b:before {
	content: "\42"
}
.fa-baby:before {
	content: "\f77c"
}
.fa-baby-carriage:before, .fa-carriage-baby:before {
	content: "\f77d"
}
.fa-backward:before {
	content: "\f04a"
}
.fa-backward-fast:before, .fa-fast-backward:before {
	content: "\f049"
}
.fa-backward-step:before, .fa-step-backward:before {
	content: "\f048"
}
.fa-bacon:before {
	content: "\f7e5"
}
.fa-bacteria:before {
	content: "\e059"
}
.fa-bacterium:before {
	content: "\e05a"
}
.fa-bag-shopping:before, .fa-shopping-bag:before {
	content: "\f290"
}
.fa-bahai:before {
	content: "\f666"
}
.fa-baht-sign:before {
	content: "\e0ac"
}
.fa-ban:before, .fa-cancel:before {
	content: "\f05e"
}
.fa-ban-smoking:before, .fa-smoking-ban:before {
	content: "\f54d"
}
.fa-band-aid:before, .fa-bandage:before {
	content: "\f462"
}
.fa-barcode:before {
	content: "\f02a"
}
.fa-bars:before, .fa-navicon:before {
	content: "\f0c9"
}
.fa-bars-progress:before, .fa-tasks-alt:before {
	content: "\f828"
}
.fa-bars-staggered:before, .fa-reorder:before, .fa-stream:before {
	content: "\f550"
}
.fa-baseball-ball:before, .fa-baseball:before {
	content: "\f433"
}
.fa-baseball-bat-ball:before {
	content: "\f432"
}
.fa-basket-shopping:before, .fa-shopping-basket:before {
	content: "\f291"
}
.fa-basketball-ball:before, .fa-basketball:before {
	content: "\f434"
}
.fa-bath:before, .fa-bathtub:before {
	content: "\f2cd"
}
.fa-battery-0:before, .fa-battery-empty:before {
	content: "\f244"
}
.fa-battery-5:before, .fa-battery-full:before, .fa-battery:before {
	content: "\f240"
}
.fa-battery-3:before, .fa-battery-half:before {
	content: "\f242"
}
.fa-battery-2:before, .fa-battery-quarter:before {
	content: "\f243"
}
.fa-battery-4:before, .fa-battery-three-quarters:before {
	content: "\f241"
}
.fa-bed:before {
	content: "\f236"
}
.fa-bed-pulse:before, .fa-procedures:before {
	content: "\f487"
}
.fa-beer-mug-empty:before, .fa-beer:before {
	content: "\f0fc"
}
.fa-bell:before {
	content: "\f0f3"
}
.fa-bell-concierge:before, .fa-concierge-bell:before {
	content: "\f562"
}
.fa-bell-slash:before {
	content: "\f1f6"
}
.fa-bezier-curve:before {
	content: "\f55b"
}
.fa-bicycle:before {
	content: "\f206"
}
.fa-binoculars:before {
	content: "\f1e5"
}
.fa-biohazard:before {
	content: "\f780"
}
.fa-bitcoin-sign:before {
	content: "\e0b4"
}
.fa-blender:before {
	content: "\f517"
}
.fa-blender-phone:before {
	content: "\f6b6"
}
.fa-blog:before {
	content: "\f781"
}
.fa-bold:before {
	content: "\f032"
}
.fa-bolt:before, .fa-zap:before {
	content: "\f0e7"
}
.fa-bolt-lightning:before {
	content: "\e0b7"
}
.fa-bomb:before {
	content: "\f1e2"
}
.fa-bone:before {
	content: "\f5d7"
}
.fa-bong:before {
	content: "\f55c"
}
.fa-book:before {
	content: "\f02d"
}
.fa-atlas:before, .fa-book-atlas:before {
	content: "\f558"
}
.fa-bible:before, .fa-book-bible:before {
	content: "\f647"
}
.fa-book-bookmark:before {
	content: "\e0bb"
}
.fa-book-journal-whills:before, .fa-journal-whills:before {
	content: "\f66a"
}
.fa-book-medical:before {
	content: "\f7e6"
}
.fa-book-open:before {
	content: "\f518"
}
.fa-book-open-reader:before, .fa-book-reader:before {
	content: "\f5da"
}
.fa-book-quran:before, .fa-quran:before {
	content: "\f687"
}
.fa-book-dead:before, .fa-book-skull:before {
	content: "\f6b7"
}
.fa-bookmark:before {
	content: "\f02e"
}
.fa-border-all:before {
	content: "\f84c"
}
.fa-border-none:before {
	content: "\f850"
}
.fa-border-style:before, .fa-border-top-left:before {
	content: "\f853"
}
.fa-bore-hole:before {
	content: "\e4c3"
}
.fa-bottle-droplet:before {
	content: "\e4c4"
}
.fa-bottle-water:before {
	content: "\e4c5"
}
.fa-bowl-food:before {
	content: "\e4c6"
}
.fa-bowl-rice:before {
	content: "\e2eb"
}
.fa-bowling-ball:before {
	content: "\f436"
}
.fa-box:before {
	content: "\f466"
}
.fa-archive:before, .fa-box-archive:before {
	content: "\f187"
}
.fa-box-open:before {
	content: "\f49e"
}
.fa-box-tissue:before {
	content: "\e05b"
}
.fa-boxes-packing:before {
	content: "\e4c7"
}
.fa-boxes-alt:before, .fa-boxes-stacked:before, .fa-boxes:before {
	content: "\f468"
}
.fa-braille:before {
	content: "\f2a1"
}
.fa-brain:before {
	content: "\f5dc"
}
.fa-brazilian-real-sign:before {
	content: "\e46c"
}
.fa-bread-slice:before {
	content: "\f7ec"
}
.fa-bridge:before {
	content: "\e4c8"
}
.fa-bridge-circle-check:before {
	content: "\e4c9"
}
.fa-bridge-circle-exclamation:before {
	content: "\e4ca"
}
.fa-bridge-circle-xmark:before {
	content: "\e4cb"
}
.fa-bridge-lock:before {
	content: "\e4cc"
}
.fa-bridge-water:before {
	content: "\e4ce"
}
.fa-briefcase:before {
	content: "\f0b1"
}
.fa-briefcase-medical:before {
	content: "\f469"
}
.fa-broom:before {
	content: "\f51a"
}
.fa-broom-ball:before, .fa-quidditch-broom-ball:before, .fa-quidditch:before {
	content: "\f458"
}
.fa-brush:before {
	content: "\f55d"
}
.fa-bucket:before {
	content: "\e4cf"
}
.fa-bug:before {
	content: "\f188"
}
.fa-bug-slash:before {
	content: "\e490"
}
.fa-bugs:before {
	content: "\e4d0"
}
.fa-building:before {
	content: "\f1ad"
}
.fa-building-circle-arrow-right:before {
	content: "\e4d1"
}
.fa-building-circle-check:before {
	content: "\e4d2"
}
.fa-building-circle-exclamation:before {
	content: "\e4d3"
}
.fa-building-circle-xmark:before {
	content: "\e4d4"
}
.fa-bank:before, .fa-building-columns:before, .fa-institution:before, .fa-museum:before, .fa-university:before {
	content: "\f19c"
}
.fa-building-flag:before {
	content: "\e4d5"
}
.fa-building-lock:before {
	content: "\e4d6"
}
.fa-building-ngo:before {
	content: "\e4d7"
}
.fa-building-shield:before {
	content: "\e4d8"
}
.fa-building-un:before {
	content: "\e4d9"
}
.fa-building-user:before {
	content: "\e4da"
}
.fa-building-wheat:before {
	content: "\e4db"
}
.fa-bullhorn:before {
	content: "\f0a1"
}
.fa-bullseye:before {
	content: "\f140"
}
.fa-burger:before, .fa-hamburger:before {
	content: "\f805"
}
.fa-burst:before {
	content: "\e4dc"
}
.fa-bus:before {
	content: "\f207"
}
.fa-bus-alt:before, .fa-bus-simple:before {
	content: "\f55e"
}
.fa-briefcase-clock:before, .fa-business-time:before {
	content: "\f64a"
}
.fa-c:before {
	content: "\43"
}
.fa-birthday-cake:before, .fa-cake-candles:before, .fa-cake:before {
	content: "\f1fd"
}
.fa-calculator:before {
	content: "\f1ec"
}
.fa-calendar:before {
	content: "\f133"
}
.fa-calendar-check:before {
	content: "\f274"
}
.fa-calendar-day:before {
	content: "\f783"
}
.fa-calendar-alt:before, .fa-calendar-days:before {
	content: "\f073"
}
.fa-calendar-minus:before {
	content: "\f272"
}
.fa-calendar-plus:before {
	content: "\f271"
}
.fa-calendar-week:before {
	content: "\f784"
}
.fa-calendar-times:before, .fa-calendar-xmark:before {
	content: "\f273"
}
.fa-camera-alt:before, .fa-camera:before {
	content: "\f030"
}
.fa-camera-retro:before {
	content: "\f083"
}
.fa-camera-rotate:before {
	content: "\e0d8"
}
.fa-campground:before {
	content: "\f6bb"
}
.fa-candy-cane:before {
	content: "\f786"
}
.fa-cannabis:before {
	content: "\f55f"
}
.fa-capsules:before {
	content: "\f46b"
}
.fa-automobile:before, .fa-car:before {
	content: "\f1b9"
}
.fa-battery-car:before, .fa-car-battery:before {
	content: "\f5df"
}
.fa-car-burst:before, .fa-car-crash:before {
	content: "\f5e1"
}
.fa-car-on:before {
	content: "\e4dd"
}
.fa-car-alt:before, .fa-car-rear:before {
	content: "\f5de"
}
.fa-car-side:before {
	content: "\f5e4"
}
.fa-car-tunnel:before {
	content: "\e4de"
}
.fa-caravan:before {
	content: "\f8ff"
}
.fa-caret-down:before {
	content: "\f0d7"
}
.fa-caret-left:before {
	content: "\f0d9"
}
.fa-caret-right:before {
	content: "\f0da"
}
.fa-caret-up:before {
	content: "\f0d8"
}
.fa-carrot:before {
	content: "\f787"
}
.fa-cart-arrow-down:before {
	content: "\f218"
}
.fa-cart-flatbed:before, .fa-dolly-flatbed:before {
	content: "\f474"
}
.fa-cart-flatbed-suitcase:before, .fa-luggage-cart:before {
	content: "\f59d"
}
.fa-cart-plus:before {
	content: "\f217"
}
.fa-cart-shopping:before, .fa-shopping-cart:before {
	content: "\f07a"
}
.fa-cash-register:before {
	content: "\f788"
}
.fa-cat:before {
	content: "\f6be"
}
.fa-cedi-sign:before {
	content: "\e0df"
}
.fa-cent-sign:before {
	content: "\e3f5"
}
.fa-certificate:before {
	content: "\f0a3"
}
.fa-chair:before {
	content: "\f6c0"
}
.fa-blackboard:before, .fa-chalkboard:before {
	content: "\f51b"
}
.fa-chalkboard-teacher:before, .fa-chalkboard-user:before {
	content: "\f51c"
}
.fa-champagne-glasses:before, .fa-glass-cheers:before {
	content: "\f79f"
}
.fa-charging-station:before {
	content: "\f5e7"
}
.fa-area-chart:before, .fa-chart-area:before {
	content: "\f1fe"
}
.fa-bar-chart:before, .fa-chart-bar:before {
	content: "\f080"
}
.fa-chart-column:before {
	content: "\e0e3"
}
.fa-chart-gantt:before {
	content: "\e0e4"
}
.fa-chart-line:before, .fa-line-chart:before {
	content: "\f201"
}
.fa-chart-pie:before, .fa-pie-chart:before {
	content: "\f200"
}
.fa-chart-simple:before {
	content: "\e473"
}
.fa-check:before {
	content: "\f00c"
}
.fa-check-double:before {
	content: "\f560"
}
.fa-check-to-slot:before, .fa-vote-yea:before {
	content: "\f772"
}
.fa-cheese:before {
	content: "\f7ef"
}
.fa-chess:before {
	content: "\f439"
}
.fa-chess-bishop:before {
	content: "\f43a"
}
.fa-chess-board:before {
	content: "\f43c"
}
.fa-chess-king:before {
	content: "\f43f"
}
.fa-chess-knight:before {
	content: "\f441"
}
.fa-chess-pawn:before {
	content: "\f443"
}
.fa-chess-queen:before {
	content: "\f445"
}
.fa-chess-rook:before {
	content: "\f447"
}
.fa-chevron-down:before {
	content: "\f078"
}
.fa-chevron-left:before {
	content: "\f053"
}
.fa-chevron-right:before {
	content: "\f054"
}
.fa-chevron-up:before {
	content: "\f077"
}
.fa-child:before {
	content: "\f1ae"
}
.fa-child-dress:before {
	content: "\e59c"
}
.fa-child-reaching:before {
	content: "\e59d"
}
.fa-child-rifle:before {
	content: "\e4e0"
}
.fa-children:before {
	content: "\e4e1"
}
.fa-church:before {
	content: "\f51d"
}
.fa-circle:before {
	content: "\f111"
}
.fa-arrow-circle-down:before, .fa-circle-arrow-down:before {
	content: "\f0ab"
}
.fa-arrow-circle-left:before, .fa-circle-arrow-left:before {
	content: "\f0a8"
}
.fa-arrow-circle-right:before, .fa-circle-arrow-right:before {
	content: "\f0a9"
}
.fa-arrow-circle-up:before, .fa-circle-arrow-up:before {
	content: "\f0aa"
}
.fa-check-circle:before, .fa-circle-check:before {
	content: "\f058"
}
.fa-chevron-circle-down:before, .fa-circle-chevron-down:before {
	content: "\f13a"
}
.fa-chevron-circle-left:before, .fa-circle-chevron-left:before {
	content: "\f137"
}
.fa-chevron-circle-right:before, .fa-circle-chevron-right:before {
	content: "\f138"
}
.fa-chevron-circle-up:before, .fa-circle-chevron-up:before {
	content: "\f139"
}
.fa-circle-dollar-to-slot:before, .fa-donate:before {
	content: "\f4b9"
}
.fa-circle-dot:before, .fa-dot-circle:before {
	content: "\f192"
}
.fa-arrow-alt-circle-down:before, .fa-circle-down:before {
	content: "\f358"
}
.fa-circle-exclamation:before, .fa-exclamation-circle:before {
	content: "\f06a"
}
.fa-circle-h:before, .fa-hospital-symbol:before {
	content: "\f47e"
}
.fa-adjust:before, .fa-circle-half-stroke:before {
	content: "\f042"
}
.fa-circle-info:before, .fa-info-circle:before {
	content: "\f05a"
}
.fa-arrow-alt-circle-left:before, .fa-circle-left:before {
	content: "\f359"
}
.fa-circle-minus:before, .fa-minus-circle:before {
	content: "\f056"
}
.fa-circle-nodes:before {
	content: "\e4e2"
}
.fa-circle-notch:before {
	content: "\f1ce"
}
.fa-circle-pause:before, .fa-pause-circle:before {
	content: "\f28b"
}
.fa-circle-play:before, .fa-play-circle:before {
	content: "\f144"
}
.fa-circle-plus:before, .fa-plus-circle:before {
	content: "\f055"
}
.fa-circle-question:before, .fa-question-circle:before {
	content: "\f059"
}
.fa-circle-radiation:before, .fa-radiation-alt:before {
	content: "\f7ba"
}
.fa-arrow-alt-circle-right:before, .fa-circle-right:before {
	content: "\f35a"
}
.fa-circle-stop:before, .fa-stop-circle:before {
	content: "\f28d"
}
.fa-arrow-alt-circle-up:before, .fa-circle-up:before {
	content: "\f35b"
}
.fa-circle-user:before, .fa-user-circle:before {
	content: "\f2bd"
}
.fa-circle-xmark:before, .fa-times-circle:before, .fa-xmark-circle:before {
	content: "\f057"
}
.fa-city:before {
	content: "\f64f"
}
.fa-clapperboard:before {
	content: "\e131"
}
.fa-clipboard:before {
	content: "\f328"
}
.fa-clipboard-check:before {
	content: "\f46c"
}
.fa-clipboard-list:before {
	content: "\f46d"
}
.fa-clipboard-question:before {
	content: "\e4e3"
}
.fa-clipboard-user:before {
	content: "\f7f3"
}
.fa-clock-four:before, .fa-clock:before {
	content: "\f017"
}
.fa-clock-rotate-left:before, .fa-history:before {
	content: "\f1da"
}
.fa-clone:before {
	content: "\f24d"
}
.fa-closed-captioning:before {
	content: "\f20a"
}
.fa-cloud:before {
	content: "\f0c2"
}
.fa-cloud-arrow-down:before, .fa-cloud-download-alt:before, .fa-cloud-download:before {
	content: "\f0ed"
}
.fa-cloud-arrow-up:before, .fa-cloud-upload-alt:before, .fa-cloud-upload:before {
	content: "\f0ee"
}
.fa-cloud-bolt:before, .fa-thunderstorm:before {
	content: "\f76c"
}
.fa-cloud-meatball:before {
	content: "\f73b"
}
.fa-cloud-moon:before {
	content: "\f6c3"
}
.fa-cloud-moon-rain:before {
	content: "\f73c"
}
.fa-cloud-rain:before {
	content: "\f73d"
}
.fa-cloud-showers-heavy:before {
	content: "\f740"
}
.fa-cloud-showers-water:before {
	content: "\e4e4"
}
.fa-cloud-sun:before {
	content: "\f6c4"
}
.fa-cloud-sun-rain:before {
	content: "\f743"
}
.fa-clover:before {
	content: "\e139"
}
.fa-code:before {
	content: "\f121"
}
.fa-code-branch:before {
	content: "\f126"
}
.fa-code-commit:before {
	content: "\f386"
}
.fa-code-compare:before {
	content: "\e13a"
}
.fa-code-fork:before {
	content: "\e13b"
}
.fa-code-merge:before {
	content: "\f387"
}
.fa-code-pull-request:before {
	content: "\e13c"
}
.fa-coins:before {
	content: "\f51e"
}
.fa-colon-sign:before {
	content: "\e140"
}
.fa-comment:before {
	content: "\f075"
}
.fa-comment-dollar:before {
	content: "\f651"
}
.fa-comment-dots:before, .fa-commenting:before {
	content: "\f4ad"
}
.fa-comment-medical:before {
	content: "\f7f5"
}
.fa-comment-slash:before {
	content: "\f4b3"
}
.fa-comment-sms:before, .fa-sms:before {
	content: "\f7cd"
}
.fa-comments:before {
	content: "\f086"
}
.fa-comments-dollar:before {
	content: "\f653"
}
.fa-compact-disc:before {
	content: "\f51f"
}
.fa-compass:before {
	content: "\f14e"
}
.fa-compass-drafting:before, .fa-drafting-compass:before {
	content: "\f568"
}
.fa-compress:before {
	content: "\f066"
}
.fa-computer:before {
	content: "\e4e5"
}
.fa-computer-mouse:before, .fa-mouse:before {
	content: "\f8cc"
}
.fa-cookie:before {
	content: "\f563"
}
.fa-cookie-bite:before {
	content: "\f564"
}
.fa-copy:before {
	content: "\f0c5"
}
.fa-copyright:before {
	content: "\f1f9"
}
.fa-couch:before {
	content: "\f4b8"
}
.fa-cow:before {
	content: "\f6c8"
}
.fa-credit-card-alt:before, .fa-credit-card:before {
	content: "\f09d"
}
.fa-crop:before {
	content: "\f125"
}
.fa-crop-alt:before, .fa-crop-simple:before {
	content: "\f565"
}
.fa-cross:before {
	content: "\f654"
}
.fa-crosshairs:before {
	content: "\f05b"
}
.fa-crow:before {
	content: "\f520"
}
.fa-crown:before {
	content: "\f521"
}
.fa-crutch:before {
	content: "\f7f7"
}
.fa-cruzeiro-sign:before {
	content: "\e152"
}
.fa-cube:before {
	content: "\f1b2"
}
.fa-cubes:before {
	content: "\f1b3"
}
.fa-cubes-stacked:before {
	content: "\e4e6"
}
.fa-d:before {
	content: "\44"
}
.fa-database:before {
	content: "\f1c0"
}
.fa-backspace:before, .fa-delete-left:before {
	content: "\f55a"
}
.fa-democrat:before {
	content: "\f747"
}
.fa-desktop-alt:before, .fa-desktop:before {
	content: "\f390"
}
.fa-dharmachakra:before {
	content: "\f655"
}
.fa-diagram-next:before {
	content: "\e476"
}
.fa-diagram-predecessor:before {
	content: "\e477"
}
.fa-diagram-project:before, .fa-project-diagram:before {
	content: "\f542"
}
.fa-diagram-successor:before {
	content: "\e47a"
}
.fa-diamond:before {
	content: "\f219"
}
.fa-diamond-turn-right:before, .fa-directions:before {
	content: "\f5eb"
}
.fa-dice:before {
	content: "\f522"
}
.fa-dice-d20:before {
	content: "\f6cf"
}
.fa-dice-d6:before {
	content: "\f6d1"
}
.fa-dice-five:before {
	content: "\f523"
}
.fa-dice-four:before {
	content: "\f524"
}
.fa-dice-one:before {
	content: "\f525"
}
.fa-dice-six:before {
	content: "\f526"
}
.fa-dice-three:before {
	content: "\f527"
}
.fa-dice-two:before {
	content: "\f528"
}
.fa-disease:before {
	content: "\f7fa"
}
.fa-display:before {
	content: "\e163"
}
.fa-divide:before {
	content: "\f529"
}
.fa-dna:before {
	content: "\f471"
}
.fa-dog:before {
	content: "\f6d3"
}
.fa-dollar-sign:before, .fa-dollar:before, .fa-usd:before {
	content: "\24"
}
.fa-dolly-box:before, .fa-dolly:before {
	content: "\f472"
}
.fa-dong-sign:before {
	content: "\e169"
}
.fa-door-closed:before {
	content: "\f52a"
}
.fa-door-open:before {
	content: "\f52b"
}
.fa-dove:before {
	content: "\f4ba"
}
.fa-compress-alt:before, .fa-down-left-and-up-right-to-center:before {
	content: "\f422"
}
.fa-down-long:before, .fa-long-arrow-alt-down:before {
	content: "\f309"
}
.fa-download:before {
	content: "\f019"
}
.fa-dragon:before {
	content: "\f6d5"
}
.fa-draw-polygon:before {
	content: "\f5ee"
}
.fa-droplet:before, .fa-tint:before {
	content: "\f043"
}
.fa-droplet-slash:before, .fa-tint-slash:before {
	content: "\f5c7"
}
.fa-drum:before {
	content: "\f569"
}
.fa-drum-steelpan:before {
	content: "\f56a"
}
.fa-drumstick-bite:before {
	content: "\f6d7"
}
.fa-dumbbell:before {
	content: "\f44b"
}
.fa-dumpster:before {
	content: "\f793"
}
.fa-dumpster-fire:before {
	content: "\f794"
}
.fa-dungeon:before {
	content: "\f6d9"
}
.fa-e:before {
	content: "\45"
}
.fa-deaf:before, .fa-deafness:before, .fa-ear-deaf:before, .fa-hard-of-hearing:before {
	content: "\f2a4"
}
.fa-assistive-listening-systems:before, .fa-ear-listen:before {
	content: "\f2a2"
}
.fa-earth-africa:before, .fa-globe-africa:before {
	content: "\f57c"
}
.fa-earth-america:before, .fa-earth-americas:before, .fa-earth:before, .fa-globe-americas:before {
	content: "\f57d"
}
.fa-earth-asia:before, .fa-globe-asia:before {
	content: "\f57e"
}
.fa-earth-europe:before, .fa-globe-europe:before {
	content: "\f7a2"
}
.fa-earth-oceania:before, .fa-globe-oceania:before {
	content: "\e47b"
}
.fa-egg:before {
	content: "\f7fb"
}
.fa-eject:before {
	content: "\f052"
}
.fa-elevator:before {
	content: "\e16d"
}
.fa-ellipsis-h:before, .fa-ellipsis:before {
	content: "\f141"
}
.fa-ellipsis-v:before, .fa-ellipsis-vertical:before {
	content: "\f142"
}
.fa-envelope:before {
	content: "\f0e0"
}
.fa-envelope-circle-check:before {
	content: "\e4e8"
}
.fa-envelope-open:before {
	content: "\f2b6"
}
.fa-envelope-open-text:before {
	content: "\f658"
}
.fa-envelopes-bulk:before, .fa-mail-bulk:before {
	content: "\f674"
}
.fa-equals:before {
	content: "\3d"
}
.fa-eraser:before {
	content: "\f12d"
}
.fa-ethernet:before {
	content: "\f796"
}
.fa-eur:before, .fa-euro-sign:before, .fa-euro:before {
	content: "\f153"
}
.fa-exclamation:before {
	content: "\21"
}
.fa-expand:before {
	content: "\f065"
}
.fa-explosion:before {
	content: "\e4e9"
}
.fa-eye:before {
	content: "\f06e"
}
.fa-eye-dropper-empty:before, .fa-eye-dropper:before, .fa-eyedropper:before {
	content: "\f1fb"
}
.fa-eye-low-vision:before, .fa-low-vision:before {
	content: "\f2a8"
}
.fa-eye-slash:before {
	content: "\f070"
}
.fa-f:before {
	content: "\46"
}
.fa-angry:before, .fa-face-angry:before {
	content: "\f556"
}
.fa-dizzy:before, .fa-face-dizzy:before {
	content: "\f567"
}
.fa-face-flushed:before, .fa-flushed:before {
	content: "\f579"
}
.fa-face-frown:before, .fa-frown:before {
	content: "\f119"
}
.fa-face-frown-open:before, .fa-frown-open:before {
	content: "\f57a"
}
.fa-face-grimace:before, .fa-grimace:before {
	content: "\f57f"
}
.fa-face-grin:before, .fa-grin:before {
	content: "\f580"
}
.fa-face-grin-beam:before, .fa-grin-beam:before {
	content: "\f582"
}
.fa-face-grin-beam-sweat:before, .fa-grin-beam-sweat:before {
	content: "\f583"
}
.fa-face-grin-hearts:before, .fa-grin-hearts:before {
	content: "\f584"
}
.fa-face-grin-squint:before, .fa-grin-squint:before {
	content: "\f585"
}
.fa-face-grin-squint-tears:before, .fa-grin-squint-tears:before {
	content: "\f586"
}
.fa-face-grin-stars:before, .fa-grin-stars:before {
	content: "\f587"
}
.fa-face-grin-tears:before, .fa-grin-tears:before {
	content: "\f588"
}
.fa-face-grin-tongue:before, .fa-grin-tongue:before {
	content: "\f589"
}
.fa-face-grin-tongue-squint:before, .fa-grin-tongue-squint:before {
	content: "\f58a"
}
.fa-face-grin-tongue-wink:before, .fa-grin-tongue-wink:before {
	content: "\f58b"
}
.fa-face-grin-wide:before, .fa-grin-alt:before {
	content: "\f581"
}
.fa-face-grin-wink:before, .fa-grin-wink:before {
	content: "\f58c"
}
.fa-face-kiss:before, .fa-kiss:before {
	content: "\f596"
}
.fa-face-kiss-beam:before, .fa-kiss-beam:before {
	content: "\f597"
}
.fa-face-kiss-wink-heart:before, .fa-kiss-wink-heart:before {
	content: "\f598"
}
.fa-face-laugh:before, .fa-laugh:before {
	content: "\f599"
}
.fa-face-laugh-beam:before, .fa-laugh-beam:before {
	content: "\f59a"
}
.fa-face-laugh-squint:before, .fa-laugh-squint:before {
	content: "\f59b"
}
.fa-face-laugh-wink:before, .fa-laugh-wink:before {
	content: "\f59c"
}
.fa-face-meh:before, .fa-meh:before {
	content: "\f11a"
}
.fa-face-meh-blank:before, .fa-meh-blank:before {
	content: "\f5a4"
}
.fa-face-rolling-eyes:before, .fa-meh-rolling-eyes:before {
	content: "\f5a5"
}
.fa-face-sad-cry:before, .fa-sad-cry:before {
	content: "\f5b3"
}
.fa-face-sad-tear:before, .fa-sad-tear:before {
	content: "\f5b4"
}
.fa-face-smile:before, .fa-smile:before {
	content: "\f118"
}
.fa-face-smile-beam:before, .fa-smile-beam:before {
	content: "\f5b8"
}
.fa-face-smile-wink:before, .fa-smile-wink:before {
	content: "\f4da"
}
.fa-face-surprise:before, .fa-surprise:before {
	content: "\f5c2"
}
.fa-face-tired:before, .fa-tired:before {
	content: "\f5c8"
}
.fa-fan:before {
	content: "\f863"
}
.fa-faucet:before {
	content: "\e005"
}
.fa-faucet-drip:before {
	content: "\e006"
}
.fa-fax:before {
	content: "\f1ac"
}
.fa-feather:before {
	content: "\f52d"
}
.fa-feather-alt:before, .fa-feather-pointed:before {
	content: "\f56b"
}
.fa-ferry:before {
	content: "\e4ea"
}
.fa-file:before {
	content: "\f15b"
}
.fa-file-arrow-down:before, .fa-file-download:before {
	content: "\f56d"
}
.fa-file-arrow-up:before, .fa-file-upload:before {
	content: "\f574"
}
.fa-file-audio:before {
	content: "\f1c7"
}
.fa-file-circle-check:before {
	content: "\e493"
}
.fa-file-circle-exclamation:before {
	content: "\e4eb"
}
.fa-file-circle-minus:before {
	content: "\e4ed"
}
.fa-file-circle-plus:before {
	content: "\e4ee"
}
.fa-file-circle-question:before {
	content: "\e4ef"
}
.fa-file-circle-xmark:before {
	content: "\e494"
}
.fa-file-code:before {
	content: "\f1c9"
}
.fa-file-contract:before {
	content: "\f56c"
}
.fa-file-csv:before {
	content: "\f6dd"
}
.fa-file-excel:before {
	content: "\f1c3"
}
.fa-arrow-right-from-file:before, .fa-file-export:before {
	content: "\f56e"
}
.fa-file-image:before {
	content: "\f1c5"
}
.fa-arrow-right-to-file:before, .fa-file-import:before {
	content: "\f56f"
}
.fa-file-invoice:before {
	content: "\f570"
}
.fa-file-invoice-dollar:before {
	content: "\f571"
}
.fa-file-alt:before, .fa-file-lines:before, .fa-file-text:before {
	content: "\f15c"
}
.fa-file-medical:before {
	content: "\f477"
}
.fa-file-pdf:before {
	content: "\f1c1"
}
.fa-file-edit:before, .fa-file-pen:before {
	content: "\f31c"
}
.fa-file-powerpoint:before {
	content: "\f1c4"
}
.fa-file-prescription:before {
	content: "\f572"
}
.fa-file-shield:before {
	content: "\e4f0"
}
.fa-file-signature:before {
	content: "\f573"
}
.fa-file-video:before {
	content: "\f1c8"
}
.fa-file-medical-alt:before, .fa-file-waveform:before {
	content: "\f478"
}
.fa-file-word:before {
	content: "\f1c2"
}
.fa-file-archive:before, .fa-file-zipper:before {
	content: "\f1c6"
}
.fa-fill:before {
	content: "\f575"
}
.fa-fill-drip:before {
	content: "\f576"
}
.fa-film:before {
	content: "\f008"
}
.fa-filter:before {
	content: "\f0b0"
}
.fa-filter-circle-dollar:before, .fa-funnel-dollar:before {
	content: "\f662"
}
.fa-filter-circle-xmark:before {
	content: "\e17b"
}
.fa-fingerprint:before {
	content: "\f577"
}
.fa-fire:before {
	content: "\f06d"
}
.fa-fire-burner:before {
	content: "\e4f1"
}
.fa-fire-extinguisher:before {
	content: "\f134"
}
.fa-fire-alt:before, .fa-fire-flame-curved:before {
	content: "\f7e4"
}
.fa-burn:before, .fa-fire-flame-simple:before {
	content: "\f46a"
}
.fa-fish:before {
	content: "\f578"
}
.fa-fish-fins:before {
	content: "\e4f2"
}
.fa-flag:before {
	content: "\f024"
}
.fa-flag-checkered:before {
	content: "\f11e"
}
.fa-flag-usa:before {
	content: "\f74d"
}
.fa-flask:before {
	content: "\f0c3"
}
.fa-flask-vial:before {
	content: "\e4f3"
}
.fa-floppy-disk:before, .fa-save:before {
	content: "\f0c7"
}
.fa-florin-sign:before {
	content: "\e184"
}
.fa-folder-blank:before, .fa-folder:before {
	content: "\f07b"
}
.fa-folder-closed:before {
	content: "\e185"
}
.fa-folder-minus:before {
	content: "\f65d"
}
.fa-folder-open:before {
	content: "\f07c"
}
.fa-folder-plus:before {
	content: "\f65e"
}
.fa-folder-tree:before {
	content: "\f802"
}
.fa-font:before {
	content: "\f031"
}
.fa-football-ball:before, .fa-football:before {
	content: "\f44e"
}
.fa-forward:before {
	content: "\f04e"
}
.fa-fast-forward:before, .fa-forward-fast:before {
	content: "\f050"
}
.fa-forward-step:before, .fa-step-forward:before {
	content: "\f051"
}
.fa-franc-sign:before {
	content: "\e18f"
}
.fa-frog:before {
	content: "\f52e"
}
.fa-futbol-ball:before, .fa-futbol:before, .fa-soccer-ball:before {
	content: "\f1e3"
}
.fa-g:before {
	content: "\47"
}
.fa-gamepad:before {
	content: "\f11b"
}
.fa-gas-pump:before {
	content: "\f52f"
}
.fa-dashboard:before, .fa-gauge-med:before, .fa-gauge:before, .fa-tachometer-alt-average:before {
	content: "\f624"
}
.fa-gauge-high:before, .fa-tachometer-alt-fast:before, .fa-tachometer-alt:before {
	content: "\f625"
}
.fa-gauge-simple-med:before, .fa-gauge-simple:before, .fa-tachometer-average:before {
	content: "\f629"
}
.fa-gauge-simple-high:before, .fa-tachometer-fast:before, .fa-tachometer:before {
	content: "\f62a"
}
.fa-gavel:before, .fa-legal:before {
	content: "\f0e3"
}
.fa-cog:before, .fa-gear:before {
	content: "\f013"
}
.fa-cogs:before, .fa-gears:before {
	content: "\f085"
}
.fa-gem:before {
	content: "\f3a5"
}
.fa-genderless:before {
	content: "\f22d"
}
.fa-ghost:before {
	content: "\f6e2"
}
.fa-gift:before {
	content: "\f06b"
}
.fa-gifts:before {
	content: "\f79c"
}
.fa-glass-water:before {
	content: "\e4f4"
}
.fa-glass-water-droplet:before {
	content: "\e4f5"
}
.fa-glasses:before {
	content: "\f530"
}
.fa-globe:before {
	content: "\f0ac"
}
.fa-golf-ball-tee:before, .fa-golf-ball:before {
	content: "\f450"
}
.fa-gopuram:before {
	content: "\f664"
}
.fa-graduation-cap:before, .fa-mortar-board:before {
	content: "\f19d"
}
.fa-greater-than:before {
	content: "\3e"
}
.fa-greater-than-equal:before {
	content: "\f532"
}
.fa-grip-horizontal:before, .fa-grip:before {
	content: "\f58d"
}
.fa-grip-lines:before {
	content: "\f7a4"
}
.fa-grip-lines-vertical:before {
	content: "\f7a5"
}
.fa-grip-vertical:before {
	content: "\f58e"
}
.fa-group-arrows-rotate:before {
	content: "\e4f6"
}
.fa-guarani-sign:before {
	content: "\e19a"
}
.fa-guitar:before {
	content: "\f7a6"
}
.fa-gun:before {
	content: "\e19b"
}
.fa-h:before {
	content: "\48"
}
.fa-hammer:before {
	content: "\f6e3"
}
.fa-hamsa:before {
	content: "\f665"
}
.fa-hand-paper:before, .fa-hand:before {
	content: "\f256"
}
.fa-hand-back-fist:before, .fa-hand-rock:before {
	content: "\f255"
}
.fa-allergies:before, .fa-hand-dots:before {
	content: "\f461"
}
.fa-fist-raised:before, .fa-hand-fist:before {
	content: "\f6de"
}
.fa-hand-holding:before {
	content: "\f4bd"
}
.fa-hand-holding-dollar:before, .fa-hand-holding-usd:before {
	content: "\f4c0"
}
.fa-hand-holding-droplet:before, .fa-hand-holding-water:before {
	content: "\f4c1"
}
.fa-hand-holding-hand:before {
	content: "\e4f7"
}
.fa-hand-holding-heart:before {
	content: "\f4be"
}
.fa-hand-holding-medical:before {
	content: "\e05c"
}
.fa-hand-lizard:before {
	content: "\f258"
}
.fa-hand-middle-finger:before {
	content: "\f806"
}
.fa-hand-peace:before {
	content: "\f25b"
}
.fa-hand-point-down:before {
	content: "\f0a7"
}
.fa-hand-point-left:before {
	content: "\f0a5"
}
.fa-hand-point-right:before {
	content: "\f0a4"
}
.fa-hand-point-up:before {
	content: "\f0a6"
}
.fa-hand-pointer:before {
	content: "\f25a"
}
.fa-hand-scissors:before {
	content: "\f257"
}
.fa-hand-sparkles:before {
	content: "\e05d"
}
.fa-hand-spock:before {
	content: "\f259"
}
.fa-handcuffs:before {
	content: "\e4f8"
}
.fa-hands:before, .fa-sign-language:before, .fa-signing:before {
	content: "\f2a7"
}
.fa-american-sign-language-interpreting:before, .fa-asl-interpreting:before, .fa-hands-american-sign-language-interpreting:before, .fa-hands-asl-interpreting:before {
	content: "\f2a3"
}
.fa-hands-bound:before {
	content: "\e4f9"
}
.fa-hands-bubbles:before, .fa-hands-wash:before {
	content: "\e05e"
}
.fa-hands-clapping:before {
	content: "\e1a8"
}
.fa-hands-holding:before {
	content: "\f4c2"
}
.fa-hands-holding-child:before {
	content: "\e4fa"
}
.fa-hands-holding-circle:before {
	content: "\e4fb"
}
.fa-hands-praying:before, .fa-praying-hands:before {
	content: "\f684"
}
.fa-handshake:before {
	content: "\f2b5"
}
.fa-hands-helping:before, .fa-handshake-angle:before {
	content: "\f4c4"
}
.fa-handshake-alt:before, .fa-handshake-simple:before {
	content: "\f4c6"
}
.fa-handshake-alt-slash:before, .fa-handshake-simple-slash:before {
	content: "\e05f"
}
.fa-handshake-slash:before {
	content: "\e060"
}
.fa-hanukiah:before {
	content: "\f6e6"
}
.fa-hard-drive:before, .fa-hdd:before {
	content: "\f0a0"
}
.fa-hashtag:before {
	content: "\23"
}
.fa-hat-cowboy:before {
	content: "\f8c0"
}
.fa-hat-cowboy-side:before {
	content: "\f8c1"
}
.fa-hat-wizard:before {
	content: "\f6e8"
}
.fa-head-side-cough:before {
	content: "\e061"
}
.fa-head-side-cough-slash:before {
	content: "\e062"
}
.fa-head-side-mask:before {
	content: "\e063"
}
.fa-head-side-virus:before {
	content: "\e064"
}
.fa-header:before, .fa-heading:before {
	content: "\f1dc"
}
.fa-headphones:before {
	content: "\f025"
}
.fa-headphones-alt:before, .fa-headphones-simple:before {
	content: "\f58f"
}
.fa-headset:before {
	content: "\f590"
}
.fa-heart:before {
	content: "\f004"
}
.fa-heart-circle-bolt:before {
	content: "\e4fc"
}
.fa-heart-circle-check:before {
	content: "\e4fd"
}
.fa-heart-circle-exclamation:before {
	content: "\e4fe"
}
.fa-heart-circle-minus:before {
	content: "\e4ff"
}
.fa-heart-circle-plus:before {
	content: "\e500"
}
.fa-heart-circle-xmark:before {
	content: "\e501"
}
.fa-heart-broken:before, .fa-heart-crack:before {
	content: "\f7a9"
}
.fa-heart-pulse:before, .fa-heartbeat:before {
	content: "\f21e"
}
.fa-helicopter:before {
	content: "\f533"
}
.fa-helicopter-symbol:before {
	content: "\e502"
}
.fa-hard-hat:before, .fa-hat-hard:before, .fa-helmet-safety:before {
	content: "\f807"
}
.fa-helmet-un:before {
	content: "\e503"
}
.fa-highlighter:before {
	content: "\f591"
}
.fa-hill-avalanche:before {
	content: "\e507"
}
.fa-hill-rockslide:before {
	content: "\e508"
}
.fa-hippo:before {
	content: "\f6ed"
}
.fa-hockey-puck:before {
	content: "\f453"
}
.fa-holly-berry:before {
	content: "\f7aa"
}
.fa-horse:before {
	content: "\f6f0"
}
.fa-horse-head:before {
	content: "\f7ab"
}
.fa-hospital-alt:before, .fa-hospital-wide:before, .fa-hospital:before {
	content: "\f0f8"
}
.fa-hospital-user:before {
	content: "\f80d"
}
.fa-hot-tub-person:before, .fa-hot-tub:before {
	content: "\f593"
}
.fa-hotdog:before {
	content: "\f80f"
}
.fa-hotel:before {
	content: "\f594"
}
.fa-hourglass-2:before, .fa-hourglass-half:before, .fa-hourglass:before {
	content: "\f254"
}
.fa-hourglass-empty:before {
	content: "\f252"
}
.fa-hourglass-3:before, .fa-hourglass-end:before {
	content: "\f253"
}
.fa-hourglass-1:before, .fa-hourglass-start:before {
	content: "\f251"
}
.fa-home-alt:before, .fa-home-lg-alt:before, .fa-home:before, .fa-house:before {
	content: "\f015"
}
.fa-home-lg:before, .fa-house-chimney:before {
	content: "\e3af"
}
.fa-house-chimney-crack:before, .fa-house-damage:before {
	content: "\f6f1"
}
.fa-clinic-medical:before, .fa-house-chimney-medical:before {
	content: "\f7f2"
}
.fa-house-chimney-user:before {
	content: "\e065"
}
.fa-house-chimney-window:before {
	content: "\e00d"
}
.fa-house-circle-check:before {
	content: "\e509"
}
.fa-house-circle-exclamation:before {
	content: "\e50a"
}
.fa-house-circle-xmark:before {
	content: "\e50b"
}
.fa-house-crack:before {
	content: "\e3b1"
}
.fa-house-fire:before {
	content: "\e50c"
}
.fa-house-flag:before {
	content: "\e50d"
}
.fa-house-flood-water:before {
	content: "\e50e"
}
.fa-house-flood-water-circle-arrow-right:before {
	content: "\e50f"
}
.fa-house-laptop:before, .fa-laptop-house:before {
	content: "\e066"
}
.fa-house-lock:before {
	content: "\e510"
}
.fa-house-medical:before {
	content: "\e3b2"
}
.fa-house-medical-circle-check:before {
	content: "\e511"
}
.fa-house-medical-circle-exclamation:before {
	content: "\e512"
}
.fa-house-medical-circle-xmark:before {
	content: "\e513"
}
.fa-house-medical-flag:before {
	content: "\e514"
}
.fa-house-signal:before {
	content: "\e012"
}
.fa-house-tsunami:before {
	content: "\e515"
}
.fa-home-user:before, .fa-house-user:before {
	content: "\e1b0"
}
.fa-hryvnia-sign:before, .fa-hryvnia:before {
	content: "\f6f2"
}
.fa-hurricane:before {
	content: "\f751"
}
.fa-i:before {
	content: "\49"
}
.fa-i-cursor:before {
	content: "\f246"
}
.fa-ice-cream:before {
	content: "\f810"
}
.fa-icicles:before {
	content: "\f7ad"
}
.fa-heart-music-camera-bolt:before, .fa-icons:before {
	content: "\f86d"
}
.fa-id-badge:before {
	content: "\f2c1"
}
.fa-drivers-license:before, .fa-id-card:before {
	content: "\f2c2"
}
.fa-id-card-alt:before, .fa-id-card-clip:before {
	content: "\f47f"
}
.fa-igloo:before {
	content: "\f7ae"
}
.fa-image:before {
	content: "\f03e"
}
.fa-image-portrait:before, .fa-portrait:before {
	content: "\f3e0"
}
.fa-images:before {
	content: "\f302"
}
.fa-inbox:before {
	content: "\f01c"
}
.fa-indent:before {
	content: "\f03c"
}
.fa-indian-rupee-sign:before, .fa-indian-rupee:before, .fa-inr:before {
	content: "\e1bc"
}
.fa-industry:before {
	content: "\f275"
}
.fa-infinity:before {
	content: "\f534"
}
.fa-info:before {
	content: "\f129"
}
.fa-italic:before {
	content: "\f033"
}
.fa-j:before {
	content: "\4a"
}
.fa-jar:before {
	content: "\e516"
}
.fa-jar-wheat:before {
	content: "\e517"
}
.fa-jedi:before {
	content: "\f669"
}
.fa-fighter-jet:before, .fa-jet-fighter:before {
	content: "\f0fb"
}
.fa-jet-fighter-up:before {
	content: "\e518"
}
.fa-joint:before {
	content: "\f595"
}
.fa-jug-detergent:before {
	content: "\e519"
}
.fa-k:before {
	content: "\4b"
}
.fa-kaaba:before {
	content: "\f66b"
}
.fa-key:before {
	content: "\f084"
}
.fa-keyboard:before {
	content: "\f11c"
}
.fa-khanda:before {
	content: "\f66d"
}
.fa-kip-sign:before {
	content: "\e1c4"
}
.fa-first-aid:before, .fa-kit-medical:before {
	content: "\f479"
}
.fa-kitchen-set:before {
	content: "\e51a"
}
.fa-kiwi-bird:before {
	content: "\f535"
}
.fa-l:before {
	content: "\4c"
}
.fa-land-mine-on:before {
	content: "\e51b"
}
.fa-landmark:before {
	content: "\f66f"
}
.fa-landmark-alt:before, .fa-landmark-dome:before {
	content: "\f752"
}
.fa-landmark-flag:before {
	content: "\e51c"
}
.fa-language:before {
	content: "\f1ab"
}
.fa-laptop:before {
	content: "\f109"
}
.fa-laptop-code:before {
	content: "\f5fc"
}
.fa-laptop-file:before {
	content: "\e51d"
}
.fa-laptop-medical:before {
	content: "\f812"
}
.fa-lari-sign:before {
	content: "\e1c8"
}
.fa-layer-group:before {
	content: "\f5fd"
}
.fa-leaf:before {
	content: "\f06c"
}
.fa-left-long:before, .fa-long-arrow-alt-left:before {
	content: "\f30a"
}
.fa-arrows-alt-h:before, .fa-left-right:before {
	content: "\f337"
}
.fa-lemon:before {
	content: "\f094"
}
.fa-less-than:before {
	content: "\3c"
}
.fa-less-than-equal:before {
	content: "\f537"
}
.fa-life-ring:before {
	content: "\f1cd"
}
.fa-lightbulb:before {
	content: "\f0eb"
}
.fa-lines-leaning:before {
	content: "\e51e"
}
.fa-chain:before, .fa-link:before {
	content: "\f0c1"
}
.fa-chain-broken:before, .fa-chain-slash:before, .fa-link-slash:before, .fa-unlink:before {
	content: "\f127"
}
.fa-lira-sign:before {
	content: "\f195"
}
.fa-list-squares:before, .fa-list:before {
	content: "\f03a"
}
.fa-list-check:before, .fa-tasks:before {
	content: "\f0ae"
}
.fa-list-1-2:before, .fa-list-numeric:before, .fa-list-ol:before {
	content: "\f0cb"
}
.fa-list-dots:before, .fa-list-ul:before {
	content: "\f0ca"
}
.fa-litecoin-sign:before {
	content: "\e1d3"
}
.fa-location-arrow:before {
	content: "\f124"
}
.fa-location-crosshairs:before, .fa-location:before {
	content: "\f601"
}
.fa-location-dot:before, .fa-map-marker-alt:before {
	content: "\f3c5"
}
.fa-location-pin:before, .fa-map-marker:before {
	content: "\f041"
}
.fa-location-pin-lock:before {
	content: "\e51f"
}
.fa-lock:before {
	content: "\f023"
}
.fa-lock-open:before {
	content: "\f3c1"
}
.fa-locust:before {
	content: "\e520"
}
.fa-lungs:before {
	content: "\f604"
}
.fa-lungs-virus:before {
	content: "\e067"
}
.fa-m:before {
	content: "\4d"
}
.fa-magnet:before {
	content: "\f076"
}
.fa-magnifying-glass:before, .fa-search:before {
	content: "\f002"
}
.fa-magnifying-glass-arrow-right:before {
	content: "\e521"
}
.fa-magnifying-glass-chart:before {
	content: "\e522"
}
.fa-magnifying-glass-dollar:before, .fa-search-dollar:before {
	content: "\f688"
}
.fa-magnifying-glass-location:before, .fa-search-location:before {
	content: "\f689"
}
.fa-magnifying-glass-minus:before, .fa-search-minus:before {
	content: "\f010"
}
.fa-magnifying-glass-plus:before, .fa-search-plus:before {
	content: "\f00e"
}
.fa-manat-sign:before {
	content: "\e1d5"
}
.fa-map:before {
	content: "\f279"
}
.fa-map-location:before, .fa-map-marked:before {
	content: "\f59f"
}
.fa-map-location-dot:before, .fa-map-marked-alt:before {
	content: "\f5a0"
}
.fa-map-pin:before {
	content: "\f276"
}
.fa-marker:before {
	content: "\f5a1"
}
.fa-mars:before {
	content: "\f222"
}
.fa-mars-and-venus:before {
	content: "\f224"
}
.fa-mars-and-venus-burst:before {
	content: "\e523"
}
.fa-mars-double:before {
	content: "\f227"
}
.fa-mars-stroke:before {
	content: "\f229"
}
.fa-mars-stroke-h:before, .fa-mars-stroke-right:before {
	content: "\f22b"
}
.fa-mars-stroke-up:before, .fa-mars-stroke-v:before {
	content: "\f22a"
}
.fa-glass-martini-alt:before, .fa-martini-glass:before {
	content: "\f57b"
}
.fa-cocktail:before, .fa-martini-glass-citrus:before {
	content: "\f561"
}
.fa-glass-martini:before, .fa-martini-glass-empty:before {
	content: "\f000"
}
.fa-mask:before {
	content: "\f6fa"
}
.fa-mask-face:before {
	content: "\e1d7"
}
.fa-mask-ventilator:before {
	content: "\e524"
}
.fa-masks-theater:before, .fa-theater-masks:before {
	content: "\f630"
}
.fa-mattress-pillow:before {
	content: "\e525"
}
.fa-expand-arrows-alt:before, .fa-maximize:before {
	content: "\f31e"
}
.fa-medal:before {
	content: "\f5a2"
}
.fa-memory:before {
	content: "\f538"
}
.fa-menorah:before {
	content: "\f676"
}
.fa-mercury:before {
	content: "\f223"
}
.fa-comment-alt:before, .fa-message:before {
	content: "\f27a"
}
.fa-meteor:before {
	content: "\f753"
}
.fa-microchip:before {
	content: "\f2db"
}
.fa-microphone:before {
	content: "\f130"
}
.fa-microphone-alt:before, .fa-microphone-lines:before {
	content: "\f3c9"
}
.fa-microphone-alt-slash:before, .fa-microphone-lines-slash:before {
	content: "\f539"
}
.fa-microphone-slash:before {
	content: "\f131"
}
.fa-microscope:before {
	content: "\f610"
}
.fa-mill-sign:before {
	content: "\e1ed"
}
.fa-compress-arrows-alt:before, .fa-minimize:before {
	content: "\f78c"
}
.fa-minus:before, .fa-subtract:before {
	content: "\f068"
}
.fa-mitten:before {
	content: "\f7b5"
}
.fa-mobile-android:before, .fa-mobile-phone:before, .fa-mobile:before {
	content: "\f3ce"
}
.fa-mobile-button:before {
	content: "\f10b"
}
.fa-mobile-retro:before {
	content: "\e527"
}
.fa-mobile-android-alt:before, .fa-mobile-screen:before {
	content: "\f3cf"
}
.fa-mobile-alt:before, .fa-mobile-screen-button:before {
	content: "\f3cd"
}
.fa-money-bill:before {
	content: "\f0d6"
}
.fa-money-bill-1:before, .fa-money-bill-alt:before {
	content: "\f3d1"
}
.fa-money-bill-1-wave:before, .fa-money-bill-wave-alt:before {
	content: "\f53b"
}
.fa-money-bill-transfer:before {
	content: "\e528"
}
.fa-money-bill-trend-up:before {
	content: "\e529"
}
.fa-money-bill-wave:before {
	content: "\f53a"
}
.fa-money-bill-wheat:before {
	content: "\e52a"
}
.fa-money-bills:before {
	content: "\e1f3"
}
.fa-money-check:before {
	content: "\f53c"
}
.fa-money-check-alt:before, .fa-money-check-dollar:before {
	content: "\f53d"
}
.fa-monument:before {
	content: "\f5a6"
}
.fa-moon:before {
	content: "\f186"
}
.fa-mortar-pestle:before {
	content: "\f5a7"
}
.fa-mosque:before {
	content: "\f678"
}
.fa-mosquito:before {
	content: "\e52b"
}
.fa-mosquito-net:before {
	content: "\e52c"
}
.fa-motorcycle:before {
	content: "\f21c"
}
.fa-mound:before {
	content: "\e52d"
}
.fa-mountain:before {
	content: "\f6fc"
}
.fa-mountain-city:before {
	content: "\e52e"
}
.fa-mountain-sun:before {
	content: "\e52f"
}
.fa-mug-hot:before {
	content: "\f7b6"
}
.fa-coffee:before, .fa-mug-saucer:before {
	content: "\f0f4"
}
.fa-music:before {
	content: "\f001"
}
.fa-n:before {
	content: "\4e"
}
.fa-naira-sign:before {
	content: "\e1f6"
}
.fa-network-wired:before {
	content: "\f6ff"
}
.fa-neuter:before {
	content: "\f22c"
}
.fa-newspaper:before {
	content: "\f1ea"
}
.fa-not-equal:before {
	content: "\f53e"
}
.fa-note-sticky:before, .fa-sticky-note:before {
	content: "\f249"
}
.fa-notes-medical:before {
	content: "\f481"
}
.fa-o:before {
	content: "\4f"
}
.fa-object-group:before {
	content: "\f247"
}
.fa-object-ungroup:before {
	content: "\f248"
}
.fa-oil-can:before {
	content: "\f613"
}
.fa-oil-well:before {
	content: "\e532"
}
.fa-om:before {
	content: "\f679"
}
.fa-otter:before {
	content: "\f700"
}
.fa-dedent:before, .fa-outdent:before {
	content: "\f03b"
}
.fa-p:before {
	content: "\50"
}
.fa-pager:before {
	content: "\f815"
}
.fa-paint-roller:before {
	content: "\f5aa"
}
.fa-paint-brush:before, .fa-paintbrush:before {
	content: "\f1fc"
}
.fa-palette:before {
	content: "\f53f"
}
.fa-pallet:before {
	content: "\f482"
}
.fa-panorama:before {
	content: "\e209"
}
.fa-paper-plane:before {
	content: "\f1d8"
}
.fa-paperclip:before {
	content: "\f0c6"
}
.fa-parachute-box:before {
	content: "\f4cd"
}
.fa-paragraph:before {
	content: "\f1dd"
}
.fa-passport:before {
	content: "\f5ab"
}
.fa-file-clipboard:before, .fa-paste:before {
	content: "\f0ea"
}
.fa-pause:before {
	content: "\f04c"
}
.fa-paw:before {
	content: "\f1b0"
}
.fa-peace:before {
	content: "\f67c"
}
.fa-pen:before {
	content: "\f304"
}
.fa-pen-alt:before, .fa-pen-clip:before {
	content: "\f305"
}
.fa-pen-fancy:before {
	content: "\f5ac"
}
.fa-pen-nib:before {
	content: "\f5ad"
}
.fa-pen-ruler:before, .fa-pencil-ruler:before {
	content: "\f5ae"
}
.fa-edit:before, .fa-pen-to-square:before {
	content: "\f044"
}
.fa-pencil-alt:before, .fa-pencil:before {
	content: "\f303"
}
.fa-people-arrows-left-right:before, .fa-people-arrows:before {
	content: "\e068"
}
.fa-people-carry-box:before, .fa-people-carry:before {
	content: "\f4ce"
}
.fa-people-group:before {
	content: "\e533"
}
.fa-people-line:before {
	content: "\e534"
}
.fa-people-pulling:before {
	content: "\e535"
}
.fa-people-robbery:before {
	content: "\e536"
}
.fa-people-roof:before {
	content: "\e537"
}
.fa-pepper-hot:before {
	content: "\f816"
}
.fa-percent:before, .fa-percentage:before {
	content: "\25"
}
.fa-male:before, .fa-person:before {
	content: "\f183"
}
.fa-person-arrow-down-to-line:before {
	content: "\e538"
}
.fa-person-arrow-up-from-line:before {
	content: "\e539"
}
.fa-biking:before, .fa-person-biking:before {
	content: "\f84a"
}
.fa-person-booth:before {
	content: "\f756"
}
.fa-person-breastfeeding:before {
	content: "\e53a"
}
.fa-person-burst:before {
	content: "\e53b"
}
.fa-person-cane:before {
	content: "\e53c"
}
.fa-person-chalkboard:before {
	content: "\e53d"
}
.fa-person-circle-check:before {
	content: "\e53e"
}
.fa-person-circle-exclamation:before {
	content: "\e53f"
}
.fa-person-circle-minus:before {
	content: "\e540"
}
.fa-person-circle-plus:before {
	content: "\e541"
}
.fa-person-circle-question:before {
	content: "\e542"
}
.fa-person-circle-xmark:before {
	content: "\e543"
}
.fa-digging:before, .fa-person-digging:before {
	content: "\f85e"
}
.fa-diagnoses:before, .fa-person-dots-from-line:before {
	content: "\f470"
}
.fa-female:before, .fa-person-dress:before {
	content: "\f182"
}
.fa-person-dress-burst:before {
	content: "\e544"
}
.fa-person-drowning:before {
	content: "\e545"
}
.fa-person-falling:before {
	content: "\e546"
}
.fa-person-falling-burst:before {
	content: "\e547"
}
.fa-person-half-dress:before {
	content: "\e548"
}
.fa-person-harassing:before {
	content: "\e549"
}
.fa-hiking:before, .fa-person-hiking:before {
	content: "\f6ec"
}
.fa-person-military-pointing:before {
	content: "\e54a"
}
.fa-person-military-rifle:before {
	content: "\e54b"
}
.fa-person-military-to-person:before {
	content: "\e54c"
}
.fa-person-praying:before, .fa-pray:before {
	content: "\f683"
}
.fa-person-pregnant:before {
	content: "\e31e"
}
.fa-person-rays:before {
	content: "\e54d"
}
.fa-person-rifle:before {
	content: "\e54e"
}
.fa-person-running:before, .fa-running:before {
	content: "\f70c"
}
.fa-person-shelter:before {
	content: "\e54f"
}
.fa-person-skating:before, .fa-skating:before {
	content: "\f7c5"
}
.fa-person-skiing:before, .fa-skiing:before {
	content: "\f7c9"
}
.fa-person-skiing-nordic:before, .fa-skiing-nordic:before {
	content: "\f7ca"
}
.fa-person-snowboarding:before, .fa-snowboarding:before {
	content: "\f7ce"
}
.fa-person-swimming:before, .fa-swimmer:before {
	content: "\f5c4"
}
.fa-person-through-window:before {
	content: "\e433"
}
.fa-person-walking:before, .fa-walking:before {
	content: "\f554"
}
.fa-person-walking-arrow-loop-left:before {
	content: "\e551"
}
.fa-person-walking-arrow-right:before {
	content: "\e552"
}
.fa-person-walking-dashed-line-arrow-right:before {
	content: "\e553"
}
.fa-person-walking-luggage:before {
	content: "\e554"
}
.fa-blind:before, .fa-person-walking-with-cane:before {
	content: "\f29d"
}
.fa-peseta-sign:before {
	content: "\e221"
}
.fa-peso-sign:before {
	content: "\e222"
}
.fa-phone:before {
	content: "\f095"
}
.fa-phone-alt:before, .fa-phone-flip:before {
	content: "\f879"
}
.fa-phone-slash:before {
	content: "\f3dd"
}
.fa-phone-volume:before, .fa-volume-control-phone:before {
	content: "\f2a0"
}
.fa-photo-film:before, .fa-photo-video:before {
	content: "\f87c"
}
.fa-piggy-bank:before {
	content: "\f4d3"
}
.fa-pills:before {
	content: "\f484"
}
.fa-pizza-slice:before {
	content: "\f818"
}
.fa-place-of-worship:before {
	content: "\f67f"
}
.fa-plane:before {
	content: "\f072"
}
.fa-plane-arrival:before {
	content: "\f5af"
}
.fa-plane-circle-check:before {
	content: "\e555"
}
.fa-plane-circle-exclamation:before {
	content: "\e556"
}
.fa-plane-circle-xmark:before {
	content: "\e557"
}
.fa-plane-departure:before {
	content: "\f5b0"
}
.fa-plane-lock:before {
	content: "\e558"
}
.fa-plane-slash:before {
	content: "\e069"
}
.fa-plane-up:before {
	content: "\e22d"
}
.fa-plant-wilt:before {
	content: "\e43b"
}
.fa-plate-wheat:before {
	content: "\e55a"
}
.fa-play:before {
	content: "\f04b"
}
.fa-plug:before {
	content: "\f1e6"
}
.fa-plug-circle-bolt:before {
	content: "\e55b"
}
.fa-plug-circle-check:before {
	content: "\e55c"
}
.fa-plug-circle-exclamation:before {
	content: "\e55d"
}
.fa-plug-circle-minus:before {
	content: "\e55e"
}
.fa-plug-circle-plus:before {
	content: "\e55f"
}
.fa-plug-circle-xmark:before {
	content: "\e560"
}
.fa-add:before, .fa-plus:before {
	content: "\2b"
}
.fa-plus-minus:before {
	content: "\e43c"
}
.fa-podcast:before {
	content: "\f2ce"
}
.fa-poo:before {
	content: "\f2fe"
}
.fa-poo-bolt:before, .fa-poo-storm:before {
	content: "\f75a"
}
.fa-poop:before {
	content: "\f619"
}
.fa-power-off:before {
	content: "\f011"
}
.fa-prescription:before {
	content: "\f5b1"
}
.fa-prescription-bottle:before {
	content: "\f485"
}
.fa-prescription-bottle-alt:before, .fa-prescription-bottle-medical:before {
	content: "\f486"
}
.fa-print:before {
	content: "\f02f"
}
.fa-pump-medical:before {
	content: "\e06a"
}
.fa-pump-soap:before {
	content: "\e06b"
}
.fa-puzzle-piece:before {
	content: "\f12e"
}
.fa-q:before {
	content: "\51"
}
.fa-qrcode:before {
	content: "\f029"
}
.fa-question:before {
	content: "\3f"
}
.fa-quote-left-alt:before, .fa-quote-left:before {
	content: "\f10d"
}
.fa-quote-right-alt:before, .fa-quote-right:before {
	content: "\f10e"
}
.fa-r:before {
	content: "\52"
}
.fa-radiation:before {
	content: "\f7b9"
}
.fa-radio:before {
	content: "\f8d7"
}
.fa-rainbow:before {
	content: "\f75b"
}
.fa-ranking-star:before {
	content: "\e561"
}
.fa-receipt:before {
	content: "\f543"
}
.fa-record-vinyl:before {
	content: "\f8d9"
}
.fa-ad:before, .fa-rectangle-ad:before {
	content: "\f641"
}
.fa-list-alt:before, .fa-rectangle-list:before {
	content: "\f022"
}
.fa-rectangle-times:before, .fa-rectangle-xmark:before, .fa-times-rectangle:before, .fa-window-close:before {
	content: "\f410"
}
.fa-recycle:before {
	content: "\f1b8"
}
.fa-registered:before {
	content: "\f25d"
}
.fa-repeat:before {
	content: "\f363"
}
.fa-mail-reply:before, .fa-reply:before {
	content: "\f3e5"
}
.fa-mail-reply-all:before, .fa-reply-all:before {
	content: "\f122"
}
.fa-republican:before {
	content: "\f75e"
}
.fa-restroom:before {
	content: "\f7bd"
}
.fa-retweet:before {
	content: "\f079"
}
.fa-ribbon:before {
	content: "\f4d6"
}
.fa-right-from-bracket:before, .fa-sign-out-alt:before {
	content: "\f2f5"
}
.fa-exchange-alt:before, .fa-right-left:before {
	content: "\f362"
}
.fa-long-arrow-alt-right:before, .fa-right-long:before {
	content: "\f30b"
}
.fa-right-to-bracket:before, .fa-sign-in-alt:before {
	content: "\f2f6"
}
.fa-ring:before {
	content: "\f70b"
}
.fa-road:before {
	content: "\f018"
}
.fa-road-barrier:before {
	content: "\e562"
}
.fa-road-bridge:before {
	content: "\e563"
}
.fa-road-circle-check:before {
	content: "\e564"
}
.fa-road-circle-exclamation:before {
	content: "\e565"
}
.fa-road-circle-xmark:before {
	content: "\e566"
}
.fa-road-lock:before {
	content: "\e567"
}
.fa-road-spikes:before {
	content: "\e568"
}
.fa-robot:before {
	content: "\f544"
}
.fa-rocket:before {
	content: "\f135"
}
.fa-rotate:before, .fa-sync-alt:before {
	content: "\f2f1"
}
.fa-rotate-back:before, .fa-rotate-backward:before, .fa-rotate-left:before, .fa-undo-alt:before {
	content: "\f2ea"
}
.fa-redo-alt:before, .fa-rotate-forward:before, .fa-rotate-right:before {
	content: "\f2f9"
}
.fa-route:before {
	content: "\f4d7"
}
.fa-feed:before, .fa-rss:before {
	content: "\f09e"
}
.fa-rouble:before, .fa-rub:before, .fa-ruble-sign:before, .fa-ruble:before {
	content: "\f158"
}
.fa-rug:before {
	content: "\e569"
}
.fa-ruler:before {
	content: "\f545"
}
.fa-ruler-combined:before {
	content: "\f546"
}
.fa-ruler-horizontal:before {
	content: "\f547"
}
.fa-ruler-vertical:before {
	content: "\f548"
}
.fa-rupee-sign:before, .fa-rupee:before {
	content: "\f156"
}
.fa-rupiah-sign:before {
	content: "\e23d"
}
.fa-s:before {
	content: "\53"
}
.fa-sack-dollar:before {
	content: "\f81d"
}
.fa-sack-xmark:before {
	content: "\e56a"
}
.fa-sailboat:before {
	content: "\e445"
}
.fa-satellite:before {
	content: "\f7bf"
}
.fa-satellite-dish:before {
	content: "\f7c0"
}
.fa-balance-scale:before, .fa-scale-balanced:before {
	content: "\f24e"
}
.fa-balance-scale-left:before, .fa-scale-unbalanced:before {
	content: "\f515"
}
.fa-balance-scale-right:before, .fa-scale-unbalanced-flip:before {
	content: "\f516"
}
.fa-school:before {
	content: "\f549"
}
.fa-school-circle-check:before {
	content: "\e56b"
}
.fa-school-circle-exclamation:before {
	content: "\e56c"
}
.fa-school-circle-xmark:before {
	content: "\e56d"
}
.fa-school-flag:before {
	content: "\e56e"
}
.fa-school-lock:before {
	content: "\e56f"
}
.fa-cut:before, .fa-scissors:before {
	content: "\f0c4"
}
.fa-screwdriver:before {
	content: "\f54a"
}
.fa-screwdriver-wrench:before, .fa-tools:before {
	content: "\f7d9"
}
.fa-scroll:before {
	content: "\f70e"
}
.fa-scroll-torah:before, .fa-torah:before {
	content: "\f6a0"
}
.fa-sd-card:before {
	content: "\f7c2"
}
.fa-section:before {
	content: "\e447"
}
.fa-seedling:before, .fa-sprout:before {
	content: "\f4d8"
}
.fa-server:before {
	content: "\f233"
}
.fa-shapes:before, .fa-triangle-circle-square:before {
	content: "\f61f"
}
.fa-arrow-turn-right:before, .fa-mail-forward:before, .fa-share:before {
	content: "\f064"
}
.fa-share-from-square:before, .fa-share-square:before {
	content: "\f14d"
}
.fa-share-alt:before, .fa-share-nodes:before {
	content: "\f1e0"
}
.fa-sheet-plastic:before {
	content: "\e571"
}
.fa-ils:before, .fa-shekel-sign:before, .fa-shekel:before, .fa-sheqel-sign:before, .fa-sheqel:before {
	content: "\f20b"
}
.fa-shield-blank:before, .fa-shield:before {
	content: "\f132"
}
.fa-shield-cat:before {
	content: "\e572"
}
.fa-shield-dog:before {
	content: "\e573"
}
.fa-shield-alt:before, .fa-shield-halved:before {
	content: "\f3ed"
}
.fa-shield-heart:before {
	content: "\e574"
}
.fa-shield-virus:before {
	content: "\e06c"
}
.fa-ship:before {
	content: "\f21a"
}
.fa-shirt:before, .fa-t-shirt:before, .fa-tshirt:before {
	content: "\f553"
}
.fa-shoe-prints:before {
	content: "\f54b"
}
.fa-shop:before, .fa-store-alt:before {
	content: "\f54f"
}
.fa-shop-lock:before {
	content: "\e4a5"
}
.fa-shop-slash:before, .fa-store-alt-slash:before {
	content: "\e070"
}
.fa-shower:before {
	content: "\f2cc"
}
.fa-shrimp:before {
	content: "\e448"
}
.fa-random:before, .fa-shuffle:before {
	content: "\f074"
}
.fa-shuttle-space:before, .fa-space-shuttle:before {
	content: "\f197"
}
.fa-sign-hanging:before, .fa-sign:before {
	content: "\f4d9"
}
.fa-signal-5:before, .fa-signal-perfect:before, .fa-signal:before {
	content: "\f012"
}
.fa-signature:before {
	content: "\f5b7"
}
.fa-map-signs:before, .fa-signs-post:before {
	content: "\f277"
}
.fa-sim-card:before {
	content: "\f7c4"
}
.fa-sink:before {
	content: "\e06d"
}
.fa-sitemap:before {
	content: "\f0e8"
}
.fa-skull:before {
	content: "\f54c"
}
.fa-skull-crossbones:before {
	content: "\f714"
}
.fa-slash:before {
	content: "\f715"
}
.fa-sleigh:before {
	content: "\f7cc"
}
.fa-sliders-h:before, .fa-sliders:before {
	content: "\f1de"
}
.fa-smog:before {
	content: "\f75f"
}
.fa-smoking:before {
	content: "\f48d"
}
.fa-snowflake:before {
	content: "\f2dc"
}
.fa-snowman:before {
	content: "\f7d0"
}
.fa-snowplow:before {
	content: "\f7d2"
}
.fa-soap:before {
	content: "\e06e"
}
.fa-socks:before {
	content: "\f696"
}
.fa-solar-panel:before {
	content: "\f5ba"
}
.fa-sort:before, .fa-unsorted:before {
	content: "\f0dc"
}
.fa-sort-desc:before, .fa-sort-down:before {
	content: "\f0dd"
}
.fa-sort-asc:before, .fa-sort-up:before {
	content: "\f0de"
}
.fa-spa:before {
	content: "\f5bb"
}
.fa-pastafarianism:before, .fa-spaghetti-monster-flying:before {
	content: "\f67b"
}
.fa-spell-check:before {
	content: "\f891"
}
.fa-spider:before {
	content: "\f717"
}
.fa-spinner:before {
	content: "\f110"
}
.fa-splotch:before {
	content: "\f5bc"
}
.fa-spoon:before, .fa-utensil-spoon:before {
	content: "\f2e5"
}
.fa-spray-can:before {
	content: "\f5bd"
}
.fa-air-freshener:before, .fa-spray-can-sparkles:before {
	content: "\f5d0"
}
.fa-square:before {
	content: "\f0c8"
}
.fa-external-link-square:before, .fa-square-arrow-up-right:before {
	content: "\f14c"
}
.fa-caret-square-down:before, .fa-square-caret-down:before {
	content: "\f150"
}
.fa-caret-square-left:before, .fa-square-caret-left:before {
	content: "\f191"
}
.fa-caret-square-right:before, .fa-square-caret-right:before {
	content: "\f152"
}
.fa-caret-square-up:before, .fa-square-caret-up:before {
	content: "\f151"
}
.fa-check-square:before, .fa-square-check:before {
	content: "\f14a"
}
.fa-envelope-square:before, .fa-square-envelope:before {
	content: "\f199"
}
.fa-square-full:before {
	content: "\f45c"
}
.fa-h-square:before, .fa-square-h:before {
	content: "\f0fd"
}
.fa-minus-square:before, .fa-square-minus:before {
	content: "\f146"
}
.fa-square-nfi:before {
	content: "\e576"
}
.fa-parking:before, .fa-square-parking:before {
	content: "\f540"
}
.fa-pen-square:before, .fa-pencil-square:before, .fa-square-pen:before {
	content: "\f14b"
}
.fa-square-person-confined:before {
	content: "\e577"
}
.fa-phone-square:before, .fa-square-phone:before {
	content: "\f098"
}
.fa-phone-square-alt:before, .fa-square-phone-flip:before {
	content: "\f87b"
}
.fa-plus-square:before, .fa-square-plus:before {
	content: "\f0fe"
}
.fa-poll-h:before, .fa-square-poll-horizontal:before {
	content: "\f682"
}
.fa-poll:before, .fa-square-poll-vertical:before {
	content: "\f681"
}
.fa-square-root-alt:before, .fa-square-root-variable:before {
	content: "\f698"
}
.fa-rss-square:before, .fa-square-rss:before {
	content: "\f143"
}
.fa-share-alt-square:before, .fa-square-share-nodes:before {
	content: "\f1e1"
}
.fa-external-link-square-alt:before, .fa-square-up-right:before {
	content: "\f360"
}
.fa-square-virus:before {
	content: "\e578"
}
.fa-square-xmark:before, .fa-times-square:before, .fa-xmark-square:before {
	content: "\f2d3"
}
.fa-rod-asclepius:before, .fa-rod-snake:before, .fa-staff-aesculapius:before, .fa-staff-snake:before {
	content: "\e579"
}
.fa-stairs:before {
	content: "\e289"
}
.fa-stamp:before {
	content: "\f5bf"
}
.fa-star:before {
	content: "\f005"
}
.fa-star-and-crescent:before {
	content: "\f699"
}
.fa-star-half:before {
	content: "\f089"
}
.fa-star-half-alt:before, .fa-star-half-stroke:before {
	content: "\f5c0"
}
.fa-star-of-david:before {
	content: "\f69a"
}
.fa-star-of-life:before {
	content: "\f621"
}
.fa-gbp:before, .fa-pound-sign:before, .fa-sterling-sign:before {
	content: "\f154"
}
.fa-stethoscope:before {
	content: "\f0f1"
}
.fa-stop:before {
	content: "\f04d"
}
.fa-stopwatch:before {
	content: "\f2f2"
}
.fa-stopwatch-20:before {
	content: "\e06f"
}
.fa-store:before {
	content: "\f54e"
}
.fa-store-slash:before {
	content: "\e071"
}
.fa-street-view:before {
	content: "\f21d"
}
.fa-strikethrough:before {
	content: "\f0cc"
}
.fa-stroopwafel:before {
	content: "\f551"
}
.fa-subscript:before {
	content: "\f12c"
}
.fa-suitcase:before {
	content: "\f0f2"
}
.fa-medkit:before, .fa-suitcase-medical:before {
	content: "\f0fa"
}
.fa-suitcase-rolling:before {
	content: "\f5c1"
}
.fa-sun:before {
	content: "\f185"
}
.fa-sun-plant-wilt:before {
	content: "\e57a"
}
.fa-superscript:before {
	content: "\f12b"
}
.fa-swatchbook:before {
	content: "\f5c3"
}
.fa-synagogue:before {
	content: "\f69b"
}
.fa-syringe:before {
	content: "\f48e"
}
.fa-t:before {
	content: "\54"
}
.fa-table:before {
	content: "\f0ce"
}
.fa-table-cells:before, .fa-th:before {
	content: "\f00a"
}
.fa-table-cells-large:before, .fa-th-large:before {
	content: "\f009"
}
.fa-columns:before, .fa-table-columns:before {
	content: "\f0db"
}
.fa-table-list:before, .fa-th-list:before {
	content: "\f00b"
}
.fa-ping-pong-paddle-ball:before, .fa-table-tennis-paddle-ball:before, .fa-table-tennis:before {
	content: "\f45d"
}
.fa-tablet-android:before, .fa-tablet:before {
	content: "\f3fb"
}
.fa-tablet-button:before {
	content: "\f10a"
}
.fa-tablet-alt:before, .fa-tablet-screen-button:before {
	content: "\f3fa"
}
.fa-tablets:before {
	content: "\f490"
}
.fa-digital-tachograph:before, .fa-tachograph-digital:before {
	content: "\f566"
}
.fa-tag:before {
	content: "\f02b"
}
.fa-tags:before {
	content: "\f02c"
}
.fa-tape:before {
	content: "\f4db"
}
.fa-tarp:before {
	content: "\e57b"
}
.fa-tarp-droplet:before {
	content: "\e57c"
}
.fa-cab:before, .fa-taxi:before {
	content: "\f1ba"
}
.fa-teeth:before {
	content: "\f62e"
}
.fa-teeth-open:before {
	content: "\f62f"
}
.fa-temperature-arrow-down:before, .fa-temperature-down:before {
	content: "\e03f"
}
.fa-temperature-arrow-up:before, .fa-temperature-up:before {
	content: "\e040"
}
.fa-temperature-0:before, .fa-temperature-empty:before, .fa-thermometer-0:before, .fa-thermometer-empty:before {
	content: "\f2cb"
}
.fa-temperature-4:before, .fa-temperature-full:before, .fa-thermometer-4:before, .fa-thermometer-full:before {
	content: "\f2c7"
}
.fa-temperature-2:before, .fa-temperature-half:before, .fa-thermometer-2:before, .fa-thermometer-half:before {
	content: "\f2c9"
}
.fa-temperature-high:before {
	content: "\f769"
}
.fa-temperature-low:before {
	content: "\f76b"
}
.fa-temperature-1:before, .fa-temperature-quarter:before, .fa-thermometer-1:before, .fa-thermometer-quarter:before {
	content: "\f2ca"
}
.fa-temperature-3:before, .fa-temperature-three-quarters:before, .fa-thermometer-3:before, .fa-thermometer-three-quarters:before {
	content: "\f2c8"
}
.fa-tenge-sign:before, .fa-tenge:before {
	content: "\f7d7"
}
.fa-tent:before {
	content: "\e57d"
}
.fa-tent-arrow-down-to-line:before {
	content: "\e57e"
}
.fa-tent-arrow-left-right:before {
	content: "\e57f"
}
.fa-tent-arrow-turn-left:before {
	content: "\e580"
}
.fa-tent-arrows-down:before {
	content: "\e581"
}
.fa-tents:before {
	content: "\e582"
}
.fa-terminal:before {
	content: "\f120"
}
.fa-text-height:before {
	content: "\f034"
}
.fa-remove-format:before, .fa-text-slash:before {
	content: "\f87d"
}
.fa-text-width:before {
	content: "\f035"
}
.fa-thermometer:before {
	content: "\f491"
}
.fa-thumbs-down:before {
	content: "\f165"
}
.fa-thumbs-up:before {
	content: "\f164"
}
.fa-thumb-tack:before, .fa-thumbtack:before {
	content: "\f08d"
}
.fa-ticket:before {
	content: "\f145"
}
.fa-ticket-alt:before, .fa-ticket-simple:before {
	content: "\f3ff"
}
.fa-timeline:before {
	content: "\e29c"
}
.fa-toggle-off:before {
	content: "\f204"
}
.fa-toggle-on:before {
	content: "\f205"
}
.fa-toilet:before {
	content: "\f7d8"
}
.fa-toilet-paper:before {
	content: "\f71e"
}
.fa-toilet-paper-slash:before {
	content: "\e072"
}
.fa-toilet-portable:before {
	content: "\e583"
}
.fa-toilets-portable:before {
	content: "\e584"
}
.fa-toolbox:before {
	content: "\f552"
}
.fa-tooth:before {
	content: "\f5c9"
}
.fa-torii-gate:before {
	content: "\f6a1"
}
.fa-tornado:before {
	content: "\f76f"
}
.fa-broadcast-tower:before, .fa-tower-broadcast:before {
	content: "\f519"
}
.fa-tower-cell:before {
	content: "\e585"
}
.fa-tower-observation:before {
	content: "\e586"
}
.fa-tractor:before {
	content: "\f722"
}
.fa-trademark:before {
	content: "\f25c"
}
.fa-traffic-light:before {
	content: "\f637"
}
.fa-trailer:before {
	content: "\e041"
}
.fa-train:before {
	content: "\f238"
}
.fa-subway:before, .fa-train-subway:before {
	content: "\f239"
}
.fa-train-tram:before, .fa-tram:before {
	content: "\f7da"
}
.fa-transgender-alt:before, .fa-transgender:before {
	content: "\f225"
}
.fa-trash:before {
	content: "\f1f8"
}
.fa-trash-arrow-up:before, .fa-trash-restore:before {
	content: "\f829"
}
.fa-trash-alt:before, .fa-trash-can:before {
	content: "\f2ed"
}
.fa-trash-can-arrow-up:before, .fa-trash-restore-alt:before {
	content: "\f82a"
}
.fa-tree:before {
	content: "\f1bb"
}
.fa-tree-city:before {
	content: "\e587"
}
.fa-exclamation-triangle:before, .fa-triangle-exclamation:before, .fa-warning:before {
	content: "\f071"
}
.fa-trophy:before {
	content: "\f091"
}
.fa-trowel:before {
	content: "\e589"
}
.fa-trowel-bricks:before {
	content: "\e58a"
}
.fa-truck:before {
	content: "\f0d1"
}
.fa-truck-arrow-right:before {
	content: "\e58b"
}
.fa-truck-droplet:before {
	content: "\e58c"
}
.fa-shipping-fast:before, .fa-truck-fast:before {
	content: "\f48b"
}
.fa-truck-field:before {
	content: "\e58d"
}
.fa-truck-field-un:before {
	content: "\e58e"
}
.fa-truck-front:before {
	content: "\e2b7"
}
.fa-ambulance:before, .fa-truck-medical:before {
	content: "\f0f9"
}
.fa-truck-monster:before {
	content: "\f63b"
}
.fa-truck-moving:before {
	content: "\f4df"
}
.fa-truck-pickup:before {
	content: "\f63c"
}
.fa-truck-plane:before {
	content: "\e58f"
}
.fa-truck-loading:before, .fa-truck-ramp-box:before {
	content: "\f4de"
}
.fa-teletype:before, .fa-tty:before {
	content: "\f1e4"
}
.fa-try:before, .fa-turkish-lira-sign:before, .fa-turkish-lira:before {
	content: "\e2bb"
}
.fa-level-down-alt:before, .fa-turn-down:before {
	content: "\f3be"
}
.fa-level-up-alt:before, .fa-turn-up:before {
	content: "\f3bf"
}
.fa-television:before, .fa-tv-alt:before, .fa-tv:before {
	content: "\f26c"
}
.fa-u:before {
	content: "\55"
}
.fa-umbrella:before {
	content: "\f0e9"
}
.fa-umbrella-beach:before {
	content: "\f5ca"
}
.fa-underline:before {
	content: "\f0cd"
}
.fa-universal-access:before {
	content: "\f29a"
}
.fa-unlock:before {
	content: "\f09c"
}
.fa-unlock-alt:before, .fa-unlock-keyhole:before {
	content: "\f13e"
}
.fa-arrows-alt-v:before, .fa-up-down:before {
	content: "\f338"
}
.fa-arrows-alt:before, .fa-up-down-left-right:before {
	content: "\f0b2"
}
.fa-long-arrow-alt-up:before, .fa-up-long:before {
	content: "\f30c"
}
.fa-expand-alt:before, .fa-up-right-and-down-left-from-center:before {
	content: "\f424"
}
.fa-external-link-alt:before, .fa-up-right-from-square:before {
	content: "\f35d"
}
.fa-upload:before {
	content: "\f093"
}
.fa-user:before {
	content: "\f007"
}
.fa-user-astronaut:before {
	content: "\f4fb"
}
.fa-user-check:before {
	content: "\f4fc"
}
.fa-user-clock:before {
	content: "\f4fd"
}
.fa-user-doctor:before, .fa-user-md:before {
	content: "\f0f0"
}
.fa-user-cog:before, .fa-user-gear:before {
	content: "\f4fe"
}
.fa-user-graduate:before {
	content: "\f501"
}
.fa-user-friends:before, .fa-user-group:before {
	content: "\f500"
}
.fa-user-injured:before {
	content: "\f728"
}
.fa-user-alt:before, .fa-user-large:before {
	content: "\f406"
}
.fa-user-alt-slash:before, .fa-user-large-slash:before {
	content: "\f4fa"
}
.fa-user-lock:before {
	content: "\f502"
}
.fa-user-minus:before {
	content: "\f503"
}
.fa-user-ninja:before {
	content: "\f504"
}
.fa-user-nurse:before {
	content: "\f82f"
}
.fa-user-edit:before, .fa-user-pen:before {
	content: "\f4ff"
}
.fa-user-plus:before {
	content: "\f234"
}
.fa-user-secret:before {
	content: "\f21b"
}
.fa-user-shield:before {
	content: "\f505"
}
.fa-user-slash:before {
	content: "\f506"
}
.fa-user-tag:before {
	content: "\f507"
}
.fa-user-tie:before {
	content: "\f508"
}
.fa-user-times:before, .fa-user-xmark:before {
	content: "\f235"
}
.fa-users:before {
	content: "\f0c0"
}
.fa-users-between-lines:before {
	content: "\e591"
}
.fa-users-cog:before, .fa-users-gear:before {
	content: "\f509"
}
.fa-users-line:before {
	content: "\e592"
}
.fa-users-rays:before {
	content: "\e593"
}
.fa-users-rectangle:before {
	content: "\e594"
}
.fa-users-slash:before {
	content: "\e073"
}
.fa-users-viewfinder:before {
	content: "\e595"
}
.fa-cutlery:before, .fa-utensils:before {
	content: "\f2e7"
}
.fa-v:before {
	content: "\56"
}
.fa-shuttle-van:before, .fa-van-shuttle:before {
	content: "\f5b6"
}
.fa-vault:before {
	content: "\e2c5"
}
.fa-vector-square:before {
	content: "\f5cb"
}
.fa-venus:before {
	content: "\f221"
}
.fa-venus-double:before {
	content: "\f226"
}
.fa-venus-mars:before {
	content: "\f228"
}
.fa-vest:before {
	content: "\e085"
}
.fa-vest-patches:before {
	content: "\e086"
}
.fa-vial:before {
	content: "\f492"
}
.fa-vial-circle-check:before {
	content: "\e596"
}
.fa-vial-virus:before {
	content: "\e597"
}
.fa-vials:before {
	content: "\f493"
}
.fa-video-camera:before, .fa-video:before {
	content: "\f03d"
}
.fa-video-slash:before {
	content: "\f4e2"
}
.fa-vihara:before {
	content: "\f6a7"
}
.fa-virus:before {
	content: "\e074"
}
.fa-virus-covid:before {
	content: "\e4a8"
}
.fa-virus-covid-slash:before {
	content: "\e4a9"
}
.fa-virus-slash:before {
	content: "\e075"
}
.fa-viruses:before {
	content: "\e076"
}
.fa-voicemail:before {
	content: "\f897"
}
.fa-volcano:before {
	content: "\f770"
}
.fa-volleyball-ball:before, .fa-volleyball:before {
	content: "\f45f"
}
.fa-volume-high:before, .fa-volume-up:before {
	content: "\f028"
}
.fa-volume-down:before, .fa-volume-low:before {
	content: "\f027"
}
.fa-volume-off:before {
	content: "\f026"
}
.fa-volume-mute:before, .fa-volume-times:before, .fa-volume-xmark:before {
	content: "\f6a9"
}
.fa-vr-cardboard:before {
	content: "\f729"
}
.fa-w:before {
	content: "\57"
}
.fa-walkie-talkie:before {
	content: "\f8ef"
}
.fa-wallet:before {
	content: "\f555"
}
.fa-magic:before, .fa-wand-magic:before {
	content: "\f0d0"
}
.fa-magic-wand-sparkles:before, .fa-wand-magic-sparkles:before {
	content: "\e2ca"
}
.fa-wand-sparkles:before {
	content: "\f72b"
}
.fa-warehouse:before {
	content: "\f494"
}
.fa-water:before {
	content: "\f773"
}
.fa-ladder-water:before, .fa-swimming-pool:before, .fa-water-ladder:before {
	content: "\f5c5"
}
.fa-wave-square:before {
	content: "\f83e"
}
.fa-weight-hanging:before {
	content: "\f5cd"
}
.fa-weight-scale:before, .fa-weight:before {
	content: "\f496"
}
.fa-wheat-alt:before, .fa-wheat-awn:before {
	content: "\e2cd"
}
.fa-wheat-awn-circle-exclamation:before {
	content: "\e598"
}
.fa-wheelchair:before {
	content: "\f193"
}
.fa-wheelchair-alt:before, .fa-wheelchair-move:before {
	content: "\e2ce"
}
.fa-glass-whiskey:before, .fa-whiskey-glass:before {
	content: "\f7a0"
}
.fa-wifi-3:before, .fa-wifi-strong:before, .fa-wifi:before {
	content: "\f1eb"
}
.fa-wind:before {
	content: "\f72e"
}
.fa-window-maximize:before {
	content: "\f2d0"
}
.fa-window-minimize:before {
	content: "\f2d1"
}
.fa-window-restore:before {
	content: "\f2d2"
}
.fa-wine-bottle:before {
	content: "\f72f"
}
.fa-wine-glass:before {
	content: "\f4e3"
}
.fa-wine-glass-alt:before, .fa-wine-glass-empty:before {
	content: "\f5ce"
}
.fa-krw:before, .fa-won-sign:before, .fa-won:before {
	content: "\f159"
}
.fa-worm:before {
	content: "\e599"
}
.fa-wrench:before {
	content: "\f0ad"
}
.fa-x:before {
	content: "\58"
}
.fa-x-ray:before {
	content: "\f497"
}
.fa-close:before, .fa-multiply:before, .fa-remove:before, .fa-times:before, .fa-xmark:before {
	content: "\f00d"
}
.fa-xmarks-lines:before {
	content: "\e59a"
}
.fa-y:before {
	content: "\59"
}
.fa-cny:before, .fa-jpy:before, .fa-rmb:before, .fa-yen-sign:before, .fa-yen:before {
	content: "\f157"
}
.fa-yin-yang:before {
	content: "\f6ad"
}
.fa-z:before {
	content: "\5a"
}
.fa-sr-only, .fa-sr-only-focusable:not(:focus), .sr-only, .sr-only-focusable:not(:focus) {
	position: absolute;
	width: 1px;
	height: 1px;
	padding: 0;
	margin: -1px;
	overflow: hidden;
	clip: rect(0, 0, 0, 0);
	white-space: nowrap;
	border-width: 0
}
:host, :root {
--fa-font-brands:normal 400 1em/1 "Font Awesome 6 Brands"
}
@font-face {
	font-family: "Font Awesome 6 Brands";
	font-style: normal;
	font-weight: 400;
	font-display: block;
	src: url(../fonts/fa-brands-400.woff2) format("woff2"), url(../fonts/fa-brands-400.ttf) format("truetype")
}
.fa-brands, .fab {
	font-family: "Font Awesome 6 Brands";
	font-weight: 400
}
.fa-42-group:before, .fa-innosoft:before {
	content: "\e080"
}
.fa-500px:before {
	content: "\f26e"
}
.fa-accessible-icon:before {
	content: "\f368"
}
.fa-accusoft:before {
	content: "\f369"
}
.fa-adn:before {
	content: "\f170"
}
.fa-adversal:before {
	content: "\f36a"
}
.fa-affiliatetheme:before {
	content: "\f36b"
}
.fa-airbnb:before {
	content: "\f834"
}
.fa-algolia:before {
	content: "\f36c"
}
.fa-alipay:before {
	content: "\f642"
}
.fa-amazon:before {
	content: "\f270"
}
.fa-amazon-pay:before {
	content: "\f42c"
}
.fa-amilia:before {
	content: "\f36d"
}
.fa-android:before {
	content: "\f17b"
}
.fa-angellist:before {
	content: "\f209"
}
.fa-angrycreative:before {
	content: "\f36e"
}
.fa-angular:before {
	content: "\f420"
}
.fa-app-store:before {
	content: "\f36f"
}
.fa-app-store-ios:before {
	content: "\f370"
}
.fa-apper:before {
	content: "\f371"
}
.fa-apple:before {
	content: "\f179"
}
.fa-apple-pay:before {
	content: "\f415"
}
.fa-artstation:before {
	content: "\f77a"
}
.fa-asymmetrik:before {
	content: "\f372"
}
.fa-atlassian:before {
	content: "\f77b"
}
.fa-audible:before {
	content: "\f373"
}
.fa-autoprefixer:before {
	content: "\f41c"
}
.fa-avianex:before {
	content: "\f374"
}
.fa-aviato:before {
	content: "\f421"
}
.fa-aws:before {
	content: "\f375"
}
.fa-bandcamp:before {
	content: "\f2d5"
}
.fa-battle-net:before {
	content: "\f835"
}
.fa-behance:before {
	content: "\f1b4"
}
.fa-behance-square:before {
	content: "\f1b5"
}
.fa-bilibili:before {
	content: "\e3d9"
}
.fa-bimobject:before {
	content: "\f378"
}
.fa-bitbucket:before {
	content: "\f171"
}
.fa-bitcoin:before {
	content: "\f379"
}
.fa-bity:before {
	content: "\f37a"
}
.fa-black-tie:before {
	content: "\f27e"
}
.fa-blackberry:before {
	content: "\f37b"
}
.fa-blogger:before {
	content: "\f37c"
}
.fa-blogger-b:before {
	content: "\f37d"
}
.fa-bluetooth:before {
	content: "\f293"
}
.fa-bluetooth-b:before {
	content: "\f294"
}
.fa-bootstrap:before {
	content: "\f836"
}
.fa-bots:before {
	content: "\e340"
}
.fa-btc:before {
	content: "\f15a"
}
.fa-buffer:before {
	content: "\f837"
}
.fa-buromobelexperte:before {
	content: "\f37f"
}
.fa-buy-n-large:before {
	content: "\f8a6"
}
.fa-buysellads:before {
	content: "\f20d"
}
.fa-canadian-maple-leaf:before {
	content: "\f785"
}
.fa-cc-amazon-pay:before {
	content: "\f42d"
}
.fa-cc-amex:before {
	content: "\f1f3"
}
.fa-cc-apple-pay:before {
	content: "\f416"
}
.fa-cc-diners-club:before {
	content: "\f24c"
}
.fa-cc-discover:before {
	content: "\f1f2"
}
.fa-cc-jcb:before {
	content: "\f24b"
}
.fa-cc-mastercard:before {
	content: "\f1f1"
}
.fa-cc-paypal:before {
	content: "\f1f4"
}
.fa-cc-stripe:before {
	content: "\f1f5"
}
.fa-cc-visa:before {
	content: "\f1f0"
}
.fa-centercode:before {
	content: "\f380"
}
.fa-centos:before {
	content: "\f789"
}
.fa-chrome:before {
	content: "\f268"
}
.fa-chromecast:before {
	content: "\f838"
}
.fa-cloudflare:before {
	content: "\e07d"
}
.fa-cloudscale:before {
	content: "\f383"
}
.fa-cloudsmith:before {
	content: "\f384"
}
.fa-cloudversify:before {
	content: "\f385"
}
.fa-cmplid:before {
	content: "\e360"
}
.fa-codepen:before {
	content: "\f1cb"
}
.fa-codiepie:before {
	content: "\f284"
}
.fa-confluence:before {
	content: "\f78d"
}
.fa-connectdevelop:before {
	content: "\f20e"
}
.fa-contao:before {
	content: "\f26d"
}
.fa-cotton-bureau:before {
	content: "\f89e"
}
.fa-cpanel:before {
	content: "\f388"
}
.fa-creative-commons:before {
	content: "\f25e"
}
.fa-creative-commons-by:before {
	content: "\f4e7"
}
.fa-creative-commons-nc:before {
	content: "\f4e8"
}
.fa-creative-commons-nc-eu:before {
	content: "\f4e9"
}
.fa-creative-commons-nc-jp:before {
	content: "\f4ea"
}
.fa-creative-commons-nd:before {
	content: "\f4eb"
}
.fa-creative-commons-pd:before {
	content: "\f4ec"
}
.fa-creative-commons-pd-alt:before {
	content: "\f4ed"
}
.fa-creative-commons-remix:before {
	content: "\f4ee"
}
.fa-creative-commons-sa:before {
	content: "\f4ef"
}
.fa-creative-commons-sampling:before {
	content: "\f4f0"
}
.fa-creative-commons-sampling-plus:before {
	content: "\f4f1"
}
.fa-creative-commons-share:before {
	content: "\f4f2"
}
.fa-creative-commons-zero:before {
	content: "\f4f3"
}
.fa-critical-role:before {
	content: "\f6c9"
}
.fa-css3:before {
	content: "\f13c"
}
.fa-css3-alt:before {
	content: "\f38b"
}
.fa-cuttlefish:before {
	content: "\f38c"
}
.fa-d-and-d:before {
	content: "\f38d"
}
.fa-d-and-d-beyond:before {
	content: "\f6ca"
}
.fa-dailymotion:before {
	content: "\e052"
}
.fa-dashcube:before {
	content: "\f210"
}
.fa-deezer:before {
	content: "\e077"
}
.fa-delicious:before {
	content: "\f1a5"
}
.fa-deploydog:before {
	content: "\f38e"
}
.fa-deskpro:before {
	content: "\f38f"
}
.fa-dev:before {
	content: "\f6cc"
}
.fa-deviantart:before {
	content: "\f1bd"
}
.fa-dhl:before {
	content: "\f790"
}
.fa-diaspora:before {
	content: "\f791"
}
.fa-digg:before {
	content: "\f1a6"
}
.fa-digital-ocean:before {
	content: "\f391"
}
.fa-discord:before {
	content: "\f392"
}
.fa-discourse:before {
	content: "\f393"
}
.fa-dochub:before {
	content: "\f394"
}
.fa-docker:before {
	content: "\f395"
}
.fa-draft2digital:before {
	content: "\f396"
}
.fa-dribbble:before {
	content: "\f17d"
}
.fa-dribbble-square:before {
	content: "\f397"
}
.fa-dropbox:before {
	content: "\f16b"
}
.fa-drupal:before {
	content: "\f1a9"
}
.fa-dyalog:before {
	content: "\f399"
}
.fa-earlybirds:before {
	content: "\f39a"
}
.fa-ebay:before {
	content: "\f4f4"
}
.fa-edge:before {
	content: "\f282"
}
.fa-edge-legacy:before {
	content: "\e078"
}
.fa-elementor:before {
	content: "\f430"
}
.fa-ello:before {
	content: "\f5f1"
}
.fa-ember:before {
	content: "\f423"
}
.fa-empire:before {
	content: "\f1d1"
}
.fa-envira:before {
	content: "\f299"
}
.fa-erlang:before {
	content: "\f39d"
}
.fa-ethereum:before {
	content: "\f42e"
}
.fa-etsy:before {
	content: "\f2d7"
}
.fa-evernote:before {
	content: "\f839"
}
.fa-expeditedssl:before {
	content: "\f23e"
}
.fa-facebook:before {
	content: "\f09a"
}
.fa-facebook-f:before {
	content: "\f39e"
}
.fa-facebook-messenger:before {
	content: "\f39f"
}
.fa-facebook-square:before {
	content: "\f082"
}
.fa-fantasy-flight-games:before {
	content: "\f6dc"
}
.fa-fedex:before {
	content: "\f797"
}
.fa-fedora:before {
	content: "\f798"
}
.fa-figma:before {
	content: "\f799"
}
.fa-firefox:before {
	content: "\f269"
}
.fa-firefox-browser:before {
	content: "\e007"
}
.fa-first-order:before {
	content: "\f2b0"
}
.fa-first-order-alt:before {
	content: "\f50a"
}
.fa-firstdraft:before {
	content: "\f3a1"
}
.fa-flickr:before {
	content: "\f16e"
}
.fa-flipboard:before {
	content: "\f44d"
}
.fa-fly:before {
	content: "\f417"
}
.fa-font-awesome-flag:before, .fa-font-awesome-logo-full:before, .fa-font-awesome:before {
	content: "\f2b4"
}
.fa-fonticons:before {
	content: "\f280"
}
.fa-fonticons-fi:before {
	content: "\f3a2"
}
.fa-fort-awesome:before {
	content: "\f286"
}
.fa-fort-awesome-alt:before {
	content: "\f3a3"
}
.fa-forumbee:before {
	content: "\f211"
}
.fa-foursquare:before {
	content: "\f180"
}
.fa-free-code-camp:before {
	content: "\f2c5"
}
.fa-freebsd:before {
	content: "\f3a4"
}
.fa-fulcrum:before {
	content: "\f50b"
}
.fa-galactic-republic:before {
	content: "\f50c"
}
.fa-galactic-senate:before {
	content: "\f50d"
}
.fa-get-pocket:before {
	content: "\f265"
}
.fa-gg:before {
	content: "\f260"
}
.fa-gg-circle:before {
	content: "\f261"
}
.fa-git:before {
	content: "\f1d3"
}
.fa-git-alt:before {
	content: "\f841"
}
.fa-git-square:before {
	content: "\f1d2"
}
.fa-github:before {
	content: "\f09b"
}
.fa-github-alt:before {
	content: "\f113"
}
.fa-github-square:before {
	content: "\f092"
}
.fa-gitkraken:before {
	content: "\f3a6"
}
.fa-gitlab:before {
	content: "\f296"
}
.fa-gitter:before {
	content: "\f426"
}
.fa-glide:before {
	content: "\f2a5"
}
.fa-glide-g:before {
	content: "\f2a6"
}
.fa-gofore:before {
	content: "\f3a7"
}
.fa-golang:before {
	content: "\e40f"
}
.fa-goodreads:before {
	content: "\f3a8"
}
.fa-goodreads-g:before {
	content: "\f3a9"
}
.fa-google:before {
	content: "\f1a0"
}
.fa-google-drive:before {
	content: "\f3aa"
}
.fa-google-pay:before {
	content: "\e079"
}
.fa-google-play:before {
	content: "\f3ab"
}
.fa-google-plus:before {
	content: "\f2b3"
}
.fa-google-plus-g:before {
	content: "\f0d5"
}
.fa-google-plus-square:before {
	content: "\f0d4"
}
.fa-google-wallet:before {
	content: "\f1ee"
}
.fa-gratipay:before {
	content: "\f184"
}
.fa-grav:before {
	content: "\f2d6"
}
.fa-gripfire:before {
	content: "\f3ac"
}
.fa-grunt:before {
	content: "\f3ad"
}
.fa-guilded:before {
	content: "\e07e"
}
.fa-gulp:before {
	content: "\f3ae"
}
.fa-hacker-news:before {
	content: "\f1d4"
}
.fa-hacker-news-square:before {
	content: "\f3af"
}
.fa-hackerrank:before {
	content: "\f5f7"
}
.fa-hashnode:before {
	content: "\e499"
}
.fa-hips:before {
	content: "\f452"
}
.fa-hire-a-helper:before {
	content: "\f3b0"
}
.fa-hive:before {
	content: "\e07f"
}
.fa-hooli:before {
	content: "\f427"
}
.fa-hornbill:before {
	content: "\f592"
}
.fa-hotjar:before {
	content: "\f3b1"
}
.fa-houzz:before {
	content: "\f27c"
}
.fa-html5:before {
	content: "\f13b"
}
.fa-hubspot:before {
	content: "\f3b2"
}
.fa-ideal:before {
	content: "\e013"
}
.fa-imdb:before {
	content: "\f2d8"
}
.fa-instagram:before {
	content: "\f16d"
}
.fa-instagram-square:before {
	content: "\e055"
}
.fa-instalod:before {
	content: "\e081"
}
.fa-intercom:before {
	content: "\f7af"
}
.fa-internet-explorer:before {
	content: "\f26b"
}
.fa-invision:before {
	content: "\f7b0"
}
.fa-ioxhost:before {
	content: "\f208"
}
.fa-itch-io:before {
	content: "\f83a"
}
.fa-itunes:before {
	content: "\f3b4"
}
.fa-itunes-note:before {
	content: "\f3b5"
}
.fa-java:before {
	content: "\f4e4"
}
.fa-jedi-order:before {
	content: "\f50e"
}
.fa-jenkins:before {
	content: "\f3b6"
}
.fa-jira:before {
	content: "\f7b1"
}
.fa-joget:before {
	content: "\f3b7"
}
.fa-joomla:before {
	content: "\f1aa"
}
.fa-js:before {
	content: "\f3b8"
}
.fa-js-square:before {
	content: "\f3b9"
}
.fa-jsfiddle:before {
	content: "\f1cc"
}
.fa-kaggle:before {
	content: "\f5fa"
}
.fa-keybase:before {
	content: "\f4f5"
}
.fa-keycdn:before {
	content: "\f3ba"
}
.fa-kickstarter:before {
	content: "\f3bb"
}
.fa-kickstarter-k:before {
	content: "\f3bc"
}
.fa-korvue:before {
	content: "\f42f"
}
.fa-laravel:before {
	content: "\f3bd"
}
.fa-lastfm:before {
	content: "\f202"
}
.fa-lastfm-square:before {
	content: "\f203"
}
.fa-leanpub:before {
	content: "\f212"
}
.fa-less:before {
	content: "\f41d"
}
.fa-line:before {
	content: "\f3c0"
}
.fa-linkedin:before {
	content: "\f08c"
}
.fa-linkedin-in:before {
	content: "\f0e1"
}
.fa-linode:before {
	content: "\f2b8"
}
.fa-linux:before {
	content: "\f17c"
}
.fa-lyft:before {
	content: "\f3c3"
}
.fa-magento:before {
	content: "\f3c4"
}
.fa-mailchimp:before {
	content: "\f59e"
}
.fa-mandalorian:before {
	content: "\f50f"
}
.fa-markdown:before {
	content: "\f60f"
}
.fa-mastodon:before {
	content: "\f4f6"
}
.fa-maxcdn:before {
	content: "\f136"
}
.fa-mdb:before {
	content: "\f8ca"
}
.fa-medapps:before {
	content: "\f3c6"
}
.fa-medium-m:before, .fa-medium:before {
	content: "\f23a"
}
.fa-medrt:before {
	content: "\f3c8"
}
.fa-meetup:before {
	content: "\f2e0"
}
.fa-megaport:before {
	content: "\f5a3"
}
.fa-mendeley:before {
	content: "\f7b3"
}
.fa-microblog:before {
	content: "\e01a"
}
.fa-microsoft:before {
	content: "\f3ca"
}
.fa-mix:before {
	content: "\f3cb"
}
.fa-mixcloud:before {
	content: "\f289"
}
.fa-mixer:before {
	content: "\e056"
}
.fa-mizuni:before {
	content: "\f3cc"
}
.fa-modx:before {
	content: "\f285"
}
.fa-monero:before {
	content: "\f3d0"
}
.fa-napster:before {
	content: "\f3d2"
}
.fa-neos:before {
	content: "\f612"
}
.fa-nfc-directional:before {
	content: "\e530"
}
.fa-nfc-symbol:before {
	content: "\e531"
}
.fa-nimblr:before {
	content: "\f5a8"
}
.fa-node:before {
	content: "\f419"
}
.fa-node-js:before {
	content: "\f3d3"
}
.fa-npm:before {
	content: "\f3d4"
}
.fa-ns8:before {
	content: "\f3d5"
}
.fa-nutritionix:before {
	content: "\f3d6"
}
.fa-octopus-deploy:before {
	content: "\e082"
}
.fa-odnoklassniki:before {
	content: "\f263"
}
.fa-odnoklassniki-square:before {
	content: "\f264"
}
.fa-old-republic:before {
	content: "\f510"
}
.fa-opencart:before {
	content: "\f23d"
}
.fa-openid:before {
	content: "\f19b"
}
.fa-opera:before {
	content: "\f26a"
}
.fa-optin-monster:before {
	content: "\f23c"
}
.fa-orcid:before {
	content: "\f8d2"
}
.fa-osi:before {
	content: "\f41a"
}
.fa-padlet:before {
	content: "\e4a0"
}
.fa-page4:before {
	content: "\f3d7"
}
.fa-pagelines:before {
	content: "\f18c"
}
.fa-palfed:before {
	content: "\f3d8"
}
.fa-patreon:before {
	content: "\f3d9"
}
.fa-paypal:before {
	content: "\f1ed"
}
.fa-perbyte:before {
	content: "\e083"
}
.fa-periscope:before {
	content: "\f3da"
}
.fa-phabricator:before {
	content: "\f3db"
}
.fa-phoenix-framework:before {
	content: "\f3dc"
}
.fa-phoenix-squadron:before {
	content: "\f511"
}
.fa-php:before {
	content: "\f457"
}
.fa-pied-piper:before {
	content: "\f2ae"
}
.fa-pied-piper-alt:before {
	content: "\f1a8"
}
.fa-pied-piper-hat:before {
	content: "\f4e5"
}
.fa-pied-piper-pp:before {
	content: "\f1a7"
}
.fa-pied-piper-square:before {
	content: "\e01e"
}
.fa-pinterest:before {
	content: "\f0d2"
}
.fa-pinterest-p:before {
	content: "\f231"
}
.fa-pinterest-square:before {
	content: "\f0d3"
}
.fa-pix:before {
	content: "\e43a"
}
.fa-playstation:before {
	content: "\f3df"
}
.fa-product-hunt:before {
	content: "\f288"
}
.fa-pushed:before {
	content: "\f3e1"
}
.fa-python:before {
	content: "\f3e2"
}
.fa-qq:before {
	content: "\f1d6"
}
.fa-quinscape:before {
	content: "\f459"
}
.fa-quora:before {
	content: "\f2c4"
}
.fa-r-project:before {
	content: "\f4f7"
}
.fa-raspberry-pi:before {
	content: "\f7bb"
}
.fa-ravelry:before {
	content: "\f2d9"
}
.fa-react:before {
	content: "\f41b"
}
.fa-reacteurope:before {
	content: "\f75d"
}
.fa-readme:before {
	content: "\f4d5"
}
.fa-rebel:before {
	content: "\f1d0"
}
.fa-red-river:before {
	content: "\f3e3"
}
.fa-reddit:before {
	content: "\f1a1"
}
.fa-reddit-alien:before {
	content: "\f281"
}
.fa-reddit-square:before {
	content: "\f1a2"
}
.fa-redhat:before {
	content: "\f7bc"
}
.fa-renren:before {
	content: "\f18b"
}
.fa-replyd:before {
	content: "\f3e6"
}
.fa-researchgate:before {
	content: "\f4f8"
}
.fa-resolving:before {
	content: "\f3e7"
}
.fa-rev:before {
	content: "\f5b2"
}
.fa-rocketchat:before {
	content: "\f3e8"
}
.fa-rockrms:before {
	content: "\f3e9"
}
.fa-rust:before {
	content: "\e07a"
}
.fa-safari:before {
	content: "\f267"
}
.fa-salesforce:before {
	content: "\f83b"
}
.fa-sass:before {
	content: "\f41e"
}
.fa-schlix:before {
	content: "\f3ea"
}
.fa-screenpal:before {
	content: "\e570"
}
.fa-scribd:before {
	content: "\f28a"
}
.fa-searchengin:before {
	content: "\f3eb"
}
.fa-sellcast:before {
	content: "\f2da"
}
.fa-sellsy:before {
	content: "\f213"
}
.fa-servicestack:before {
	content: "\f3ec"
}
.fa-shirtsinbulk:before {
	content: "\f214"
}
.fa-shopify:before {
	content: "\e057"
}
.fa-shopware:before {
	content: "\f5b5"
}
.fa-simplybuilt:before {
	content: "\f215"
}
.fa-sistrix:before {
	content: "\f3ee"
}
.fa-sith:before {
	content: "\f512"
}
.fa-sitrox:before {
	content: "\e44a"
}
.fa-sketch:before {
	content: "\f7c6"
}
.fa-skyatlas:before {
	content: "\f216"
}
.fa-skype:before {
	content: "\f17e"
}
.fa-slack-hash:before, .fa-slack:before {
	content: "\f198"
}
.fa-slideshare:before {
	content: "\f1e7"
}
.fa-snapchat-ghost:before, .fa-snapchat:before {
	content: "\f2ab"
}
.fa-snapchat-square:before {
	content: "\f2ad"
}
.fa-soundcloud:before {
	content: "\f1be"
}
.fa-sourcetree:before {
	content: "\f7d3"
}
.fa-speakap:before {
	content: "\f3f3"
}
.fa-speaker-deck:before {
	content: "\f83c"
}
.fa-spotify:before {
	content: "\f1bc"
}
.fa-square-font-awesome:before {
	content: "\f425"
}
.fa-font-awesome-alt:before, .fa-square-font-awesome-stroke:before {
	content: "\f35c"
}
.fa-squarespace:before {
	content: "\f5be"
}
.fa-stack-exchange:before {
	content: "\f18d"
}
.fa-stack-overflow:before {
	content: "\f16c"
}
.fa-stackpath:before {
	content: "\f842"
}
.fa-staylinked:before {
	content: "\f3f5"
}
.fa-steam:before {
	content: "\f1b6"
}
.fa-steam-square:before {
	content: "\f1b7"
}
.fa-steam-symbol:before {
	content: "\f3f6"
}
.fa-sticker-mule:before {
	content: "\f3f7"
}
.fa-strava:before {
	content: "\f428"
}
.fa-stripe:before {
	content: "\f429"
}
.fa-stripe-s:before {
	content: "\f42a"
}
.fa-studiovinari:before {
	content: "\f3f8"
}
.fa-stumbleupon:before {
	content: "\f1a4"
}
.fa-stumbleupon-circle:before {
	content: "\f1a3"
}
.fa-superpowers:before {
	content: "\f2dd"
}
.fa-supple:before {
	content: "\f3f9"
}
.fa-suse:before {
	content: "\f7d6"
}
.fa-swift:before {
	content: "\f8e1"
}
.fa-symfony:before {
	content: "\f83d"
}
.fa-teamspeak:before {
	content: "\f4f9"
}
.fa-telegram-plane:before, .fa-telegram:before {
	content: "\f2c6"
}
.fa-tencent-weibo:before {
	content: "\f1d5"
}
.fa-the-red-yeti:before {
	content: "\f69d"
}
.fa-themeco:before {
	content: "\f5c6"
}
.fa-themeisle:before {
	content: "\f2b2"
}
.fa-think-peaks:before {
	content: "\f731"
}
.fa-tiktok:before {
	content: "\e07b"
}
.fa-trade-federation:before {
	content: "\f513"
}
.fa-trello:before {
	content: "\f181"
}
.fa-tumblr:before {
	content: "\f173"
}
.fa-tumblr-square:before {
	content: "\f174"
}
.fa-twitch:before {
	content: "\f1e8"
}
.fa-twitter:before {
	content: "\f099"
}
.fa-twitter-square:before {
	content: "\f081"
}
.fa-typo3:before {
	content: "\f42b"
}
.fa-uber:before {
	content: "\f402"
}
.fa-ubuntu:before {
	content: "\f7df"
}
.fa-uikit:before {
	content: "\f403"
}
.fa-umbraco:before {
	content: "\f8e8"
}
.fa-uncharted:before {
	content: "\e084"
}
.fa-uniregistry:before {
	content: "\f404"
}
.fa-unity:before {
	content: "\e049"
}
.fa-unsplash:before {
	content: "\e07c"
}
.fa-untappd:before {
	content: "\f405"
}
.fa-ups:before {
	content: "\f7e0"
}
.fa-usb:before {
	content: "\f287"
}
.fa-usps:before {
	content: "\f7e1"
}
.fa-ussunnah:before {
	content: "\f407"
}
.fa-vaadin:before {
	content: "\f408"
}
.fa-viacoin:before {
	content: "\f237"
}
.fa-viadeo:before {
	content: "\f2a9"
}
.fa-viadeo-square:before {
	content: "\f2aa"
}
.fa-viber:before {
	content: "\f409"
}
.fa-vimeo:before {
	content: "\f40a"
}
.fa-vimeo-square:before {
	content: "\f194"
}
.fa-vimeo-v:before {
	content: "\f27d"
}
.fa-vine:before {
	content: "\f1ca"
}
.fa-vk:before {
	content: "\f189"
}
.fa-vnv:before {
	content: "\f40b"
}
.fa-vuejs:before {
	content: "\f41f"
}
.fa-watchman-monitoring:before {
	content: "\e087"
}
.fa-waze:before {
	content: "\f83f"
}
.fa-weebly:before {
	content: "\f5cc"
}
.fa-weibo:before {
	content: "\f18a"
}
.fa-weixin:before {
	content: "\f1d7"
}
.fa-whatsapp:before {
	content: "\f232"
}
.fa-whatsapp-square:before {
	content: "\f40c"
}
.fa-whmcs:before {
	content: "\f40d"
}
.fa-wikipedia-w:before {
	content: "\f266"
}
.fa-windows:before {
	content: "\f17a"
}
.fa-wirsindhandwerk:before, .fa-wsh:before {
	content: "\e2d0"
}
.fa-wix:before {
	content: "\f5cf"
}
.fa-wizards-of-the-coast:before {
	content: "\f730"
}
.fa-wodu:before {
	content: "\e088"
}
.fa-wolf-pack-battalion:before {
	content: "\f514"
}
.fa-wordpress:before {
	content: "\f19a"
}
.fa-wordpress-simple:before {
	content: "\f411"
}
.fa-wpbeginner:before {
	content: "\f297"
}
.fa-wpexplorer:before {
	content: "\f2de"
}
.fa-wpforms:before {
	content: "\f298"
}
.fa-wpressr:before {
	content: "\f3e4"
}
.fa-xbox:before {
	content: "\f412"
}
.fa-xing:before {
	content: "\f168"
}
.fa-xing-square:before {
	content: "\f169"
}
.fa-y-combinator:before {
	content: "\f23b"
}
.fa-yahoo:before {
	content: "\f19e"
}
.fa-yammer:before {
	content: "\f840"
}
.fa-yandex:before {
	content: "\f413"
}
.fa-yandex-international:before {
	content: "\f414"
}
.fa-yarn:before {
	content: "\f7e3"
}
.fa-yelp:before {
	content: "\f1e9"
}
.fa-yoast:before {
	content: "\f2b1"
}
.fa-youtube:before {
	content: "\f167"
}
.fa-youtube-square:before {
	content: "\f431"
}
.fa-zhihu:before {
	content: "\f63f"
}
:host, :root {
--fa-font-regular:normal 400 1em/1 "Font Awesome 6 Free"
}
@font-face {
	font-family: "Font Awesome 6 Free";
	font-style: normal;
	font-weight: 400;
	font-display: block;
	src: url(../fonts/fa-regular-400.woff2) format("woff2"), url(../fonts/fa-regular-400.ttf) format("truetype")
}
.fa-regular, .far {
	font-family: "Font Awesome 6 Free";
	font-weight: 400
}
:host, :root {
--fa-font-solid:normal 900 1em/1 "Font Awesome 6 Free"
}
@font-face {
	font-family: "Font Awesome 6 Free";
	font-style: normal;
	font-weight: 900;
	font-display: block;
	src: url(../fonts/fa-solid-900.woff2) format("woff2"), url(../fonts/fa-solid-900.ttf) format("truetype")
}
.fa-solid, .fas {
	font-family: "Font Awesome 6 Free";
	font-weight: 900
}
@font-face {
	font-family: "Font Awesome 5 Brands";
	font-display: block;
	font-weight: 400;
	src: url(../fonts/fa-brands-400.woff2) format("woff2"), url(../fonts/fa-brands-400.ttf) format("truetype")
}
@font-face {
	font-family: "Font Awesome 5 Free";
	font-display: block;
	font-weight: 900;
	src: url(../fonts/fa-solid-900.woff2) format("woff2"), url(../fonts/fa-solid-900.ttf) format("truetype")
}
@font-face {
	font-family: "Font Awesome 5 Free";
	font-display: block;
	font-weight: 400;
	src: url(../fonts/fa-regular-400.woff2) format("woff2"), url(../fonts/fa-regular-400.ttf) format("truetype")
}
@font-face {
	font-family: "FontAwesome";
	font-display: block;
	src: url(../fonts/fa-solid-900.woff2) format("woff2"), url(../fonts/fa-solid-900.ttf) format("truetype")
}
@font-face {
	font-family: "FontAwesome";
	font-display: block;
	src: url(../fonts/fa-brands-400.woff2) format("woff2"), url(../fonts/fa-brands-400.ttf) format("truetype")
}
@font-face {
	font-family: "FontAwesome";
	font-display: block;
	src: url(../fonts/fa-regular-400.woff2) format("woff2"), url(../fonts/fa-regular-400.ttf) format("truetype");
unicode-range:u+f003, u+f006, u+f014, u+f016-f017, u+f01a-f01b, u+f01d, u+f022, u+f03e, u+f044, u+f046, u+f05c-f05d, u+f06e, u+f070, u+f087-f088, u+f08a, u+f094, u+f096-f097, u+f09d, u+f0a0, u+f0a2, u+f0a4-f0a7, u+f0c5, u+f0c7, u+f0e5-f0e6, u+f0eb, u+f0f6-f0f8, u+f10c, u+f114-f115, u+f118-f11a, u+f11c-f11d, u+f133, u+f147, u+f14e, u+f150-f152, u+f185-f186, u+f18e, u+f190-f192, u+f196, u+f1c1-f1c9, u+f1d9, u+f1db, u+f1e3, u+f1ea, u+f1f7, u+f1f9, u+f20a, u+f247-f248, u+f24a, u+f24d, u+f255-f25b, u+f25d, u+f271-f274, u+f278, u+f27b, u+f28c, u+f28e, u+f29c, u+f2b5, u+f2b7, u+f2ba, u+f2bc, u+f2be, u+f2c0-f2c1, u+f2c3, u+f2d0, u+f2d2, u+f2d4, u+f2dc
}
@font-face {
	font-family: "FontAwesome";
	font-display: block;
	src: url(../fonts/fa-v4compatibility.woff2) format("woff2"), url(../fonts/fa-v4compatibility.ttf) format("truetype");
unicode-range:u+f041, u+f047, u+f065-f066, u+f07d-f07e, u+f080, u+f08b, u+f08e, u+f090, u+f09a, u+f0ac, u+f0ae, u+f0b2, u+f0d0, u+f0d6, u+f0e4, u+f0ec, u+f10a-f10b, u+f123, u+f13e, u+f148-f149, u+f14c, u+f156, u+f15e, u+f160-f161, u+f163, u+f175-f178, u+f195, u+f1f8, u+f219, u+f250, u+f252, u+f27a
}
@font-face {
	font-family: 'themify';
	src: url("../fonts/themify9f24.eot?-fvbane");
	src: url("../fonts/themifyd41d.eot?#iefix-fvbane") format("embedded-opentype"), url("../fonts/themify9f24.woff?-fvbane") format("woff"), url("../fonts/themify9f24.ttf?-fvbane") format("truetype"), url("../fonts/themify9f24.svg?-fvbane#themify") format("svg");
	font-weight: normal;
	font-style: normal
}
[class^="ti-"], [class*=" ti-"] {
	font-family: 'themify';
	speak: none;
	font-style: normal;
	font-weight: normal;
	font-variant: normal;
	text-transform: none;
	line-height: 1;
	-webkit-font-smoothing: antialiased;
	-moz-osx-font-smoothing: grayscale
}
.ti-wand:before {
	content: "\e600"
}
.ti-volume:before {
	content: "\e601"
}
.ti-user:before {
	content: "\e602"
}
.ti-unlock:before {
	content: "\e603"
}
.ti-unlink:before {
	content: "\e604"
}
.ti-trash:before {
	content: "\e605"
}
.ti-thought:before {
	content: "\e606"
}
.ti-target:before {
	content: "\e607"
}
.ti-tag:before {
	content: "\e608"
}
.ti-tablet:before {
	content: "\e609"
}
.ti-star:before {
	content: "\e60a"
}
.ti-spray:before {
	content: "\e60b"
}
.ti-signal:before {
	content: "\e60c"
}
.ti-shopping-cart:before {
	content: "\e60d"
}
.ti-shopping-cart-full:before {
	content: "\e60e"
}
.ti-settings:before {
	content: "\e60f"
}
.ti-search:before {
	content: "\e610"
}
.ti-zoom-in:before {
	content: "\e611"
}
.ti-zoom-out:before {
	content: "\e612"
}
.ti-cut:before {
	content: "\e613"
}
.ti-ruler:before {
	content: "\e614"
}
.ti-ruler-pencil:before {
	content: "\e615"
}
.ti-ruler-alt:before {
	content: "\e616"
}
.ti-bookmark:before {
	content: "\e617"
}
.ti-bookmark-alt:before {
	content: "\e618"
}
.ti-reload:before {
	content: "\e619"
}
.ti-plus:before {
	content: "\e61a"
}
.ti-pin:before {
	content: "\e61b"
}
.ti-pencil:before {
	content: "\e61c"
}
.ti-pencil-alt:before {
	content: "\e61d"
}
.ti-paint-roller:before {
	content: "\e61e"
}
.ti-paint-bucket:before {
	content: "\e61f"
}
.ti-na:before {
	content: "\e620"
}
.ti-mobile:before {
	content: "\e621"
}
.ti-minus:before {
	content: "\e622"
}
.ti-medall:before {
	content: "\e623"
}
.ti-medall-alt:before {
	content: "\e624"
}
.ti-marker:before {
	content: "\e625"
}
.ti-marker-alt:before {
	content: "\e626"
}
.ti-arrow-up:before {
	content: "\e627"
}
.ti-arrow-right:before {
	content: "\e628"
}
.ti-arrow-left:before {
	content: "\e629"
}
.ti-arrow-down:before {
	content: "\e62a"
}
.ti-lock:before {
	content: "\e62b"
}
.ti-location-arrow:before {
	content: "\e62c"
}
.ti-link:before {
	content: "\e62d"
}
.ti-layout:before {
	content: "\e62e"
}
.ti-layers:before {
	content: "\e62f"
}
.ti-layers-alt:before {
	content: "\e630"
}
.ti-key:before {
	content: "\e631"
}
.ti-import:before {
	content: "\e632"
}
.ti-image:before {
	content: "\e633"
}
.ti-heart:before {
	content: "\e634"
}
.ti-heart-broken:before {
	content: "\e635"
}
.ti-hand-stop:before {
	content: "\e636"
}
.ti-hand-open:before {
	content: "\e637"
}
.ti-hand-drag:before {
	content: "\e638"
}
.ti-folder:before {
	content: "\e639"
}
.ti-flag:before {
	content: "\e63a"
}
.ti-flag-alt:before {
	content: "\e63b"
}
.ti-flag-alt-2:before {
	content: "\e63c"
}
.ti-eye:before {
	content: "\e63d"
}
.ti-export:before {
	content: "\e63e"
}
.ti-exchange-vertical:before {
	content: "\e63f"
}
.ti-desktop:before {
	content: "\e640"
}
.ti-cup:before {
	content: "\e641"
}
.ti-crown:before {
	content: "\e642"
}
.ti-comments:before {
	content: "\e643"
}
.ti-comment:before {
	content: "\e644"
}
.ti-comment-alt:before {
	content: "\e645"
}
.ti-close:before {
	content: "\e646"
}
.ti-clip:before {
	content: "\e647"
}
.ti-angle-up:before {
	content: "\e648"
}
.ti-angle-right:before {
	content: "\e649"
}
.ti-angle-left:before {
	content: "\e64a"
}
.ti-angle-down:before {
	content: "\e64b"
}
.ti-check:before {
	content: "\e64c"
}
.ti-check-box:before {
	content: "\e64d"
}
.ti-camera:before {
	content: "\e64e"
}
.ti-announcement:before {
	content: "\e64f"
}
.ti-brush:before {
	content: "\e650"
}
.ti-briefcase:before {
	content: "\e651"
}
.ti-bolt:before {
	content: "\e652"
}
.ti-bolt-alt:before {
	content: "\e653"
}
.ti-blackboard:before {
	content: "\e654"
}
.ti-bag:before {
	content: "\e655"
}
.ti-move:before {
	content: "\e656"
}
.ti-arrows-vertical:before {
	content: "\e657"
}
.ti-arrows-horizontal:before {
	content: "\e658"
}
.ti-fullscreen:before {
	content: "\e659"
}
.ti-arrow-top-right:before {
	content: "\e65a"
}
.ti-arrow-top-left:before {
	content: "\e65b"
}
.ti-arrow-circle-up:before {
	content: "\e65c"
}
.ti-arrow-circle-right:before {
	content: "\e65d"
}
.ti-arrow-circle-left:before {
	content: "\e65e"
}
.ti-arrow-circle-down:before {
	content: "\e65f"
}
.ti-angle-double-up:before {
	content: "\e660"
}
.ti-angle-double-right:before {
	content: "\e661"
}
.ti-angle-double-left:before {
	content: "\e662"
}
.ti-angle-double-down:before {
	content: "\e663"
}
.ti-zip:before {
	content: "\e664"
}
.ti-world:before {
	content: "\e665"
}
.ti-wheelchair:before {
	content: "\e666"
}
.ti-view-list:before {
	content: "\e667"
}
.ti-view-list-alt:before {
	content: "\e668"
}
.ti-view-grid:before {
	content: "\e669"
}
.ti-uppercase:before {
	content: "\e66a"
}
.ti-upload:before {
	content: "\e66b"
}
.ti-underline:before {
	content: "\e66c"
}
.ti-truck:before {
	content: "\e66d"
}
.ti-timer:before {
	content: "\e66e"
}
.ti-ticket:before {
	content: "\e66f"
}
.ti-thumb-up:before {
	content: "\e670"
}
.ti-thumb-down:before {
	content: "\e671"
}
.ti-text:before {
	content: "\e672"
}
.ti-stats-up:before {
	content: "\e673"
}
.ti-stats-down:before {
	content: "\e674"
}
.ti-split-v:before {
	content: "\e675"
}
.ti-split-h:before {
	content: "\e676"
}
.ti-smallcap:before {
	content: "\e677"
}
.ti-shine:before {
	content: "\e678"
}
.ti-shift-right:before {
	content: "\e679"
}
.ti-shift-left:before {
	content: "\e67a"
}
.ti-shield:before {
	content: "\e67b"
}
.ti-notepad:before {
	content: "\e67c"
}
.ti-server:before {
	content: "\e67d"
}
.ti-quote-right:before {
	content: "\e67e"
}
.ti-quote-left:before {
	content: "\e67f"
}
.ti-pulse:before {
	content: "\e680"
}
.ti-printer:before {
	content: "\e681"
}
.ti-power-off:before {
	content: "\e682"
}
.ti-plug:before {
	content: "\e683"
}
.ti-pie-chart:before {
	content: "\e684"
}
.ti-paragraph:before {
	content: "\e685"
}
.ti-panel:before {
	content: "\e686"
}
.ti-package:before {
	content: "\e687"
}
.ti-music:before {
	content: "\e688"
}
.ti-music-alt:before {
	content: "\e689"
}
.ti-mouse:before {
	content: "\e68a"
}
.ti-mouse-alt:before {
	content: "\e68b"
}
.ti-money:before {
	content: "\e68c"
}
.ti-microphone:before {
	content: "\e68d"
}
.ti-menu:before {
	content: "\e68e"
}
.ti-menu-alt:before {
	content: "\e68f"
}
.ti-map:before {
	content: "\e690"
}
.ti-map-alt:before {
	content: "\e691"
}
.ti-loop:before {
	content: "\e692"
}
.ti-location-pin:before {
	content: "\e693"
}
.ti-list:before {
	content: "\e694"
}
.ti-light-bulb:before {
	content: "\e695"
}
.ti-Italic:before {
	content: "\e696"
}
.ti-info:before {
	content: "\e697"
}
.ti-infinite:before {
	content: "\e698"
}
.ti-id-badge:before {
	content: "\e699"
}
.ti-hummer:before {
	content: "\e69a"
}
.ti-home:before {
	content: "\e69b"
}
.ti-help:before {
	content: "\e69c"
}
.ti-headphone:before {
	content: "\e69d"
}
.ti-harddrives:before {
	content: "\e69e"
}
.ti-harddrive:before {
	content: "\e69f"
}
.ti-gift:before {
	content: "\e6a0"
}
.ti-game:before {
	content: "\e6a1"
}
.ti-filter:before {
	content: "\e6a2"
}
.ti-files:before {
	content: "\e6a3"
}
.ti-file:before {
	content: "\e6a4"
}
.ti-eraser:before {
	content: "\e6a5"
}
.ti-envelope:before {
	content: "\e6a6"
}
.ti-download:before {
	content: "\e6a7"
}
.ti-direction:before {
	content: "\e6a8"
}
.ti-direction-alt:before {
	content: "\e6a9"
}
.ti-dashboard:before {
	content: "\e6aa"
}
.ti-control-stop:before {
	content: "\e6ab"
}
.ti-control-shuffle:before {
	content: "\e6ac"
}
.ti-control-play:before {
	content: "\e6ad"
}
.ti-control-pause:before {
	content: "\e6ae"
}
.ti-control-forward:before {
	content: "\e6af"
}
.ti-control-backward:before {
	content: "\e6b0"
}
.ti-cloud:before {
	content: "\e6b1"
}
.ti-cloud-up:before {
	content: "\e6b2"
}
.ti-cloud-down:before {
	content: "\e6b3"
}
.ti-clipboard:before {
	content: "\e6b4"
}
.ti-car:before {
	content: "\e6b5"
}
.ti-calendar:before {
	content: "\e6b6"
}
.ti-book:before {
	content: "\e6b7"
}
.ti-bell:before {
	content: "\e6b8"
}
.ti-basketball:before {
	content: "\e6b9"
}
.ti-bar-chart:before {
	content: "\e6ba"
}
.ti-bar-chart-alt:before {
	content: "\e6bb"
}
.ti-back-right:before {
	content: "\e6bc"
}
.ti-back-left:before {
	content: "\e6bd"
}
.ti-arrows-corner:before {
	content: "\e6be"
}
.ti-archive:before {
	content: "\e6bf"
}
.ti-anchor:before {
	content: "\e6c0"
}
.ti-align-right:before {
	content: "\e6c1"
}
.ti-align-left:before {
	content: "\e6c2"
}
.ti-align-justify:before {
	content: "\e6c3"
}
.ti-align-center:before {
	content: "\e6c4"
}
.ti-alert:before {
	content: "\e6c5"
}
.ti-alarm-clock:before {
	content: "\e6c6"
}
.ti-agenda:before {
	content: "\e6c7"
}
.ti-write:before {
	content: "\e6c8"
}
.ti-window:before {
	content: "\e6c9"
}
.ti-widgetized:before {
	content: "\e6ca"
}
.ti-widget:before {
	content: "\e6cb"
}
.ti-widget-alt:before {
	content: "\e6cc"
}
.ti-wallet:before {
	content: "\e6cd"
}
.ti-video-clapper:before {
	content: "\e6ce"
}
.ti-video-camera:before {
	content: "\e6cf"
}
.ti-vector:before {
	content: "\e6d0"
}
.ti-themify-logo:before {
	content: "\e6d1"
}
.ti-themify-favicon:before {
	content: "\e6d2"
}
.ti-themify-favicon-alt:before {
	content: "\e6d3"
}
.ti-support:before {
	content: "\e6d4"
}
.ti-stamp:before {
	content: "\e6d5"
}
.ti-split-v-alt:before {
	content: "\e6d6"
}
.ti-slice:before {
	content: "\e6d7"
}
.ti-shortcode:before {
	content: "\e6d8"
}
.ti-shift-right-alt:before {
	content: "\e6d9"
}
.ti-shift-left-alt:before {
	content: "\e6da"
}
.ti-ruler-alt-2:before {
	content: "\e6db"
}
.ti-receipt:before {
	content: "\e6dc"
}
.ti-pin2:before {
	content: "\e6dd"
}
.ti-pin-alt:before {
	content: "\e6de"
}
.ti-pencil-alt2:before {
	content: "\e6df"
}
.ti-palette:before {
	content: "\e6e0"
}
.ti-more:before {
	content: "\e6e1"
}
.ti-more-alt:before {
	content: "\e6e2"
}
.ti-microphone-alt:before {
	content: "\e6e3"
}
.ti-magnet:before {
	content: "\e6e4"
}
.ti-line-double:before {
	content: "\e6e5"
}
.ti-line-dotted:before {
	content: "\e6e6"
}
.ti-line-dashed:before {
	content: "\e6e7"
}
.ti-layout-width-full:before {
	content: "\e6e8"
}
.ti-layout-width-default:before {
	content: "\e6e9"
}
.ti-layout-width-default-alt:before {
	content: "\e6ea"
}
.ti-layout-tab:before {
	content: "\e6eb"
}
.ti-layout-tab-window:before {
	content: "\e6ec"
}
.ti-layout-tab-v:before {
	content: "\e6ed"
}
.ti-layout-tab-min:before {
	content: "\e6ee"
}
.ti-layout-slider:before {
	content: "\e6ef"
}
.ti-layout-slider-alt:before {
	content: "\e6f0"
}
.ti-layout-sidebar-right:before {
	content: "\e6f1"
}
.ti-layout-sidebar-none:before {
	content: "\e6f2"
}
.ti-layout-sidebar-left:before {
	content: "\e6f3"
}
.ti-layout-placeholder:before {
	content: "\e6f4"
}
.ti-layout-menu:before {
	content: "\e6f5"
}
.ti-layout-menu-v:before {
	content: "\e6f6"
}
.ti-layout-menu-separated:before {
	content: "\e6f7"
}
.ti-layout-menu-full:before {
	content: "\e6f8"
}
.ti-layout-media-right-alt:before {
	content: "\e6f9"
}
.ti-layout-media-right:before {
	content: "\e6fa"
}
.ti-layout-media-overlay:before {
	content: "\e6fb"
}
.ti-layout-media-overlay-alt:before {
	content: "\e6fc"
}
.ti-layout-media-overlay-alt-2:before {
	content: "\e6fd"
}
.ti-layout-media-left-alt:before {
	content: "\e6fe"
}
.ti-layout-media-left:before {
	content: "\e6ff"
}
.ti-layout-media-center-alt:before {
	content: "\e700"
}
.ti-layout-media-center:before {
	content: "\e701"
}
.ti-layout-list-thumb:before {
	content: "\e702"
}
.ti-layout-list-thumb-alt:before {
	content: "\e703"
}
.ti-layout-list-post:before {
	content: "\e704"
}
.ti-layout-list-large-image:before {
	content: "\e705"
}
.ti-layout-line-solid:before {
	content: "\e706"
}
.ti-layout-grid4:before {
	content: "\e707"
}
.ti-layout-grid3:before {
	content: "\e708"
}
.ti-layout-grid2:before {
	content: "\e709"
}
.ti-layout-grid2-thumb:before {
	content: "\e70a"
}
.ti-layout-cta-right:before {
	content: "\e70b"
}
.ti-layout-cta-left:before {
	content: "\e70c"
}
.ti-layout-cta-center:before {
	content: "\e70d"
}
.ti-layout-cta-btn-right:before {
	content: "\e70e"
}
.ti-layout-cta-btn-left:before {
	content: "\e70f"
}
.ti-layout-column4:before {
	content: "\e710"
}
.ti-layout-column3:before {
	content: "\e711"
}
.ti-layout-column2:before {
	content: "\e712"
}
.ti-layout-accordion-separated:before {
	content: "\e713"
}
.ti-layout-accordion-merged:before {
	content: "\e714"
}
.ti-layout-accordion-list:before {
	content: "\e715"
}
.ti-ink-pen:before {
	content: "\e716"
}
.ti-info-alt:before {
	content: "\e717"
}
.ti-help-alt:before {
	content: "\e718"
}
.ti-headphone-alt:before {
	content: "\e719"
}
.ti-hand-point-up:before {
	content: "\e71a"
}
.ti-hand-point-right:before {
	content: "\e71b"
}
.ti-hand-point-left:before {
	content: "\e71c"
}
.ti-hand-point-down:before {
	content: "\e71d"
}
.ti-gallery:before {
	content: "\e71e"
}
.ti-face-smile:before {
	content: "\e71f"
}
.ti-face-sad:before {
	content: "\e720"
}
.ti-credit-card:before {
	content: "\e721"
}
.ti-control-skip-forward:before {
	content: "\e722"
}
.ti-control-skip-backward:before {
	content: "\e723"
}
.ti-control-record:before {
	content: "\e724"
}
.ti-control-eject:before {
	content: "\e725"
}
.ti-comments-smiley:before {
	content: "\e726"
}
.ti-brush-alt:before {
	content: "\e727"
}
.ti-youtube:before {
	content: "\e728"
}
.ti-vimeo:before {
	content: "\e729"
}
.ti-twitter:before {
	content: "\e72a"
}
.ti-time:before {
	content: "\e72b"
}
.ti-tumblr:before {
	content: "\e72c"
}
.ti-skype:before {
	content: "\e72d"
}
.ti-share:before {
	content: "\e72e"
}
.ti-share-alt:before {
	content: "\e72f"
}
.ti-rocket:before {
	content: "\e730"
}
.ti-pinterest:before {
	content: "\e731"
}
.ti-new-window:before {
	content: "\e732"
}
.ti-microsoft:before {
	content: "\e733"
}
.ti-list-ol:before {
	content: "\e734"
}
.ti-linkedin:before {
	content: "\e735"
}
.ti-layout-sidebar-2:before {
	content: "\e736"
}
.ti-layout-grid4-alt:before {
	content: "\e737"
}
.ti-layout-grid3-alt:before {
	content: "\e738"
}
.ti-layout-grid2-alt:before {
	content: "\e739"
}
.ti-layout-column4-alt:before {
	content: "\e73a"
}
.ti-layout-column3-alt:before {
	content: "\e73b"
}
.ti-layout-column2-alt:before {
	content: "\e73c"
}
.ti-instagram:before {
	content: "\e73d"
}
.ti-google:before {
	content: "\e73e"
}
.ti-github:before {
	content: "\e73f"
}
.ti-flickr:before {
	content: "\e740"
}
.ti-facebook:before {
	content: "\e741"
}
.ti-dropbox:before {
	content: "\e742"
}
.ti-dribbble:before {
	content: "\e743"
}
.ti-apple:before {
	content: "\e744"
}
.ti-android:before {
	content: "\e745"
}
.ti-save:before {
	content: "\e746"
}
.ti-save-alt:before {
	content: "\e747"
}
.ti-yahoo:before {
	content: "\e748"
}
.ti-wordpress:before {
	content: "\e749"
}
.ti-vimeo-alt:before {
	content: "\e74a"
}
.ti-twitter-alt:before {
	content: "\e74b"
}
.ti-tumblr-alt:before {
	content: "\e74c"
}
.ti-trello:before {
	content: "\e74d"
}
.ti-stack-overflow:before {
	content: "\e74e"
}
.ti-soundcloud:before {
	content: "\e74f"
}
.ti-sharethis:before {
	content: "\e750"
}
.ti-sharethis-alt:before {
	content: "\e751"
}
.ti-reddit:before {
	content: "\e752"
}
.ti-pinterest-alt:before {
	content: "\e753"
}
.ti-microsoft-alt:before {
	content: "\e754"
}
.ti-linux:before {
	content: "\e755"
}
.ti-jsfiddle:before {
	content: "\e756"
}
.ti-joomla:before {
	content: "\e757"
}
.ti-html5:before {
	content: "\e758"
}
.ti-flickr-alt:before {
	content: "\e759"
}
.ti-email:before {
	content: "\e75a"
}
.ti-drupal:before {
	content: "\e75b"
}
.ti-dropbox-alt:before {
	content: "\e75c"
}
.ti-css3:before {
	content: "\e75d"
}
.ti-rss:before {
	content: "\e75e"
}
.ti-rss-alt:before {
	content: "\e75f"
}
.mfp-bg {
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	z-index: 999999;
	overflow: hidden;
	position: fixed;
	background: #0b0b0b;
	opacity: 0.8
}
.mfp-wrap {
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	z-index: 999999;
	position: fixed;
	outline: none !important;
	-webkit-backface-visibility: hidden
}
.mfp-container {
	text-align: center;
	position: absolute;
	width: 100%;
	height: 100%;
	left: 0;
	top: 0;
	padding: 0 8px;
	box-sizing: border-box
}
.mfp-container:before {
	content: '';
	display: inline-block;
	height: 100%;
	vertical-align: middle
}
.mfp-align-top .mfp-container:before {
	display: none
}
.mfp-content {
	position: relative;
	display: inline-block;
	vertical-align: middle;
	margin: 0 auto;
	text-align: left;
	z-index: 1045
}
.mfp-inline-holder .mfp-content, .mfp-ajax-holder .mfp-content {
	width: 100%;
	cursor: auto
}
.mfp-ajax-cur {
	cursor: progress
}
.mfp-zoom-out-cur, .mfp-zoom-out-cur .mfp-image-holder .mfp-close {
	cursor: -moz-zoom-out;
	cursor: -webkit-zoom-out;
	cursor: zoom-out
}
.mfp-zoom {
	cursor: pointer;
	cursor: -webkit-zoom-in;
	cursor: -moz-zoom-in;
	cursor: zoom-in
}
.mfp-auto-cursor .mfp-content {
	cursor: auto
}
.mfp-close, .mfp-arrow, .mfp-preloader, .mfp-counter {
	-webkit-user-select: none;
	-moz-user-select: none;
	user-select: none
}
.mfp-loading.mfp-figure {
	display: none
}
.mfp-hide {
	display: none !important
}
.mfp-preloader {
	color: #CCC;
	position: absolute;
	top: 50%;
	width: auto;
	text-align: center;
	margin-top: -0.8em;
	left: 8px;
	right: 8px;
	z-index: 1044
}
.mfp-preloader a {
	color: #CCC
}
.mfp-preloader a:hover {
	color: #FFF
}
.mfp-s-ready .mfp-preloader {
	display: none
}
.mfp-s-error .mfp-content {
	display: none
}
button.mfp-close, button.mfp-arrow {
	overflow: visible;
	cursor: pointer;
	background: transparent;
	border: 0;
	-webkit-appearance: none;
	display: block;
	outline: none;
	padding: 0;
	z-index: 1046;
	box-shadow: none;
	touch-action: manipulation
}
button::-moz-focus-inner {
padding:0;
border:0
}
.mfp-close {
	width: 44px;
	height: 44px;
	line-height: 44px;
	position: absolute;
	right: 0;
	top: 0;
	text-decoration: none;
	text-align: center;
	opacity: 0.65;
	padding: 0 0 18px 10px;
	color: #FFF;
	font-style: normal;
	font-size: 28px;
	font-family: Arial, Baskerville, monospace
}
.mfp-close:hover, .mfp-close:focus {
	opacity: 1
}
.mfp-close:active {
	top: 1px
}
.mfp-close-btn-in .mfp-close {
	color: #333
}
.mfp-image-holder .mfp-close, .mfp-iframe-holder .mfp-close {
	color: #FFF;
	right: -6px;
	text-align: right;
	padding-right: 6px;
	width: 100%
}
.mfp-counter {
	position: absolute;
	top: 0;
	right: 0;
	color: #CCC;
	font-size: 12px;
	line-height: 18px;
	white-space: nowrap
}
.mfp-arrow {
	position: absolute;
	opacity: 0.65;
	margin: 0;
	top: 50%;
	margin-top: -55px;
	padding: 0;
	width: 90px;
	height: 110px;
	-webkit-tap-highlight-color: transparent
}
.mfp-arrow:active {
	margin-top: -54px
}
.mfp-arrow:hover, .mfp-arrow:focus {
	opacity: 1
}
.mfp-arrow:before, .mfp-arrow:after {
	content: '';
	display: block;
	width: 0;
	height: 0;
	position: absolute;
	left: 0;
	top: 0;
	margin-top: 35px;
	margin-left: 35px;
	border: medium inset transparent
}
.mfp-arrow:after {
	border-top-width: 13px;
	border-bottom-width: 13px;
	top: 8px
}
.mfp-arrow:before {
	border-top-width: 21px;
	border-bottom-width: 21px;
	opacity: 0.7
}
.mfp-arrow-left {
	left: 0
}
.mfp-arrow-left:after {
	border-right: 17px solid #FFF;
	margin-left: 31px
}
.mfp-arrow-left:before {
	margin-left: 25px;
	border-right: 27px solid #3F3F3F
}
.mfp-arrow-right {
	right: 0
}
.mfp-arrow-right:after {
	border-left: 17px solid #FFF;
	margin-left: 39px
}
.mfp-arrow-right:before {
	border-left: 27px solid #3F3F3F
}
.mfp-iframe-holder {
	padding-top: 40px;
	padding-bottom: 40px
}
.mfp-iframe-holder .mfp-content {
	line-height: 0;
	width: 100%;
	max-width: 900px
}
.mfp-iframe-holder .mfp-close {
	top: -40px
}
.mfp-iframe-scaler {
	width: 100%;
	height: 0;
	overflow: hidden;
	padding-top: 56.25%
}
.mfp-iframe-scaler iframe {
	position: absolute;
	display: block;
	top: 0;
	left: 0;
	width: 100%;
	height: 100%;
	box-shadow: 0 0 8px rgba(0,0,0,0.6);
	background: #000
}
img.mfp-img {
	width: auto;
	max-width: 100%;
	height: auto;
	display: block;
	line-height: 0;
	box-sizing: border-box;
	padding: 40px 0 40px;
	margin: 0 auto
}
.mfp-figure {
	line-height: 0
}
.mfp-figure:after {
	content: '';
	position: absolute;
	left: 0;
	top: 40px;
	bottom: 40px;
	display: block;
	right: 0;
	width: auto;
	height: auto;
	z-index: -1;
	box-shadow: 0 0 8px rgba(0,0,0,0.6);
	background: #444
}
.mfp-figure small {
	color: #BDBDBD;
	display: block;
	font-size: 12px;
	line-height: 14px
}
.mfp-figure figure {
	margin: 0
}
.mfp-bottom-bar {
	margin-top: -36px;
	position: absolute;
	top: 100%;
	left: 0;
	width: 100%;
	cursor: auto
}
.mfp-title {
	text-align: left;
	line-height: 18px;
	color: #F3F3F3;
	word-wrap: break-word;
	padding-right: 36px
}
.mfp-image-holder .mfp-content {
	max-width: 100%
}
.mfp-gallery .mfp-image-holder .mfp-figure {
	cursor: pointer
}

@media screen and (max-width: 800px) and (orientation: landscape), screen and (max-height: 300px) {
.mfp-img-mobile .mfp-image-holder {
	padding-left: 0;
	padding-right: 0
}
.mfp-img-mobile img.mfp-img {
	padding: 0
}
.mfp-img-mobile .mfp-figure:after {
	top: 0;
	bottom: 0
}
.mfp-img-mobile .mfp-figure small {
	display: inline;
	margin-left: 5px
}
.mfp-img-mobile .mfp-bottom-bar {
	background: rgba(0,0,0,0.6);
	bottom: 0;
	margin: 0;
	top: auto;
	padding: 3px 5px;
	position: fixed;
	box-sizing: border-box
}
.mfp-img-mobile .mfp-bottom-bar:empty {
	padding: 0
}
.mfp-img-mobile .mfp-counter {
	right: 5px;
	top: 3px
}
.mfp-img-mobile .mfp-close {
	top: 0;
	right: 0;
	width: 35px;
	height: 35px;
	line-height: 35px;
	background: rgba(0,0,0,0.6);
	position: fixed;
	text-align: center;
	padding: 0
}
}

@media all and (max-width: 900px) {
.mfp-arrow {
	-webkit-transform: scale(0.75);
	transform: scale(0.75)
}
.mfp-arrow-left {
	-webkit-transform-origin: 0;
	transform-origin: 0
}
.mfp-arrow-right {
	-webkit-transform-origin: 100%;
	transform-origin: 100%
}
.mfp-container {
	padding-left: 6px;
	padding-right: 6px
}
}
.owl-carousel {
	display: none;
	width: 100%;
	-webkit-tap-highlight-color: transparent;
	position: relative;
	z-index: 1
}
.owl-carousel .owl-stage {
	position: relative;
	-ms-touch-action: pan-Y;
	touch-action: manipulation;
	-moz-backface-visibility: hidden
}
.owl-carousel .owl-stage:after {
	content: ".";
	display: block;
	clear: both;
	visibility: hidden;
	line-height: 0;
	height: 0
}
.owl-carousel .owl-stage-outer {
	position: relative;
	overflow: hidden;
	-webkit-transform: translate3d(0px, 0px, 0px)
}
.owl-carousel .owl-wrapper, .owl-carousel .owl-item {
	-webkit-backface-visibility: hidden;
	-moz-backface-visibility: hidden;
	-ms-backface-visibility: hidden;
	-webkit-transform: translate3d(0, 0, 0);
	-moz-transform: translate3d(0, 0, 0);
	-ms-transform: translate3d(0, 0, 0)
}
.owl-carousel .owl-item {
	position: relative;
	min-height: 1px;
	float: left;
	-webkit-backface-visibility: hidden;
	-webkit-tap-highlight-color: transparent;
	-webkit-touch-callout: none
}
.owl-carousel .owl-item img {
	display: block;
	width: 100%
}
.owl-carousel .owl-nav.disabled, .owl-carousel .owl-dots.disabled {
	display: none
}
.owl-carousel .owl-nav .owl-prev, .owl-carousel .owl-nav .owl-next, .owl-carousel .owl-dot {
	cursor: pointer;
	-webkit-user-select: none;
	-khtml-user-select: none;
	-moz-user-select: none;
	-ms-user-select: none;
	user-select: none
}
.owl-carousel .owl-nav button.owl-prev, .owl-carousel .owl-nav button.owl-next, .owl-carousel button.owl-dot {
	background: none;
	color: inherit;
	border: none;
	padding: 0 !important;
	font: inherit
}
.owl-carousel.owl-loaded {
	display: block
}
.owl-carousel.owl-loading {
	opacity: 0;
	display: block
}
.owl-carousel.owl-hidden {
	opacity: 0
}
.owl-carousel.owl-refresh .owl-item {
	visibility: hidden
}
.owl-carousel.owl-drag .owl-item {
	-ms-touch-action: pan-y;
	touch-action: pan-y;
	-webkit-user-select: none;
	-moz-user-select: none;
	-ms-user-select: none;
	user-select: none
}
.owl-carousel.owl-grab {
	cursor: move;
	cursor: grab
}
.owl-carousel.owl-rtl {
	direction: rtl
}
.owl-carousel.owl-rtl .owl-item {
	float: right
}
.no-js .owl-carousel {
	display: block
}
.owl-carousel .animated {
	animation-duration: 1000ms;
	animation-fill-mode: both
}
.owl-carousel .owl-animated-in {
	z-index: 0
}
.owl-carousel .owl-animated-out {
	z-index: 1
}
.owl-carousel .fadeOut {
	animation-name: fadeOut
}
@keyframes fadeOut {
0% {
opacity:1
}
100% {
opacity:0
}
}
.owl-height {
	transition: height 500ms ease-in-out
}
.owl-carousel .owl-item .owl-lazy {
	opacity: 0;
	transition: opacity 400ms ease
}
.owl-carousel .owl-item .owl-lazy[src^=""], .owl-carousel .owl-item .owl-lazy:not([src]) {
	max-height: 0
}
.owl-carousel .owl-item img.owl-lazy {
	transform-style: preserve-3d
}
.owl-carousel .owl-video-wrapper {
	position: relative;
	height: 100%;
	background: #000
}
.owl-carousel .owl-video-play-icon {
	position: absolute;
	height: 80px;
	width: 80px;
	left: 50%;
	top: 50%;
	margin-left: -40px;
	margin-top: -40px;
	background: url("owl.video.play.html") no-repeat;
	cursor: pointer;
	z-index: 1;
	-webkit-backface-visibility: hidden;
	transition: transform 100ms ease
}
.owl-carousel .owl-video-play-icon:hover {
	-ms-transform: scale(1.3, 1.3);
	transform: scale(1.3, 1.3)
}
.owl-carousel .owl-video-playing .owl-video-tn, .owl-carousel .owl-video-playing .owl-video-play-icon {
	display: none
}
.owl-carousel .owl-video-tn {
	opacity: 0;
	height: 100%;
	background-position: center center;
	background-repeat: no-repeat;
	background-size: contain;
	transition: opacity 400ms ease
}
.owl-carousel .owl-video-frame {
	position: relative;
	z-index: 1;
	height: 100%;
	width: 100%
}
.owl-theme .owl-nav {
	margin-top: 10px;
	text-align: center;
	-webkit-tap-highlight-color: transparent
}
.owl-theme .owl-nav [class*='owl-'] {
	color: #FFF;
	font-size: 14px;
	margin: 5px;
	padding: 4px 7px;
	background: #D6D6D6;
	display: inline-block;
	cursor: pointer;
	border-radius: 3px
}
.owl-theme .owl-nav [class*='owl-']:hover {
	background: #869791;
	color: #FFF;
	text-decoration: none
}
.owl-theme .owl-nav .disabled {
	opacity: 0.5;
	cursor: default
}
.owl-theme .owl-nav.disabled+.owl-dots {
	margin-top: 10px
}
.owl-theme .owl-dots {
	text-align: center;
	-webkit-tap-highlight-color: transparent
}
.owl-theme .owl-dots .owl-dot {
	display: inline-block;
	zoom: 1;
*display:inline
}
.owl-theme .owl-dots .owl-dot span {
	width: 10px;
	height: 10px;
	margin: 5px 7px;
	background: #D6D6D6;
	display: block;
	-webkit-backface-visibility: visible;
	transition: opacity 200ms ease;
	border-radius: 30px
}
.owl-theme .owl-dots .owl-dot.active span, .owl-theme .owl-dots .owl-dot:hover span {
	background: #869791
}/*! lightgallery - v1.9.0 - 2020-10-14
* http://sachinchoolur.github.io/lightGallery/
* Copyright (c) 2020 Sachin N; Licensed GPLv3 */
@font-face {
	font-family: 'lg';
	src: url("../fonts/lg8306.ttf?22t19m") format("truetype"), url("../fonts/lg8306.woff?22t19m") format("woff"), url("../fonts/lg8306.svg?22t19m#lg") format("svg");
	font-weight: normal;
	font-style: normal;
	font-display: block
}
.lg-icon {
	font-family: 'lg' !important;
	speak: never;
	font-style: normal;
	font-weight: normal;
	font-variant: normal;
	text-transform: none;
	line-height: 1;
	-webkit-font-smoothing: antialiased;
	-moz-osx-font-smoothing: grayscale
}
.lg-actions .lg-next, .lg-actions .lg-prev {
	background-color: rgba(0,0,0,0.45);
	border-radius: 2px;
	color: #999;
	cursor: pointer;
	display: block;
	font-size: 22px;
	margin-top: -10px;
	padding: 8px 10px 9px;
	position: absolute;
	top: 50%;
	z-index: 1080;
	border: none;
	outline: none
}
.lg-actions .lg-next.disabled, .lg-actions .lg-prev.disabled {
	pointer-events: none;
	opacity: 0.5
}
.lg-actions .lg-next:hover, .lg-actions .lg-prev:hover {
	color: #FFF
}
.lg-actions .lg-next {
	right: 20px
}
.lg-actions .lg-next:before {
	content: "\e095"
}
.lg-actions .lg-prev {
	left: 20px
}
.lg-actions .lg-prev:after {
	content: "\e094"
}
@-webkit-keyframes lg-right-end {
0% {
left:0
}
50% {
left:-30px
}
100% {
left:0
}
}
@-moz-keyframes lg-right-end {
0% {
left:0
}
50% {
left:-30px
}
100% {
left:0
}
}
@-ms-keyframes lg-right-end {
0% {
left:0
}
50% {
left:-30px
}
100% {
left:0
}
}
@keyframes lg-right-end {
0% {
left:0
}
50% {
left:-30px
}
100% {
left:0
}
}
@-webkit-keyframes lg-left-end {
0% {
left:0
}
50% {
left:30px
}
100% {
left:0
}
}
@-moz-keyframes lg-left-end {
0% {
left:0
}
50% {
left:30px
}
100% {
left:0
}
}
@-ms-keyframes lg-left-end {
0% {
left:0
}
50% {
left:30px
}
100% {
left:0
}
}
@keyframes lg-left-end {
0% {
left:0
}
50% {
left:30px
}
100% {
left:0
}
}
.lg-outer.lg-right-end .lg-object {
	-webkit-animation: lg-right-end 0.3s;
	-o-animation: lg-right-end 0.3s;
	animation: lg-right-end 0.3s;
	position: relative
}
.lg-outer.lg-left-end .lg-object {
	-webkit-animation: lg-left-end 0.3s;
	-o-animation: lg-left-end 0.3s;
	animation: lg-left-end 0.3s;
	position: relative
}
.lg-toolbar {
	z-index: 1082;
	left: 0;
	position: absolute;
	top: 0;
	width: 100%;
	background-color: rgba(0,0,0,0.45)
}
.lg-toolbar .lg-icon {
	color: #999;
	cursor: pointer;
	float: right;
	font-size: 24px;
	height: 47px;
	line-height: 27px;
	padding: 10px 0;
	text-align: center;
	width: 50px;
	text-decoration: none !important;
	outline: medium none;
	background: none;
	border: none;
	box-shadow: none;
	-webkit-transition: color 0.2s linear;
	-o-transition: color 0.2s linear;
	transition: color 0.2s linear
}
.lg-toolbar .lg-icon:hover {
	color: #FFF
}
.lg-toolbar .lg-close:after {
	content: "\e070"
}
.lg-toolbar .lg-download:after {
	content: "\e0f2"
}
.lg-sub-html {
	background-color: rgba(0,0,0,0.45);
	bottom: 0;
	color: #EEE;
	font-size: 16px;
	left: 0;
	padding: 10px 40px;
	position: fixed;
	right: 0;
	text-align: center;
	z-index: 1080
}
.lg-sub-html h4 {
	margin: 0;
	font-size: 13px;
	font-weight: bold
}
.lg-sub-html p {
	font-size: 12px;
	margin: 5px 0 0
}
#lg-counter {
	color: #999;
	display: inline-block;
	font-size: 16px;
	padding-left: 20px;
	padding-top: 12px;
	vertical-align: middle
}
.lg-toolbar, .lg-prev, .lg-next {
	opacity: 1;
	-webkit-transition: -webkit-transform 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, color 0.2s linear;
	-moz-transition: -moz-transform 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, color 0.2s linear;
	-o-transition: -o-transform 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, color 0.2s linear;
	transition: transform 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.35s cubic-bezier(0, 0, 0.25, 1) 0s, color 0.2s linear
}
.lg-hide-items .lg-prev {
	opacity: 0;
	-webkit-transform: translate3d(-10px, 0, 0);
	transform: translate3d(-10px, 0, 0)
}
.lg-hide-items .lg-next {
	opacity: 0;
	-webkit-transform: translate3d(10px, 0, 0);
	transform: translate3d(10px, 0, 0)
}
.lg-hide-items .lg-toolbar {
	opacity: 0;
	-webkit-transform: translate3d(0, -10px, 0);
	transform: translate3d(0, -10px, 0)
}
body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-object {
	-webkit-transform: scale3d(0.5, 0.5, 0.5);
	transform: scale3d(0.5, 0.5, 0.5);
	opacity: 0;
	-webkit-transition: -webkit-transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
	-moz-transition: -moz-transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
	-o-transition: -o-transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
	transition: transform 250ms cubic-bezier(0, 0, 0.25, 1) 0s, opacity 250ms cubic-bezier(0, 0, 0.25, 1) !important;
	-webkit-transform-origin: 50% 50%;
	-moz-transform-origin: 50% 50%;
	-ms-transform-origin: 50% 50%;
	transform-origin: 50% 50%
}
body:not(.lg-from-hash) .lg-outer.lg-start-zoom .lg-item.lg-complete .lg-object {
	-webkit-transform: scale3d(1, 1, 1);
	transform: scale3d(1, 1, 1);
	opacity: 1
}
.lg-outer .lg-thumb-outer {
	background-color: #0D0A0A;
	bottom: 0;
	position: absolute;
	width: 100%;
	z-index: 1080;
	max-height: 350px;
	-webkit-transform: translate3d(0, 100%, 0);
	transform: translate3d(0, 100%, 0);
	-webkit-transition: -webkit-transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s;
	-moz-transition: -moz-transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s;
	-o-transition: -o-transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s;
	transition: transform 0.25s cubic-bezier(0, 0, 0.25, 1) 0s
}
.lg-outer .lg-thumb-outer.lg-grab .lg-thumb-item {
	cursor: -webkit-grab;
	cursor: -moz-grab;
	cursor: -o-grab;
	cursor: -ms-grab;
	cursor: grab
}
.lg-outer .lg-thumb-outer.lg-grabbing .lg-thumb-item {
	cursor: move;
	cursor: -webkit-grabbing;
	cursor: -moz-grabbing;
	cursor: -o-grabbing;
	cursor: -ms-grabbing;
	cursor: grabbing
}
.lg-outer .lg-thumb-outer.lg-dragging .lg-thumb {
	-webkit-transition-duration: 0s !important;
	transition-duration: 0s !important
}
.lg-outer.lg-thumb-open .lg-thumb-outer {
	-webkit-transform: translate3d(0, 0%, 0);
	transform: translate3d(0, 0%, 0)
}
.lg-outer .lg-thumb {
	padding: 10px 0;
	height: 100%;
	margin-bottom: -5px
}
.lg-outer .lg-thumb-item {
	border-radius: 5px;
	cursor: pointer;
	float: left;
	overflow: hidden;
	height: 100%;
	border: 2px solid #FFF;
	border-radius: 4px;
	margin-bottom: 5px
}

@media (min-width: 1025px) {
.lg-outer .lg-thumb-item {
	-webkit-transition: border-color 0.25s ease;
	-o-transition: border-color 0.25s ease;
	transition: border-color 0.25s ease
}
}
.lg-outer .lg-thumb-item.active, .lg-outer .lg-thumb-item:hover {
	border-color: #a90707
}
.lg-outer .lg-thumb-item img {
	width: 100%;
	height: 100%;
	object-fit: cover
}
.lg-outer.lg-has-thumb .lg-item {
	padding-bottom: 120px
}
.lg-outer.lg-can-toggle .lg-item {
	padding-bottom: 0
}
.lg-outer.lg-pull-caption-up .lg-sub-html {
	-webkit-transition: bottom 0.25s ease;
	-o-transition: bottom 0.25s ease;
	transition: bottom 0.25s ease
}
.lg-outer.lg-pull-caption-up.lg-thumb-open .lg-sub-html {
	bottom: 100px
}
.lg-outer .lg-toogle-thumb {
	background-color: #0D0A0A;
	border-radius: 2px 2px 0 0;
	color: #999;
	cursor: pointer;
	font-size: 24px;
	height: 39px;
	line-height: 27px;
	padding: 5px 0;
	position: absolute;
	right: 20px;
	text-align: center;
	top: -39px;
	width: 50px;
	outline: medium none;
	border: none
}
.lg-outer .lg-toogle-thumb:after {
	content: "\e1ff"
}
.lg-outer .lg-toogle-thumb:hover {
	color: #FFF
}
.lg-outer .lg-video-cont {
	display: inline-block;
	vertical-align: middle;
	max-width: 1140px;
	max-height: 100%;
	width: 100%;
	padding: 0 5px
}
.lg-outer .lg-video {
	width: 100%;
	height: 0;
	padding-bottom: 56.25%;
	overflow: hidden;
	position: relative
}
.lg-outer .lg-video .lg-object {
	display: inline-block;
	position: absolute;
	top: 0;
	left: 0;
	width: 100% !important;
	height: 100% !important
}
.lg-outer .lg-video .lg-video-play {
	width: 84px;
	height: 59px;
	position: absolute;
	left: 50%;
	top: 50%;
	margin-left: -42px;
	margin-top: -30px;
	z-index: 1080;
	cursor: pointer
}
.lg-outer .lg-has-iframe .lg-video {
	-webkit-overflow-scrolling: touch;
	overflow: auto
}
.lg-outer .lg-has-vimeo .lg-video-play {
	background: url("../img/icons/vimeo-play.html") no-repeat scroll 0 0 transparent
}
.lg-outer .lg-has-vimeo:hover .lg-video-play {
	background: url("../img/icons/vimeo-play.html") no-repeat scroll 0 -58px transparent
}
.lg-outer .lg-has-html5 .lg-video-play {
	background: transparent url("../img/icons/video-play.html") no-repeat scroll 0 0;
	height: 64px;
	margin-left: -32px;
	margin-top: -32px;
	width: 64px;
	opacity: 0.8
}
.lg-outer .lg-has-html5:hover .lg-video-play {
	opacity: 1
}
.lg-outer .lg-has-youtube .lg-video-play {
	background: url("../img/icons/youtube-play.html") no-repeat scroll 0 0 transparent
}
.lg-outer .lg-has-youtube:hover .lg-video-play {
	background: url("../img/icons/youtube-play.html") no-repeat scroll 0 -60px transparent
}
.lg-outer .lg-video-object {
	width: 100% !important;
	height: 100% !important;
	position: absolute;
	top: 0;
	left: 0
}
.lg-outer .lg-has-video .lg-video-object {
	visibility: hidden
}
.lg-outer .lg-has-video.lg-video-playing .lg-object, .lg-outer .lg-has-video.lg-video-playing .lg-video-play {
	display: none
}
.lg-outer .lg-has-video.lg-video-playing .lg-video-object {
	visibility: visible
}
.lg-progress-bar {
	background-color: #333;
	height: 5px;
	left: 0;
	position: absolute;
	top: 0;
	width: 100%;
	z-index: 1083;
	opacity: 0;
	-webkit-transition: opacity 0.08s ease 0s;
	-moz-transition: opacity 0.08s ease 0s;
	-o-transition: opacity 0.08s ease 0s;
	transition: opacity 0.08s ease 0s
}
.lg-progress-bar .lg-progress {
	background-color: #a90707;
	height: 5px;
	width: 0
}
.lg-progress-bar.lg-start .lg-progress {
	width: 100%
}
.lg-show-autoplay .lg-progress-bar {
	opacity: 1
}
.lg-autoplay-button:after {
	content: "\e01d"
}
.lg-show-autoplay .lg-autoplay-button:after {
	content: "\e01a"
}
.lg-outer.lg-css3.lg-zoom-dragging .lg-item.lg-complete.lg-zoomable .lg-img-wrap, .lg-outer.lg-css3.lg-zoom-dragging .lg-item.lg-complete.lg-zoomable .lg-image {
	-webkit-transition-duration: 0s;
	transition-duration: 0s
}
.lg-outer.lg-use-transition-for-zoom .lg-item.lg-complete.lg-zoomable .lg-img-wrap {
	-webkit-transition: -webkit-transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s;
	-moz-transition: -moz-transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s;
	-o-transition: -o-transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s;
	transition: transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s
}
.lg-outer.lg-use-left-for-zoom .lg-item.lg-complete.lg-zoomable .lg-img-wrap {
	-webkit-transition: left 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, top 0.3s cubic-bezier(0, 0, 0.25, 1) 0s;
	-moz-transition: left 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, top 0.3s cubic-bezier(0, 0, 0.25, 1) 0s;
	-o-transition: left 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, top 0.3s cubic-bezier(0, 0, 0.25, 1) 0s;
	transition: left 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, top 0.3s cubic-bezier(0, 0, 0.25, 1) 0s
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-img-wrap {
	-webkit-transform: translate3d(0, 0, 0);
	transform: translate3d(0, 0, 0);
	-webkit-backface-visibility: hidden;
	-moz-backface-visibility: hidden;
	backface-visibility: hidden
}
.lg-outer .lg-item.lg-complete.lg-zoomable .lg-image {
	-webkit-transform: scale3d(1, 1, 1);
	transform: scale3d(1, 1, 1);
	-webkit-transition: -webkit-transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.15s !important;
	-moz-transition: -moz-transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.15s !important;
	-o-transition: -o-transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.15s !important;
	transition: transform 0.3s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.15s !important;
	-webkit-transform-origin: 0 0;
	-moz-transform-origin: 0 0;
	-ms-transform-origin: 0 0;
	transform-origin: 0 0;
	-webkit-backface-visibility: hidden;
	-moz-backface-visibility: hidden;
	backface-visibility: hidden
}
#lg-zoom-in:after {
	content: "\e311"
}
#lg-actual-size {
	font-size: 20px
}
#lg-actual-size:after {
	content: "\e033"
}
#lg-zoom-out {
	opacity: 0.5;
	pointer-events: none
}
#lg-zoom-out:after {
	content: "\e312"
}
.lg-zoomed #lg-zoom-out {
	opacity: 1;
	pointer-events: auto
}
.lg-outer .lg-pager-outer {
	bottom: 60px;
	left: 0;
	position: absolute;
	right: 0;
	text-align: center;
	z-index: 1080;
	height: 10px
}
.lg-outer .lg-pager-outer.lg-pager-hover .lg-pager-cont {
	overflow: visible
}
.lg-outer .lg-pager-cont {
	cursor: pointer;
	display: inline-block;
	overflow: hidden;
	position: relative;
	vertical-align: top;
	margin: 0 5px
}
.lg-outer .lg-pager-cont:hover .lg-pager-thumb-cont {
	opacity: 1;
	-webkit-transform: translate3d(0, 0, 0);
	transform: translate3d(0, 0, 0)
}
.lg-outer .lg-pager-cont.lg-pager-active .lg-pager {
	box-shadow: 0 0 0 2px white inset
}
.lg-outer .lg-pager-thumb-cont {
	background-color: #fff;
	color: #FFF;
	bottom: 100%;
	height: 83px;
	left: 0;
	margin-bottom: 20px;
	margin-left: -60px;
	opacity: 0;
	padding: 5px;
	position: absolute;
	width: 120px;
	border-radius: 3px;
	-webkit-transition: opacity 0.15s ease 0s, -webkit-transform 0.15s ease 0s;
	-moz-transition: opacity 0.15s ease 0s, -moz-transform 0.15s ease 0s;
	-o-transition: opacity 0.15s ease 0s, -o-transform 0.15s ease 0s;
	transition: opacity 0.15s ease 0s, transform 0.15s ease 0s;
	-webkit-transform: translate3d(0, 5px, 0);
	transform: translate3d(0, 5px, 0)
}
.lg-outer .lg-pager-thumb-cont img {
	width: 100%;
	height: 100%
}
.lg-outer .lg-pager {
	background-color: rgba(255,255,255,0.5);
	border-radius: 50%;
	box-shadow: 0 0 0 8px rgba(255,255,255,0.7) inset;
	display: block;
	height: 12px;
	-webkit-transition: box-shadow 0.3s ease 0s;
	-o-transition: box-shadow 0.3s ease 0s;
	transition: box-shadow 0.3s ease 0s;
	width: 12px
}
.lg-outer .lg-pager:hover, .lg-outer .lg-pager:focus {
	box-shadow: 0 0 0 8px white inset
}
.lg-outer .lg-caret {
	border-left: 10px solid transparent;
	border-right: 10px solid transparent;
	border-top: 10px dashed;
	bottom: -10px;
	display: inline-block;
	height: 0;
	left: 50%;
	margin-left: -5px;
	position: absolute;
	vertical-align: middle;
	width: 0
}
.lg-fullscreen:after {
	content: "\e20c"
}
.lg-fullscreen-on .lg-fullscreen:after {
	content: "\e20d"
}
.lg-outer #lg-dropdown-overlay {
	background-color: rgba(0,0,0,0.25);
	bottom: 0;
	cursor: default;
	left: 0;
	position: fixed;
	right: 0;
	top: 0;
	z-index: 1081;
	opacity: 0;
	visibility: hidden;
	-webkit-transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
	-o-transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s;
	transition: visibility 0s linear 0.18s, opacity 0.18s linear 0s
}
.lg-outer.lg-dropdown-active .lg-dropdown, .lg-outer.lg-dropdown-active #lg-dropdown-overlay {
	-webkit-transition-delay: 0s;
	transition-delay: 0s;
	-moz-transform: translate3d(0, 0px, 0);
	-o-transform: translate3d(0, 0px, 0);
	-ms-transform: translate3d(0, 0px, 0);
	-webkit-transform: translate3d(0, 0px, 0);
	transform: translate3d(0, 0px, 0);
	opacity: 1;
	visibility: visible
}
.lg-outer.lg-dropdown-active #lg-share {
	color: #FFF
}
.lg-outer .lg-dropdown {
	background-color: #fff;
	border-radius: 2px;
	font-size: 14px;
	list-style-type: none;
	margin: 0;
	padding: 10px 0;
	position: absolute;
	right: 0;
	text-align: left;
	top: 50px;
	opacity: 0;
	visibility: hidden;
	-moz-transform: translate3d(0, 5px, 0);
	-o-transform: translate3d(0, 5px, 0);
	-ms-transform: translate3d(0, 5px, 0);
	-webkit-transform: translate3d(0, 5px, 0);
	transform: translate3d(0, 5px, 0);
	-webkit-transition: -webkit-transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s;
	-moz-transition: -moz-transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s;
	-o-transition: -o-transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s;
	transition: transform 0.18s linear 0s, visibility 0s linear 0.5s, opacity 0.18s linear 0s
}
.lg-outer .lg-dropdown:after {
	content: "";
	display: block;
	height: 0;
	width: 0;
	position: absolute;
	border: 8px solid transparent;
	border-bottom-color: #FFF;
	right: 16px;
	top: -16px
}
.lg-outer .lg-dropdown>li:last-child {
	margin-bottom: 0px
}
.lg-outer .lg-dropdown>li:hover a, .lg-outer .lg-dropdown>li:hover .lg-icon {
	color: #333
}
.lg-outer .lg-dropdown a {
	color: #333;
	display: block;
	white-space: pre;
	padding: 4px 12px;
	font-family: "Open Sans", "Helvetica Neue", Helvetica, Arial, sans-serif;
	font-size: 12px
}
.lg-outer .lg-dropdown a:hover {
	background-color: rgba(0,0,0,0.07)
}
.lg-outer .lg-dropdown .lg-dropdown-text {
	display: inline-block;
	line-height: 1;
	margin-top: -3px;
	vertical-align: middle
}
.lg-outer .lg-dropdown .lg-icon {
	color: #333;
	display: inline-block;
	float: none;
	font-size: 20px;
	height: auto;
	line-height: 1;
	margin-right: 8px;
	padding: 0;
	vertical-align: middle;
	width: auto
}
.lg-outer #lg-share {
	position: relative
}
.lg-outer #lg-share:after {
	content: "\e80d"
}
.lg-outer #lg-share-facebook .lg-icon {
	color: #3b5998
}
.lg-outer #lg-share-facebook .lg-icon:after {
	content: "\e904"
}
.lg-outer #lg-share-twitter .lg-icon {
	color: #00aced
}
.lg-outer #lg-share-twitter .lg-icon:after {
	content: "\e907"
}
.lg-outer #lg-share-pinterest .lg-icon {
	color: #cb2027
}
.lg-outer #lg-share-pinterest .lg-icon:after {
	content: "\e906"
}
.lg-outer .lg-img-rotate {
	position: absolute;
	padding: 0 5px;
	left: 0;
	right: 0;
	top: 0;
	bottom: 0;
	-webkit-transition: -webkit-transform 0.3s cubic-bezier(0.32, 0, 0.67, 0) 0s;
	-moz-transition: -moz-transform 0.3s cubic-bezier(0.32, 0, 0.67, 0) 0s;
	-o-transition: -o-transform 0.3s cubic-bezier(0.32, 0, 0.67, 0) 0s;
	transition: transform 0.3s cubic-bezier(0.32, 0, 0.67, 0) 0s
}
.lg-rotate-left:after {
	content: "\e900"
}
.lg-rotate-right:after {
	content: "\e901"
}
.lg-icon.lg-flip-hor, .lg-icon.lg-flip-ver {
	font-size: 26px
}
.lg-flip-ver:after {
	content: "\e903"
}
.lg-flip-hor:after {
	content: "\e902"
}
.lg-group:after {
	content: "";
	display: table;
	clear: both
}
.lg-outer {
	width: 100%;
	height: 100%;
	position: fixed;
	top: 0;
	left: 0;
	z-index: 1050;
	text-align: left;
	opacity: 0;
	outline: none;
	-webkit-transition: opacity 0.15s ease 0s;
	-o-transition: opacity 0.15s ease 0s;
	transition: opacity 0.15s ease 0s
}
.lg-outer * {
	-webkit-box-sizing: border-box;
	-moz-box-sizing: border-box;
	box-sizing: border-box
}
.lg-outer.lg-visible {
	opacity: 1
}
.lg-outer.lg-css3 .lg-item.lg-prev-slide, .lg-outer.lg-css3 .lg-item.lg-next-slide, .lg-outer.lg-css3 .lg-item.lg-current {
	-webkit-transition-duration: inherit !important;
	transition-duration: inherit !important;
	-webkit-transition-timing-function: inherit !important;
	transition-timing-function: inherit !important
}
.lg-outer.lg-css3.lg-dragging .lg-item.lg-prev-slide, .lg-outer.lg-css3.lg-dragging .lg-item.lg-next-slide, .lg-outer.lg-css3.lg-dragging .lg-item.lg-current {
	-webkit-transition-duration: 0s !important;
	transition-duration: 0s !important;
	opacity: 1
}
.lg-outer.lg-grab img.lg-object {
	cursor: -webkit-grab;
	cursor: -moz-grab;
	cursor: -o-grab;
	cursor: -ms-grab;
	cursor: grab
}
.lg-outer.lg-grabbing img.lg-object {
	cursor: move;
	cursor: -webkit-grabbing;
	cursor: -moz-grabbing;
	cursor: -o-grabbing;
	cursor: -ms-grabbing;
	cursor: grabbing
}
.lg-outer .lg {
	height: 100%;
	width: 100%;
	position: relative;
	overflow: hidden;
	margin-left: auto;
	margin-right: auto;
	max-width: 100%;
	max-height: 100%
}
.lg-outer .lg-inner {
	width: 100%;
	height: 100%;
	position: absolute;
	left: 0;
	top: 0;
	white-space: nowrap
}
.lg-outer .lg-item {
	background: url("../img/content/loading.gif") no-repeat scroll center center transparent;
	display: none !important
}
.lg-outer.lg-css3 .lg-prev-slide, .lg-outer.lg-css3 .lg-current, .lg-outer.lg-css3 .lg-next-slide {
	display: inline-block !important
}
.lg-outer.lg-css .lg-current {
	display: inline-block !important
}
.lg-outer .lg-item, .lg-outer .lg-img-wrap {
	display: inline-block;
	text-align: center;
	position: absolute;
	width: 100%;
	height: 100%
}
.lg-outer .lg-item:before, .lg-outer .lg-img-wrap:before {
	content: "";
	display: inline-block;
	height: 50%;
	width: 1px;
	margin-right: -1px
}
.lg-outer .lg-img-wrap {
	position: absolute;
	padding: 0 5px;
	left: 0;
	right: 0;
	top: 0;
	bottom: 0
}
.lg-outer .lg-item.lg-complete {
	background-image: none
}
.lg-outer .lg-item.lg-current {
	z-index: 1060
}
.lg-outer .lg-image {
	display: inline-block;
	vertical-align: middle;
	max-width: 100%;
	max-height: 100%;
	width: auto !important;
	height: auto !important
}
.lg-outer.lg-show-after-load .lg-item .lg-object, .lg-outer.lg-show-after-load .lg-item .lg-video-play {
	opacity: 0;
	-webkit-transition: opacity 0.15s ease 0s;
	-o-transition: opacity 0.15s ease 0s;
	transition: opacity 0.15s ease 0s
}
.lg-outer.lg-show-after-load .lg-item.lg-complete .lg-object, .lg-outer.lg-show-after-load .lg-item.lg-complete .lg-video-play {
	opacity: 1
}
.lg-outer .lg-empty-html {
	display: none
}
.lg-outer.lg-hide-download #lg-download {
	display: none
}
.lg-backdrop {
	position: fixed;
	top: 0;
	left: 0;
	right: 0;
	bottom: 0;
	z-index: 1040;
	background-color: #000;
	opacity: 0;
	-webkit-transition: opacity 0.15s ease 0s;
	-o-transition: opacity 0.15s ease 0s;
	transition: opacity 0.15s ease 0s
}
.lg-backdrop.in {
	opacity: 1
}
.lg-css3.lg-no-trans .lg-prev-slide, .lg-css3.lg-no-trans .lg-next-slide, .lg-css3.lg-no-trans .lg-current {
	-webkit-transition: none 0s ease 0s !important;
	-moz-transition: none 0s ease 0s !important;
	-o-transition: none 0s ease 0s !important;
	transition: none 0s ease 0s !important
}
.lg-css3.lg-use-css3 .lg-item {
	-webkit-backface-visibility: hidden;
	-moz-backface-visibility: hidden;
	backface-visibility: hidden
}
.lg-css3.lg-use-left .lg-item {
	-webkit-backface-visibility: hidden;
	-moz-backface-visibility: hidden;
	backface-visibility: hidden
}
.lg-css3.lg-fade .lg-item {
	opacity: 0
}
.lg-css3.lg-fade .lg-item.lg-current {
	opacity: 1
}
.lg-css3.lg-fade .lg-item.lg-prev-slide, .lg-css3.lg-fade .lg-item.lg-next-slide, .lg-css3.lg-fade .lg-item.lg-current {
	-webkit-transition: opacity 0.1s ease 0s;
	-moz-transition: opacity 0.1s ease 0s;
	-o-transition: opacity 0.1s ease 0s;
	transition: opacity 0.1s ease 0s
}
.lg-css3.lg-slide.lg-use-css3 .lg-item {
	opacity: 0
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-prev-slide {
	-webkit-transform: translate3d(-100%, 0, 0);
	transform: translate3d(-100%, 0, 0)
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-next-slide {
	-webkit-transform: translate3d(100%, 0, 0);
	transform: translate3d(100%, 0, 0)
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-current {
	-webkit-transform: translate3d(0, 0, 0);
	transform: translate3d(0, 0, 0);
	opacity: 1
}
.lg-css3.lg-slide.lg-use-css3 .lg-item.lg-prev-slide, .lg-css3.lg-slide.lg-use-css3 .lg-item.lg-next-slide, .lg-css3.lg-slide.lg-use-css3 .lg-item.lg-current {
	-webkit-transition: -webkit-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
	-moz-transition: -moz-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
	-o-transition: -o-transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
	transition: transform 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s
}
.lg-css3.lg-slide.lg-use-left .lg-item {
	opacity: 0;
	position: absolute;
	left: 0
}
.lg-css3.lg-slide.lg-use-left .lg-item.lg-prev-slide {
	left: -100%
}
.lg-css3.lg-slide.lg-use-left .lg-item.lg-next-slide {
	left: 100%
}
.lg-css3.lg-slide.lg-use-left .lg-item.lg-current {
	left: 0;
	opacity: 1
}
.lg-css3.lg-slide.lg-use-left .lg-item.lg-prev-slide, .lg-css3.lg-slide.lg-use-left .lg-item.lg-next-slide, .lg-css3.lg-slide.lg-use-left .lg-item.lg-current {
	-webkit-transition: left 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
	-moz-transition: left 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
	-o-transition: left 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s;
	transition: left 1s cubic-bezier(0, 0, 0.25, 1) 0s, opacity 0.1s ease 0s
}
* {
	margin: 0;
	padding: 0;
	box-sizing: border-box
}
body {
	font-family: 'DM Sans', sans-serif;
	-webkit-font-smoothing: antialiased;
	font-smoothing: antialiased;
	font-size: 17px;
	letter-spacing: 0.5px;
	color: #575a7b;
	font-weight: 500;
	line-height: 1.7
}
body, html {
	-moz-osx-font-smoothing: grayscale
}
a, a:active, a:focus {
	color: #575a7b;
	text-decoration: none;
	transition-timing-function: ease-in-out;
	-ms-transition-timing-function: ease-in-out;
	-moz-transition-timing-function: ease-in-out;
	-webkit-transition-timing-function: ease-in-out;
	-o-transition-timing-function: ease-in-out;
	transition-duration: .2s;
	-ms-transition-duration: .2s;
	-moz-transition-duration: .2s;
	-webkit-transition-duration: .2s;
	-o-transition-duration: .2s
}
a:hover, a:active {
	color: #1e2022;
	text-decoration: none
}
a:focus, a:active, button:focus, button:active, .btn.active.focus, .btn.active:focus, .btn.focus, .btn:active.focus, .btn:active:focus, .btn:focus {
	outline: none;
	box-shadow: none
}
img {
	max-width: 100%;
	height: auto;
	vertical-align: top
}
.form-control {
	min-height: 46px
}
.form-control:focus {
	box-shadow: 0 0 10px rgba(55,125,255,0.1);
	border-color: #4e86ff
}
.form-control::-webkit-input-placeholder {
color:#adaeb7;
opacity:1
}
.form-control::-moz-placeholder {
color:#adaeb7;
opacity:1
}
.form-control:-ms-input-placeholder {
color:#adaeb7;
opacity:1
}
.form-control::-ms-input-placeholder {
color:#adaeb7;
opacity:1
}
.form-control::placeholder {
color:#adaeb7;
opacity:1
}
input[type="button"], input[type="text"], input[type="email"], input[type="search"], input[type="password"], textarea, input[type="submit"] {
	-webkit-appearance: none;
	outline: none
}
input:focus, textarea:focus {
	border-color: #585858;
	outline: none
}
input[type="button"]:focus {
	outline: none
}
select::-ms-expand {
display:none
}
iframe {
	border: 0;
	vertical-align: top
}
p {
	margin: 0 0 20px
}
.height-50 {
	height: 50%
}
.white-space {
	white-space: normal
}
.word-wrap {
	word-wrap: break-word
}
.word-break {
	word-break: break-all
}
.valign {
	display: -webkit-box;
	display: -ms-flexbox;
	display: flex;
	-webkit-box-align: center;
	-ms-flex-align: center;
	align-items: center
}
.transition-hover {
	transition: all 0.3s cubic-bezier(0.645, 0.045, 0.355, 1)
}
.transition-hover:hover, .transition-hover:focus {
	transform: translateY(-8px)
}
::selection {
	color: #000;
	background: #dbdbdb
}
::-moz-selection {
color:#000;
background:#dbdbdb
}
.media {
	display: -ms-flexbox;
	display: flex;
	-ms-flex-align: start;
	align-items: flex-start
}
.media-body {
	-ms-flex: 1;
	flex: 1;
	word-break: break-word
}

@media (min-width: 1200px) {
.container {
	max-width: 1170px
}
}

@media (min-width: 1400px) {
.container {
	max-width: 1320px
}
}
_:-ms-lang(x), .container, _:-ms-lang(x), .container-fluid, _:-ms-lang(x), .container-lg, _:-ms-lang(x), .container-md, _:-ms-lang(x), .container-sm, _:-ms-lang(x), .container-xl, _:-ms-lang(x), .container-xxl {
padding-right:15px;
padding-left:15px
}
_:-ms-lang(x), .row.g-0 {
margin-right:0;
margin-left:0
}
_:-ms-lang(x), .row.g-0>* {
padding-right:0;
padding-left:0
}
_:-ms-lang(x), .row {
margin-right:-15px;
margin-left:-15px
}
_:-ms-lang(x), .row>* {
padding-right:15px;
padding-left:15px
}
.alt-font {
	font-family: 'Oswald', sans-serif
}
.main-font {
	font-family: 'DM Sans', sans-serif
}
h1, h2, h3, h4, h5, h6, .h1, .h2, .h3, .h4, .h5, .h6 {
	font-weight: 400 !important;
	font-family: 'Oswald', sans-serif;
	color: #001736;
	line-height: 1 !important
}
h1 a, h2 a, h3 a, h4 a, h5 a, h6 a, .h1 a, .h2 a, .h3 a, .h4 a, .h5 a, .h6 a {
	font-weight: 400 !important;
	color: #001736;
	line-height: 1 !important
}
.display-7 {
	font-size: 3.2rem
}
.display-8 {
	font-size: 3.1rem
}
.display-9 {
	font-size: 3.0rem
}
.display-10 {
	font-size: 2.9rem
}
.display-11 {
	font-size: 2.8rem
}
.display-12 {
	font-size: 2.7rem
}
.display-13 {
	font-size: 2.6rem
}
.display-14 {
	font-size: 2.5rem
}
.display-15 {
	font-size: 2.4rem
}
.display-16 {
	font-size: 2.3rem
}
.display-17 {
	font-size: 2.2rem
}
.display-18 {
	font-size: 2.1rem
}
.display-19 {
	font-size: 2.0rem
}
.display-20 {
	font-size: 1.9rem
}
.display-21 {
	font-size: 1.8rem
}
.display-22 {
	font-size: 1.7rem
}
.display-23 {
	font-size: 1.6rem
}
.display-24 {
	font-size: 1.5rem
}
.display-25 {
	font-size: 1.4rem
}
.display-26 {
	font-size: 1.3rem
}
.display-27 {
	font-size: 1.2rem
}
.display-28 {
	font-size: 1.1rem
}
.display-29 {
	font-size: 1.0rem
}
.display-30 {
	font-size: 0.9rem
}
.display-31 {
	font-size: 0.8rem
}
.display-32 {
	font-size: 0.7rem
}
.display-33 {
	font-size: 0.6rem
}
.display-34 {
	font-size: 0.5rem
}
.text-black {
	color: #000
}
.text-extra-dark-gray {
	color: #1e2022
}
.text-dark-gray {
	color: #626262
}
.text-extra-medium-gray {
	color: #757575
}
.text-medium-gray {
	color: #939393
}
.text-extra-light-gray {
	color: #b7b7b7
}
.text-light-gray {
	color: #d6d5d5
}
.text-very-light-gray {
	color: #ededed
}
.text-default-color {
	color: #6f6f6f
}
.no-letter-spacing {
	letter-spacing: 0px
}
.letter-spacing-1 {
	letter-spacing: 1px
}
.letter-spacing-2 {
	letter-spacing: 2px
}
.letter-spacing-3 {
	letter-spacing: 3px
}
.letter-spacing-4 {
	letter-spacing: 4px
}
.letter-spacing-5 {
	letter-spacing: 5px
}
.font-weight-100 {
	font-weight: 100
}
.font-weight-200 {
	font-weight: 200
}
.font-weight-300 {
	font-weight: 300
}
.font-weight-400 {
	font-weight: 400
}
.font-weight-500 {
	font-weight: 500
}
.font-weight-600 {
	font-weight: 600
}
.font-weight-700 {
	font-weight: 700
}
.font-weight-800 {
	font-weight: 800
}
.font-weight-900 {
	font-weight: 900
}
.bg-transparent {
	background-color: transparent
}
.bg-black {
	background-color: #000
}
.bg-extra-dark-gray {
	background-color: #1c1c1c
}
.bg-dark-gray {
	background-color: #757575
}
.bg-extra-medium-gray {
	background-color: #939393
}
.bg-medium-gray {
	background-color: #dbdbdb
}
.bg-extra-light-gray {
	background-color: #e0e0e0
}
.bg-medium-light-gray {
	background-color: #ededed
}
.bg-light-gray {
	background-color: #f1f7ff
}
.bg-very-light-gray {
	background-color: #fafafa
}
.bg-grey {
	background-color: #f9f9f9
}
.bg-red {
	background-color: #ed1b24
}
.bg-dark-theme {
	background: #1e2022
}
.bg-transparent-white {
	background-color: rgba(255,255,255,0.3);
	background: -moz-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0) 37%, #fff 96%, #fff 100%);
	background: -webkit-gradient(left top, right top, color-stop(0%, rgba(255,255,255,0)), color-stop(37%, rgba(255,255,255,0)), color-stop(96%, #fff), color-stop(100%, #fff));
	background: -webkit-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0) 37%, #fff 96%, #fff 100%);
	background: -o-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0) 37%, #fff 96%, #fff 100%);
	background: -ms-linear-gradient(left, rgba(255,255,255,0) 0%, rgba(255,255,255,0) 37%, #fff 96%, #fff 100%);
	background: linear-gradient(to right, rgba(255,255,255,0) 0%, rgba(255,255,255,0) 37%, #fff 96%, #fff 100%);
filter:progid:DXImageTransform.Microsoft.gradient( startColorstr='#ffffff', endColorstr='#ffffff', GradientType=1 )
}
.bg-transparent-black {
	background-color: transparent;
	background: -moz-linear-gradient(left, transparent 0%, transparent 37%, #000 96%, #000 100%);
	background: -webkit-gradient(left top, right top, color-stop(0%, transparent), color-stop(37%, transparent), color-stop(96%, #000), color-stop(100%, #000));
	background: -webkit-linear-gradient(left, transparent 0%, transparent 37%, #000 96%, #000 100%);
	background: -o-linear-gradient(left, transparent 0%, transparent 37%, #000 96%, #000 100%);
	background: -ms-linear-gradient(left, transparent 0%, transparent 37%, #000 96%, #000 100%);
	background: linear-gradient(to right, transparent 0%, transparent 37%, #000 96%, #000 100%);
filter:progid:DXImageTransform.Microsoft.gradient( startColorstr='#000000', endColorstr='#000000', GradientType=1 )
}
.bg-white-opacity {
	background-color: rgba(255,255,255,0.85)
}
.bg-black-opacity {
	background-color: rgba(0,0,0,0.85)
}
.bg-black-opacity-light {
	background-color: rgba(0,0,0,0.5)
}
section {
	padding: 170px 0;
	overflow: hidden;
	background: #fff;
	position: relative
}
section.md {
	padding: 140px 0
}
.big-input, .big-textarea, .big-select select {
	padding: 18px 25px;
	font-size: 14px;
	border-radius: 0
}
.medium-input, .medium-textarea, .medium-select select {
	padding: 12px 20px;
	font-size: 14px;
	line-height: normal;
	border-radius: 0
}
.small-input, .small-textarea {
	padding: 12px 15px;
	font-size: 11px;
	line-height: normal
}
.small-select select {
	padding: 15px 15px;
	line-height: normal
}
.medium-input-light, .medium-textarea-light, .medium-select-light select {
	padding: 12px 25px;
	font-size: 12px;
	line-height: normal
}
[data-overlay-dark], [data-overlay-light] {
	position: relative
}
[data-overlay-dark] .position-unset, [data-overlay-light] .position-unset {
	position: unset !important
}
[data-overlay-dark] .container, [data-overlay-light] .container {
	position: relative;
	z-index: 2
}
[data-overlay-dark]:before, [data-overlay-light]:before {
	content: '';
	position: absolute;
	width: 100%;
	height: 100%;
	top: 0;
	left: 0;
	z-index: 1
}
[data-overlay-dark]:before {
	background: #000
}
[data-overlay-light]:before {
	background: #fff
}
[data-overlay-dark="0"]:before, [data-overlay-light="0"]:before {
	opacity: 0
}
[data-overlay-dark="1"]:before, [data-overlay-light="1"]:before {
	opacity: 0.1
}
[data-overlay-dark="2"]:before, [data-overlay-light="2"]:before {
	opacity: 0.2
}
[data-overlay-dark="3"]:before, [data-overlay-light="3"]:before {
	opacity: 0.3
}
[data-overlay-dark="4"]:before, [data-overlay-light="4"]:before {
	opacity: 0.4
}
[data-overlay-dark="5"]:before, [data-overlay-light="5"]:before {
	opacity: 0.5
}
[data-overlay-dark="55"]:before, [data-overlay-light="55"]:before {
	opacity: 0.55
}
[data-overlay-dark="6"]:before, [data-overlay-light="6"]:before {
	opacity: 0.6
}
[data-overlay-dark="65"]:before, [data-overlay-light="65"]:before {
	opacity: 0.65
}
[data-overlay-dark="7"]:before, [data-overlay-light="7"]:before {
	opacity: 0.7
}
[data-overlay-dark="75"]:before, [data-overlay-light="75"]:before {
	opacity: 0.75
}
[data-overlay-dark="8"]:before, [data-overlay-light="8"]:before {
	opacity: 0.8
}
[data-overlay-dark="85"]:before, [data-overlay-light="85"]:before {
	opacity: 0.85
}
[data-overlay-dark="9"]:before, [data-overlay-light="9"]:before {
	opacity: 0.9
}
[data-overlay-dark="91"]:before, [data-overlay-light="91"]:before {
	opacity: 0.91
}
[data-overlay-dark="92"]:before, [data-overlay-light="92"]:before {
	opacity: 0.92
}
[data-overlay-dark="93"]:before, [data-overlay-light="93"]:before {
	opacity: 0.93
}
[data-overlay-dark="94"]:before, [data-overlay-light="94"]:before {
	opacity: 0.94
}
[data-overlay-dark="95"]:before, [data-overlay-light="95"]:before {
	opacity: 0.95
}
[data-overlay-dark="96"]:before, [data-overlay-light="96"]:before {
	opacity: 0.96
}
[data-overlay-dark="97"]:before, [data-overlay-light="97"]:before {
	opacity: 0.97
}
[data-overlay-dark="98"]:before, [data-overlay-light="98"]:before {
	opacity: 0.98
}
[data-overlay-dark="99"]:before, [data-overlay-light="99"]:before {
	opacity: 0.99
}
[data-overlay-dark="10"]:before, [data-overlay-light="10"]:before {
	opacity: 1
}
.separator-line-verticle-extra-small {
	width: 1px;
	height: 8px
}
.separator-line-verticle-small-thick {
	width: 17px;
	height: 3px
}
.separator-line-verticle-small {
	width: 1px;
	height: 13px
}
.separator-line-verticle-small-thick2 {
	width: 64px;
	height: 7px
}
.separator-line-verticle-large {
	width: 1px;
	height: 20px
}
.separator-line-verticle-extra-large {
	width: 1px;
	height: 30px
}
.separator-line-verticle-medium-thick-full {
	width: 8px;
	height: 40px
}
.separator-line-verticle-large-thick {
	width: 109px;
	height: 11px
}
.separator-line-horrizontal-medium-light {
	width: 36px;
	height: 3px
}
.separator-line-horrizontal-medium-light2 {
	width: 50px;
	height: 1px
}
.separator-line-horrizontal-medium-light3 {
	width: 18%;
	height: 1px
}
.separator-line-horrizontal-medium-thick {
	width: 50px;
	height: 5px
}
.separator-line-horrizontal-full {
	width: 100%;
	height: 1px
}
.divider-full {
	width: 100%;
	height: 1px;
	display: inline-block
}
.opacity-very-light {
	position: absolute;
	height: 100%;
	width: 100%;
	opacity: 0.2;
	top: 0;
	left: 0
}
.opacity-light {
	position: absolute;
	height: 100%;
	width: 100%;
	opacity: 0.3;
	top: 0;
	left: 0
}
.opacity-extra-medium {
	position: absolute;
	height: 100%;
	width: 100%;
	opacity: 0.5;
	top: 0;
	left: 0
}
.opacity-medium {
	position: absolute;
	height: 100%;
	width: 100%;
	opacity: 0.75;
	top: 0;
	left: 0
}
.opacity-full {
	position: absolute;
	height: 100%;
	width: 100%;
	opacity: 0.8;
	top: 0;
	left: 0
}
.opacity-full-dark {
	position: absolute;
	height: 100%;
	width: 100%;
	opacity: 0.9;
	top: 0;
	left: 0
}
.opacity01 {
	opacity: .01
}
.opacity02 {
	opacity: .02
}
.opacity03 {
	opacity: .03
}
.opacity04 {
	opacity: .04
}
.opacity05 {
	opacity: .05
}
.opacity06 {
	opacity: .06
}
.opacity07 {
	opacity: .07
}
.opacity08 {
	opacity: .08
}
.opacity09 {
	opacity: .09
}
.opacity1 {
	opacity: .1
}
.opacity2 {
	opacity: .2
}
.opacity3 {
	opacity: .3
}
.opacity4 {
	opacity: .4
}
.opacity5 {
	opacity: .5
}
.opacity6 {
	opacity: .6
}
.opacity7 {
	opacity: .7
}
.opacity8 {
	opacity: .8
}
.opacity9 {
	opacity: .9
}
.box-shadow-light {
	box-shadow: 0 0 3px rgba(0,0,0,0.1)
}
.box-shadow {
	box-shadow: 0 0 3px rgba(0,0,0,0.2)
}
.box-shadow-dark {
	box-shadow: 0 0 4px rgba(0,0,0,0.4)
}
.box-shadow-large {
	box-shadow: 0 0 12px rgba(0,0,0,0.1)
}
.box-shadow-primary {
	-webkit-box-shadow: 0 18px 38px rgba(0,0,0,0.2);
	box-shadow: 0 18px 38px rgba(0,0,0,0.2)
}
.box-shadow-none {
	-webkit-box-shadow: none !important;
	-moz-box-shadow: none !important;
	box-shadow: none !important
}
.text-shadow-light {
	text-shadow: 0 0 3px rgba(0,0,0,0.1)
}
.text-shadow {
	text-shadow: 0 0 3px rgba(0,0,0,0.2)
}
.text-shadow-dark {
	text-shadow: 0 0 4px rgba(0,0,0,0.4)
}
.text-shadow-large {
	text-shadow: 0 0 12px rgba(0,0,0,0.1)
}
.text-shadow-primary {
	text-shadow: 0 18px 38px rgba(0,0,0,0.2)
}
.text-shadow-none {
	text-shadow: none !important
}
.z-index-1111 {
	z-index: 1111
}
.z-index-111 {
	z-index: 111
}
.z-index-1 {
	z-index: 1
}
.z-index-2 {
	z-index: 2
}
.z-index-3 {
	z-index: 3
}
.z-index-4 {
	z-index: 4
}
.z-index-5 {
	z-index: 5
}
.z-index-9 {
	z-index: 9
}
.z-index-99 {
	z-index: 99
}
.z-index-0 {
	z-index: 0
}
.z-index-minus2 {
	z-index: -2
}
.vertical-align-middle {
	vertical-align: middle
}
.vertical-align-top {
	vertical-align: top
}
.vertical-align-bottom {
	vertical-align: bottom
}
.clear-both {
	clear: both
}
.line-break {
	display: block
}
.no-transition * {
	transition-timing-function: none !important;
	-moz-transition-timing-function: none !important;
	-webkit-transition-timing-function: none !important;
	-o-transition-timing-function: none !important;
	-ms-transition-timing-function: none !important;
	transition-duration: 0s !important;
	-moz-transition-duration: 0s !important;
	-webkit-transition-duration: 0s !important;
	-o-transition-duration: 0s !important;
	-ms-transition-duration: 0s !important
}
.borders-top {
	border-top: 1px solid
}
.borders-end {
	border-right: 1px solid
}
.borders-bottom {
	border-bottom: 1px solid
}
.borders-start {
	border-left: 1px solid
}
.borders-top-0 {
	border-top: none
}
.borders-end-0 {
	border-right: none
}
.borders-bottom-0 {
	border-bottom: none
}
.borders-start-0 {
	border-left: none
}
.border-width-1 {
	border-width: 1px !important
}
.border-width-2 {
	border-width: 2px !important
}
.border-width-3 {
	border-width: 3px !important
}
.border-width-4 {
	border-width: 4px !important
}
.border-width-5 {
	border-width: 5px !important
}
.border-width-6 {
	border-width: 6px !important
}
.border-width-7 {
	border-width: 7px !important
}
.border-width-8 {
	border-width: 8px !important
}
.border-width-9 {
	border-width: 9px !important
}
.border-width-10 {
	border-width: 10px !important
}
.border-width-20 {
	border-width: 20px !important
}
.border-color-white {
	border-color: #fff !important
}
.border-color-black {
	border-color: #000 !important
}
.border-color-extra-dark-gray {
	border-color: #1e2022 !important
}
.border-color-medium-dark-gray {
	border-color: #363636 !important
}
.border-color-dark-gray {
	border-color: #939393 !important
}
.border-color-extra-medium-gray {
	border-color: #dbdbdb !important
}
.border-color-medium-gray {
	border-color: #e4e4e4 !important
}
.border-color-extra-light-gray {
	border-color: #ededed !important
}
.border-color-light-gray {
	border-color: #f5f5f5 !important
}
.border-color-light-white {
	border-color: rgba(255,255,255,0.1) !important
}
.border-color-light-black {
	border-color: rgba(0,0,0,0.085) !important
}
.border-dotted {
	border-style: dotted !important
}
.border-dashed {
	border-style: dashed !important
}
.border-solid {
	border-style: solid !important
}
.border-double {
	border-style: double !important
}
.border-groove {
	border-style: groove !important
}
.border-ridge {
	border-style: ridge !important
}
.border-inset {
	border-style: inset !important
}
.border-outset {
	border-style: outset !important
}
.border-none {
	border-style: none !important
}
.border-hidden {
	border-style: hidden !important
}
.border-transperent {
	border-color: transparent !important
}
.border-radius-1 {
	border-radius: 1px
}
.border-radius-2 {
	border-radius: 2px
}
.border-radius-3 {
	border-radius: 3px
}
.border-radius-4 {
	border-radius: 4px
}
.border-radius-5 {
	border-radius: 5px
}
.border-radius-6 {
	border-radius: 6px
}
.border-radius-7 {
	border-radius: 7px
}
.border-radius-8 {
	border-radius: 8px
}
.border-radius-9 {
	border-radius: 9px
}
.border-radius-10 {
	border-radius: 10px
}
.border-radius-50 {
	border-radius: 50%
}
.border-radius-100 {
	border-radius: 100%
}
.border-radius-none {
	border-radius: 0 !important
}
.parallax {
	position: relative;
	background-size: cover;
	overflow: hidden;
	background-attachment: fixed
}
.fix-background {
	position: relative;
	background-size: cover;
	animation-duration: 0s;
	animation-fill-mode: none;
	-webkit-animation-duration: 0s;
	-webkit-animation-fill-mode: none;
	-moz-animation-duration: 0s;
	-moz-animation-fill-mode: none;
	-ms-animation-duration: 0s;
	-ms-animation-fill-mode: none;
	-o-animation-fill-mode: none;
	overflow: hidden;
	background-position: center center;
	background-repeat: no-repeat;
	background-attachment: fixed
}
.cover-background {
	position: relative !important;
	background-size: cover !important;
	overflow: hidden !important;
	background-position: center !important;
	background-repeat: no-repeat !important
}
.background-size-inherit {
	background-size: inherit
}
.background-attachment-inherit {
	background-attachment: inherit
}
.background-position-left {
	background-position: left center
}
.background-position-left-bottom {
	background-position: left bottom
}
.background-position-right {
	background-position: right center
}
.background-position-top {
	background-position: center top !important
}
.up-down-ani {
	display: table;
	position: relative;
	-webkit-animation-name: up-down-animation;
	-webkit-animation-duration: .7s;
	-webkit-animation-timing-function: linear;
	-webkit-animation-delay: .7s;
	-webkit-animation-iteration-count: infinite;
	-webkit-animation-direction: alternate;
	-moz-animation-name: up-down-animation;
	-moz-animation-duration: .7s;
	-moz-animation-timing-function: linear;
	-moz-animation-delay: .7s;
	-moz-animation-iteration-count: infinite;
	-ms-animation-name: up-down-animation;
	-ms-animation-duration: .7s;
	-ms-animation-timing-function: linear;
	-ms-animation-delay: .7s;
	-ms-animation-iteration-count: infinite;
	-ms-animation-direction: alternate;
	-o-animation-direction: alternate;
	-o-animation-name: up-down-animation;
	-o-animation-duration: .7s;
	-o-animation-timing-function: linear;
	-o-animation-delay: .7s;
	-o-animation-iteration-count: infinite;
	-o-animation-direction: alternate;
	animation-direction: alternate;
	animation-name: up-down-animation;
	animation-duration: .7s;
	animation-timing-function: linear;
	animation-delay: .7s;
	animation-iteration-count: infinite;
	animation-direction: alternate;
	margin: 0 auto
}
.background-position-x-50 {
	background-position-x: 50% !important
}
.background-size-contain {
	background-size: contain
}
.background-no-repeat {
	background-repeat: no-repeat
}
.mt-n1 {
	margin-top: -0.25rem !important
}
.mt-n2 {
	margin-top: -0.5rem !important
}
.mt-n3 {
	margin-top: -1rem !important
}
.mt-n4 {
	margin-top: -1.5rem !important
}
.mt-n5 {
	margin-top: -3rem !important
}
.mt-n6 {
	margin-top: -3.5rem
}
.mt-n7 {
	margin-top: -4rem
}
.mt-n8 {
	margin-top: -4.5rem
}
.mt-n9 {
	margin-top: -5rem
}
.mt-n10 {
	margin-top: -5.5rem
}
.mt-n1-6 {
	margin-top: -1.6rem !important
}
.mt-n1-9 {
	margin-top: -1.9rem !important
}
.mt-n2-2 {
	margin-top: -2.2rem !important
}
.mt-n2-6 {
	margin-top: -2.6rem !important
}
.mt-n2-9 {
	margin-top: -2.9rem !important
}
.m-1-6 {
	margin: 1.6rem
}
.m-1-7 {
	margin: 1.7rem
}
.m-1-8 {
	margin: 1.8rem
}
.m-1-9 {
	margin: 1.9rem
}
.m-2-0 {
	margin: 2.0rem
}
.m-2-1 {
	margin: 2.1rem
}
.m-2-2 {
	margin: 2.2rem
}
.m-2-3 {
	margin: 2.3rem
}
.m-2-4 {
	margin: 2.4rem
}
.m-2-5 {
	margin: 2.5rem
}
.m-2-6 {
	margin: 2.6rem
}
.m-2-7 {
	margin: 2.7rem
}
.m-2-8 {
	margin: 2.8rem
}
.m-2-9 {
	margin: 2.9rem
}
.m-6 {
	margin: 3.5rem
}
.m-7 {
	margin: 4rem
}
.m-8 {
	margin: 4.5rem
}
.m-9 {
	margin: 5rem
}
.m-10 {
	margin: 5.5rem
}
.m-11 {
	margin: 6rem
}
.m-12 {
	margin: 6.5rem
}
.m-13 {
	margin: 7rem
}
.m-14 {
	margin: 7.5rem
}
.m-15 {
	margin: 8rem
}
.m-16 {
	margin: 8.5rem
}
.m-17 {
	margin: 9rem
}
.m-18 {
	margin: 9.5rem
}
.m-19 {
	margin: 10rem
}
.m-20 {
	margin: 10.5rem
}
.m-21 {
	margin: 11rem
}
.m-22 {
	margin: 11.5rem
}
.m-23 {
	margin: 12rem
}
.m-24 {
	margin: 12.5rem
}
.mt-1-6, .my-1-6 {
	margin-top: 1.6rem
}
.mt-1-7, .my-1-7 {
	margin-top: 1.7rem
}
.mt-1-8, .my-1-8 {
	margin-top: 1.8rem
}
.mt-1-9, .my-1-9 {
	margin-top: 1.9rem
}
.mt-2-0, .my-2-0 {
	margin-top: 2.0rem
}
.mt-2-1, .my-2-1 {
	margin-top: 2.1rem
}
.mt-2-2, .my-2-2 {
	margin-top: 2.2rem
}
.mt-2-3, .my-2-3 {
	margin-top: 2.3rem
}
.mt-2-4, .my-2-4 {
	margin-top: 2.4rem
}
.mt-2-5, .my-2-5 {
	margin-top: 2.5rem
}
.mt-2-6, .my-2-6 {
	margin-top: 2.6rem
}
.mt-2-7, .my-2-7 {
	margin-top: 2.7rem
}
.mt-2-8, .my-2-8 {
	margin-top: 2.8rem
}
.mt-2-9, .my-2-9 {
	margin-top: 2.9rem
}
.mt-6, .my-6 {
	margin-top: 3.5rem
}
.mt-7, .my-7 {
	margin-top: 4rem
}
.mt-8, .my-8 {
	margin-top: 4.5rem
}
.mt-9, .my-9 {
	margin-top: 5rem
}
.mt-10, .my-10 {
	margin-top: 5.5rem
}
.mt-11, .my-11 {
	margin-top: 6rem
}
.mt-12, .my-12 {
	margin-top: 6.5rem
}
.mt-13, .my-13 {
	margin-top: 7rem
}
.mt-14, .my-14 {
	margin-top: 7.5rem
}
.mt-15, .my-15 {
	margin-top: 8rem
}
.mt-16, .my-16 {
	margin-top: 8.5rem
}
.mt-17, .my-17 {
	margin-top: 9rem
}
.mt-18, .my-18 {
	margin-top: 9.5rem
}
.mt-19, .my-19 {
	margin-top: 10rem
}
.mt-20, .my-20 {
	margin-top: 10.5rem
}
.mt-21, .my-21 {
	margin-top: 11rem
}
.mt-22, .my-22 {
	margin-top: 11.5rem
}
.mt-23, .my-23 {
	margin-top: 12rem
}
.mt-24, .my-24 {
	margin-top: 12.5rem
}
.mb-1-6, .my-1-6 {
	margin-bottom: 1.6rem
}
.mb-1-7, .my-1-7 {
	margin-bottom: 1.7rem
}
.mb-1-8, .my-1-8 {
	margin-bottom: 1.8rem
}
.mb-1-9, .my-1-9 {
	margin-bottom: 1.9rem
}
.mb-2-0, .my-2-0 {
	margin-bottom: 2.0rem
}
.mb-2-1, .my-2-1 {
	margin-bottom: 2.1rem
}
.mb-2-2, .my-2-2 {
	margin-bottom: 2.2rem
}
.mb-2-3, .my-2-3 {
	margin-bottom: 2.3rem
}
.mb-2-4, .my-2-4 {
	margin-bottom: 2.4rem
}
.mb-2-5, .my-2-5 {
	margin-bottom: 2.5rem
}
.mb-2-6, .my-2-6 {
	margin-bottom: 2.6rem
}
.mb-2-7, .my-2-7 {
	margin-bottom: 2.7rem
}
.mb-2-8, .my-2-8 {
	margin-bottom: 2.8rem
}
.mb-2-9, .my-2-9 {
	margin-bottom: 2.9rem
}
.mb-6, .my-6 {
	margin-bottom: 3.5rem
}
.mb-7, .my-7 {
	margin-bottom: 4rem
}
.mb-8, .my-8 {
	margin-bottom: 4.5rem
}
.mb-9, .my-9 {
	margin-bottom: 5rem
}
.mb-10, .my-10 {
	margin-bottom: 5.5rem
}
.mb-11, .my-11 {
	margin-bottom: 6rem
}
.mb-12, .my-12 {
	margin-bottom: 6.5rem
}
.mb-13, .my-13 {
	margin-bottom: 7rem
}
.mb-14, .my-14 {
	margin-bottom: 7.5rem
}
.mb-15, .my-15 {
	margin-bottom: 8rem
}
.mb-16, .my-16 {
	margin-bottom: 8.5rem
}
.mb-17, .my-17 {
	margin-bottom: 9rem
}
.mb-18, .my-18 {
	margin-bottom: 9.5rem
}
.mb-19, .my-19 {
	margin-bottom: 10rem
}
.mb-20, .my-20 {
	margin-bottom: 10.5rem
}
.mb-21, .my-21 {
	margin-bottom: 11rem
}
.mb-22, .my-22 {
	margin-bottom: 11.5rem
}
.mb-23, .my-23 {
	margin-bottom: 12rem
}
.mb-24, .my-24 {
	margin-bottom: 12.5rem
}
.ms-1-6, .mx-1-6 {
	margin-left: 1.6rem
}
.ms-1-7, .mx-1-7 {
	margin-left: 1.7rem
}
.ms-1-8, .mx-1-8 {
	margin-left: 1.8rem
}
.ms-1-9, .mx-1-9 {
	margin-left: 1.9rem
}
.ms-2-0, .mx-2-0 {
	margin-left: 2.0rem
}
.ms-2-1, .mx-2-1 {
	margin-left: 2.1rem
}
.ms-2-2, .mx-2-2 {
	margin-left: 2.2rem
}
.ms-2-3, .mx-2-3 {
	margin-left: 2.3rem
}
.ms-2-4, .mx-2-4 {
	margin-left: 2.4rem
}
.ms-2-5, .mx-2-5 {
	margin-left: 2.5rem
}
.ms-2-6, .mx-2-6 {
	margin-left: 2.6rem
}
.ms-2-7, .mx-2-7 {
	margin-left: 2.7rem
}
.ms-2-8, .mx-2-8 {
	margin-left: 2.8rem
}
.ms-2-9, .mx-2-9 {
	margin-left: 2.9rem
}
.ms-6, .mx-6 {
	margin-left: 3.5rem
}
.ms-7, .mx-7 {
	margin-left: 4rem
}
.ms-8, .mx-8 {
	margin-left: 4.5rem
}
.ms-9, .mx-9 {
	margin-left: 5rem
}
.ms-10, .mx-10 {
	margin-left: 5.5rem
}
.ms-11, .mx-11 {
	margin-left: 6rem
}
.ms-12, .mx-12 {
	margin-left: 6.5rem
}
.ms-13, .mx-13 {
	margin-left: 7rem
}
.ms-14, .mx-14 {
	margin-left: 7.5rem
}
.ms-15, .mx-15 {
	margin-left: 8rem
}
.ms-16, .mx-16 {
	margin-left: 8.5rem
}
.ms-17, .mx-17 {
	margin-left: 9rem
}
.ms-18, .mx-18 {
	margin-left: 9.5rem
}
.ms-19, .mx-19 {
	margin-left: 10rem
}
.ms-20, .mx-20 {
	margin-left: 10.5rem
}
.ms-21, .mx-21 {
	margin-left: 11rem
}
.ms-22, .mx-22 {
	margin-left: 11.5rem
}
.ms-23, .mx-23 {
	margin-left: 12rem
}
.ms-24, .mx-24 {
	margin-left: 12.5rem
}
.me-1-6, .mx-1-6 {
	margin-right: 1.6rem
}
.me-1-7, .mx-1-7 {
	margin-right: 1.7rem
}
.me-1-8, .mx-1-8 {
	margin-right: 1.8rem
}
.me-1-9, .mx-1-9 {
	margin-right: 1.9rem
}
.me-2-0, .mx-2-0 {
	margin-right: 2.0rem
}
.me-2-1, .mx-2-1 {
	margin-right: 2.1rem
}
.me-2-2, .mx-2-2 {
	margin-right: 2.2rem
}
.me-2-3, .mx-2-3 {
	margin-right: 2.3rem
}
.me-2-4, .mx-2-4 {
	margin-right: 2.4rem
}
.me-2-5, .mx-2-5 {
	margin-right: 2.5rem
}
.me-2-6, .mx-2-6 {
	margin-right: 2.6rem
}
.me-2-7, .mx-2-7 {
	margin-right: 2.7rem
}
.me-2-8, .mx-2-8 {
	margin-right: 2.8rem
}
.me-2-9, .mx-2-9 {
	margin-right: 2.9rem
}
.me-6, .mx-6 {
	margin-right: 3.5rem
}
.me-7, .mx-7 {
	margin-right: 4rem
}
.me-8, .mx-8 {
	margin-right: 4.5rem
}
.me-9, .mx-9 {
	margin-right: 5rem
}
.me-10, .mx-10 {
	margin-right: 5.5rem
}
.me-11, .mx-11 {
	margin-right: 6rem
}
.me-12, .mx-12 {
	margin-right: 6.5rem
}
.me-13, .mx-13 {
	margin-right: 7rem
}
.me-14, .mx-14 {
	margin-right: 7.5rem
}
.me-15, .mx-15 {
	margin-right: 8rem
}
.me-16, .mx-16 {
	margin-right: 8.5rem
}
.me-17, .mx-17 {
	margin-right: 9rem
}
.me-18, .mx-18 {
	margin-right: 9.5rem
}
.me-19, .mx-19 {
	margin-right: 10rem
}
.me-20, .mx-20 {
	margin-right: 10.5rem
}
.me-21, .mx-21 {
	margin-right: 11rem
}
.me-22, .mx-22 {
	margin-right: 11.5rem
}
.me-23, .mx-23 {
	margin-right: 12rem
}
.me-24, .mx-24 {
	margin-right: 12.5rem
}
.p-1-6 {
	padding: 1.6rem
}
.p-1-7 {
	padding: 1.7rem
}
.p-1-8 {
	padding: 1.8rem
}
.p-1-9 {
	padding: 1.9rem
}
.p-2-0 {
	padding: 2.0rem
}
.p-2-1 {
	padding: 2.1rem
}
.p-2-2 {
	padding: 2.2rem
}
.p-2-3 {
	padding: 2.3rem
}
.p-2-4 {
	padding: 2.4rem
}
.p-2-5 {
	padding: 2.5rem
}
.p-2-6 {
	padding: 2.6rem
}
.p-2-7 {
	padding: 2.7rem
}
.p-2-8 {
	padding: 2.8rem
}
.p-2-9 {
	padding: 2.9rem
}
.p-6 {
	padding: 3.5rem
}
.p-7 {
	padding: 4rem
}
.p-8 {
	padding: 4.5rem
}
.p-9 {
	padding: 5rem
}
.p-10 {
	padding: 5.5rem
}
.p-11 {
	padding: 6rem
}
.p-12 {
	padding: 6.5rem
}
.p-13 {
	padding: 7rem
}
.p-14 {
	padding: 7.5rem
}
.p-15 {
	padding: 8rem
}
.p-16 {
	padding: 8.5rem
}
.p-17 {
	padding: 9rem
}
.p-18 {
	padding: 9.5rem
}
.p-19 {
	padding: 10rem
}
.p-20 {
	padding: 10.5rem
}
.p-21 {
	padding: 11rem
}
.p-22 {
	padding: 11.5rem
}
.p-23 {
	padding: 12rem
}
.p-24 {
	padding: 12.5rem
}
.pt-1-6, .py-1-6 {
	padding-top: 1.6rem
}
.pt-1-7, .py-1-7 {
	padding-top: 1.7rem
}
.pt-1-8, .py-1-8 {
	padding-top: 1.8rem
}
.pt-1-9, .py-1-9 {
	padding-top: 1.9rem
}
.pt-2-0, .py-2-0 {
	padding-top: 2.0rem
}
.pt-2-1, .py-2-1 {
	padding-top: 2.1rem
}
.pt-2-2, .py-2-2 {
	padding-top: 2.2rem
}
.pt-2-3, .py-2-3 {
	padding-top: 2.3rem
}
.pt-2-4, .py-2-4 {
	padding-top: 2.4rem
}
.pt-2-5, .py-2-5 {
	padding-top: 2.5rem
}
.pt-2-6, .py-2-6 {
	padding-top: 2.6rem
}
.pt-2-7, .py-2-7 {
	padding-top: 2.7rem
}
.pt-2-8, .py-2-8 {
	padding-top: 2.8rem
}
.pt-2-9, .py-2-9 {
	padding-top: 2.9rem
}
.pt-6, .py-6 {
	padding-top: 3.5rem
}
.pt-7, .py-7 {
	padding-top: 4rem
}
.pt-8, .py-8 {
	padding-top: 4.5rem
}
.pt-9, .py-9 {
	padding-top: 5rem
}
.pt-10, .py-10 {
	padding-top: 5.5rem
}
.pt-11, .py-11 {
	padding-top: 6rem
}
.pt-12, .py-12 {
	padding-top: 6.5rem
}
.pt-13, .py-13 {
	padding-top: 7rem
}
.pt-14, .py-14 {
	padding-top: 7.5rem
}
.pt-15, .py-15 {
	padding-top: 8rem
}
.pt-16, .py-16 {
	padding-top: 8.5rem
}
.pt-17, .py-17 {
	padding-top: 9rem
}
.pt-18, .py-18 {
	padding-top: 9.5rem
}
.pt-19, .py-19 {
	padding-top: 10rem
}
.pt-20, .py-20 {
	padding-top: 10.5rem
}
.pt-21, .py-21 {
	padding-top: 11rem
}
.pt-22, .py-22 {
	padding-top: 11.5rem
}
.pt-23, .py-23 {
	padding-top: 12rem
}
.pt-24, .py-24 {
	padding-top: 12.5rem
}
.pb-1-6, .py-1-6 {
	padding-bottom: 1.6rem
}
.pb-1-7, .py-1-7 {
	padding-bottom: 1.7rem
}
.pb-1-8, .py-1-8 {
	padding-bottom: 1.8rem
}
.pb-1-9, .py-1-9 {
	padding-bottom: 1.9rem
}
.pb-2-0, .py-2-0 {
	padding-bottom: 2.0rem
}
.pb-2-1, .py-2-1 {
	padding-bottom: 2.1rem
}
.pb-2-2, .py-2-2 {
	padding-bottom: 2.2rem
}
.pb-2-3, .py-2-3 {
	padding-bottom: 2.3rem
}
.pb-2-4, .py-2-4 {
	padding-bottom: 2.4rem
}
.pb-2-5, .py-2-5 {
	padding-bottom: 2.5rem
}
.pb-2-6, .py-2-6 {
	padding-bottom: 2.6rem
}
.pb-2-7, .py-2-7 {
	padding-bottom: 2.7rem
}
.pb-2-8, .py-2-8 {
	padding-bottom: 2.8rem
}
.pb-2-9, .py-2-9 {
	padding-bottom: 2.9rem
}
.pb-6, .py-6 {
	padding-bottom: 3.5rem
}
.pb-7, .py-7 {
	padding-bottom: 4rem
}
.pb-8, .py-8 {
	padding-bottom: 4.5rem
}
.pb-9, .py-9 {
	padding-bottom: 5rem
}
.pb-10, .py-10 {
	padding-bottom: 5.5rem
}
.pb-11, .py-11 {
	padding-bottom: 6rem
}
.pb-12, .py-12 {
	padding-bottom: 6.5rem
}
.pb-13, .py-13 {
	padding-bottom: 7rem
}
.pb-14, .py-14 {
	padding-bottom: 7.5rem
}
.pb-15, .py-15 {
	padding-bottom: 8rem
}
.pb-16, .py-16 {
	padding-bottom: 8.5rem
}
.pb-17, .py-17 {
	padding-bottom: 9rem
}
.pb-18, .py-18 {
	padding-bottom: 9.5rem
}
.pb-19, .py-19 {
	padding-bottom: 10rem
}
.pb-20, .py-20 {
	padding-bottom: 10.5rem
}
.pb-21, .py-21 {
	padding-bottom: 11rem
}
.pb-22, .py-22 {
	padding-bottom: 11.5rem
}
.pb-23, .py-23 {
	padding-bottom: 12rem
}
.pb-24, .py-24 {
	padding-bottom: 12.5rem
}
.ps-1-6, .px-1-6 {
	padding-left: 1.6rem
}
.ps-1-7, .px-1-7 {
	padding-left: 1.7rem
}
.ps-1-8, .px-1-8 {
	padding-left: 1.8rem
}
.ps-1-9, .px-1-9 {
	padding-left: 1.9rem
}
.ps-2-0, .px-2-0 {
	padding-left: 2.0rem
}
.ps-2-1, .px-2-1 {
	padding-left: 2.1rem
}
.ps-2-2, .px-2-2 {
	padding-left: 2.2rem
}
.ps-2-3, .px-2-3 {
	padding-left: 2.3rem
}
.ps-2-4, .px-2-4 {
	padding-left: 2.4rem
}
.ps-2-5, .px-2-5 {
	padding-left: 2.5rem
}
.ps-2-6, .px-2-6 {
	padding-left: 2.6rem
}
.ps-2-7, .px-2-7 {
	padding-left: 2.7rem
}
.ps-2-8, .px-2-8 {
	padding-left: 2.8rem
}
.ps-2-9, .px-2-9 {
	padding-left: 2.9rem
}
.ps-6, .px-6 {
	padding-left: 3.5rem
}
.ps-7, .px-7 {
	padding-left: 4rem
}
.ps-8, .px-8 {
	padding-left: 4.5rem
}
.ps-9, .px-9 {
	padding-left: 5rem
}
.ps-10, .px-10 {
	padding-left: 5.5rem
}
.ps-11, .px-11 {
	padding-left: 6rem
}
.ps-12, .px-12 {
	padding-left: 6.5rem
}
.ps-13, .px-13 {
	padding-left: 7rem
}
.ps-14, .px-14 {
	padding-left: 7.5rem
}
.ps-15, .px-15 {
	padding-left: 8rem
}
.ps-16, .px-16 {
	padding-left: 8.5rem
}
.ps-17, .px-17 {
	padding-left: 9rem
}
.ps-18, .px-18 {
	padding-left: 9.5rem
}
.ps-19, .px-19 {
	padding-left: 10rem
}
.ps-20, .px-20 {
	padding-left: 10.5rem
}
.ps-21, .px-21 {
	padding-left: 11rem
}
.ps-22, .px-22 {
	padding-left: 11.5rem
}
.ps-23, .px-23 {
	padding-left: 12rem
}
.ps-24, .px-24 {
	padding-left: 12.5rem
}
.pe-1-6, .px-1-6 {
	padding-right: 1.6rem
}
.pe-1-7, .px-1-7 {
	padding-right: 1.7rem
}
.pe-1-8, .px-1-8 {
	padding-right: 1.8rem
}
.pe-1-9, .px-1-9 {
	padding-right: 1.9rem
}
.pe-2-0, .px-2-0 {
	padding-right: 2.0rem
}
.pe-2-1, .px-2-1 {
	padding-right: 2.1rem
}
.pe-2-2, .px-2-2 {
	padding-right: 2.2rem
}
.pe-2-3, .px-2-3 {
	padding-right: 2.3rem
}
.pe-2-4, .px-2-4 {
	padding-right: 2.4rem
}
.pe-2-5, .px-2-5 {
	padding-right: 2.5rem
}
.pe-2-6, .px-2-6 {
	padding-right: 2.6rem
}
.pe-2-7, .px-2-7 {
	padding-right: 2.7rem
}
.pe-2-8, .px-2-8 {
	padding-right: 2.8rem
}
.pe-2-9, .px-2-9 {
	padding-right: 2.9rem
}
.pe-6, .px-6 {
	padding-right: 3.5rem
}
.pe-7, .px-7 {
	padding-right: 4rem
}
.pe-8, .px-8 {
	padding-right: 4.5rem
}
.pe-9, .px-9 {
	padding-right: 5rem
}
.pe-10, .px-10 {
	padding-right: 5.5rem
}
.pe-11, .px-11 {
	padding-right: 6rem
}
.pe-12, .px-12 {
	padding-right: 6.5rem
}
.pe-13, .px-13 {
	padding-right: 7rem
}
.pe-14, .px-14 {
	padding-right: 7.5rem
}
.pe-15, .px-15 {
	padding-right: 8rem
}
.pe-16, .px-16 {
	padding-right: 8.5rem
}
.pe-17, .px-17 {
	padding-right: 9rem
}
.pe-18, .px-18 {
	padding-right: 9.5rem
}
.pe-19, .px-19 {
	padding-right: 10rem
}
.pe-20, .px-20 {
	padding-right: 10.5rem
}
.pe-21, .px-21 {
	padding-right: 11rem
}
.pe-22, .px-22 {
	padding-right: 11.5rem
}
.pe-23, .px-23 {
	padding-right: 12rem
}
.pe-24, .px-24 {
	padding-right: 12.5rem
}
.overflow-hidden {
	overflow: hidden !important
}
.overflow-visible {
	overflow: visible !important
}
.overflow-auto {
	overflow: auto !important
}
.position-inherit {
	position: inherit !important
}
.right {
	right: 0
}
.right-1 {
	right: -1px
}
.left {
	left: 0
}
.left-1 {
	left: -1px
}
.top {
	top: 0
}
.top-1 {
	top: -1px
}
.bottom {
	bottom: 0
}
.bottom-1 {
	bottom: -1px
}
.top-5 {
	top: 5%;
	bottom: inherit
}
.top-10 {
	top: 10%;
	bottom: inherit
}
.top-15 {
	top: 15%;
	bottom: inherit
}
.top-20 {
	top: 20%;
	bottom: inherit
}
.top-25 {
	top: 25%;
	bottom: inherit
}
.top-30 {
	top: 30%;
	bottom: inherit
}
.top-35 {
	top: 35%;
	bottom: inherit
}
.top-40 {
	top: 40%;
	bottom: inherit
}
.top-45 {
	top: 45%;
	bottom: inherit
}
.top-50 {
	top: 50%;
	bottom: inherit
}
.top-55 {
	top: 55%;
	bottom: inherit
}
.top-60 {
	top: 60%;
	bottom: inherit
}
.top-65 {
	top: 65%;
	bottom: inherit
}
.top-70 {
	top: 70%;
	bottom: inherit
}
.top-75 {
	top: 75%;
	bottom: inherit
}
.top-80 {
	top: 80%;
	bottom: inherit
}
.top-85 {
	top: 85%;
	bottom: inherit
}
.top-90 {
	top: 90%;
	bottom: inherit
}
.top-95 {
	top: 95%;
	bottom: inherit
}
.top-100 {
	top: 100%;
	bottom: inherit
}
.top-n5 {
	top: -5%;
	bottom: inherit
}
.top-n10 {
	top: -10%;
	bottom: inherit
}
.top-n15 {
	top: -15%;
	bottom: inherit
}
.top-n20 {
	top: -20%;
	bottom: inherit
}
.top-n25 {
	top: -25%;
	bottom: inherit
}
.top-n30 {
	top: -30%;
	bottom: inherit
}
.top-n35 {
	top: -35%;
	bottom: inherit
}
.top-n40 {
	top: -40%;
	bottom: inherit
}
.top-n45 {
	top: -45%;
	bottom: inherit
}
.top-n50 {
	top: -50%;
	bottom: inherit
}
.top-n55 {
	top: -55%;
	bottom: inherit
}
.top-n60 {
	top: -60%;
	bottom: inherit
}
.top-n65 {
	top: -65%;
	bottom: inherit
}
.top-n70 {
	top: -70%;
	bottom: inherit
}
.top-n75 {
	top: -75%;
	bottom: inherit
}
.top-n80 {
	top: -80%;
	bottom: inherit
}
.top-n85 {
	top: -85%;
	bottom: inherit
}
.top-n90 {
	top: -90%;
	bottom: inherit
}
.top-n95 {
	top: -95%;
	bottom: inherit
}
.top-n100 {
	top: -100%;
	bottom: inherit
}
.bottom-5 {
	bottom: 5%;
	top: inherit
}
.bottom-10 {
	bottom: 10%;
	top: inherit
}
.bottom-15 {
	bottom: 15%;
	top: inherit
}
.bottom-20 {
	bottom: 20%;
	top: inherit
}
.bottom-25 {
	bottom: 25%;
	top: inherit
}
.bottom-30 {
	bottom: 30%;
	top: inherit
}
.bottom-35 {
	bottom: 35%;
	top: inherit
}
.bottom-40 {
	bottom: 40%;
	top: inherit
}
.bottom-45 {
	bottom: 45%;
	top: inherit
}
.bottom-50 {
	bottom: 50%;
	top: inherit
}
.bottom-55 {
	bottom: 55%;
	top: inherit
}
.bottom-60 {
	bottom: 60%;
	top: inherit
}
.bottom-65 {
	bottom: 65%;
	top: inherit
}
.bottom-70 {
	bottom: 70%;
	top: inherit
}
.bottom-75 {
	bottom: 75%;
	top: inherit
}
.bottom-80 {
	bottom: 80%;
	top: inherit
}
.bottom-85 {
	bottom: 85%;
	top: inherit
}
.bottom-90 {
	bottom: 90%;
	top: inherit
}
.bottom-95 {
	bottom: 95%;
	top: inherit
}
.bottom-100 {
	bottom: 100%;
	top: inherit
}
.bottom-n5 {
	bottom: -5%;
	top: inherit
}
.bottom-n10 {
	bottom: -10%;
	top: inherit
}
.bottom-n15 {
	bottom: -15%;
	top: inherit
}
.bottom-n20 {
	bottom: -20%;
	top: inherit
}
.bottom-n25 {
	bottom: -25%;
	top: inherit
}
.bottom-n30 {
	bottom: -30%;
	top: inherit
}
.bottom-n35 {
	bottom: -35%;
	top: inherit
}
.bottom-n40 {
	bottom: -40%;
	top: inherit
}
.bottom-n45 {
	bottom: -45%;
	top: inherit
}
.bottom-n50 {
	bottom: -50%;
	top: inherit
}
.bottom-n55 {
	bottom: -55%;
	top: inherit
}
.bottom-n60 {
	bottom: -60%;
	top: inherit
}
.bottom-n65 {
	bottom: -65%;
	top: inherit
}
.bottom-n70 {
	bottom: -70%;
	top: inherit
}
.bottom-n75 {
	bottom: -75%;
	top: inherit
}
.bottom-n80 {
	bottom: -80%;
	top: inherit
}
.bottom-n85 {
	bottom: -85%;
	top: inherit
}
.bottom-n90 {
	bottom: -90%;
	top: inherit
}
.bottom-n95 {
	bottom: -95%;
	top: inherit
}
.bottom-n100 {
	bottom: -100%;
	top: inherit
}
.left-5 {
	left: 5%;
	right: inherit
}
.left-10 {
	left: 10%;
	right: inherit
}
.left-15 {
	left: 15%;
	right: inherit
}
.left-20 {
	left: 20%;
	right: inherit
}
.left-25 {
	left: 25%;
	right: inherit
}
.left-30 {
	left: 30%;
	right: inherit
}
.left-35 {
	left: 35%;
	right: inherit
}
.left-40 {
	left: 40%;
	right: inherit
}
.left-45 {
	left: 45%;
	right: inherit
}
.left-50 {
	left: 50%;
	right: inherit
}
.left-55 {
	left: 55%;
	right: inherit
}
.left-60 {
	left: 60%;
	right: inherit
}
.left-65 {
	left: 65%;
	right: inherit
}
.left-70 {
	left: 70%;
	right: inherit
}
.left-75 {
	left: 75%;
	right: inherit
}
.left-80 {
	left: 80%;
	right: inherit
}
.left-85 {
	left: 85%;
	right: inherit
}
.left-90 {
	left: 90%;
	right: inherit
}
.left-95 {
	left: 95%;
	right: inherit
}
.left-100 {
	left: 100%;
	right: inherit
}
.left-n5 {
	left: -5%;
	right: inherit
}
.left-n10 {
	left: -10%;
	right: inherit
}
.left-n15 {
	left: -15%;
	right: inherit
}
.left-n20 {
	left: -20%;
	right: inherit
}
.left-n25 {
	left: -25%;
	right: inherit
}
.left-n30 {
	left: -30%;
	right: inherit
}
.left-n35 {
	left: -35%;
	right: inherit
}
.left-n40 {
	left: -40%;
	right: inherit
}
.left-n45 {
	left: -45%;
	right: inherit
}
.left-n50 {
	left: -50%;
	right: inherit
}
.left-n55 {
	left: -55%;
	right: inherit
}
.left-n60 {
	left: -60%;
	right: inherit
}
.left-n65 {
	left: -65%;
	right: inherit
}
.left-n70 {
	left: -70%;
	right: inherit
}
.left-n75 {
	left: -75%;
	right: inherit
}
.left-n80 {
	left: -80%;
	right: inherit
}
.left-n85 {
	left: -85%;
	right: inherit
}
.left-n90 {
	left: -90%;
	right: inherit
}
.left-n95 {
	left: -95%;
	right: inherit
}
.left-n100 {
	left: -100%;
	right: inherit
}
.right-5 {
	right: 5%;
	left: inherit
}
.right-10 {
	right: 10%;
	left: inherit
}
.right-15 {
	right: 15%;
	left: inherit
}
.right-20 {
	right: 20%;
	left: inherit
}
.right-25 {
	right: 25%;
	left: inherit
}
.right-30 {
	right: 30%;
	left: inherit
}
.right-35 {
	right: 35%;
	left: inherit
}
.right-40 {
	right: 40%;
	left: inherit
}
.right-45 {
	right: 45%;
	left: inherit
}
.right-50 {
	right: 50%;
	left: inherit
}
.right-55 {
	right: 55%;
	left: inherit
}
.right-60 {
	right: 60%;
	left: inherit
}
.right-65 {
	right: 65%;
	left: inherit
}
.right-70 {
	right: 70%;
	left: inherit
}
.right-75 {
	right: 75%;
	left: inherit
}
.right-80 {
	right: 80%;
	left: inherit
}
.right-85 {
	right: 85%;
	left: inherit
}
.right-90 {
	right: 90%;
	left: inherit
}
.right-95 {
	right: 95%;
	left: inherit
}
.right-100 {
	right: 100%;
	left: inherit
}
.right-n5 {
	right: -5%;
	left: inherit
}
.right-n10 {
	right: -10%;
	left: inherit
}
.right-n15 {
	right: -15%;
	left: inherit
}
.right-n20 {
	right: -20%;
	left: inherit
}
.right-n25 {
	right: -25%;
	left: inherit
}
.right-n30 {
	right: -30%;
	left: inherit
}
.right-n35 {
	right: -35%;
	left: inherit
}
.right-n40 {
	right: -40%;
	left: inherit
}
.right-n45 {
	right: -45%;
	left: inherit
}
.right-n50 {
	right: -50%;
	left: inherit
}
.right-n55 {
	right: -55%;
	left: inherit
}
.right-n60 {
	right: -60%;
	left: inherit
}
.right-n65 {
	right: -65%;
	left: inherit
}
.right-n70 {
	right: -70%;
	left: inherit
}
.right-n75 {
	right: -75%;
	left: inherit
}
.right-n80 {
	right: -80%;
	left: inherit
}
.right-n85 {
	right: -85%;
	left: inherit
}
.right-n90 {
	right: -90%;
	left: inherit
}
.right-n95 {
	right: -95%;
	left: inherit
}
.right-n100 {
	right: -100%;
	left: inherit
}
.w-1px {
	width: 1px
}
.w-2px {
	width: 2px
}
.w-3px {
	width: 3px
}
.w-4px {
	width: 4px
}
.w-5px {
	width: 5px
}
.w-6px {
	width: 6px
}
.w-7px {
	width: 7px
}
.w-8px {
	width: 8px
}
.w-9px {
	width: 9px
}
.w-10px {
	width: 10px
}
.w-15px {
	width: 15px
}
.w-20px {
	width: 20px
}
.w-25px {
	width: 25px
}
.w-30px {
	width: 30px
}
.w-35px {
	width: 35px
}
.w-40px {
	width: 40px
}
.w-50px {
	width: 50px
}
.w-55px {
	width: 55px
}
.w-60px {
	width: 60px
}
.w-65px {
	width: 65px
}
.w-70px {
	width: 70px
}
.w-75px {
	width: 75px
}
.w-80px {
	width: 80px
}
.w-85px {
	width: 85px
}
.w-90px {
	width: 90px
}
.w-100px {
	width: 100px
}
.w-1 {
	width: 1%
}
.w-2 {
	width: 2%
}
.w-3 {
	width: 3%
}
.w-4 {
	width: 4%
}
.w-5 {
	width: 5%
}
.w-6 {
	width: 6%
}
.w-7 {
	width: 7%
}
.w-8 {
	width: 8%
}
.w-9 {
	width: 9%
}
.w-10 {
	width: 10%
}
.w-11 {
	width: 11%
}
.w-12 {
	width: 12%
}
.w-13 {
	width: 13%
}
.w-14 {
	width: 14%
}
.w-15 {
	width: 15%
}
.w-20 {
	width: 20%
}
.w-25 {
	width: 25%
}
.w-30 {
	width: 30%
}
.w-35 {
	width: 35%
}
.w-40 {
	width: 40%
}
.w-45 {
	width: 45%
}
.w-50 {
	width: 50%
}
.w-55 {
	width: 55%
}
.w-60 {
	width: 60%
}
.w-65 {
	width: 65%
}
.w-70 {
	width: 70%
}
.w-75 {
	width: 75%
}
.w-80 {
	width: 80%
}
.w-85 {
	width: 85%
}
.w-90 {
	width: 90%
}
.w-95 {
	width: 95%
}
.w-100 {
	width: 100%
}
.w-auto {
	width: auto
}

@media screen and (min-width: 576px) {
.w-sm-1px {
	width: 1px
}
.w-sm-2px {
	width: 2px
}
.w-sm-3px {
	width: 3px
}
.w-sm-4px {
	width: 4px
}
.w-sm-5px {
	width: 5px
}
.w-sm-6px {
	width: 6px
}
.w-sm-7px {
	width: 7px
}
.w-sm-8px {
	width: 8px
}
.w-sm-9px {
	width: 9px
}
.w-sm-10px {
	width: 10px
}
.w-sm-15px {
	width: 15px
}
.w-sm-20px {
	width: 20px
}
.w-sm-25px {
	width: 25px
}
.w-sm-30px {
	width: 30px
}
.w-sm-35px {
	width: 35px
}
.w-sm-40px {
	width: 40px
}
.w-sm-50px {
	width: 50px
}
.w-sm-55px {
	width: 55px
}
.w-sm-60px {
	width: 60px
}
.w-sm-65px {
	width: 65px
}
.w-sm-70px {
	width: 70px
}
.w-sm-75px {
	width: 75px
}
.w-sm-80px {
	width: 80px
}
.w-sm-85px {
	width: 85px
}
.w-sm-90px {
	width: 90px
}
.w-sm-100px {
	width: 100px
}
.w-sm-1 {
	width: 1%
}
.w-sm-2 {
	width: 2%
}
.w-sm-3 {
	width: 3%
}
.w-sm-4 {
	width: 4%
}
.w-sm-5 {
	width: 5%
}
.w-sm-6 {
	width: 6%
}
.w-sm-7 {
	width: 7%
}
.w-sm-8 {
	width: 8%
}
.w-sm-9 {
	width: 9%
}
.w-sm-10 {
	width: 10%
}
.w-sm-11 {
	width: 11%
}
.w-sm-12 {
	width: 12%
}
.w-sm-13 {
	width: 13%
}
.w-sm-14 {
	width: 14%
}
.w-sm-15 {
	width: 15%
}
.w-sm-20 {
	width: 20%
}
.w-sm-25 {
	width: 25%
}
.w-sm-30 {
	width: 30%
}
.w-sm-35 {
	width: 35%
}
.w-sm-40 {
	width: 40%
}
.w-sm-45 {
	width: 45%
}
.w-sm-50 {
	width: 50%
}
.w-sm-55 {
	width: 55%
}
.w-sm-60 {
	width: 60%
}
.w-sm-65 {
	width: 65%
}
.w-sm-70 {
	width: 70%
}
.w-sm-75 {
	width: 75%
}
.w-sm-80 {
	width: 80%
}
.w-sm-85 {
	width: 85%
}
.w-sm-90 {
	width: 90%
}
.w-sm-95 {
	width: 95%
}
.w-sm-100 {
	width: 100%
}
.w-sm-auto {
	width: auto
}
.display-sm-1 {
	font-size: 6rem
}
.display-sm-2 {
	font-size: 5.5rem
}
.display-sm-3 {
	font-size: 4.5rem
}
.display-sm-4 {
	font-size: 3.5rem
}
.display-sm-5 {
	font-size: 3.4rem
}
.display-sm-6 {
	font-size: 3.3rem
}
.display-sm-7 {
	font-size: 3.2rem
}
.display-sm-8 {
	font-size: 3.1rem
}
.display-sm-9 {
	font-size: 3.0rem
}
.display-sm-10 {
	font-size: 2.9rem
}
.display-sm-11 {
	font-size: 2.8rem
}
.display-sm-12 {
	font-size: 2.7rem
}
.display-sm-13 {
	font-size: 2.6rem
}
.display-sm-14 {
	font-size: 2.5rem
}
.display-sm-15 {
	font-size: 2.4rem
}
.display-sm-16 {
	font-size: 2.3rem
}
.display-sm-17 {
	font-size: 2.2rem
}
.display-sm-18 {
	font-size: 2.1rem
}
.display-sm-19 {
	font-size: 2.0rem
}
.display-sm-20 {
	font-size: 1.9rem
}
.display-sm-21 {
	font-size: 1.8rem
}
.display-sm-22 {
	font-size: 1.7rem
}
.display-sm-23 {
	font-size: 1.6rem
}
.display-sm-24 {
	font-size: 1.5rem
}
.display-sm-25 {
	font-size: 1.4rem
}
.display-sm-26 {
	font-size: 1.3rem
}
.display-sm-27 {
	font-size: 1.2rem
}
.display-sm-28 {
	font-size: 1.1rem
}
.display-sm-29 {
	font-size: 1.0rem
}
.display-sm-30 {
	font-size: 0.9rem
}
.display-sm-31 {
	font-size: 0.8rem
}
.display-sm-32 {
	font-size: 0.7rem
}
.display-sm-33 {
	font-size: 0.6rem
}
.display-sm-34 {
	font-size: 0.5rem
}
.border-sm-0 {
	border: none
}
.border-sm {
	border: 1px solid #dee2e6
}
.border-sm-top {
	border-top: 1px solid #dee2e6
}
.border-sm-end {
	border-right: 1px solid #dee2e6
}
.border-sm-bottom {
	border-bottom: 1px solid #dee2e6
}
.border-sm-start {
	border-left: 1px solid #dee2e6
}
.border-sm-top-0 {
	border-top: none
}
.border-sm-end-0 {
	border-right: none
}
.border-sm-bottom-0 {
	border-bottom: none
}
.border-sm-start-0 {
	border-left: none
}
.border-sm-color-light-white {
	border-color: rgba(255,255,255,0.1) !important
}
.rounded-sm {
	border-radius: .25rem
}
.top-sm-5 {
	top: 5%;
	bottom: inherit
}
.top-sm-10 {
	top: 10%;
	bottom: inherit
}
.top-sm-15 {
	top: 15%;
	bottom: inherit
}
.top-sm-20 {
	top: 20%;
	bottom: inherit
}
.top-sm-25 {
	top: 25%;
	bottom: inherit
}
.top-sm-30 {
	top: 30%;
	bottom: inherit
}
.top-sm-35 {
	top: 35%;
	bottom: inherit
}
.top-sm-40 {
	top: 40%;
	bottom: inherit
}
.top-sm-45 {
	top: 45%;
	bottom: inherit
}
.top-sm-50 {
	top: 50%;
	bottom: inherit
}
.top-sm-55 {
	top: 55%;
	bottom: inherit
}
.top-sm-60 {
	top: 60%;
	bottom: inherit
}
.top-sm-65 {
	top: 65%;
	bottom: inherit
}
.top-sm-70 {
	top: 70%;
	bottom: inherit
}
.top-sm-75 {
	top: 75%;
	bottom: inherit
}
.top-sm-80 {
	top: 80%;
	bottom: inherit
}
.top-sm-85 {
	top: 85%;
	bottom: inherit
}
.top-sm-90 {
	top: 90%;
	bottom: inherit
}
.top-sm-95 {
	top: 95%;
	bottom: inherit
}
.top-sm-100 {
	top: 100%;
	bottom: inherit
}
.top-sm-n5 {
	top: -5%;
	bottom: inherit
}
.top-sm-n10 {
	top: -10%;
	bottom: inherit
}
.top-sm-n15 {
	top: -15%;
	bottom: inherit
}
.top-sm-n20 {
	top: -20%;
	bottom: inherit
}
.top-sm-n25 {
	top: -25%;
	bottom: inherit
}
.top-sm-n30 {
	top: -30%;
	bottom: inherit
}
.top-sm-n35 {
	top: -35%;
	bottom: inherit
}
.top-sm-n40 {
	top: -40%;
	bottom: inherit
}
.top-sm-n45 {
	top: -45%;
	bottom: inherit
}
.top-sm-n50 {
	top: -50%;
	bottom: inherit
}
.top-sm-n55 {
	top: -55%;
	bottom: inherit
}
.top-sm-n60 {
	top: -60%;
	bottom: inherit
}
.top-sm-n65 {
	top: -65%;
	bottom: inherit
}
.top-sm-n70 {
	top: -70%;
	bottom: inherit
}
.top-sm-n75 {
	top: -75%;
	bottom: inherit
}
.top-sm-n80 {
	top: -80%;
	bottom: inherit
}
.top-sm-n85 {
	top: -85%;
	bottom: inherit
}
.top-sm-n90 {
	top: -90%;
	bottom: inherit
}
.top-sm-n95 {
	top: -95%;
	bottom: inherit
}
.top-sm-n100 {
	top: -100%;
	bottom: inherit
}
.bottom-sm-5 {
	bottom: 5%;
	top: inherit
}
.bottom-sm-10 {
	bottom: 10%;
	top: inherit
}
.bottom-sm-15 {
	bottom: 15%;
	top: inherit
}
.bottom-sm-20 {
	bottom: 20%;
	top: inherit
}
.bottom-sm-25 {
	bottom: 25%;
	top: inherit
}
.bottom-sm-30 {
	bottom: 30%;
	top: inherit
}
.bottom-sm-35 {
	bottom: 35%;
	top: inherit
}
.bottom-sm-40 {
	bottom: 40%;
	top: inherit
}
.bottom-sm-45 {
	bottom: 45%;
	top: inherit
}
.bottom-sm-50 {
	bottom: 50%;
	top: inherit
}
.bottom-sm-55 {
	bottom: 55%;
	top: inherit
}
.bottom-sm-60 {
	bottom: 60%;
	top: inherit
}
.bottom-sm-65 {
	bottom: 65%;
	top: inherit
}
.bottom-sm-70 {
	bottom: 70%;
	top: inherit
}
.bottom-sm-75 {
	bottom: 75%;
	top: inherit
}
.bottom-sm-80 {
	bottom: 80%;
	top: inherit
}
.bottom-sm-85 {
	bottom: 85%;
	top: inherit
}
.bottom-sm-90 {
	bottom: 90%;
	top: inherit
}
.bottom-sm-95 {
	bottom: 95%;
	top: inherit
}
.bottom-sm-100 {
	bottom: 100%;
	top: inherit
}
.bottom-sm-n5 {
	bottom: -5%;
	top: inherit
}
.bottom-sm-n10 {
	bottom: -10%;
	top: inherit
}
.bottom-sm-n15 {
	bottom: -15%;
	top: inherit
}
.bottom-sm-n20 {
	bottom: -20%;
	top: inherit
}
.bottom-sm-n25 {
	bottom: -25%;
	top: inherit
}
.bottom-sm-n30 {
	bottom: -30%;
	top: inherit
}
.bottom-sm-n35 {
	bottom: -35%;
	top: inherit
}
.bottom-sm-n40 {
	bottom: -40%;
	top: inherit
}
.bottom-sm-n45 {
	bottom: -45%;
	top: inherit
}
.bottom-sm-n50 {
	bottom: -50%;
	top: inherit
}
.bottom-sm-n55 {
	bottom: -55%;
	top: inherit
}
.bottom-sm-n60 {
	bottom: -60%;
	top: inherit
}
.bottom-sm-n65 {
	bottom: -65%;
	top: inherit
}
.bottom-sm-n70 {
	bottom: -70%;
	top: inherit
}
.bottom-sm-n75 {
	bottom: -75%;
	top: inherit
}
.bottom-sm-n80 {
	bottom: -80%;
	top: inherit
}
.bottom-sm-n85 {
	bottom: -85%;
	top: inherit
}
.bottom-sm-n90 {
	bottom: -90%;
	top: inherit
}
.bottom-sm-n95 {
	bottom: -95%;
	top: inherit
}
.bottom-sm-n100 {
	bottom: -100%;
	top: inherit
}
.left-sm-5 {
	left: 5%;
	right: inherit
}
.left-sm-10 {
	left: 10%;
	right: inherit
}
.left-sm-15 {
	left: 15%;
	right: inherit
}
.left-sm-20 {
	left: 20%;
	right: inherit
}
.left-sm-25 {
	left: 25%;
	right: inherit
}
.left-sm-30 {
	left: 30%;
	right: inherit
}
.left-sm-35 {
	left: 35%;
	right: inherit
}
.left-sm-40 {
	left: 40%;
	right: inherit
}
.left-sm-45 {
	left: 45%;
	right: inherit
}
.left-sm-50 {
	left: 50%;
	right: inherit
}
.left-sm-55 {
	left: 55%;
	right: inherit
}
.left-sm-60 {
	left: 60%;
	right: inherit
}
.left-sm-65 {
	left: 65%;
	right: inherit
}
.left-sm-70 {
	left: 70%;
	right: inherit
}
.left-sm-75 {
	left: 75%;
	right: inherit
}
.left-sm-80 {
	left: 80%;
	right: inherit
}
.left-sm-85 {
	left: 85%;
	right: inherit
}
.left-sm-90 {
	left: 90%;
	right: inherit
}
.left-sm-95 {
	left: 95%;
	right: inherit
}
.left-sm-100 {
	left: 100%;
	right: inherit
}
.left-sm-n5 {
	left: -5%;
	right: inherit
}
.left-sm-n10 {
	left: -10%;
	right: inherit
}
.left-sm-n15 {
	left: -15%;
	right: inherit
}
.left-sm-n20 {
	left: -20%;
	right: inherit
}
.left-sm-n25 {
	left: -25%;
	right: inherit
}
.left-sm-n30 {
	left: -30%;
	right: inherit
}
.left-sm-n35 {
	left: -35%;
	right: inherit
}
.left-sm-n40 {
	left: -40%;
	right: inherit
}
.left-sm-n45 {
	left: -45%;
	right: inherit
}
.left-sm-n50 {
	left: -50%;
	right: inherit
}
.left-sm-n55 {
	left: -55%;
	right: inherit
}
.left-sm-n60 {
	left: -60%;
	right: inherit
}
.left-sm-n65 {
	left: -65%;
	right: inherit
}
.left-sm-n70 {
	left: -70%;
	right: inherit
}
.left-sm-n75 {
	left: -75%;
	right: inherit
}
.left-sm-n80 {
	left: -80%;
	right: inherit
}
.left-sm-n85 {
	left: -85%;
	right: inherit
}
.left-sm-n90 {
	left: -90%;
	right: inherit
}
.left-sm-n95 {
	left: -95%;
	right: inherit
}
.left-sm-n100 {
	left: -100%;
	right: inherit
}
.right-sm-5 {
	right: 5%;
	left: inherit
}
.right-sm-10 {
	right: 10%;
	left: inherit
}
.right-sm-15 {
	right: 15%;
	left: inherit
}
.right-sm-20 {
	right: 20%;
	left: inherit
}
.right-sm-25 {
	right: 25%;
	left: inherit
}
.right-sm-30 {
	right: 30%;
	left: inherit
}
.right-sm-35 {
	right: 35%;
	left: inherit
}
.right-sm-40 {
	right: 40%;
	left: inherit
}
.right-sm-45 {
	right: 45%;
	left: inherit
}
.right-sm-50 {
	right: 50%;
	left: inherit
}
.right-sm-55 {
	right: 55%;
	left: inherit
}
.right-sm-60 {
	right: 60%;
	left: inherit
}
.right-sm-65 {
	right: 65%;
	left: inherit
}
.right-sm-70 {
	right: 70%;
	left: inherit
}
.right-sm-75 {
	right: 75%;
	left: inherit
}
.right-sm-80 {
	right: 80%;
	left: inherit
}
.right-sm-85 {
	right: 85%;
	left: inherit
}
.right-sm-90 {
	right: 90%;
	left: inherit
}
.right-sm-95 {
	right: 95%;
	left: inherit
}
.right-sm-100 {
	right: 100%;
	left: inherit
}
.right-sm-n5 {
	right: -5%;
	left: inherit
}
.right-sm-n10 {
	right: -10%;
	left: inherit
}
.right-sm-n15 {
	right: -15%;
	left: inherit
}
.right-sm-n20 {
	right: -20%;
	left: inherit
}
.right-sm-n25 {
	right: -25%;
	left: inherit
}
.right-sm-n30 {
	right: -30%;
	left: inherit
}
.right-sm-n35 {
	right: -35%;
	left: inherit
}
.right-sm-n40 {
	right: -40%;
	left: inherit
}
.right-sm-n45 {
	right: -45%;
	left: inherit
}
.right-sm-n50 {
	right: -50%;
	left: inherit
}
.right-sm-n55 {
	right: -55%;
	left: inherit
}
.right-sm-n60 {
	right: -60%;
	left: inherit
}
.right-sm-n65 {
	right: -65%;
	left: inherit
}
.right-sm-n70 {
	right: -70%;
	left: inherit
}
.right-sm-n75 {
	right: -75%;
	left: inherit
}
.right-sm-n80 {
	right: -80%;
	left: inherit
}
.right-sm-n85 {
	right: -85%;
	left: inherit
}
.right-sm-n90 {
	right: -90%;
	left: inherit
}
.right-sm-n95 {
	right: -95%;
	left: inherit
}
.right-sm-n100 {
	right: -100%;
	left: inherit
}
.m-sm-1-6 {
	margin: 1.6rem
}
.m-sm-1-7 {
	margin: 1.7rem
}
.m-sm-1-8 {
	margin: 1.8rem
}
.m-sm-1-9 {
	margin: 1.9rem
}
.m-sm-2-0 {
	margin: 2.0rem
}
.m-sm-2-1 {
	margin: 2.1rem
}
.m-sm-2-2 {
	margin: 2.2rem
}
.m-sm-2-3 {
	margin: 2.3rem
}
.m-sm-2-4 {
	margin: 2.4rem
}
.m-sm-2-5 {
	margin: 2.5rem
}
.m-sm-2-6 {
	margin: 2.6rem
}
.m-sm-2-7 {
	margin: 2.7rem
}
.m-sm-2-8 {
	margin: 2.8rem
}
.m-sm-2-9 {
	margin: 2.9rem
}
.m-sm-6 {
	margin: 3.5rem
}
.m-sm-7 {
	margin: 4rem
}
.m-sm-8 {
	margin: 4.5rem
}
.m-sm-9 {
	margin: 5rem
}
.m-sm-10 {
	margin: 5.5rem
}
.m-sm-11 {
	margin: 6rem
}
.m-sm-12 {
	margin: 6.5rem
}
.m-sm-13 {
	margin: 7rem
}
.m-sm-14 {
	margin: 7.5rem
}
.m-sm-15 {
	margin: 8rem
}
.m-sm-16 {
	margin: 8.5rem
}
.m-sm-17 {
	margin: 9rem
}
.m-sm-18 {
	margin: 9.5rem
}
.m-sm-19 {
	margin: 10rem
}
.m-sm-20 {
	margin: 10.5rem
}
.m-sm-21 {
	margin: 11rem
}
.m-sm-22 {
	margin: 11.5rem
}
.m-sm-23 {
	margin: 12rem
}
.m-sm-24 {
	margin: 12.5rem
}
.mt-sm-1-6, .my-sm-1-6 {
	margin-top: 1.6rem
}
.mt-sm-1-7, .my-sm-1-7 {
	margin-top: 1.7rem
}
.mt-sm-1-8, .my-sm-1-8 {
	margin-top: 1.8rem
}
.mt-sm-1-9, .my-sm-1-9 {
	margin-top: 1.9rem
}
.mt-sm-2-0, .my-sm-2-0 {
	margin-top: 2.0rem
}
.mt-sm-2-1, .my-sm-2-1 {
	margin-top: 2.1rem
}
.mt-sm-2-2, .my-sm-2-2 {
	margin-top: 2.2rem
}
.mt-sm-2-3, .my-sm-2-3 {
	margin-top: 2.3rem
}
.mt-sm-2-4, .my-sm-2-4 {
	margin-top: 2.4rem
}
.mt-sm-2-5, .my-sm-2-5 {
	margin-top: 2.5rem
}
.mt-sm-2-6, .my-sm-2-6 {
	margin-top: 2.6rem
}
.mt-sm-2-7, .my-sm-2-7 {
	margin-top: 2.7rem
}
.mt-sm-2-8, .my-sm-2-8 {
	margin-top: 2.8rem
}
.mt-sm-2-9, .my-sm-2-9 {
	margin-top: 2.9rem
}
.mt-sm-6, .my-sm-6 {
	margin-top: 3.5rem
}
.mt-sm-7, .my-sm-7 {
	margin-top: 4rem
}
.mt-sm-8, .my-sm-8 {
	margin-top: 4.5rem
}
.mt-sm-9, .my-sm-9 {
	margin-top: 5rem
}
.mt-sm-10, .my-sm-10 {
	margin-top: 5.5rem
}
.mt-sm-11, .my-sm-11 {
	margin-top: 6rem
}
.mt-sm-12, .my-sm-12 {
	margin-top: 6.5rem
}
.mt-sm-13, .my-sm-13 {
	margin-top: 7rem
}
.mt-sm-14, .my-sm-14 {
	margin-top: 7.5rem
}
.mt-sm-15, .my-sm-15 {
	margin-top: 8rem
}
.mt-sm-16, .my-sm-16 {
	margin-top: 8.5rem
}
.mt-sm-17, .my-sm-17 {
	margin-top: 9rem
}
.mt-sm-18, .my-sm-18 {
	margin-top: 9.5rem
}
.mt-sm-19, .my-sm-19 {
	margin-top: 10rem
}
.mt-sm-20, .my-sm-20 {
	margin-top: 10.5rem
}
.mt-sm-21, .my-sm-21 {
	margin-top: 11rem
}
.mt-sm-22, .my-sm-22 {
	margin-top: 11.5rem
}
.mt-sm-23, .my-sm-23 {
	margin-top: 12rem
}
.mt-sm-24, .my-sm-24 {
	margin-top: 12.5rem
}
.mb-sm-1-6, .my-sm-1-6 {
	margin-bottom: 1.6rem
}
.mb-sm-1-7, .my-sm-1-7 {
	margin-bottom: 1.7rem
}
.mb-sm-1-8, .my-sm-1-8 {
	margin-bottom: 1.8rem
}
.mb-sm-1-9, .my-sm-1-9 {
	margin-bottom: 1.9rem
}
.mb-sm-2-0, .my-sm-2-0 {
	margin-bottom: 2.0rem
}
.mb-sm-2-1, .my-sm-2-1 {
	margin-bottom: 2.1rem
}
.mb-sm-2-2, .my-sm-2-2 {
	margin-bottom: 2.2rem
}
.mb-sm-2-3, .my-sm-2-3 {
	margin-bottom: 2.3rem
}
.mb-sm-2-4, .my-sm-2-4 {
	margin-bottom: 2.4rem
}
.mb-sm-2-5, .my-sm-2-5 {
	margin-bottom: 2.5rem
}
.mb-sm-2-6, .my-sm-2-6 {
	margin-bottom: 2.6rem
}
.mb-sm-2-7, .my-sm-2-7 {
	margin-bottom: 2.7rem
}
.mb-sm-2-8, .my-sm-2-8 {
	margin-bottom: 2.8rem
}
.mb-sm-2-9, .my-sm-2-9 {
	margin-bottom: 2.9rem
}
.mb-sm-6, .my-sm-6 {
	margin-bottom: 3.5rem
}
.mb-sm-7, .my-sm-7 {
	margin-bottom: 4rem
}
.mb-sm-8, .my-sm-8 {
	margin-bottom: 4.5rem
}
.mb-sm-9, .my-sm-9 {
	margin-bottom: 5rem
}
.mb-sm-10, .my-sm-10 {
	margin-bottom: 5.5rem
}
.mb-sm-11, .my-sm-11 {
	margin-bottom: 6rem
}
.mb-sm-12, .my-sm-12 {
	margin-bottom: 6.5rem
}
.mb-sm-13, .my-sm-13 {
	margin-bottom: 7rem
}
.mb-sm-14, .my-sm-14 {
	margin-bottom: 7.5rem
}
.mb-sm-15, .my-sm-15 {
	margin-bottom: 8rem
}
.mb-sm-16, .my-sm-16 {
	margin-bottom: 8.5rem
}
.mb-sm-17, .my-sm-17 {
	margin-bottom: 9rem
}
.mb-sm-18, .my-sm-18 {
	margin-bottom: 9.5rem
}
.mb-sm-19, .my-sm-19 {
	margin-bottom: 10rem
}
.mb-sm-20, .my-sm-20 {
	margin-bottom: 10.5rem
}
.mb-sm-21, .my-sm-21 {
	margin-bottom: 11rem
}
.mb-sm-22, .my-sm-22 {
	margin-bottom: 11.5rem
}
.mb-sm-23, .my-sm-23 {
	margin-bottom: 12rem
}
.mb-sm-24, .my-sm-24 {
	margin-bottom: 12.5rem
}
.ms-sm-1-6, .mx-sm-1-6 {
	margin-left: 1.6rem
}
.ms-sm-1-7, .mx-sm-1-7 {
	margin-left: 1.7rem
}
.ms-sm-1-8, .mx-sm-1-8 {
	margin-left: 1.8rem
}
.ms-sm-1-9, .mx-sm-1-9 {
	margin-left: 1.9rem
}
.ms-sm-2-0, .mx-sm-2-0 {
	margin-left: 2.0rem
}
.ms-sm-2-1, .mx-sm-2-1 {
	margin-left: 2.1rem
}
.ms-sm-2-2, .mx-sm-2-2 {
	margin-left: 2.2rem
}
.ms-sm-2-3, .mx-sm-2-3 {
	margin-left: 2.3rem
}
.ms-sm-2-4, .mx-sm-2-4 {
	margin-left: 2.4rem
}
.ms-sm-2-5, .mx-sm-2-5 {
	margin-left: 2.5rem
}
.ms-sm-2-6, .mx-sm-2-6 {
	margin-left: 2.6rem
}
.ms-sm-2-7, .mx-sm-2-7 {
	margin-left: 2.7rem
}
.ms-sm-2-8, .mx-sm-2-8 {
	margin-left: 2.8rem
}
.ms-sm-2-9, .mx-sm-2-9 {
	margin-left: 2.9rem
}
.ms-sm-6, .mx-sm-6 {
	margin-left: 3.5rem
}
.ms-sm-7, .mx-sm-7 {
	margin-left: 4rem
}
.ms-sm-8, .mx-sm-8 {
	margin-left: 4.5rem
}
.ms-sm-9, .mx-sm-9 {
	margin-left: 5rem
}
.ms-sm-10, .mx-sm-10 {
	margin-left: 5.5rem
}
.ms-sm-11, .mx-sm-11 {
	margin-left: 6rem
}
.ms-sm-12, .mx-sm-12 {
	margin-left: 6.5rem
}
.ms-sm-13, .mx-sm-13 {
	margin-left: 7rem
}
.ms-sm-14, .mx-sm-14 {
	margin-left: 7.5rem
}
.ms-sm-15, .mx-sm-15 {
	margin-left: 8rem
}
.ms-sm-16, .mx-sm-16 {
	margin-left: 8.5rem
}
.ms-sm-17, .mx-sm-17 {
	margin-left: 9rem
}
.ms-sm-18, .mx-sm-18 {
	margin-left: 9.5rem
}
.ms-sm-19, .mx-sm-19 {
	margin-left: 10rem
}
.ms-sm-20, .mx-sm-20 {
	margin-left: 10.5rem
}
.ms-sm-21, .mx-sm-21 {
	margin-left: 11rem
}
.ms-sm-22, .mx-sm-22 {
	margin-left: 11.5rem
}
.ms-sm-23, .mx-sm-23 {
	margin-left: 12rem
}
.ms-sm-24, .mx-sm-24 {
	margin-left: 12.5rem
}
.me-sm-1-6, .mx-sm-1-6 {
	margin-right: 1.6rem
}
.me-sm-1-7, .mx-sm-1-7 {
	margin-right: 1.7rem
}
.me-sm-1-8, .mx-sm-1-8 {
	margin-right: 1.8rem
}
.me-sm-1-9, .mx-sm-1-9 {
	margin-right: 1.9rem
}
.me-sm-2-0, .mx-sm-2-0 {
	margin-right: 2.0rem
}
.me-sm-2-1, .mx-sm-2-1 {
	margin-right: 2.1rem
}
.me-sm-2-2, .mx-sm-2-2 {
	margin-right: 2.2rem
}
.me-sm-2-3, .mx-sm-2-3 {
	margin-right: 2.3rem
}
.me-sm-2-4, .mx-sm-2-4 {
	margin-right: 2.4rem
}
.me-sm-2-5, .mx-sm-2-5 {
	margin-right: 2.5rem
}
.me-sm-2-6, .mx-sm-2-6 {
	margin-right: 2.6rem
}
.me-sm-2-7, .mx-sm-2-7 {
	margin-right: 2.7rem
}
.me-sm-2-8, .mx-sm-2-8 {
	margin-right: 2.8rem
}
.me-sm-2-9, .mx-sm-2-9 {
	margin-right: 2.9rem
}
.me-sm-6, .mx-sm-6 {
	margin-right: 3.5rem
}
.me-sm-7, .mx-sm-7 {
	margin-right: 4rem
}
.me-sm-8, .mx-sm-8 {
	margin-right: 4.5rem
}
.me-sm-9, .mx-sm-9 {
	margin-right: 5rem
}
.me-sm-10, .mx-sm-10 {
	margin-right: 5.5rem
}
.me-sm-11, .mx-sm-11 {
	margin-right: 6rem
}
.me-sm-12, .mx-sm-12 {
	margin-right: 6.5rem
}
.me-sm-13, .mx-sm-13 {
	margin-right: 7rem
}
.me-sm-14, .mx-sm-14 {
	margin-right: 7.5rem
}
.me-sm-15, .mx-sm-15 {
	margin-right: 8rem
}
.me-sm-16, .mx-sm-16 {
	margin-right: 8.5rem
}
.me-sm-17, .mx-sm-17 {
	margin-right: 9rem
}
.me-sm-18, .mx-sm-18 {
	margin-right: 9.5rem
}
.me-sm-19, .mx-sm-19 {
	margin-right: 10rem
}
.me-sm-20, .mx-sm-20 {
	margin-right: 10.5rem
}
.me-sm-21, .mx-sm-21 {
	margin-right: 11rem
}
.me-sm-22, .mx-sm-22 {
	margin-right: 11.5rem
}
.me-sm-23, .mx-sm-23 {
	margin-right: 12rem
}
.me-sm-24, .mx-sm-24 {
	margin-right: 12.5rem
}
.p-sm-1-6 {
	padding: 1.6rem
}
.p-sm-1-7 {
	padding: 1.7rem
}
.p-sm-1-8 {
	padding: 1.8rem
}
.p-sm-1-9 {
	padding: 1.9rem
}
.p-sm-2-0 {
	padding: 2.0rem
}
.p-sm-2-1 {
	padding: 2.1rem
}
.p-sm-2-2 {
	padding: 2.2rem
}
.p-sm-2-3 {
	padding: 2.3rem
}
.p-sm-2-4 {
	padding: 2.4rem
}
.p-sm-2-5 {
	padding: 2.5rem
}
.p-sm-2-6 {
	padding: 2.6rem
}
.p-sm-2-7 {
	padding: 2.7rem
}
.p-sm-2-8 {
	padding: 2.8rem
}
.p-sm-2-9 {
	padding: 2.9rem
}
.p-sm-6 {
	padding: 3.5rem
}
.p-sm-7 {
	padding: 4rem
}
.p-sm-8 {
	padding: 4.5rem
}
.p-sm-9 {
	padding: 5rem
}
.p-sm-10 {
	padding: 5.5rem
}
.p-sm-11 {
	padding: 6rem
}
.p-sm-12 {
	padding: 6.5rem
}
.p-sm-13 {
	padding: 7rem
}
.p-sm-14 {
	padding: 7.5rem
}
.p-sm-15 {
	padding: 8rem
}
.p-sm-16 {
	padding: 8.5rem
}
.p-sm-17 {
	padding: 9rem
}
.p-sm-18 {
	padding: 9.5rem
}
.p-sm-19 {
	padding: 10rem
}
.p-sm-20 {
	padding: 10.5rem
}
.p-sm-21 {
	padding: 11rem
}
.p-sm-22 {
	padding: 11.5rem
}
.p-sm-23 {
	padding: 12rem
}
.p-sm-24 {
	padding: 12.5rem
}
.pt-sm-1-6, .py-sm-1-6 {
	padding-top: 1.6rem
}
.pt-sm-1-7, .py-sm-1-7 {
	padding-top: 1.7rem
}
.pt-sm-1-8, .py-sm-1-8 {
	padding-top: 1.8rem
}
.pt-sm-1-9, .py-sm-1-9 {
	padding-top: 1.9rem
}
.pt-sm-2-0, .py-sm-2-0 {
	padding-top: 2.0rem
}
.pt-sm-2-1, .py-sm-2-1 {
	padding-top: 2.1rem
}
.pt-sm-2-2, .py-sm-2-2 {
	padding-top: 2.2rem
}
.pt-sm-2-3, .py-sm-2-3 {
	padding-top: 2.3rem
}
.pt-sm-2-4, .py-sm-2-4 {
	padding-top: 2.4rem
}
.pt-sm-2-5, .py-sm-2-5 {
	padding-top: 2.5rem
}
.pt-sm-2-6, .py-sm-2-6 {
	padding-top: 2.6rem
}
.pt-sm-2-7, .py-sm-2-7 {
	padding-top: 2.7rem
}
.pt-sm-2-8, .py-sm-2-8 {
	padding-top: 2.8rem
}
.pt-sm-2-9, .py-sm-2-9 {
	padding-top: 2.9rem
}
.pt-sm-6, .py-sm-6 {
	padding-top: 3.5rem
}
.pt-sm-7, .py-sm-7 {
	padding-top: 4rem
}
.pt-sm-8, .py-sm-8 {
	padding-top: 4.5rem
}
.pt-sm-9, .py-sm-9 {
	padding-top: 5rem
}
.pt-sm-10, .py-sm-10 {
	padding-top: 5.5rem
}
.pt-sm-11, .py-sm-11 {
	padding-top: 6rem
}
.pt-sm-12, .py-sm-12 {
	padding-top: 6.5rem
}
.pt-sm-13, .py-sm-13 {
	padding-top: 7rem
}
.pt-sm-14, .py-sm-14 {
	padding-top: 7.5rem
}
.pt-sm-15, .py-sm-15 {
	padding-top: 8rem
}
.pt-sm-16, .py-sm-16 {
	padding-top: 8.5rem
}
.pt-sm-17, .py-sm-17 {
	padding-top: 9rem
}
.pt-sm-18, .py-sm-18 {
	padding-top: 9.5rem
}
.pt-sm-19, .py-sm-19 {
	padding-top: 10rem
}
.pt-sm-20, .py-sm-20 {
	padding-top: 10.5rem
}
.pt-sm-21, .py-sm-21 {
	padding-top: 11rem
}
.pt-sm-22, .py-sm-22 {
	padding-top: 11.5rem
}
.pt-sm-23, .py-sm-23 {
	padding-top: 12rem
}
.pt-sm-24, .py-sm-24 {
	padding-top: 12.5rem
}
.pb-sm-1-6, .py-sm-1-6 {
	padding-bottom: 1.6rem
}
.pb-sm-1-7, .py-sm-1-7 {
	padding-bottom: 1.7rem
}
.pb-sm-1-8, .py-sm-1-8 {
	padding-bottom: 1.8rem
}
.pb-sm-1-9, .py-sm-1-9 {
	padding-bottom: 1.9rem
}
.pb-sm-2-0, .py-sm-2-0 {
	padding-bottom: 2.0rem
}
.pb-sm-2-1, .py-sm-2-1 {
	padding-bottom: 2.1rem
}
.pb-sm-2-2, .py-sm-2-2 {
	padding-bottom: 2.2rem
}
.pb-sm-2-3, .py-sm-2-3 {
	padding-bottom: 2.3rem
}
.pb-sm-2-4, .py-sm-2-4 {
	padding-bottom: 2.4rem
}
.pb-sm-2-5, .py-sm-2-5 {
	padding-bottom: 2.5rem
}
.pb-sm-2-6, .py-sm-2-6 {
	padding-bottom: 2.6rem
}
.pb-sm-2-7, .py-sm-2-7 {
	padding-bottom: 2.7rem
}
.pb-sm-2-8, .py-sm-2-8 {
	padding-bottom: 2.8rem
}
.pb-sm-2-9, .py-sm-2-9 {
	padding-bottom: 2.9rem
}
.pb-sm-6, .py-sm-6 {
	padding-bottom: 3.5rem
}
.pb-sm-7, .py-sm-7 {
	padding-bottom: 4rem
}
.pb-sm-8, .py-sm-8 {
	padding-bottom: 4.5rem
}
.pb-sm-9, .py-sm-9 {
	padding-bottom: 5rem
}
.pb-sm-10, .py-sm-10 {
	padding-bottom: 5.5rem
}
.pb-sm-11, .py-sm-11 {
	padding-bottom: 6rem
}
.pb-sm-12, .py-sm-12 {
	padding-bottom: 6.5rem
}
.pb-sm-13, .py-sm-13 {
	padding-bottom: 7rem
}
.pb-sm-14, .py-sm-14 {
	padding-bottom: 7.5rem
}
.pb-sm-15, .py-sm-15 {
	padding-bottom: 8rem
}
.pb-sm-16, .py-sm-16 {
	padding-bottom: 8.5rem
}
.pb-sm-17, .py-sm-17 {
	padding-bottom: 9rem
}
.pb-sm-18, .py-sm-18 {
	padding-bottom: 9.5rem
}
.pb-sm-19, .py-sm-19 {
	padding-bottom: 10rem
}
.pb-sm-20, .py-sm-20 {
	padding-bottom: 10.5rem
}
.pb-sm-21, .py-sm-21 {
	padding-bottom: 11rem
}
.pb-sm-22, .py-sm-22 {
	padding-bottom: 11.5rem
}
.pb-sm-23, .py-sm-23 {
	padding-bottom: 12rem
}
.pb-sm-24, .py-sm-24 {
	padding-bottom: 12.5rem
}
.ps-sm-1-6, .px-sm-1-6 {
	padding-left: 1.6rem
}
.ps-sm-1-7, .px-sm-1-7 {
	padding-left: 1.7rem
}
.ps-sm-1-8, .px-sm-1-8 {
	padding-left: 1.8rem
}
.ps-sm-1-9, .px-sm-1-9 {
	padding-left: 1.9rem
}
.ps-sm-2-0, .px-sm-2-0 {
	padding-left: 2.0rem
}
.ps-sm-2-1, .px-sm-2-1 {
	padding-left: 2.1rem
}
.ps-sm-2-2, .px-sm-2-2 {
	padding-left: 2.2rem
}
.ps-sm-2-3, .px-sm-2-3 {
	padding-left: 2.3rem
}
.ps-sm-2-4, .px-sm-2-4 {
	padding-left: 2.4rem
}
.ps-sm-2-5, .px-sm-2-5 {
	padding-left: 2.5rem
}
.ps-sm-2-6, .px-sm-2-6 {
	padding-left: 2.6rem
}
.ps-sm-2-7, .px-sm-2-7 {
	padding-left: 2.7rem
}
.ps-sm-2-8, .px-sm-2-8 {
	padding-left: 2.8rem
}
.ps-sm-2-9, .px-sm-2-9 {
	padding-left: 2.9rem
}
.ps-sm-6, .px-sm-6 {
	padding-left: 3.5rem
}
.ps-sm-7, .px-sm-7 {
	padding-left: 4rem
}
.ps-sm-8, .px-sm-8 {
	padding-left: 4.5rem
}
.ps-sm-9, .px-sm-9 {
	padding-left: 5rem
}
.ps-sm-10, .px-sm-10 {
	padding-left: 5.5rem
}
.ps-sm-11, .px-sm-11 {
	padding-left: 6rem
}
.ps-sm-12, .px-sm-12 {
	padding-left: 6.5rem
}
.ps-sm-13, .px-sm-13 {
	padding-left: 7rem
}
.ps-sm-14, .px-sm-14 {
	padding-left: 7.5rem
}
.ps-sm-15, .px-sm-15 {
	padding-left: 8rem
}
.ps-sm-16, .px-sm-16 {
	padding-left: 8.5rem
}
.ps-sm-17, .px-sm-17 {
	padding-left: 9rem
}
.ps-sm-18, .px-sm-18 {
	padding-left: 9.5rem
}
.ps-sm-19, .px-sm-19 {
	padding-left: 10rem
}
.ps-sm-20, .px-sm-20 {
	padding-left: 10.5rem
}
.ps-sm-21, .px-sm-21 {
	padding-left: 11rem
}
.ps-sm-22, .px-sm-22 {
	padding-left: 11.5rem
}
.ps-sm-23, .px-sm-23 {
	padding-left: 12rem
}
.ps-sm-24, .px-sm-24 {
	padding-left: 12.5rem
}
.pe-sm-1-6, .px-sm-1-6 {
	padding-right: 1.6rem
}
.pe-sm-1-7, .px-sm-1-7 {
	padding-right: 1.7rem
}
.pe-sm-1-8, .px-sm-1-8 {
	padding-right: 1.8rem
}
.pe-sm-1-9, .px-sm-1-9 {
	padding-right: 1.9rem
}
.pe-sm-2-0, .px-sm-2-0 {
	padding-right: 2.0rem
}
.pe-sm-2-1, .px-sm-2-1 {
	padding-right: 2.1rem
}
.pe-sm-2-2, .px-sm-2-2 {
	padding-right: 2.2rem
}
.pe-sm-2-3, .px-sm-2-3 {
	padding-right: 2.3rem
}
.pe-sm-2-4, .px-sm-2-4 {
	padding-right: 2.4rem
}
.pe-sm-2-5, .px-sm-2-5 {
	padding-right: 2.5rem
}
.pe-sm-2-6, .px-sm-2-6 {
	padding-right: 2.6rem
}
.pe-sm-2-7, .px-sm-2-7 {
	padding-right: 2.7rem
}
.pe-sm-2-8, .px-sm-2-8 {
	padding-right: 2.8rem
}
.pe-sm-2-9, .px-sm-2-9 {
	padding-right: 2.9rem
}
.pe-sm-6, .px-sm-6 {
	padding-right: 3.5rem
}
.pe-sm-7, .px-sm-7 {
	padding-right: 4rem
}
.pe-sm-8, .px-sm-8 {
	padding-right: 4.5rem
}
.pe-sm-9, .px-sm-9 {
	padding-right: 5rem
}
.pe-sm-10, .px-sm-10 {
	padding-right: 5.5rem
}
.pe-sm-11, .px-sm-11 {
	padding-right: 6rem
}
.pe-sm-12, .px-sm-12 {
	padding-right: 6.5rem
}
.pe-sm-13, .px-sm-13 {
	padding-right: 7rem
}
.pe-sm-14, .px-sm-14 {
	padding-right: 7.5rem
}
.pe-sm-15, .px-sm-15 {
	padding-right: 8rem
}
.pe-sm-16, .px-sm-16 {
	padding-right: 8.5rem
}
.pe-sm-17, .px-sm-17 {
	padding-right: 9rem
}
.pe-sm-18, .px-sm-18 {
	padding-right: 9.5rem
}
.pe-sm-19, .px-sm-19 {
	padding-right: 10rem
}
.pe-sm-20, .px-sm-20 {
	padding-right: 10.5rem
}
.pe-sm-21, .px-sm-21 {
	padding-right: 11rem
}
.pe-sm-22, .px-sm-22 {
	padding-right: 11.5rem
}
.pe-sm-23, .px-sm-23 {
	padding-right: 12rem
}
.pe-sm-24, .px-sm-24 {
	padding-right: 12.5rem
}
}

@media screen and (min-width: 768px) {
.w-md-1px {
	width: 1px
}
.w-md-2px {
	width: 2px
}
.w-md-3px {
	width: 3px
}
.w-md-4px {
	width: 4px
}
.w-md-5px {
	width: 5px
}
.w-md-6px {
	width: 6px
}
.w-md-7px {
	width: 7px
}
.w-md-8px {
	width: 8px
}
.w-md-9px {
	width: 9px
}
.w-md-10px {
	width: 10px
}
.w-md-15px {
	width: 15px
}
.w-md-20px {
	width: 20px
}
.w-md-25px {
	width: 25px
}
.w-md-30px {
	width: 30px
}
.w-md-35px {
	width: 35px
}
.w-md-40px {
	width: 40px
}
.w-md-50px {
	width: 50px
}
.w-md-55px {
	width: 55px
}
.w-md-60px {
	width: 60px
}
.w-md-65px {
	width: 65px
}
.w-md-70px {
	width: 70px
}
.w-md-75px {
	width: 75px
}
.w-md-80px {
	width: 80px
}
.w-md-85px {
	width: 85px
}
.w-md-90px {
	width: 90px
}
.w-md-100px {
	width: 100px
}
.w-md-1 {
	width: 1%
}
.w-md-2 {
	width: 2%
}
.w-md-3 {
	width: 3%
}
.w-md-4 {
	width: 4%
}
.w-md-5 {
	width: 5%
}
.w-md-6 {
	width: 6%
}
.w-md-7 {
	width: 7%
}
.w-md-8 {
	width: 8%
}
.w-md-9 {
	width: 9%
}
.w-md-10 {
	width: 10%
}
.w-md-11 {
	width: 10%
}
.w-md-12 {
	width: 12%
}
.w-md-13 {
	width: 13%
}
.w-md-14 {
	width: 14%
}
.w-md-15 {
	width: 15%
}
.w-md-20 {
	width: 20%
}
.w-md-25 {
	width: 25%
}
.w-md-30 {
	width: 30%
}
.w-md-35 {
	width: 35%
}
.w-md-40 {
	width: 40%
}
.w-md-45 {
	width: 45%
}
.w-md-50 {
	width: 50%
}
.w-md-55 {
	width: 55%
}
.w-md-60 {
	width: 60%
}
.w-md-65 {
	width: 65%
}
.w-md-70 {
	width: 70%
}
.w-md-75 {
	width: 75%
}
.w-md-80 {
	width: 80%
}
.w-md-85 {
	width: 85%
}
.w-md-90 {
	width: 90%
}
.w-md-95 {
	width: 95%
}
.w-md-100 {
	width: 100%
}
.w-md-auto {
	width: auto
}
.display-md-1 {
	font-size: 6rem
}
.display-md-2 {
	font-size: 5.5rem
}
.display-md-3 {
	font-size: 4.5rem
}
.display-md-4 {
	font-size: 3.5rem
}
.display-md-5 {
	font-size: 3.4rem
}
.display-md-6 {
	font-size: 3.3rem
}
.display-md-7 {
	font-size: 3.2rem
}
.display-md-8 {
	font-size: 3.1rem
}
.display-md-9 {
	font-size: 3.0rem
}
.display-md-10 {
	font-size: 2.9rem
}
.display-md-11 {
	font-size: 2.8rem
}
.display-md-12 {
	font-size: 2.7rem
}
.display-md-13 {
	font-size: 2.6rem
}
.display-md-14 {
	font-size: 2.5rem
}
.display-md-15 {
	font-size: 2.4rem
}
.display-md-16 {
	font-size: 2.3rem
}
.display-md-17 {
	font-size: 2.2rem
}
.display-md-18 {
	font-size: 2.1rem
}
.display-md-19 {
	font-size: 2.0rem
}
.display-md-20 {
	font-size: 1.9rem
}
.display-md-21 {
	font-size: 1.8rem
}
.display-md-22 {
	font-size: 1.7rem
}
.display-md-23 {
	font-size: 1.6rem
}
.display-md-24 {
	font-size: 1.5rem
}
.display-md-25 {
	font-size: 1.4rem
}
.display-md-26 {
	font-size: 1.3rem
}
.display-md-27 {
	font-size: 1.2rem
}
.display-md-28 {
	font-size: 1.1rem
}
.display-md-29 {
	font-size: 1.0rem
}
.display-md-30 {
	font-size: 0.9rem
}
.display-md-31 {
	font-size: 0.8rem
}
.display-md-32 {
	font-size: 0.7rem
}
.display-md-33 {
	font-size: 0.6rem
}
.display-md-34 {
	font-size: 0.5rem
}
.border-md-0 {
	border: none
}
.border-md {
	border: 1px solid #dee2e6
}
.border-md-top {
	border-top: 1px solid #dee2e6
}
.border-md-end {
	border-right: 1px solid #dee2e6
}
.border-md-bottom {
	border-bottom: 1px solid #dee2e6
}
.border-md-start {
	border-left: 1px solid #dee2e6
}
.border-md-top-0 {
	border-top: none
}
.border-md-end-0 {
	border-right: none
}
.border-md-bottom-0 {
	border-bottom: none
}
.border-md-start-0 {
	border-left: none
}
.border-md-color-light-white {
	border-color: rgba(255,255,255,0.1) !important
}
.rounded-md {
	border-radius: .25rem
}
.top-md-5 {
	top: 5%;
	bottom: inherit
}
.top-md-10 {
	top: 10%;
	bottom: inherit
}
.top-md-15 {
	top: 15%;
	bottom: inherit
}
.top-md-20 {
	top: 20%;
	bottom: inherit
}
.top-md-25 {
	top: 25%;
	bottom: inherit
}
.top-md-30 {
	top: 30%;
	bottom: inherit
}
.top-md-35 {
	top: 35%;
	bottom: inherit
}
.top-md-40 {
	top: 40%;
	bottom: inherit
}
.top-md-45 {
	top: 45%;
	bottom: inherit
}
.top-md-50 {
	top: 50%;
	bottom: inherit
}
.top-md-55 {
	top: 55%;
	bottom: inherit
}
.top-md-60 {
	top: 60%;
	bottom: inherit
}
.top-md-65 {
	top: 65%;
	bottom: inherit
}
.top-md-70 {
	top: 70%;
	bottom: inherit
}
.top-md-75 {
	top: 75%;
	bottom: inherit
}
.top-md-80 {
	top: 80%;
	bottom: inherit
}
.top-md-85 {
	top: 85%;
	bottom: inherit
}
.top-md-90 {
	top: 90%;
	bottom: inherit
}
.top-md-95 {
	top: 95%;
	bottom: inherit
}
.top-md-100 {
	top: 100%;
	bottom: inherit
}
.top-md-n5 {
	top: -5%;
	bottom: inherit
}
.top-md-n10 {
	top: -10%;
	bottom: inherit
}
.top-md-n15 {
	top: -15%;
	bottom: inherit
}
.top-md-n20 {
	top: -20%;
	bottom: inherit
}
.top-md-n25 {
	top: -25%;
	bottom: inherit
}
.top-md-n30 {
	top: -30%;
	bottom: inherit
}
.top-md-n35 {
	top: -35%;
	bottom: inherit
}
.top-md-n40 {
	top: -40%;
	bottom: inherit
}
.top-md-n45 {
	top: -45%;
	bottom: inherit
}
.top-md-n50 {
	top: -50%;
	bottom: inherit
}
.top-md-n55 {
	top: -55%;
	bottom: inherit
}
.top-md-n60 {
	top: -60%;
	bottom: inherit
}
.top-md-n65 {
	top: -65%;
	bottom: inherit
}
.top-md-n70 {
	top: -70%;
	bottom: inherit
}
.top-md-n75 {
	top: -75%;
	bottom: inherit
}
.top-md-n80 {
	top: -80%;
	bottom: inherit
}
.top-md-n85 {
	top: -85%;
	bottom: inherit
}
.top-md-n90 {
	top: -90%;
	bottom: inherit
}
.top-md-n95 {
	top: -95%;
	bottom: inherit
}
.top-md-n100 {
	top: -100%;
	bottom: inherit
}
.bottom-md-5 {
	bottom: 5%;
	top: inherit
}
.bottom-md-10 {
	bottom: 10%;
	top: inherit
}
.bottom-md-15 {
	bottom: 15%;
	top: inherit
}
.bottom-md-20 {
	bottom: 20%;
	top: inherit
}
.bottom-md-25 {
	bottom: 25%;
	top: inherit
}
.bottom-md-30 {
	bottom: 30%;
	top: inherit
}
.bottom-md-35 {
	bottom: 35%;
	top: inherit
}
.bottom-md-40 {
	bottom: 40%;
	top: inherit
}
.bottom-md-45 {
	bottom: 45%;
	top: inherit
}
.bottom-md-50 {
	bottom: 50%;
	top: inherit
}
.bottom-md-55 {
	bottom: 55%;
	top: inherit
}
.bottom-md-60 {
	bottom: 60%;
	top: inherit
}
.bottom-md-65 {
	bottom: 65%;
	top: inherit
}
.bottom-md-70 {
	bottom: 70%;
	top: inherit
}
.bottom-md-75 {
	bottom: 75%;
	top: inherit
}
.bottom-md-80 {
	bottom: 80%;
	top: inherit
}
.bottom-md-85 {
	bottom: 85%;
	top: inherit
}
.bottom-md-90 {
	bottom: 90%;
	top: inherit
}
.bottom-md-95 {
	bottom: 95%;
	top: inherit
}
.bottom-md-100 {
	bottom: 100%;
	top: inherit
}
.bottom-md-n5 {
	bottom: -5%;
	top: inherit
}
.bottom-md-n10 {
	bottom: -10%;
	top: inherit
}
.bottom-md-n15 {
	bottom: -15%;
	top: inherit
}
.bottom-md-n20 {
	bottom: -20%;
	top: inherit
}
.bottom-md-n25 {
	bottom: -25%;
	top: inherit
}
.bottom-md-n30 {
	bottom: -30%;
	top: inherit
}
.bottom-md-n35 {
	bottom: -35%;
	top: inherit
}
.bottom-md-n40 {
	bottom: -40%;
	top: inherit
}
.bottom-md-n45 {
	bottom: -45%;
	top: inherit
}
.bottom-md-n50 {
	bottom: -50%;
	top: inherit
}
.bottom-md-n55 {
	bottom: -55%;
	top: inherit
}
.bottom-md-n60 {
	bottom: -60%;
	top: inherit
}
.bottom-md-n65 {
	bottom: -65%;
	top: inherit
}
.bottom-md-n70 {
	bottom: -70%;
	top: inherit
}
.bottom-md-n75 {
	bottom: -75%;
	top: inherit
}
.bottom-md-n80 {
	bottom: -80%;
	top: inherit
}
.bottom-md-n85 {
	bottom: -85%;
	top: inherit
}
.bottom-md-n90 {
	bottom: -90%;
	top: inherit
}
.bottom-md-n95 {
	bottom: -95%;
	top: inherit
}
.bottom-md-n100 {
	bottom: -100%;
	top: inherit
}
.left-md-5 {
	left: 5%;
	right: inherit
}
.left-md-10 {
	left: 10%;
	right: inherit
}
.left-md-15 {
	left: 15%;
	right: inherit
}
.left-md-20 {
	left: 20%;
	right: inherit
}
.left-md-25 {
	left: 25%;
	right: inherit
}
.left-md-30 {
	left: 30%;
	right: inherit
}
.left-md-35 {
	left: 35%;
	right: inherit
}
.left-md-40 {
	left: 40%;
	right: inherit
}
.left-md-45 {
	left: 45%;
	right: inherit
}
.left-md-50 {
	left: 50%;
	right: inherit
}
.left-md-55 {
	left: 55%;
	right: inherit
}
.left-md-60 {
	left: 60%;
	right: inherit
}
.left-md-65 {
	left: 65%;
	right: inherit
}
.left-md-70 {
	left: 70%;
	right: inherit
}
.left-md-75 {
	left: 75%;
	right: inherit
}
.left-md-80 {
	left: 80%;
	right: inherit
}
.left-md-85 {
	left: 85%;
	right: inherit
}
.left-md-90 {
	left: 90%;
	right: inherit
}
.left-md-95 {
	left: 95%;
	right: inherit
}
.left-md-100 {
	left: 100%;
	right: inherit
}
.left-md-n5 {
	left: -5%;
	right: inherit
}
.left-md-n10 {
	left: -10%;
	right: inherit
}
.left-md-n15 {
	left: -15%;
	right: inherit
}
.left-md-n20 {
	left: -20%;
	right: inherit
}
.left-md-n25 {
	left: -25%;
	right: inherit
}
.left-md-n30 {
	left: -30%;
	right: inherit
}
.left-md-n35 {
	left: -35%;
	right: inherit
}
.left-md-n40 {
	left: -40%;
	right: inherit
}
.left-md-n45 {
	left: -45%;
	right: inherit
}
.left-md-n50 {
	left: -50%;
	right: inherit
}
.left-md-n55 {
	left: -55%;
	right: inherit
}
.left-md-n60 {
	left: -60%;
	right: inherit
}
.left-md-n65 {
	left: -65%;
	right: inherit
}
.left-md-n70 {
	left: -70%;
	right: inherit
}
.left-md-n75 {
	left: -75%;
	right: inherit
}
.left-md-n80 {
	left: -80%;
	right: inherit
}
.left-md-n85 {
	left: -85%;
	right: inherit
}
.left-md-n90 {
	left: -90%;
	right: inherit
}
.left-md-n95 {
	left: -95%;
	right: inherit
}
.left-md-n100 {
	left: -100%;
	right: inherit
}
.right-md-5 {
	right: 5%;
	left: inherit
}
.right-md-10 {
	right: 10%;
	left: inherit
}
.right-md-15 {
	right: 15%;
	left: inherit
}
.right-md-20 {
	right: 20%;
	left: inherit
}
.right-md-25 {
	right: 25%;
	left: inherit
}
.right-md-30 {
	right: 30%;
	left: inherit
}
.right-md-35 {
	right: 35%;
	left: inherit
}
.right-md-40 {
	right: 40%;
	left: inherit
}
.right-md-45 {
	right: 45%;
	left: inherit
}
.right-md-50 {
	right: 50%;
	left: inherit
}
.right-md-55 {
	right: 55%;
	left: inherit
}
.right-md-60 {
	right: 60%;
	left: inherit
}
.right-md-65 {
	right: 65%;
	left: inherit
}
.right-md-70 {
	right: 70%;
	left: inherit
}
.right-md-75 {
	right: 75%;
	left: inherit
}
.right-md-80 {
	right: 80%;
	left: inherit
}
.right-md-85 {
	right: 85%;
	left: inherit
}
.right-md-90 {
	right: 90%;
	left: inherit
}
.right-md-95 {
	right: 95%;
	left: inherit
}
.right-md-100 {
	right: 100%;
	left: inherit
}
.right-md-n5 {
	right: -5%;
	left: inherit
}
.right-md-n10 {
	right: -10%;
	left: inherit
}
.right-md-n15 {
	right: -15%;
	left: inherit
}
.right-md-n20 {
	right: -20%;
	left: inherit
}
.right-md-n25 {
	right: -25%;
	left: inherit
}
.right-md-n30 {
	right: -30%;
	left: inherit
}
.right-md-n35 {
	right: -35%;
	left: inherit
}
.right-md-n40 {
	right: -40%;
	left: inherit
}
.right-md-n45 {
	right: -45%;
	left: inherit
}
.right-md-n50 {
	right: -50%;
	left: inherit
}
.right-md-n55 {
	right: -55%;
	left: inherit
}
.right-md-n60 {
	right: -60%;
	left: inherit
}
.right-md-n65 {
	right: -65%;
	left: inherit
}
.right-md-n70 {
	right: -70%;
	left: inherit
}
.right-md-n75 {
	right: -75%;
	left: inherit
}
.right-md-n80 {
	right: -80%;
	left: inherit
}
.right-md-n85 {
	right: -85%;
	left: inherit
}
.right-md-n90 {
	right: -90%;
	left: inherit
}
.right-md-n95 {
	right: -95%;
	left: inherit
}
.right-md-n100 {
	right: -100%;
	left: inherit
}
.m-md-1-6 {
	margin: 1.6rem
}
.m-md-1-7 {
	margin: 1.7rem
}
.m-md-1-8 {
	margin: 1.8rem
}
.m-md-1-9 {
	margin: 1.9rem
}
.m-md-2-0 {
	margin: 2.0rem
}
.m-md-2-1 {
	margin: 2.1rem
}
.m-md-2-2 {
	margin: 2.2rem
}
.m-md-2-3 {
	margin: 2.3rem
}
.m-md-2-4 {
	margin: 2.4rem
}
.m-md-2-5 {
	margin: 2.5rem
}
.m-md-2-6 {
	margin: 2.6rem
}
.m-md-2-7 {
	margin: 2.7rem
}
.m-md-2-8 {
	margin: 2.8rem
}
.m-md-2-9 {
	margin: 2.9rem
}
.m-md-6 {
	margin: 3.5rem
}
.m-md-7 {
	margin: 4rem
}
.m-md-8 {
	margin: 4.5rem
}
.m-md-9 {
	margin: 5rem
}
.m-md-10 {
	margin: 5.5rem
}
.m-md-11 {
	margin: 6rem
}
.m-md-12 {
	margin: 6.5rem
}
.m-md-13 {
	margin: 7rem
}
.m-md-14 {
	margin: 7.5rem
}
.m-md-15 {
	margin: 8rem
}
.m-md-16 {
	margin: 8.5rem
}
.m-md-17 {
	margin: 9rem
}
.m-md-18 {
	margin: 9.5rem
}
.m-md-19 {
	margin: 10rem
}
.m-md-20 {
	margin: 10.5rem
}
.m-md-21 {
	margin: 11rem
}
.m-md-22 {
	margin: 11.5rem
}
.m-md-23 {
	margin: 12rem
}
.m-md-24 {
	margin: 12.5rem
}
.mt-md-1-6, .my-md-1-6 {
	margin-top: 1.6rem
}
.mt-md-1-7, .my-md-1-7 {
	margin-top: 1.7rem
}
.mt-md-1-8, .my-md-1-8 {
	margin-top: 1.8rem
}
.mt-md-1-9, .my-md-1-9 {
	margin-top: 1.9rem
}
.mt-md-2-0, .my-md-2-0 {
	margin-top: 2.0rem
}
.mt-md-2-1, .my-md-2-1 {
	margin-top: 2.1rem
}
.mt-md-2-2, .my-md-2-2 {
	margin-top: 2.2rem
}
.mt-md-2-3, .my-md-2-3 {
	margin-top: 2.3rem
}
.mt-md-2-4, .my-md-2-4 {
	margin-top: 2.4rem
}
.mt-md-2-5, .my-md-2-5 {
	margin-top: 2.5rem
}
.mt-md-2-6, .my-md-2-6 {
	margin-top: 2.6rem
}
.mt-md-2-7, .my-md-2-7 {
	margin-top: 2.7rem
}
.mt-md-2-8, .my-md-2-8 {
	margin-top: 2.8rem
}
.mt-md-2-9, .my-md-2-9 {
	margin-top: 2.9rem
}
.mt-md-6, .my-md-6 {
	margin-top: 3.5rem
}
.mt-md-7, .my-md-7 {
	margin-top: 4rem
}
.mt-md-8, .my-md-8 {
	margin-top: 4.5rem
}
.mt-md-9, .my-md-9 {
	margin-top: 5rem
}
.mt-md-10, .my-md-10 {
	margin-top: 5.5rem
}
.mt-md-11, .my-md-11 {
	margin-top: 6rem
}
.mt-md-12, .my-md-12 {
	margin-top: 6.5rem
}
.mt-md-13, .my-md-13 {
	margin-top: 7rem
}
.mt-md-14, .my-md-14 {
	margin-top: 7.5rem
}
.mt-md-15, .my-md-15 {
	margin-top: 8rem
}
.mt-md-16, .my-md-16 {
	margin-top: 8.5rem
}
.mt-md-17, .my-md-17 {
	margin-top: 9rem
}
.mt-md-18, .my-md-18 {
	margin-top: 9.5rem
}
.mt-md-19, .my-md-19 {
	margin-top: 10rem
}
.mt-md-20, .my-md-20 {
	margin-top: 10.5rem
}
.mt-md-21, .my-md-21 {
	margin-top: 11rem
}
.mt-md-22, .my-md-22 {
	margin-top: 11.5rem
}
.mt-md-23, .my-md-23 {
	margin-top: 12rem
}
.mt-md-24, .my-md-24 {
	margin-top: 12.5rem
}
.mb-md-1-6, .my-md-1-6 {
	margin-bottom: 1.6rem
}
.mb-md-1-7, .my-md-1-7 {
	margin-bottom: 1.7rem
}
.mb-md-1-8, .my-md-1-8 {
	margin-bottom: 1.8rem
}
.mb-md-1-9, .my-md-1-9 {
	margin-bottom: 1.9rem
}
.mb-md-2-0, .my-md-2-0 {
	margin-bottom: 2.0rem
}
.mb-md-2-1, .my-md-2-1 {
	margin-bottom: 2.1rem
}
.mb-md-2-2, .my-md-2-2 {
	margin-bottom: 2.2rem
}
.mb-md-2-3, .my-md-2-3 {
	margin-bottom: 2.3rem
}
.mb-md-2-4, .my-md-2-4 {
	margin-bottom: 2.4rem
}
.mb-md-2-5, .my-md-2-5 {
	margin-bottom: 2.5rem
}
.mb-md-2-6, .my-md-2-6 {
	margin-bottom: 2.6rem
}
.mb-md-2-7, .my-md-2-7 {
	margin-bottom: 2.7rem
}
.mb-md-2-8, .my-md-2-8 {
	margin-bottom: 2.8rem
}
.mb-md-2-9, .my-md-2-9 {
	margin-bottom: 2.9rem
}
.mb-md-6, .my-md-6 {
	margin-bottom: 3.5rem
}
.mb-md-7, .my-md-7 {
	margin-bottom: 4rem
}
.mb-md-8, .my-md-8 {
	margin-bottom: 4.5rem
}
.mb-md-9, .my-md-9 {
	margin-bottom: 5rem
}
.mb-md-10, .my-md-10 {
	margin-bottom: 5.5rem
}
.mb-md-11, .my-md-11 {
	margin-bottom: 6rem
}
.mb-md-12, .my-md-12 {
	margin-bottom: 6.5rem
}
.mb-md-13, .my-md-13 {
	margin-bottom: 7rem
}
.mb-md-14, .my-md-14 {
	margin-bottom: 7.5rem
}
.mb-md-15, .my-md-15 {
	margin-bottom: 8rem
}
.mb-md-16, .my-md-16 {
	margin-bottom: 8.5rem
}
.mb-md-17, .my-md-17 {
	margin-bottom: 9rem
}
.mb-md-18, .my-md-18 {
	margin-bottom: 9.5rem
}
.mb-md-19, .my-md-19 {
	margin-bottom: 10rem
}
.mb-md-20, .my-md-20 {
	margin-bottom: 10.5rem
}
.mb-md-21, .my-md-21 {
	margin-bottom: 11rem
}
.mb-md-22, .my-md-22 {
	margin-bottom: 11.5rem
}
.mb-md-23, .my-md-23 {
	margin-bottom: 12rem
}
.mb-md-24, .my-md-24 {
	margin-bottom: 12.5rem
}
.ms-md-1-6, .mx-md-1-6 {
	margin-left: 1.6rem
}
.ms-md-1-7, .mx-md-1-7 {
	margin-left: 1.7rem
}
.ms-md-1-8, .mx-md-1-8 {
	margin-left: 1.8rem
}
.ms-md-1-9, .mx-md-1-9 {
	margin-left: 1.9rem
}
.ms-md-2-0, .mx-md-2-0 {
	margin-left: 2.0rem
}
.ms-md-2-1, .mx-md-2-1 {
	margin-left: 2.1rem
}
.ms-md-2-2, .mx-md-2-2 {
	margin-left: 2.2rem
}
.ms-md-2-3, .mx-md-2-3 {
	margin-left: 2.3rem
}
.ms-md-2-4, .mx-md-2-4 {
	margin-left: 2.4rem
}
.ms-md-2-5, .mx-md-2-5 {
	margin-left: 2.5rem
}
.ms-md-2-6, .mx-md-2-6 {
	margin-left: 2.6rem
}
.ms-md-2-7, .mx-md-2-7 {
	margin-left: 2.7rem
}
.ms-md-2-8, .mx-md-2-8 {
	margin-left: 2.8rem
}
.ms-md-2-9, .mx-md-2-9 {
	margin-left: 2.9rem
}
.ms-md-6, .mx-md-6 {
	margin-left: 3.5rem
}
.ms-md-7, .mx-md-7 {
	margin-left: 4rem
}
.ms-md-8, .mx-md-8 {
	margin-left: 4.5rem
}
.ms-md-9, .mx-md-9 {
	margin-left: 5rem
}
.ms-md-10, .mx-md-10 {
	margin-left: 5.5rem
}
.ms-md-11, .mx-md-11 {
	margin-left: 6rem
}
.ms-md-12, .mx-md-12 {
	margin-left: 6.5rem
}
.ms-md-13, .mx-md-13 {
	margin-left: 7rem
}
.ms-md-14, .mx-md-14 {
	margin-left: 7.5rem
}
.ms-md-15, .mx-md-15 {
	margin-left: 8rem
}
.ms-md-16, .mx-md-16 {
	margin-left: 8.5rem
}
.ms-md-17, .mx-md-17 {
	margin-left: 9rem
}
.ms-md-18, .mx-md-18 {
	margin-left: 9.5rem
}
.ms-md-19, .mx-md-19 {
	margin-left: 10rem
}
.ms-md-20, .mx-md-20 {
	margin-left: 10.5rem
}
.ms-md-21, .mx-md-21 {
	margin-left: 11rem
}
.ms-md-22, .mx-md-22 {
	margin-left: 11.5rem
}
.ms-md-23, .mx-md-23 {
	margin-left: 12rem
}
.ms-md-24, .mx-md-24 {
	margin-left: 12.5rem
}
.me-md-1-6, .mx-md-1-6 {
	margin-right: 1.6rem
}
.me-md-1-7, .mx-md-1-7 {
	margin-right: 1.7rem
}
.me-md-1-8, .mx-md-1-8 {
	margin-right: 1.8rem
}
.me-md-1-9, .mx-md-1-9 {
	margin-right: 1.9rem
}
.me-md-2-0, .mx-md-2-0 {
	margin-right: 2.0rem
}
.me-md-2-1, .mx-md-2-1 {
	margin-right: 2.1rem
}
.me-md-2-2, .mx-md-2-2 {
	margin-right: 2.2rem
}
.me-md-2-3, .mx-md-2-3 {
	margin-right: 2.3rem
}
.me-md-2-4, .mx-md-2-4 {
	margin-right: 2.4rem
}
.me-md-2-5, .mx-md-2-5 {
	margin-right: 2.5rem
}
.me-md-2-6, .mx-md-2-6 {
	margin-right: 2.6rem
}
.me-md-2-7, .mx-md-2-7 {
	margin-right: 2.7rem
}
.me-md-2-8, .mx-md-2-8 {
	margin-right: 2.8rem
}
.me-md-2-9, .mx-md-2-9 {
	margin-right: 2.9rem
}
.me-md-6, .mx-md-6 {
	margin-right: 3.5rem
}
.me-md-7, .mx-md-7 {
	margin-right: 4rem
}
.me-md-8, .mx-md-8 {
	margin-right: 4.5rem
}
.me-md-9, .mx-md-9 {
	margin-right: 5rem
}
.me-md-10, .mx-md-10 {
	margin-right: 5.5rem
}
.me-md-11, .mx-md-11 {
	margin-right: 6rem
}
.me-md-12, .mx-md-12 {
	margin-right: 6.5rem
}
.me-md-13, .mx-md-13 {
	margin-right: 7rem
}
.me-md-14, .mx-md-14 {
	margin-right: 7.5rem
}
.me-md-15, .mx-md-15 {
	margin-right: 8rem
}
.me-md-16, .mx-md-16 {
	margin-right: 8.5rem
}
.me-md-17, .mx-md-17 {
	margin-right: 9rem
}
.me-md-18, .mx-md-18 {
	margin-right: 9.5rem
}
.me-md-19, .mx-md-19 {
	margin-right: 10rem
}
.me-md-20, .mx-md-20 {
	margin-right: 10.5rem
}
.me-md-21, .mx-md-21 {
	margin-right: 11rem
}
.me-md-22, .mx-md-22 {
	margin-right: 11.5rem
}
.me-md-23, .mx-md-23 {
	margin-right: 12rem
}
.me-md-24, .mx-md-24 {
	margin-right: 12.5rem
}
.p-md-1-6 {
	padding: 1.6rem
}
.p-md-1-7 {
	padding: 1.7rem
}
.p-md-1-8 {
	padding: 1.8rem
}
.p-md-1-9 {
	padding: 1.9rem
}
.p-md-2-0 {
	padding: 2.0rem
}
.p-md-2-1 {
	padding: 2.1rem
}
.p-md-2-2 {
	padding: 2.2rem
}
.p-md-2-3 {
	padding: 2.3rem
}
.p-md-2-4 {
	padding: 2.4rem
}
.p-md-2-5 {
	padding: 2.5rem
}
.p-md-2-6 {
	padding: 2.6rem
}
.p-md-2-7 {
	padding: 2.7rem
}
.p-md-2-8 {
	padding: 2.8rem
}
.p-md-2-9 {
	padding: 2.9rem
}
.p-md-6 {
	padding: 3.5rem
}
.p-md-7 {
	padding: 4rem
}
.p-md-8 {
	padding: 4.5rem
}
.p-md-9 {
	padding: 5rem
}
.p-md-10 {
	padding: 5.5rem
}
.p-md-11 {
	padding: 6rem
}
.p-md-12 {
	padding: 6.5rem
}
.p-md-13 {
	padding: 7rem
}
.p-md-14 {
	padding: 7.5rem
}
.p-md-15 {
	padding: 8rem
}
.p-md-16 {
	padding: 8.5rem
}
.p-md-17 {
	padding: 9rem
}
.p-md-18 {
	padding: 9.5rem
}
.p-md-19 {
	padding: 10rem
}
.p-md-20 {
	padding: 10.5rem
}
.p-md-21 {
	padding: 11rem
}
.p-md-22 {
	padding: 11.5rem
}
.p-md-23 {
	padding: 12rem
}
.p-md-24 {
	padding: 12.5rem
}
.pt-md-1-6, .py-md-1-6 {
	padding-top: 1.6rem
}
.pt-md-1-7, .py-md-1-7 {
	padding-top: 1.7rem
}
.pt-md-1-8, .py-md-1-8 {
	padding-top: 1.8rem
}
.pt-md-1-9, .py-md-1-9 {
	padding-top: 1.9rem
}
.pt-md-2-0, .py-md-2-0 {
	padding-top: 2.0rem
}
.pt-md-2-1, .py-md-2-1 {
	padding-top: 2.1rem
}
.pt-md-2-2, .py-md-2-2 {
	padding-top: 2.2rem
}
.pt-md-2-3, .py-md-2-3 {
	padding-top: 2.3rem
}
.pt-md-2-4, .py-md-2-4 {
	padding-top: 2.4rem
}
.pt-md-2-5, .py-md-2-5 {
	padding-top: 2.5rem
}
.pt-md-2-6, .py-md-2-6 {
	padding-top: 2.6rem
}
.pt-md-2-7, .py-md-2-7 {
	padding-top: 2.7rem
}
.pt-md-2-8, .py-md-2-8 {
	padding-top: 2.8rem
}
.pt-md-2-9, .py-md-2-9 {
	padding-top: 2.9rem
}
.pt-md-6, .py-md-6 {
	padding-top: 3.5rem
}
.pt-md-7, .py-md-7 {
	padding-top: 4rem
}
.pt-md-8, .py-md-8 {
	padding-top: 4.5rem
}
.pt-md-9, .py-md-9 {
	padding-top: 5rem
}
.pt-md-10, .py-md-10 {
	padding-top: 5.5rem
}
.pt-md-11, .py-md-11 {
	padding-top: 6rem
}
.pt-md-12, .py-md-12 {
	padding-top: 6.5rem
}
.pt-md-13, .py-md-13 {
	padding-top: 7rem
}
.pt-md-14, .py-md-14 {
	padding-top: 7.5rem
}
.pt-md-15, .py-md-15 {
	padding-top: 8rem
}
.pt-md-16, .py-md-16 {
	padding-top: 8.5rem
}
.pt-md-17, .py-md-17 {
	padding-top: 9rem
}
.pt-md-18, .py-md-18 {
	padding-top: 9.5rem
}
.pt-md-19, .py-md-19 {
	padding-top: 10rem
}
.pt-md-20, .py-md-20 {
	padding-top: 10.5rem
}
.pt-md-21, .py-md-21 {
	padding-top: 11rem
}
.pt-md-22, .py-md-22 {
	padding-top: 11.5rem
}
.pt-md-23, .py-md-23 {
	padding-top: 12rem
}
.pt-md-24, .py-md-24 {
	padding-top: 12.5rem
}
.pb-md-1-6, .py-md-1-6 {
	padding-bottom: 1.6rem
}
.pb-md-1-7, .py-md-1-7 {
	padding-bottom: 1.7rem
}
.pb-md-1-8, .py-md-1-8 {
	padding-bottom: 1.8rem
}
.pb-md-1-9, .py-md-1-9 {
	padding-bottom: 1.9rem
}
.pb-md-2-0, .py-md-2-0 {
	padding-bottom: 2.0rem
}
.pb-md-2-1, .py-md-2-1 {
	padding-bottom: 2.1rem
}
.pb-md-2-2, .py-md-2-2 {
	padding-bottom: 2.2rem
}
.pb-md-2-3, .py-md-2-3 {
	padding-bottom: 2.3rem
}
.pb-md-2-4, .py-md-2-4 {
	padding-bottom: 2.4rem
}
.pb-md-2-5, .py-md-2-5 {
	padding-bottom: 2.5rem
}
.pb-md-2-6, .py-md-2-6 {
	padding-bottom: 2.6rem
}
.pb-md-2-7, .py-md-2-7 {
	padding-bottom: 2.7rem
}
.pb-md-2-8, .py-md-2-8 {
	padding-bottom: 2.8rem
}
.pb-md-2-9, .py-md-2-9 {
	padding-bottom: 2.9rem
}
.pb-md-6, .py-md-6 {
	padding-bottom: 3.5rem
}
.pb-md-7, .py-md-7 {
	padding-bottom: 4rem
}
.pb-md-8, .py-md-8 {
	padding-bottom: 4.5rem
}
.pb-md-9, .py-md-9 {
	padding-bottom: 5rem
}
.pb-md-10, .py-md-10 {
	padding-bottom: 5.5rem
}
.pb-md-11, .py-md-11 {
	padding-bottom: 6rem
}
.pb-md-12, .py-md-12 {
	padding-bottom: 6.5rem
}
.pb-md-13, .py-md-13 {
	padding-bottom: 7rem
}
.pb-md-14, .py-md-14 {
	padding-bottom: 7.5rem
}
.pb-md-15, .py-md-15 {
	padding-bottom: 8rem
}
.pb-md-16, .py-md-16 {
	padding-bottom: 8.5rem
}
.pb-md-17, .py-md-17 {
	padding-bottom: 9rem
}
.pb-md-18, .py-md-18 {
	padding-bottom: 9.5rem
}
.pb-md-19, .py-md-19 {
	padding-bottom: 10rem
}
.pb-md-20, .py-md-20 {
	padding-bottom: 10.5rem
}
.pb-md-21, .py-md-21 {
	padding-bottom: 11rem
}
.pb-md-22, .py-md-22 {
	padding-bottom: 11.5rem
}
.pb-md-23, .py-md-23 {
	padding-bottom: 12rem
}
.pb-md-24, .py-md-24 {
	padding-bottom: 12.5rem
}
.ps-md-1-6, .px-md-1-6 {
	padding-left: 1.6rem
}
.ps-md-1-7, .px-md-1-7 {
	padding-left: 1.7rem
}
.ps-md-1-8, .px-md-1-8 {
	padding-left: 1.8rem
}
.ps-md-1-9, .px-md-1-9 {
	padding-left: 1.9rem
}
.ps-md-2-0, .px-md-2-0 {
	padding-left: 2.0rem
}
.ps-md-2-1, .px-md-2-1 {
	padding-left: 2.1rem
}
.ps-md-2-2, .px-md-2-2 {
	padding-left: 2.2rem
}
.ps-md-2-3, .px-md-2-3 {
	padding-left: 2.3rem
}
.ps-md-2-4, .px-md-2-4 {
	padding-left: 2.4rem
}
.ps-md-2-5, .px-md-2-5 {
	padding-left: 2.5rem
}
.ps-md-2-6, .px-md-2-6 {
	padding-left: 2.6rem
}
.ps-md-2-7, .px-md-2-7 {
	padding-left: 2.7rem
}
.ps-md-2-8, .px-md-2-8 {
	padding-left: 2.8rem
}
.ps-md-2-9, .px-md-2-9 {
	padding-left: 2.9rem
}
.ps-md-6, .px-md-6 {
	padding-left: 3.5rem
}
.ps-md-7, .px-md-7 {
	padding-left: 4rem
}
.ps-md-8, .px-md-8 {
	padding-left: 4.5rem
}
.ps-md-9, .px-md-9 {
	padding-left: 5rem
}
.ps-md-10, .px-md-10 {
	padding-left: 5.5rem
}
.ps-md-11, .px-md-11 {
	padding-left: 6rem
}
.ps-md-12, .px-md-12 {
	padding-left: 6.5rem
}
.ps-md-13, .px-md-13 {
	padding-left: 7rem
}
.ps-md-14, .px-md-14 {
	padding-left: 7.5rem
}
.ps-md-15, .px-md-15 {
	padding-left: 8rem
}
.ps-md-16, .px-md-16 {
	padding-left: 8.5rem
}
.ps-md-17, .px-md-17 {
	padding-left: 9rem
}
.ps-md-18, .px-md-18 {
	padding-left: 9.5rem
}
.ps-md-19, .px-md-19 {
	padding-left: 10rem
}
.ps-md-20, .px-md-20 {
	padding-left: 10.5rem
}
.ps-md-21, .px-md-21 {
	padding-left: 11rem
}
.ps-md-22, .px-md-22 {
	padding-left: 11.5rem
}
.ps-md-23, .px-md-23 {
	padding-left: 12rem
}
.ps-md-24, .px-md-24 {
	padding-left: 12.5rem
}
.pe-md-1-6, .px-md-1-6 {
	padding-right: 1.6rem
}
.pe-md-1-7, .px-md-1-7 {
	padding-right: 1.7rem
}
.pe-md-1-8, .px-md-1-8 {
	padding-right: 1.8rem
}
.pe-md-1-9, .px-md-1-9 {
	padding-right: 1.9rem
}
.pe-md-2-0, .px-md-2-0 {
	padding-right: 2.0rem
}
.pe-md-2-1, .px-md-2-1 {
	padding-right: 2.1rem
}
.pe-md-2-2, .px-md-2-2 {
	padding-right: 2.2rem
}
.pe-md-2-3, .px-md-2-3 {
	padding-right: 2.3rem
}
.pe-md-2-4, .px-md-2-4 {
	padding-right: 2.4rem
}
.pe-md-2-5, .px-md-2-5 {
	padding-right: 2.5rem
}
.pe-md-2-6, .px-md-2-6 {
	padding-right: 2.6rem
}
.pe-md-2-7, .px-md-2-7 {
	padding-right: 2.7rem
}
.pe-md-2-8, .px-md-2-8 {
	padding-right: 2.8rem
}
.pe-md-2-9, .px-md-2-9 {
	padding-right: 2.9rem
}
.pe-md-6, .px-md-6 {
	padding-right: 3.5rem
}
.pe-md-7, .px-md-7 {
	padding-right: 4rem
}
.pe-md-8, .px-md-8 {
	padding-right: 4.5rem
}
.pe-md-9, .px-md-9 {
	padding-right: 5rem
}
.pe-md-10, .px-md-10 {
	padding-right: 5.5rem
}
.pe-md-11, .px-md-11 {
	padding-right: 6rem
}
.pe-md-12, .px-md-12 {
	padding-right: 6.5rem
}
.pe-md-13, .px-md-13 {
	padding-right: 7rem
}
.pe-md-14, .px-md-14 {
	padding-right: 7.5rem
}
.pe-md-15, .px-md-15 {
	padding-right: 8rem
}
.pe-md-16, .px-md-16 {
	padding-right: 8.5rem
}
.pe-md-17, .px-md-17 {
	padding-right: 9rem
}
.pe-md-18, .px-md-18 {
	padding-right: 9.5rem
}
.pe-md-19, .px-md-19 {
	padding-right: 10rem
}
.pe-md-20, .px-md-20 {
	padding-right: 10.5rem
}
.pe-md-21, .px-md-21 {
	padding-right: 11rem
}
.pe-md-22, .px-md-22 {
	padding-right: 11.5rem
}
.pe-md-23, .px-md-23 {
	padding-right: 12rem
}
.pe-md-24, .px-md-24 {
	padding-right: 12.5rem
}
}

@media screen and (min-width: 992px) {
.w-lg-1px {
	width: 1px
}
.w-lg-2px {
	width: 2px
}
.w-lg-3px {
	width: 3px
}
.w-lg-4px {
	width: 4px
}
.w-lg-5px {
	width: 5px
}
.w-lg-6px {
	width: 6px
}
.w-lg-7px {
	width: 7px
}
.w-lg-8px {
	width: 8px
}
.w-lg-9px {
	width: 9px
}
.w-lg-10px {
	width: 10px
}
.w-lg-15px {
	width: 15px
}
.w-lg-20px {
	width: 20px
}
.w-lg-25px {
	width: 25px
}
.w-lg-30px {
	width: 30px
}
.w-lg-35px {
	width: 35px
}
.w-lg-40px {
	width: 40px
}
.w-lg-50px {
	width: 50px
}
.w-lg-55px {
	width: 55px
}
.w-lg-60px {
	width: 60px
}
.w-lg-65px {
	width: 65px
}
.w-lg-70px {
	width: 70px
}
.w-lg-75px {
	width: 75px
}
.w-lg-80px {
	width: 80px
}
.w-lg-85px {
	width: 85px
}
.w-lg-90px {
	width: 90px
}
.w-lg-100px {
	width: 100px
}
.w-lg-1 {
	width: 1%
}
.w-lg-2 {
	width: 2%
}
.w-lg-3 {
	width: 3%
}
.w-lg-4 {
	width: 4%
}
.w-lg-5 {
	width: 5%
}
.w-lg-6 {
	width: 6%
}
.w-lg-7 {
	width: 7%
}
.w-lg-8 {
	width: 8%
}
.w-lg-9 {
	width: 9%
}
.w-lg-10 {
	width: 10%
}
.w-lg-11 {
	width: 10%
}
.w-lg-12 {
	width: 12%
}
.w-lg-13 {
	width: 13%
}
.w-lg-14 {
	width: 14%
}
.w-lg-15 {
	width: 15%
}
.w-lg-20 {
	width: 20%
}
.w-lg-25 {
	width: 25%
}
.w-lg-30 {
	width: 30%
}
.w-lg-35 {
	width: 35%
}
.w-lg-40 {
	width: 40%
}
.w-lg-45 {
	width: 45%
}
.w-lg-50 {
	width: 50%
}
.w-lg-55 {
	width: 55%
}
.w-lg-60 {
	width: 60%
}
.w-lg-65 {
	width: 65%
}
.w-lg-70 {
	width: 70%
}
.w-lg-75 {
	width: 75%
}
.w-lg-80 {
	width: 80%
}
.w-lg-85 {
	width: 85%
}
.w-lg-90 {
	width: 90%
}
.w-lg-95 {
	width: 95%
}
.w-lg-100 {
	width: 100%
}
.w-lg-auto {
	width: auto
}
.display-lg-1 {
	font-size: 6rem
}
.display-lg-2 {
	font-size: 5.5rem
}
.display-lg-3 {
	font-size: 4.5rem
}
.display-lg-4 {
	font-size: 3.5rem
}
.display-lg-5 {
	font-size: 3.4rem
}
.display-lg-6 {
	font-size: 3.3rem
}
.display-lg-7 {
	font-size: 3.2rem
}
.display-lg-8 {
	font-size: 3.1rem
}
.display-lg-9 {
	font-size: 3.0rem
}
.display-lg-10 {
	font-size: 2.9rem
}
.display-lg-11 {
	font-size: 2.8rem
}
.display-lg-12 {
	font-size: 2.7rem
}
.display-lg-13 {
	font-size: 2.6rem
}
.display-lg-14 {
	font-size: 2.5rem
}
.display-lg-15 {
	font-size: 2.4rem
}
.display-lg-16 {
	font-size: 2.3rem
}
.display-lg-17 {
	font-size: 2.2rem
}
.display-lg-18 {
	font-size: 2.1rem
}
.display-lg-19 {
	font-size: 2.0rem
}
.display-lg-20 {
	font-size: 1.9rem
}
.display-lg-21 {
	font-size: 1.8rem
}
.display-lg-22 {
	font-size: 1.7rem
}
.display-lg-23 {
	font-size: 1.6rem
}
.display-lg-24 {
	font-size: 1.5rem
}
.display-lg-25 {
	font-size: 1.4rem
}
.display-lg-26 {
	font-size: 1.3rem
}
.display-lg-27 {
	font-size: 1.2rem
}
.display-lg-28 {
	font-size: 1.1rem
}
.display-lg-29 {
	font-size: 1.0rem
}
.display-lg-30 {
	font-size: 0.9rem
}
.display-lg-31 {
	font-size: 0.8rem
}
.display-lg-32 {
	font-size: 0.7rem
}
.display-lg-33 {
	font-size: 0.6rem
}
.display-lg-34 {
	font-size: 0.5rem
}
.border-lg-0 {
	border: none
}
.border-lg {
	border: 1px solid #dee2e6
}
.border-lg-top {
	border-top: 1px solid #dee2e6
}
.border-lg-end {
	border-right: 1px solid #dee2e6
}
.border-lg-bottom {
	border-bottom: 1px solid #dee2e6
}
.border-lg-start {
	border-left: 1px solid #dee2e6
}
.border-lg-top-0 {
	border-top: none
}
.border-lg-end-0 {
	border-right: none
}
.border-lg-bottom-0 {
	border-bottom: none
}
.border-lg-start-0 {
	border-left: none
}
.border-lg-color-light-white {
	border-color: rgba(255,255,255,0.1) !important
}
.rounded-lg {
	border-radius: .25rem
}
.border-radius-lg-10 {
	border-radius: 10px
}
.rounded-lg-circle {
	border-radius: 50%
}
.top-lg-5 {
	top: 5%;
	bottom: inherit
}
.top-lg-10 {
	top: 10%;
	bottom: inherit
}
.top-lg-15 {
	top: 15%;
	bottom: inherit
}
.top-lg-20 {
	top: 20%;
	bottom: inherit
}
.top-lg-25 {
	top: 25%;
	bottom: inherit
}
.top-lg-30 {
	top: 30%;
	bottom: inherit
}
.top-lg-35 {
	top: 35%;
	bottom: inherit
}
.top-lg-40 {
	top: 40%;
	bottom: inherit
}
.top-lg-45 {
	top: 45%;
	bottom: inherit
}
.top-lg-50 {
	top: 50%;
	bottom: inherit
}
.top-lg-55 {
	top: 55%;
	bottom: inherit
}
.top-lg-60 {
	top: 60%;
	bottom: inherit
}
.top-lg-65 {
	top: 65%;
	bottom: inherit
}
.top-lg-70 {
	top: 70%;
	bottom: inherit
}
.top-lg-75 {
	top: 75%;
	bottom: inherit
}
.top-lg-80 {
	top: 80%;
	bottom: inherit
}
.top-lg-85 {
	top: 85%;
	bottom: inherit
}
.top-lg-90 {
	top: 90%;
	bottom: inherit
}
.top-lg-95 {
	top: 95%;
	bottom: inherit
}
.top-lg-100 {
	top: 100%;
	bottom: inherit
}
.top-lg-n5 {
	top: -5%;
	bottom: inherit
}
.top-lg-n10 {
	top: -10%;
	bottom: inherit
}
.top-lg-n15 {
	top: -15%;
	bottom: inherit
}
.top-lg-n20 {
	top: -20%;
	bottom: inherit
}
.top-lg-n25 {
	top: -25%;
	bottom: inherit
}
.top-lg-n30 {
	top: -30%;
	bottom: inherit
}
.top-lg-n35 {
	top: -35%;
	bottom: inherit
}
.top-lg-n40 {
	top: -40%;
	bottom: inherit
}
.top-lg-n45 {
	top: -45%;
	bottom: inherit
}
.top-lg-n50 {
	top: -50%;
	bottom: inherit
}
.top-lg-n55 {
	top: -55%;
	bottom: inherit
}
.top-lg-n60 {
	top: -60%;
	bottom: inherit
}
.top-lg-n65 {
	top: -65%;
	bottom: inherit
}
.top-lg-n70 {
	top: -70%;
	bottom: inherit
}
.top-lg-n75 {
	top: -75%;
	bottom: inherit
}
.top-lg-n80 {
	top: -80%;
	bottom: inherit
}
.top-lg-n85 {
	top: -85%;
	bottom: inherit
}
.top-lg-n90 {
	top: -90%;
	bottom: inherit
}
.top-lg-n95 {
	top: -95%;
	bottom: inherit
}
.top-lg-n100 {
	top: -100%;
	bottom: inherit
}
.bottom-lg-5 {
	bottom: 5%;
	top: inherit
}
.bottom-lg-10 {
	bottom: 10%;
	top: inherit
}
.bottom-lg-15 {
	bottom: 15%;
	top: inherit
}
.bottom-lg-20 {
	bottom: 20%;
	top: inherit
}
.bottom-lg-25 {
	bottom: 25%;
	top: inherit
}
.bottom-lg-30 {
	bottom: 30%;
	top: inherit
}
.bottom-lg-35 {
	bottom: 35%;
	top: inherit
}
.bottom-lg-40 {
	bottom: 40%;
	top: inherit
}
.bottom-lg-45 {
	bottom: 45%;
	top: inherit
}
.bottom-lg-50 {
	bottom: 50%;
	top: inherit
}
.bottom-lg-55 {
	bottom: 55%;
	top: inherit
}
.bottom-lg-60 {
	bottom: 60%;
	top: inherit
}
.bottom-lg-65 {
	bottom: 65%;
	top: inherit
}
.bottom-lg-70 {
	bottom: 70%;
	top: inherit
}
.bottom-lg-75 {
	bottom: 75%;
	top: inherit
}
.bottom-lg-80 {
	bottom: 80%;
	top: inherit
}
.bottom-lg-85 {
	bottom: 85%;
	top: inherit
}
.bottom-lg-90 {
	bottom: 90%;
	top: inherit
}
.bottom-lg-95 {
	bottom: 95%;
	top: inherit
}
.bottom-lg-100 {
	bottom: 100%;
	top: inherit
}
.bottom-lg-n5 {
	bottom: -5%;
	top: inherit
}
.bottom-lg-n10 {
	bottom: -10%;
	top: inherit
}
.bottom-lg-n15 {
	bottom: -15%;
	top: inherit
}
.bottom-lg-n20 {
	bottom: -20%;
	top: inherit
}
.bottom-lg-n25 {
	bottom: -25%;
	top: inherit
}
.bottom-lg-n30 {
	bottom: -30%;
	top: inherit
}
.bottom-lg-n35 {
	bottom: -35%;
	top: inherit
}
.bottom-lg-n40 {
	bottom: -40%;
	top: inherit
}
.bottom-lg-n45 {
	bottom: -45%;
	top: inherit
}
.bottom-lg-n50 {
	bottom: -50%;
	top: inherit
}
.bottom-lg-n55 {
	bottom: -55%;
	top: inherit
}
.bottom-lg-n60 {
	bottom: -60%;
	top: inherit
}
.bottom-lg-n65 {
	bottom: -65%;
	top: inherit
}
.bottom-lg-n70 {
	bottom: -70%;
	top: inherit
}
.bottom-lg-n75 {
	bottom: -75%;
	top: inherit
}
.bottom-lg-n80 {
	bottom: -80%;
	top: inherit
}
.bottom-lg-n85 {
	bottom: -85%;
	top: inherit
}
.bottom-lg-n90 {
	bottom: -90%;
	top: inherit
}
.bottom-lg-n95 {
	bottom: -95%;
	top: inherit
}
.bottom-lg-n100 {
	bottom: -100%;
	top: inherit
}
.left-lg-5 {
	left: 5%;
	right: inherit
}
.left-lg-10 {
	left: 10%;
	right: inherit
}
.left-lg-15 {
	left: 15%;
	right: inherit
}
.left-lg-20 {
	left: 20%;
	right: inherit
}
.left-lg-25 {
	left: 25%;
	right: inherit
}
.left-lg-30 {
	left: 30%;
	right: inherit
}
.left-lg-35 {
	left: 35%;
	right: inherit
}
.left-lg-40 {
	left: 40%;
	right: inherit
}
.left-lg-45 {
	left: 45%;
	right: inherit
}
.left-lg-50 {
	left: 50%;
	right: inherit
}
.left-lg-55 {
	left: 55%;
	right: inherit
}
.left-lg-60 {
	left: 60%;
	right: inherit
}
.left-lg-65 {
	left: 65%;
	right: inherit
}
.left-lg-70 {
	left: 70%;
	right: inherit
}
.left-lg-75 {
	left: 75%;
	right: inherit
}
.left-lg-80 {
	left: 80%;
	right: inherit
}
.left-lg-85 {
	left: 85%;
	right: inherit
}
.left-lg-90 {
	left: 90%;
	right: inherit
}
.left-lg-95 {
	left: 95%;
	right: inherit
}
.left-lg-100 {
	left: 100%;
	right: inherit
}
.left-lg-n5 {
	left: -5%;
	right: inherit
}
.left-lg-n10 {
	left: -10%;
	right: inherit
}
.left-lg-n15 {
	left: -15%;
	right: inherit
}
.left-lg-n20 {
	left: -20%;
	right: inherit
}
.left-lg-n25 {
	left: -25%;
	right: inherit
}
.left-lg-n30 {
	left: -30%;
	right: inherit
}
.left-lg-n35 {
	left: -35%;
	right: inherit
}
.left-lg-n40 {
	left: -40%;
	right: inherit
}
.left-lg-n45 {
	left: -45%;
	right: inherit
}
.left-lg-n50 {
	left: -50%;
	right: inherit
}
.left-lg-n55 {
	left: -55%;
	right: inherit
}
.left-lg-n60 {
	left: -60%;
	right: inherit
}
.left-lg-n65 {
	left: -65%;
	right: inherit
}
.left-lg-n70 {
	left: -70%;
	right: inherit
}
.left-lg-n75 {
	left: -75%;
	right: inherit
}
.left-lg-n80 {
	left: -80%;
	right: inherit
}
.left-lg-n85 {
	left: -85%;
	right: inherit
}
.left-lg-n90 {
	left: -90%;
	right: inherit
}
.left-lg-n95 {
	left: -95%;
	right: inherit
}
.left-lg-n100 {
	left: -100%;
	right: inherit
}
.right-lg-5 {
	right: 5%;
	left: inherit
}
.right-lg-10 {
	right: 10%;
	left: inherit
}
.right-lg-15 {
	right: 15%;
	left: inherit
}
.right-lg-20 {
	right: 20%;
	left: inherit
}
.right-lg-25 {
	right: 25%;
	left: inherit
}
.right-lg-30 {
	right: 30%;
	left: inherit
}
.right-lg-35 {
	right: 35%;
	left: inherit
}
.right-lg-40 {
	right: 40%;
	left: inherit
}
.right-lg-45 {
	right: 45%;
	left: inherit
}
.right-lg-50 {
	right: 50%;
	left: inherit
}
.right-lg-55 {
	right: 55%;
	left: inherit
}
.right-lg-60 {
	right: 60%;
	left: inherit
}
.right-lg-65 {
	right: 65%;
	left: inherit
}
.right-lg-70 {
	right: 70%;
	left: inherit
}
.right-lg-75 {
	right: 75%;
	left: inherit
}
.right-lg-80 {
	right: 80%;
	left: inherit
}
.right-lg-85 {
	right: 85%;
	left: inherit
}
.right-lg-90 {
	right: 90%;
	left: inherit
}
.right-lg-95 {
	right: 95%;
	left: inherit
}
.right-lg-100 {
	right: 100%;
	left: inherit
}
.right-lg-n5 {
	right: -5%;
	left: inherit
}
.right-lg-n10 {
	right: -10%;
	left: inherit
}
.right-lg-n15 {
	right: -15%;
	left: inherit
}
.right-lg-n20 {
	right: -20%;
	left: inherit
}
.right-lg-n25 {
	right: -25%;
	left: inherit
}
.right-lg-n30 {
	right: -30%;
	left: inherit
}
.right-lg-n35 {
	right: -35%;
	left: inherit
}
.right-lg-n40 {
	right: -40%;
	left: inherit
}
.right-lg-n45 {
	right: -45%;
	left: inherit
}
.right-lg-n50 {
	right: -50%;
	left: inherit
}
.right-lg-n55 {
	right: -55%;
	left: inherit
}
.right-lg-n60 {
	right: -60%;
	left: inherit
}
.right-lg-n65 {
	right: -65%;
	left: inherit
}
.right-lg-n70 {
	right: -70%;
	left: inherit
}
.right-lg-n75 {
	right: -75%;
	left: inherit
}
.right-lg-n80 {
	right: -80%;
	left: inherit
}
.right-lg-n85 {
	right: -85%;
	left: inherit
}
.right-lg-n90 {
	right: -90%;
	left: inherit
}
.right-lg-n95 {
	right: -95%;
	left: inherit
}
.right-lg-n100 {
	right: -100%;
	left: inherit
}
.m-lg-1-6 {
	margin: 1.6rem
}
.m-lg-1-7 {
	margin: 1.7rem
}
.m-lg-1-8 {
	margin: 1.8rem
}
.m-lg-1-9 {
	margin: 1.9rem
}
.m-lg-2-0 {
	margin: 2.0rem
}
.m-lg-2-1 {
	margin: 2.1rem
}
.m-lg-2-2 {
	margin: 2.2rem
}
.m-lg-2-3 {
	margin: 2.3rem
}
.m-lg-2-4 {
	margin: 2.4rem
}
.m-lg-2-5 {
	margin: 2.5rem
}
.m-lg-2-6 {
	margin: 2.6rem
}
.m-lg-2-7 {
	margin: 2.7rem
}
.m-lg-2-8 {
	margin: 2.8rem
}
.m-lg-2-9 {
	margin: 2.9rem
}
.m-lg-6 {
	margin: 3.5rem
}
.m-lg-7 {
	margin: 4rem
}
.m-lg-8 {
	margin: 4.5rem
}
.m-lg-9 {
	margin: 5rem
}
.m-lg-10 {
	margin: 5.5rem
}
.m-lg-11 {
	margin: 6rem
}
.m-lg-12 {
	margin: 6.5rem
}
.m-lg-13 {
	margin: 7rem
}
.m-lg-14 {
	margin: 7.5rem
}
.m-lg-15 {
	margin: 8rem
}
.m-lg-16 {
	margin: 8.5rem
}
.m-lg-17 {
	margin: 9rem
}
.m-lg-18 {
	margin: 9.5rem
}
.m-lg-19 {
	margin: 10rem
}
.m-lg-20 {
	margin: 10.5rem
}
.m-lg-21 {
	margin: 11rem
}
.m-lg-22 {
	margin: 11.5rem
}
.m-lg-23 {
	margin: 12rem
}
.m-lg-24 {
	margin: 12.5rem
}
.mt-lg-1-6, .my-lg-1-6 {
	margin-top: 1.6rem
}
.mt-lg-1-7, .my-lg-1-7 {
	margin-top: 1.7rem
}
.mt-lg-1-8, .my-lg-1-8 {
	margin-top: 1.8rem
}
.mt-lg-1-9, .my-lg-1-9 {
	margin-top: 1.9rem
}
.mt-lg-2-0, .my-lg-2-0 {
	margin-top: 2.0rem
}
.mt-lg-2-1, .my-lg-2-1 {
	margin-top: 2.1rem
}
.mt-lg-2-2, .my-lg-2-2 {
	margin-top: 2.2rem
}
.mt-lg-2-3, .my-lg-2-3 {
	margin-top: 2.3rem
}
.mt-lg-2-4, .my-lg-2-4 {
	margin-top: 2.4rem
}
.mt-lg-2-5, .my-lg-2-5 {
	margin-top: 2.5rem
}
.mt-lg-2-6, .my-lg-2-6 {
	margin-top: 2.6rem
}
.mt-lg-2-7, .my-lg-2-7 {
	margin-top: 2.7rem
}
.mt-lg-2-8, .my-lg-2-8 {
	margin-top: 2.8rem
}
.mt-lg-2-9, .my-lg-2-9 {
	margin-top: 2.9rem
}
.mt-lg-6, .my-lg-6 {
	margin-top: 3.5rem
}
.mt-lg-7, .my-lg-7 {
	margin-top: 4rem
}
.mt-lg-8, .my-lg-8 {
	margin-top: 4.5rem
}
.mt-lg-9, .my-lg-9 {
	margin-top: 5rem
}
.mt-lg-10, .my-lg-10 {
	margin-top: 5.5rem
}
.mt-lg-11, .my-lg-11 {
	margin-top: 6rem
}
.mt-lg-12, .my-lg-12 {
	margin-top: 6.5rem
}
.mt-lg-13, .my-lg-13 {
	margin-top: 7rem
}
.mt-lg-14, .my-lg-14 {
	margin-top: 7.5rem
}
.mt-lg-15, .my-lg-15 {
	margin-top: 8rem
}
.mt-lg-16, .my-lg-16 {
	margin-top: 8.5rem
}
.mt-lg-17, .my-lg-17 {
	margin-top: 9rem
}
.mt-lg-18, .my-lg-18 {
	margin-top: 9.5rem
}
.mt-lg-19, .my-lg-19 {
	margin-top: 10rem
}
.mt-lg-20, .my-lg-20 {
	margin-top: 10.5rem
}
.mt-lg-21, .my-lg-21 {
	margin-top: 11rem
}
.mt-lg-22, .my-lg-22 {
	margin-top: 11.5rem
}
.mt-lg-23, .my-lg-23 {
	margin-top: 12rem
}
.mt-lg-24, .my-lg-24 {
	margin-top: 12.5rem
}
.mb-lg-1-6, .my-lg-1-6 {
	margin-bottom: 1.6rem
}
.mb-lg-1-7, .my-lg-1-7 {
	margin-bottom: 1.7rem
}
.mb-lg-1-8, .my-lg-1-8 {
	margin-bottom: 1.8rem
}
.mb-lg-1-9, .my-lg-1-9 {
	margin-bottom: 1.9rem
}
.mb-lg-2-0, .my-lg-2-0 {
	margin-bottom: 2.0rem
}
.mb-lg-2-1, .my-lg-2-1 {
	margin-bottom: 2.1rem
}
.mb-lg-2-2, .my-lg-2-2 {
	margin-bottom: 2.2rem
}
.mb-lg-2-3, .my-lg-2-3 {
	margin-bottom: 2.3rem
}
.mb-lg-2-4, .my-lg-2-4 {
	margin-bottom: 2.4rem
}
.mb-lg-2-5, .my-lg-2-5 {
	margin-bottom: 2.5rem
}
.mb-lg-2-6, .my-lg-2-6 {
	margin-bottom: 2.6rem
}
.mb-lg-2-7, .my-lg-2-7 {
	margin-bottom: 2.7rem
}
.mb-lg-2-8, .my-lg-2-8 {
	margin-bottom: 2.8rem
}
.mb-lg-2-9, .my-lg-2-9 {
	margin-bottom: 2.9rem
}
.mb-lg-6, .my-lg-6 {
	margin-bottom: 3.5rem
}
.mb-lg-7, .my-lg-7 {
	margin-bottom: 4rem
}
.mb-lg-8, .my-lg-8 {
	margin-bottom: 4.5rem
}
.mb-lg-9, .my-lg-9 {
	margin-bottom: 5rem
}
.mb-lg-10, .my-lg-10 {
	margin-bottom: 5.5rem
}
.mb-lg-11, .my-lg-11 {
	margin-bottom: 6rem
}
.mb-lg-12, .my-lg-12 {
	margin-bottom: 6.5rem
}
.mb-lg-13, .my-lg-13 {
	margin-bottom: 7rem
}
.mb-lg-14, .my-lg-14 {
	margin-bottom: 7.5rem
}
.mb-lg-15, .my-lg-15 {
	margin-bottom: 8rem
}
.mb-lg-16, .my-lg-16 {
	margin-bottom: 8.5rem
}
.mb-lg-17, .my-lg-17 {
	margin-bottom: 9rem
}
.mb-lg-18, .my-lg-18 {
	margin-bottom: 9.5rem
}
.mb-lg-19, .my-lg-19 {
	margin-bottom: 10rem
}
.mb-lg-20, .my-lg-20 {
	margin-bottom: 10.5rem
}
.mb-lg-21, .my-lg-21 {
	margin-bottom: 11rem
}
.mb-lg-22, .my-lg-22 {
	margin-bottom: 11.5rem
}
.mb-lg-23, .my-lg-23 {
	margin-bottom: 12rem
}
.mb-lg-24, .my-lg-24 {
	margin-bottom: 12.5rem
}
.ms-lg-1-6, .mx-lg-1-6 {
	margin-left: 1.6rem
}
.ms-lg-1-7, .mx-lg-1-7 {
	margin-left: 1.7rem
}
.ms-lg-1-8, .mx-lg-1-8 {
	margin-left: 1.8rem
}
.ms-lg-1-9, .mx-lg-1-9 {
	margin-left: 1.9rem
}
.ms-lg-2-0, .mx-lg-2-0 {
	margin-left: 2.0rem
}
.ms-lg-2-1, .mx-lg-2-1 {
	margin-left: 2.1rem
}
.ms-lg-2-2, .mx-lg-2-2 {
	margin-left: 2.2rem
}
.ms-lg-2-3, .mx-lg-2-3 {
	margin-left: 2.3rem
}
.ms-lg-2-4, .mx-lg-2-4 {
	margin-left: 2.4rem
}
.ms-lg-2-5, .mx-lg-2-5 {
	margin-left: 2.5rem
}
.ms-lg-2-6, .mx-lg-2-6 {
	margin-left: 2.6rem
}
.ms-lg-2-7, .mx-lg-2-7 {
	margin-left: 2.7rem
}
.ms-lg-2-8, .mx-lg-2-8 {
	margin-left: 2.8rem
}
.ms-lg-2-9, .mx-lg-2-9 {
	margin-left: 2.9rem
}
.ms-lg-6, .mx-lg-6 {
	margin-left: 3.5rem
}
.ms-lg-7, .mx-lg-7 {
	margin-left: 4rem
}
.ms-lg-8, .mx-lg-8 {
	margin-left: 4.5rem
}
.ms-lg-9, .mx-lg-9 {
	margin-left: 5rem
}
.ms-lg-10, .mx-lg-10 {
	margin-left: 5.5rem
}
.ms-lg-11, .mx-lg-11 {
	margin-left: 6rem
}
.ms-lg-12, .mx-lg-12 {
	margin-left: 6.5rem
}
.ms-lg-13, .mx-lg-13 {
	margin-left: 7rem
}
.ms-lg-14, .mx-lg-14 {
	margin-left: 7.5rem
}
.ms-lg-15, .mx-lg-15 {
	margin-left: 8rem
}
.ms-lg-16, .mx-lg-16 {
	margin-left: 8.5rem
}
.ms-lg-17, .mx-lg-17 {
	margin-left: 9rem
}
.ms-lg-18, .mx-lg-18 {
	margin-left: 9.5rem
}
.ms-lg-19, .mx-lg-19 {
	margin-left: 10rem
}
.ms-lg-20, .mx-lg-20 {
	margin-left: 10.5rem
}
.ms-lg-21, .mx-lg-21 {
	margin-left: 11rem
}
.ms-lg-22, .mx-lg-22 {
	margin-left: 11.5rem
}
.ms-lg-23, .mx-lg-23 {
	margin-left: 12rem
}
.ms-lg-24, .mx-lg-24 {
	margin-left: 12.5rem
}
.me-lg-1-6, .mx-lg-1-6 {
	margin-right: 1.6rem
}
.me-lg-1-7, .mx-lg-1-7 {
	margin-right: 1.7rem
}
.me-lg-1-8, .mx-lg-1-8 {
	margin-right: 1.8rem
}
.me-lg-1-9, .mx-lg-1-9 {
	margin-right: 1.9rem
}
.me-lg-2-0, .mx-lg-2-0 {
	margin-right: 2.0rem
}
.me-lg-2-1, .mx-lg-2-1 {
	margin-right: 2.1rem
}
.me-lg-2-2, .mx-lg-2-2 {
	margin-right: 2.2rem
}
.me-lg-2-3, .mx-lg-2-3 {
	margin-right: 2.3rem
}
.me-lg-2-4, .mx-lg-2-4 {
	margin-right: 2.4rem
}
.me-lg-2-5, .mx-lg-2-5 {
	margin-right: 2.5rem
}
.me-lg-2-6, .mx-lg-2-6 {
	margin-right: 2.6rem
}
.me-lg-2-7, .mx-lg-2-7 {
	margin-right: 2.7rem
}
.me-lg-2-8, .mx-lg-2-8 {
	margin-right: 2.8rem
}
.me-lg-2-9, .mx-lg-2-9 {
	margin-right: 2.9rem
}
.me-lg-6, .mx-lg-6 {
	margin-right: 3.5rem
}
.me-lg-7, .mx-lg-7 {
	margin-right: 4rem
}
.me-lg-8, .mx-lg-8 {
	margin-right: 4.5rem
}
.me-lg-9, .mx-lg-9 {
	margin-right: 5rem
}
.me-lg-10, .mx-lg-10 {
	margin-right: 5.5rem
}
.me-lg-11, .mx-lg-11 {
	margin-right: 6rem
}
.me-lg-12, .mx-lg-12 {
	margin-right: 6.5rem
}
.me-lg-13, .mx-lg-13 {
	margin-right: 7rem
}
.me-lg-14, .mx-lg-14 {
	margin-right: 7.5rem
}
.me-lg-15, .mx-lg-15 {
	margin-right: 8rem
}
.me-lg-16, .mx-lg-16 {
	margin-right: 8.5rem
}
.me-lg-17, .mx-lg-17 {
	margin-right: 9rem
}
.me-lg-18, .mx-lg-18 {
	margin-right: 9.5rem
}
.me-lg-19, .mx-lg-19 {
	margin-right: 10rem
}
.me-lg-20, .mx-lg-20 {
	margin-right: 10.5rem
}
.me-lg-21, .mx-lg-21 {
	margin-right: 11rem
}
.me-lg-22, .mx-lg-22 {
	margin-right: 11.5rem
}
.me-lg-23, .mx-lg-23 {
	margin-right: 12rem
}
.me-lg-24, .mx-lg-24 {
	margin-right: 12.5rem
}
.p-lg-1-6 {
	padding: 1.6rem
}
.p-lg-1-7 {
	padding: 1.7rem
}
.p-lg-1-8 {
	padding: 1.8rem
}
.p-lg-1-9 {
	padding: 1.9rem
}
.p-lg-2-0 {
	padding: 2.0rem
}
.p-lg-2-1 {
	padding: 2.1rem
}
.p-lg-2-2 {
	padding: 2.2rem
}
.p-lg-2-3 {
	padding: 2.3rem
}
.p-lg-2-4 {
	padding: 2.4rem
}
.p-lg-2-5 {
	padding: 2.5rem
}
.p-lg-2-6 {
	padding: 2.6rem
}
.p-lg-2-7 {
	padding: 2.7rem
}
.p-lg-2-8 {
	padding: 2.8rem
}
.p-lg-2-9 {
	padding: 2.9rem
}
.p-lg-6 {
	padding: 3.5rem
}
.p-lg-7 {
	padding: 4rem
}
.p-lg-8 {
	padding: 4.5rem
}
.p-lg-9 {
	padding: 5rem
}
.p-lg-10 {
	padding: 5.5rem
}
.p-lg-11 {
	padding: 6rem
}
.p-lg-12 {
	padding: 6.5rem
}
.p-lg-13 {
	padding: 7rem
}
.p-lg-14 {
	padding: 7.5rem
}
.p-lg-15 {
	padding: 8rem
}
.p-lg-16 {
	padding: 8.5rem
}
.p-lg-17 {
	padding: 9rem
}
.p-lg-18 {
	padding: 9.5rem
}
.p-lg-19 {
	padding: 10rem
}
.p-lg-20 {
	padding: 10.5rem
}
.p-lg-21 {
	padding: 11rem
}
.p-lg-22 {
	padding: 11.5rem
}
.p-lg-23 {
	padding: 12rem
}
.p-lg-24 {
	padding: 12.5rem
}
.pt-lg-1-6, .py-lg-1-6 {
	padding-top: 1.6rem
}
.pt-lg-1-7, .py-lg-1-7 {
	padding-top: 1.7rem
}
.pt-lg-1-8, .py-lg-1-8 {
	padding-top: 1.8rem
}
.pt-lg-1-9, .py-lg-1-9 {
	padding-top: 1.9rem
}
.pt-lg-2-0, .py-lg-2-0 {
	padding-top: 2.0rem
}
.pt-lg-2-1, .py-lg-2-1 {
	padding-top: 2.1rem
}
.pt-lg-2-2, .py-lg-2-2 {
	padding-top: 2.2rem
}
.pt-lg-2-3, .py-lg-2-3 {
	padding-top: 2.3rem
}
.pt-lg-2-4, .py-lg-2-4 {
	padding-top: 2.4rem
}
.pt-lg-2-5, .py-lg-2-5 {
	padding-top: 2.5rem
}
.pt-lg-2-6, .py-lg-2-6 {
	padding-top: 2.6rem
}
.pt-lg-2-7, .py-lg-2-7 {
	padding-top: 2.7rem
}
.pt-lg-2-8, .py-lg-2-8 {
	padding-top: 2.8rem
}
.pt-lg-2-9, .py-lg-2-9 {
	padding-top: 2.9rem
}
.pt-lg-6, .py-lg-6 {
	padding-top: 3.5rem
}
.pt-lg-7, .py-lg-7 {
	padding-top: 4rem
}
.pt-lg-8, .py-lg-8 {
	padding-top: 4.5rem
}
.pt-lg-9, .py-lg-9 {
	padding-top: 5rem
}
.pt-lg-10, .py-lg-10 {
	padding-top: 5.5rem
}
.pt-lg-11, .py-lg-11 {
	padding-top: 6rem
}
.pt-lg-12, .py-lg-12 {
	padding-top: 6.5rem
}
.pt-lg-13, .py-lg-13 {
	padding-top: 7rem
}
.pt-lg-14, .py-lg-14 {
	padding-top: 7.5rem
}
.pt-lg-15, .py-lg-15 {
	padding-top: 8rem
}
.pt-lg-16, .py-lg-16 {
	padding-top: 8.5rem
}
.pt-lg-17, .py-lg-17 {
	padding-top: 9rem
}
.pt-lg-18, .py-lg-18 {
	padding-top: 9.5rem
}
.pt-lg-19, .py-lg-19 {
	padding-top: 10rem
}
.pt-lg-20, .py-lg-20 {
	padding-top: 10.5rem
}
.pt-lg-21, .py-lg-21 {
	padding-top: 11rem
}
.pt-lg-22, .py-lg-22 {
	padding-top: 11.5rem
}
.pt-lg-23, .py-lg-23 {
	padding-top: 12rem
}
.pt-lg-24, .py-lg-24 {
	padding-top: 12.5rem
}
.pb-lg-1-6, .py-lg-1-6 {
	padding-bottom: 1.6rem
}
.pb-lg-1-7, .py-lg-1-7 {
	padding-bottom: 1.7rem
}
.pb-lg-1-8, .py-lg-1-8 {
	padding-bottom: 1.8rem
}
.pb-lg-1-9, .py-lg-1-9 {
	padding-bottom: 1.9rem
}
.pb-lg-2-0, .py-lg-2-0 {
	padding-bottom: 2.0rem
}
.pb-lg-2-1, .py-lg-2-1 {
	padding-bottom: 2.1rem
}
.pb-lg-2-2, .py-lg-2-2 {
	padding-bottom: 2.2rem
}
.pb-lg-2-3, .py-lg-2-3 {
	padding-bottom: 2.3rem
}
.pb-lg-2-4, .py-lg-2-4 {
	padding-bottom: 2.4rem
}
.pb-lg-2-5, .py-lg-2-5 {
	padding-bottom: 2.5rem
}
.pb-lg-2-6, .py-lg-2-6 {
	padding-bottom: 2.6rem
}
.pb-lg-2-7, .py-lg-2-7 {
	padding-bottom: 2.7rem
}
.pb-lg-2-8, .py-lg-2-8 {
	padding-bottom: 2.8rem
}
.pb-lg-2-9, .py-lg-2-9 {
	padding-bottom: 2.9rem
}
.pb-lg-6, .py-lg-6 {
	padding-bottom: 3.5rem
}
.pb-lg-7, .py-lg-7 {
	padding-bottom: 4rem
}
.pb-lg-8, .py-lg-8 {
	padding-bottom: 4.5rem
}
.pb-lg-9, .py-lg-9 {
	padding-bottom: 5rem
}
.pb-lg-10, .py-lg-10 {
	padding-bottom: 5.5rem
}
.pb-lg-11, .py-lg-11 {
	padding-bottom: 6rem
}
.pb-lg-12, .py-lg-12 {
	padding-bottom: 6.5rem
}
.pb-lg-13, .py-lg-13 {
	padding-bottom: 7rem
}
.pb-lg-14, .py-lg-14 {
	padding-bottom: 7.5rem
}
.pb-lg-15, .py-lg-15 {
	padding-bottom: 8rem
}
.pb-lg-16, .py-lg-16 {
	padding-bottom: 8.5rem
}
.pb-lg-17, .py-lg-17 {
	padding-bottom: 9rem
}
.pb-lg-18, .py-lg-18 {
	padding-bottom: 9.5rem
}
.pb-lg-19, .py-lg-19 {
	padding-bottom: 10rem
}
.pb-lg-20, .py-lg-20 {
	padding-bottom: 10.5rem
}
.pb-lg-21, .py-lg-21 {
	padding-bottom: 11rem
}
.pb-lg-22, .py-lg-22 {
	padding-bottom: 11.5rem
}
.pb-lg-23, .py-lg-23 {
	padding-bottom: 12rem
}
.pb-lg-24, .py-lg-24 {
	padding-bottom: 12.5rem
}
.ps-lg-1-6, .px-lg-1-6 {
	padding-left: 1.6rem
}
.ps-lg-1-7, .px-lg-1-7 {
	padding-left: 1.7rem
}
.ps-lg-1-8, .px-lg-1-8 {
	padding-left: 1.8rem
}
.ps-lg-1-9, .px-lg-1-9 {
	padding-left: 1.9rem
}
.ps-lg-2-0, .px-lg-2-0 {
	padding-left: 2.0rem
}
.ps-lg-2-1, .px-lg-2-1 {
	padding-left: 2.1rem
}
.ps-lg-2-2, .px-lg-2-2 {
	padding-left: 2.2rem
}
.ps-lg-2-3, .px-lg-2-3 {
	padding-left: 2.3rem
}
.ps-lg-2-4, .px-lg-2-4 {
	padding-left: 2.4rem
}
.ps-lg-2-5, .px-lg-2-5 {
	padding-left: 2.5rem
}
.ps-lg-2-6, .px-lg-2-6 {
	padding-left: 2.6rem
}
.ps-lg-2-7, .px-lg-2-7 {
	padding-left: 2.7rem
}
.ps-lg-2-8, .px-lg-2-8 {
	padding-left: 2.8rem
}
.ps-lg-2-9, .px-lg-2-9 {
	padding-left: 2.9rem
}
.ps-lg-6, .px-lg-6 {
	padding-left: 3.5rem
}
.ps-lg-7, .px-lg-7 {
	padding-left: 4rem
}
.ps-lg-8, .px-lg-8 {
	padding-left: 4.5rem
}
.ps-lg-9, .px-lg-9 {
	padding-left: 5rem
}
.ps-lg-10, .px-lg-10 {
	padding-left: 5.5rem
}
.ps-lg-11, .px-lg-11 {
	padding-left: 6rem
}
.ps-lg-12, .px-lg-12 {
	padding-left: 6.5rem
}
.ps-lg-13, .px-lg-13 {
	padding-left: 7rem
}
.ps-lg-14, .px-lg-14 {
	padding-left: 7.5rem
}
.ps-lg-15, .px-lg-15 {
	padding-left: 8rem
}
.ps-lg-16, .px-lg-16 {
	padding-left: 8.5rem
}
.ps-lg-17, .px-lg-17 {
	padding-left: 9rem
}
.ps-lg-18, .px-lg-18 {
	padding-left: 9.5rem
}
.ps-lg-19, .px-lg-19 {
	padding-left: 10rem
}
.ps-lg-20, .px-lg-20 {
	padding-left: 10.5rem
}
.ps-lg-21, .px-lg-21 {
	padding-left: 11rem
}
.ps-lg-22, .px-lg-22 {
	padding-left: 11.5rem
}
.ps-lg-23, .px-lg-23 {
	padding-left: 12rem
}
.ps-lg-24, .px-lg-24 {
	padding-left: 12.5rem
}
.pe-lg-1-6, .px-lg-1-6 {
	padding-right: 1.6rem
}
.pe-lg-1-7, .px-lg-1-7 {
	padding-right: 1.7rem
}
.pe-lg-1-8, .px-lg-1-8 {
	padding-right: 1.8rem
}
.pe-lg-1-9, .px-lg-1-9 {
	padding-right: 1.9rem
}
.pe-lg-2-0, .px-lg-2-0 {
	padding-right: 2.0rem
}
.pe-lg-2-1, .px-lg-2-1 {
	padding-right: 2.1rem
}
.pe-lg-2-2, .px-lg-2-2 {
	padding-right: 2.2rem
}
.pe-lg-2-3, .px-lg-2-3 {
	padding-right: 2.3rem
}
.pe-lg-2-4, .px-lg-2-4 {
	padding-right: 2.4rem
}
.pe-lg-2-5, .px-lg-2-5 {
	padding-right: 2.5rem
}
.pe-lg-2-6, .px-lg-2-6 {
	padding-right: 2.6rem
}
.pe-lg-2-7, .px-lg-2-7 {
	padding-right: 2.7rem
}
.pe-lg-2-8, .px-lg-2-8 {
	padding-right: 2.8rem
}
.pe-lg-2-9, .px-lg-2-9 {
	padding-right: 2.9rem
}
.pe-lg-6, .px-lg-6 {
	padding-right: 3.5rem
}
.pe-lg-7, .px-lg-7 {
	padding-right: 4rem
}
.pe-lg-8, .px-lg-8 {
	padding-right: 4.5rem
}
.pe-lg-9, .px-lg-9 {
	padding-right: 5rem
}
.pe-lg-10, .px-lg-10 {
	padding-right: 5.5rem
}
.pe-lg-11, .px-lg-11 {
	padding-right: 6rem
}
.pe-lg-12, .px-lg-12 {
	padding-right: 6.5rem
}
.pe-lg-13, .px-lg-13 {
	padding-right: 7rem
}
.pe-lg-14, .px-lg-14 {
	padding-right: 7.5rem
}
.pe-lg-15, .px-lg-15 {
	padding-right: 8rem
}
.pe-lg-16, .px-lg-16 {
	padding-right: 8.5rem
}
.pe-lg-17, .px-lg-17 {
	padding-right: 9rem
}
.pe-lg-18, .px-lg-18 {
	padding-right: 9.5rem
}
.pe-lg-19, .px-lg-19 {
	padding-right: 10rem
}
.pe-lg-20, .px-lg-20 {
	padding-right: 10.5rem
}
.pe-lg-21, .px-lg-21 {
	padding-right: 11rem
}
.pe-lg-22, .px-lg-22 {
	padding-right: 11.5rem
}
.pe-lg-23, .px-lg-23 {
	padding-right: 12rem
}
.pe-lg-24, .px-lg-24 {
	padding-right: 12.5rem
}
}

@media screen and (min-width: 1200px) {
.w-xl-1px {
	width: 1px
}
.w-xl-2px {
	width: 2px
}
.w-xl-3px {
	width: 3px
}
.w-xl-4px {
	width: 4px
}
.w-xl-5px {
	width: 5px
}
.w-xl-6px {
	width: 6px
}
.w-xl-7px {
	width: 7px
}
.w-xl-8px {
	width: 8px
}
.w-xl-9px {
	width: 9px
}
.w-xl-10px {
	width: 10px
}
.w-xl-15px {
	width: 15px
}
.w-xl-20px {
	width: 20px
}
.w-xl-25px {
	width: 25px
}
.w-xl-30px {
	width: 30px
}
.w-xl-35px {
	width: 35px
}
.w-xl-40px {
	width: 40px
}
.w-xl-50px {
	width: 50px
}
.w-xl-55px {
	width: 55px
}
.w-xl-60px {
	width: 60px
}
.w-xl-65px {
	width: 65px
}
.w-xl-70px {
	width: 70px
}
.w-xl-75px {
	width: 75px
}
.w-xl-80px {
	width: 80px
}
.w-xl-85px {
	width: 85px
}
.w-xl-90px {
	width: 90px
}
.w-xl-100px {
	width: 100px
}
.w-xl-1 {
	width: 1%
}
.w-xl-2 {
	width: 2%
}
.w-xl-3 {
	width: 3%
}
.w-xl-4 {
	width: 4%
}
.w-xl-5 {
	width: 5%
}
.w-xl-6 {
	width: 6%
}
.w-xl-7 {
	width: 7%
}
.w-xl-8 {
	width: 8%
}
.w-xl-9 {
	width: 9%
}
.w-xl-10 {
	width: 10%
}
.w-xl-11 {
	width: 10%
}
.w-xl-12 {
	width: 12%
}
.w-xl-13 {
	width: 13%
}
.w-xl-14 {
	width: 14%
}
.w-xl-15 {
	width: 15%
}
.w-xl-20 {
	width: 20%
}
.w-xl-25 {
	width: 25%
}
.w-xl-30 {
	width: 30%
}
.w-xl-35 {
	width: 35%
}
.w-xl-40 {
	width: 40%
}
.w-xl-45 {
	width: 45%
}
.w-xl-50 {
	width: 50%
}
.w-xl-55 {
	width: 55%
}
.w-xl-60 {
	width: 60%
}
.w-xl-65 {
	width: 65%
}
.w-xl-70 {
	width: 70%
}
.w-xl-75 {
	width: 75%
}
.w-xl-80 {
	width: 80%
}
.w-xl-85 {
	width: 85%
}
.w-xl-90 {
	width: 90%
}
.w-xl-95 {
	width: 95%
}
.w-xl-100 {
	width: 100%
}
.w-xl-auto {
	width: auto
}
.display-xl-1 {
	font-size: 6rem
}
.display-xl-2 {
	font-size: 5.5rem
}
.display-xl-3 {
	font-size: 4.5rem
}
.display-xl-4 {
	font-size: 3.5rem
}
.display-xl-5 {
	font-size: 3.4rem
}
.display-xl-6 {
	font-size: 3.3rem
}
.display-xl-7 {
	font-size: 3.2rem
}
.display-xl-8 {
	font-size: 3.1rem
}
.display-xl-9 {
	font-size: 3.0rem
}
.display-xl-10 {
	font-size: 2.9rem
}
.display-xl-11 {
	font-size: 2.8rem
}
.display-xl-12 {
	font-size: 2.7rem
}
.display-xl-13 {
	font-size: 2.6rem
}
.display-xl-14 {
	font-size: 2.5rem
}
.display-xl-15 {
	font-size: 2.4rem
}
.display-xl-16 {
	font-size: 2.3rem
}
.display-xl-17 {
	font-size: 2.2rem
}
.display-xl-18 {
	font-size: 2.1rem
}
.display-xl-19 {
	font-size: 2.0rem
}
.display-xl-20 {
	font-size: 1.9rem
}
.display-xl-21 {
	font-size: 1.8rem
}
.display-xl-22 {
	font-size: 1.7rem
}
.display-xl-23 {
	font-size: 1.6rem
}
.display-xl-24 {
	font-size: 1.5rem
}
.display-xl-25 {
	font-size: 1.4rem
}
.display-xl-26 {
	font-size: 1.3rem
}
.display-xl-27 {
	font-size: 1.2rem
}
.display-xl-28 {
	font-size: 1.1rem
}
.display-xl-29 {
	font-size: 1.0rem
}
.display-xl-30 {
	font-size: 0.9rem
}
.display-xl-31 {
	font-size: 0.8rem
}
.display-xl-32 {
	font-size: 0.7rem
}
.display-xl-33 {
	font-size: 0.6rem
}
.display-xl-34 {
	font-size: 0.5rem
}
.border-xl-0 {
	border: none
}
.border-xl {
	border: 1px solid #dee2e6
}
.border-xl-top {
	border-top: 1px solid #dee2e6
}
.border-xl-end {
	border-right: 1px solid #dee2e6
}
.border-xl-bottom {
	border-bottom: 1px solid #dee2e6
}
.border-xl-start {
	border-left: 1px solid #dee2e6
}
.border-xl-top-0 {
	border-top: none
}
.border-xl-end-0 {
	border-right: none
}
.border-xl-bottom-0 {
	border-bottom: none
}
.border-xl-start-0 {
	border-left: none
}
.border-xl-color-light-white {
	border-color: rgba(255,255,255,0.1) !important
}
.rounded-xl {
	border-radius: .25rem
}
.border-radius-xl-10 {
	border-radius: 10px
}
.top-xl-5 {
	top: 5%;
	bottom: inherit
}
.top-xl-10 {
	top: 10%;
	bottom: inherit
}
.top-xl-15 {
	top: 15%;
	bottom: inherit
}
.top-xl-20 {
	top: 20%;
	bottom: inherit
}
.top-xl-25 {
	top: 25%;
	bottom: inherit
}
.top-xl-30 {
	top: 30%;
	bottom: inherit
}
.top-xl-35 {
	top: 35%;
	bottom: inherit
}
.top-xl-40 {
	top: 40%;
	bottom: inherit
}
.top-xl-45 {
	top: 45%;
	bottom: inherit
}
.top-xl-50 {
	top: 50%;
	bottom: inherit
}
.top-xl-55 {
	top: 55%;
	bottom: inherit
}
.top-xl-60 {
	top: 60%;
	bottom: inherit
}
.top-xl-65 {
	top: 65%;
	bottom: inherit
}
.top-xl-70 {
	top: 70%;
	bottom: inherit
}
.top-xl-75 {
	top: 75%;
	bottom: inherit
}
.top-xl-80 {
	top: 80%;
	bottom: inherit
}
.top-xl-85 {
	top: 85%;
	bottom: inherit
}
.top-xl-90 {
	top: 90%;
	bottom: inherit
}
.top-xl-95 {
	top: 95%;
	bottom: inherit
}
.top-xl-100 {
	top: 100%;
	bottom: inherit
}
.top-xl-n5 {
	top: -5%;
	bottom: inherit
}
.top-xl-n10 {
	top: -10%;
	bottom: inherit
}
.top-xl-n15 {
	top: -15%;
	bottom: inherit
}
.top-xl-n20 {
	top: -20%;
	bottom: inherit
}
.top-xl-n25 {
	top: -25%;
	bottom: inherit
}
.top-xl-n30 {
	top: -30%;
	bottom: inherit
}
.top-xl-n35 {
	top: -35%;
	bottom: inherit
}
.top-xl-n40 {
	top: -40%;
	bottom: inherit
}
.top-xl-n45 {
	top: -45%;
	bottom: inherit
}
.top-xl-n50 {
	top: -50%;
	bottom: inherit
}
.top-xl-n55 {
	top: -55%;
	bottom: inherit
}
.top-xl-n60 {
	top: -60%;
	bottom: inherit
}
.top-xl-n65 {
	top: -65%;
	bottom: inherit
}
.top-xl-n70 {
	top: -70%;
	bottom: inherit
}
.top-xl-n75 {
	top: -75%;
	bottom: inherit
}
.top-xl-n80 {
	top: -80%;
	bottom: inherit
}
.top-xl-n85 {
	top: -85%;
	bottom: inherit
}
.top-xl-n90 {
	top: -90%;
	bottom: inherit
}
.top-xl-n95 {
	top: -95%;
	bottom: inherit
}
.top-xl-n100 {
	top: -100%;
	bottom: inherit
}
.bottom-xl-5 {
	bottom: 5%;
	top: inherit
}
.bottom-xl-10 {
	bottom: 10%;
	top: inherit
}
.bottom-xl-15 {
	bottom: 15%;
	top: inherit
}
.bottom-xl-20 {
	bottom: 20%;
	top: inherit
}
.bottom-xl-25 {
	bottom: 25%;
	top: inherit
}
.bottom-xl-30 {
	bottom: 30%;
	top: inherit
}
.bottom-xl-35 {
	bottom: 35%;
	top: inherit
}
.bottom-xl-40 {
	bottom: 40%;
	top: inherit
}
.bottom-xl-45 {
	bottom: 45%;
	top: inherit
}
.bottom-xl-50 {
	bottom: 50%;
	top: inherit
}
.bottom-xl-55 {
	bottom: 55%;
	top: inherit
}
.bottom-xl-60 {
	bottom: 60%;
	top: inherit
}
.bottom-xl-65 {
	bottom: 65%;
	top: inherit
}
.bottom-xl-70 {
	bottom: 70%;
	top: inherit
}
.bottom-xl-75 {
	bottom: 75%;
	top: inherit
}
.bottom-xl-80 {
	bottom: 80%;
	top: inherit
}
.bottom-xl-85 {
	bottom: 85%;
	top: inherit
}
.bottom-xl-90 {
	bottom: 90%;
	top: inherit
}
.bottom-xl-95 {
	bottom: 95%;
	top: inherit
}
.bottom-xl-100 {
	bottom: 100%;
	top: inherit
}
.bottom-xl-n5 {
	bottom: -5%;
	top: inherit
}
.bottom-xl-n10 {
	bottom: -10%;
	top: inherit
}
.bottom-xl-n15 {
	bottom: -15%;
	top: inherit
}
.bottom-xl-n20 {
	bottom: -20%;
	top: inherit
}
.bottom-xl-n25 {
	bottom: -25%;
	top: inherit
}
.bottom-xl-n30 {
	bottom: -30%;
	top: inherit
}
.bottom-xl-n35 {
	bottom: -35%;
	top: inherit
}
.bottom-xl-n40 {
	bottom: -40%;
	top: inherit
}
.bottom-xl-n45 {
	bottom: -45%;
	top: inherit
}
.bottom-xl-n50 {
	bottom: -50%;
	top: inherit
}
.bottom-xl-n55 {
	bottom: -55%;
	top: inherit
}
.bottom-xl-n60 {
	bottom: -60%;
	top: inherit
}
.bottom-xl-n65 {
	bottom: -65%;
	top: inherit
}
.bottom-xl-n70 {
	bottom: -70%;
	top: inherit
}
.bottom-xl-n75 {
	bottom: -75%;
	top: inherit
}
.bottom-xl-n80 {
	bottom: -80%;
	top: inherit
}
.bottom-xl-n85 {
	bottom: -85%;
	top: inherit
}
.bottom-xl-n90 {
	bottom: -90%;
	top: inherit
}
.bottom-xl-n95 {
	bottom: -95%;
	top: inherit
}
.bottom-xl-n100 {
	bottom: -100%;
	top: inherit
}
.left-xl-5 {
	left: 5%;
	right: inherit
}
.left-xl-10 {
	left: 10%;
	right: inherit
}
.left-xl-15 {
	left: 15%;
	right: inherit
}
.left-xl-20 {
	left: 20%;
	right: inherit
}
.left-xl-25 {
	left: 25%;
	right: inherit
}
.left-xl-30 {
	left: 30%;
	right: inherit
}
.left-xl-35 {
	left: 35%;
	right: inherit
}
.left-xl-40 {
	left: 40%;
	right: inherit
}
.left-xl-45 {
	left: 45%;
	right: inherit
}
.left-xl-50 {
	left: 50%;
	right: inherit
}
.left-xl-55 {
	left: 55%;
	right: inherit
}
.left-xl-60 {
	left: 60%;
	right: inherit
}
.left-xl-65 {
	left: 65%;
	right: inherit
}
.left-xl-70 {
	left: 70%;
	right: inherit
}
.left-xl-75 {
	left: 75%;
	right: inherit
}
.left-xl-80 {
	left: 80%;
	right: inherit
}
.left-xl-85 {
	left: 85%;
	right: inherit
}
.left-xl-90 {
	left: 90%;
	right: inherit
}
.left-xl-95 {
	left: 95%;
	right: inherit
}
.left-xl-100 {
	left: 100%;
	right: inherit
}
.left-xl-n5 {
	left: -5%;
	right: inherit
}
.left-xl-n10 {
	left: -10%;
	right: inherit
}
.left-xl-n15 {
	left: -15%;
	right: inherit
}
.left-xl-n20 {
	left: -20%;
	right: inherit
}
.left-xl-n25 {
	left: -25%;
	right: inherit
}
.left-xl-n30 {
	left: -30%;
	right: inherit
}
.left-xl-n35 {
	left: -35%;
	right: inherit
}
.left-xl-n40 {
	left: -40%;
	right: inherit
}
.left-xl-n45 {
	left: -45%;
	right: inherit
}
.left-xl-n50 {
	left: -50%;
	right: inherit
}
.left-xl-n55 {
	left: -55%;
	right: inherit
}
.left-xl-n60 {
	left: -60%;
	right: inherit
}
.left-xl-n65 {
	left: -65%;
	right: inherit
}
.left-xl-n70 {
	left: -70%;
	right: inherit
}
.left-xl-n75 {
	left: -75%;
	right: inherit
}
.left-xl-n80 {
	left: -80%;
	right: inherit
}
.left-xl-n85 {
	left: -85%;
	right: inherit
}
.left-xl-n90 {
	left: -90%;
	right: inherit
}
.left-xl-n95 {
	left: -95%;
	right: inherit
}
.left-xl-n100 {
	left: -100%;
	right: inherit
}
.right-xl-5 {
	right: 5%;
	left: inherit
}
.right-xl-10 {
	right: 10%;
	left: inherit
}
.right-xl-15 {
	right: 15%;
	left: inherit
}
.right-xl-20 {
	right: 20%;
	left: inherit
}
.right-xl-25 {
	right: 25%;
	left: inherit
}
.right-xl-30 {
	right: 30%;
	left: inherit
}
.right-xl-35 {
	right: 35%;
	left: inherit
}
.right-xl-40 {
	right: 40%;
	left: inherit
}
.right-xl-45 {
	right: 45%;
	left: inherit
}
.right-xl-50 {
	right: 50%;
	left: inherit
}
.right-xl-55 {
	right: 55%;
	left: inherit
}
.right-xl-60 {
	right: 60%;
	left: inherit
}
.right-xl-65 {
	right: 65%;
	left: inherit
}
.right-xl-70 {
	right: 70%;
	left: inherit
}
.right-xl-75 {
	right: 75%;
	left: inherit
}
.right-xl-80 {
	right: 80%;
	left: inherit
}
.right-xl-85 {
	right: 85%;
	left: inherit
}
.right-xl-90 {
	right: 90%;
	left: inherit
}
.right-xl-95 {
	right: 95%;
	left: inherit
}
.right-xl-100 {
	right: 100%;
	left: inherit
}
.right-xl-n5 {
	right: -5%;
	left: inherit
}
.right-xl-n10 {
	right: -10%;
	left: inherit
}
.right-xl-n15 {
	right: -15%;
	left: inherit
}
.right-xl-n20 {
	right: -20%;
	left: inherit
}
.right-xl-n25 {
	right: -25%;
	left: inherit
}
.right-xl-n30 {
	right: -30%;
	left: inherit
}
.right-xl-n35 {
	right: -35%;
	left: inherit
}
.right-xl-n40 {
	right: -40%;
	left: inherit
}
.right-xl-n45 {
	right: -45%;
	left: inherit
}
.right-xl-n50 {
	right: -50%;
	left: inherit
}
.right-xl-n55 {
	right: -55%;
	left: inherit
}
.right-xl-n60 {
	right: -60%;
	left: inherit
}
.right-xl-n65 {
	right: -65%;
	left: inherit
}
.right-xl-n70 {
	right: -70%;
	left: inherit
}
.right-xl-n75 {
	right: -75%;
	left: inherit
}
.right-xl-n80 {
	right: -80%;
	left: inherit
}
.right-xl-n85 {
	right: -85%;
	left: inherit
}
.right-xl-n90 {
	right: -90%;
	left: inherit
}
.right-xl-n95 {
	right: -95%;
	left: inherit
}
.right-xl-n100 {
	right: -100%;
	left: inherit
}
.m-xl-1-6 {
	margin: 1.6rem
}
.m-xl-1-7 {
	margin: 1.7rem
}
.m-xl-1-8 {
	margin: 1.8rem
}
.m-xl-1-9 {
	margin: 1.9rem
}
.m-xl-2-0 {
	margin: 2.0rem
}
.m-xl-2-1 {
	margin: 2.1rem
}
.m-xl-2-2 {
	margin: 2.2rem
}
.m-xl-2-3 {
	margin: 2.3rem
}
.m-xl-2-4 {
	margin: 2.4rem
}
.m-xl-2-5 {
	margin: 2.5rem
}
.m-xl-2-6 {
	margin: 2.6rem
}
.m-xl-2-7 {
	margin: 2.7rem
}
.m-xl-2-8 {
	margin: 2.8rem
}
.m-xl-2-9 {
	margin: 2.9rem
}
.m-xl-6 {
	margin: 3.5rem
}
.m-xl-7 {
	margin: 4rem
}
.m-xl-8 {
	margin: 4.5rem
}
.m-xl-9 {
	margin: 5rem
}
.m-xl-10 {
	margin: 5.5rem
}
.m-xl-11 {
	margin: 6rem
}
.m-xl-12 {
	margin: 6.5rem
}
.m-xl-13 {
	margin: 7rem
}
.m-xl-14 {
	margin: 7.5rem
}
.m-xl-15 {
	margin: 8rem
}
.m-xl-16 {
	margin: 8.5rem
}
.m-xl-17 {
	margin: 9rem
}
.m-xl-18 {
	margin: 9.5rem
}
.m-xl-19 {
	margin: 10rem
}
.m-xl-20 {
	margin: 10.5rem
}
.m-xl-21 {
	margin: 11rem
}
.m-xl-22 {
	margin: 11.5rem
}
.m-xl-23 {
	margin: 12rem
}
.m-xl-24 {
	margin: 12.5rem
}
.mt-xl-1-6, .my-xl-1-6 {
	margin-top: 1.6rem
}
.mt-xl-1-7, .my-xl-1-7 {
	margin-top: 1.7rem
}
.mt-xl-1-8, .my-xl-1-8 {
	margin-top: 1.8rem
}
.mt-xl-1-9, .my-xl-1-9 {
	margin-top: 1.9rem
}
.mt-xl-2-0, .my-xl-2-0 {
	margin-top: 2.0rem
}
.mt-xl-2-1, .my-xl-2-1 {
	margin-top: 2.1rem
}
.mt-xl-2-2, .my-xl-2-2 {
	margin-top: 2.2rem
}
.mt-xl-2-3, .my-xl-2-3 {
	margin-top: 2.3rem
}
.mt-xl-2-4, .my-xl-2-4 {
	margin-top: 2.4rem
}
.mt-xl-2-5, .my-xl-2-5 {
	margin-top: 2.5rem
}
.mt-xl-2-6, .my-xl-2-6 {
	margin-top: 2.6rem
}
.mt-xl-2-7, .my-xl-2-7 {
	margin-top: 2.7rem
}
.mt-xl-2-8, .my-xl-2-8 {
	margin-top: 2.8rem
}
.mt-xl-2-9, .my-xl-2-9 {
	margin-top: 2.9rem
}
.mt-xl-6, .my-xl-6 {
	margin-top: 3.5rem
}
.mt-xl-7, .my-xl-7 {
	margin-top: 4rem
}
.mt-xl-8, .my-xl-8 {
	margin-top: 4.5rem
}
.mt-xl-9, .my-xl-9 {
	margin-top: 5rem
}
.mt-xl-10, .my-xl-10 {
	margin-top: 5.5rem
}
.mt-xl-11, .my-xl-11 {
	margin-top: 6rem
}
.mt-xl-12, .my-xl-12 {
	margin-top: 6.5rem
}
.mt-xl-13, .my-xl-13 {
	margin-top: 7rem
}
.mt-xl-14, .my-xl-14 {
	margin-top: 7.5rem
}
.mt-xl-15, .my-xl-15 {
	margin-top: 8rem
}
.mt-xl-16, .my-xl-16 {
	margin-top: 8.5rem
}
.mt-xl-17, .my-xl-17 {
	margin-top: 9rem
}
.mt-xl-18, .my-xl-18 {
	margin-top: 9.5rem
}
.mt-xl-19, .my-xl-19 {
	margin-top: 10rem
}
.mt-xl-20, .my-xl-20 {
	margin-top: 10.5rem
}
.mt-xl-21, .my-xl-21 {
	margin-top: 11rem
}
.mt-xl-22, .my-xl-22 {
	margin-top: 11.5rem
}
.mt-xl-23, .my-xl-23 {
	margin-top: 12rem
}
.mt-xl-24, .my-xl-24 {
	margin-top: 12.5rem
}
.mb-xl-1-6, .my-xl-1-6 {
	margin-bottom: 1.6rem
}
.mb-xl-1-7, .my-xl-1-7 {
	margin-bottom: 1.7rem
}
.mb-xl-1-8, .my-xl-1-8 {
	margin-bottom: 1.8rem
}
.mb-xl-1-9, .my-xl-1-9 {
	margin-bottom: 1.9rem
}
.mb-xl-2-0, .my-xl-2-0 {
	margin-bottom: 2.0rem
}
.mb-xl-2-1, .my-xl-2-1 {
	margin-bottom: 2.1rem
}
.mb-xl-2-2, .my-xl-2-2 {
	margin-bottom: 2.2rem
}
.mb-xl-2-3, .my-xl-2-3 {
	margin-bottom: 2.3rem
}
.mb-xl-2-4, .my-xl-2-4 {
	margin-bottom: 2.4rem
}
.mb-xl-2-5, .my-xl-2-5 {
	margin-bottom: 2.5rem
}
.mb-xl-2-6, .my-xl-2-6 {
	margin-bottom: 2.6rem
}
.mb-xl-2-7, .my-xl-2-7 {
	margin-bottom: 2.7rem
}
.mb-xl-2-8, .my-xl-2-8 {
	margin-bottom: 2.8rem
}
.mb-xl-2-9, .my-xl-2-9 {
	margin-bottom: 2.9rem
}
.mb-xl-6, .my-xl-6 {
	margin-bottom: 3.5rem
}
.mb-xl-7, .my-xl-7 {
	margin-bottom: 4rem
}
.mb-xl-8, .my-xl-8 {
	margin-bottom: 4.5rem
}
.mb-xl-9, .my-xl-9 {
	margin-bottom: 5rem
}
.mb-xl-10, .my-xl-10 {
	margin-bottom: 5.5rem
}
.mb-xl-11, .my-xl-11 {
	margin-bottom: 6rem
}
.mb-xl-12, .my-xl-12 {
	margin-bottom: 6.5rem
}
.mb-xl-13, .my-xl-13 {
	margin-bottom: 7rem
}
.mb-xl-14, .my-xl-14 {
	margin-bottom: 7.5rem
}
.mb-xl-15, .my-xl-15 {
	margin-bottom: 8rem
}
.mb-xl-16, .my-xl-16 {
	margin-bottom: 8.5rem
}
.mb-xl-17, .my-xl-17 {
	margin-bottom: 9rem
}
.mb-xl-18, .my-xl-18 {
	margin-bottom: 9.5rem
}
.mb-xl-19, .my-xl-19 {
	margin-bottom: 10rem
}
.mb-xl-20, .my-xl-20 {
	margin-bottom: 10.5rem
}
.mb-xl-21, .my-xl-21 {
	margin-bottom: 11rem
}
.mb-xl-22, .my-xl-22 {
	margin-bottom: 11.5rem
}
.mb-xl-23, .my-xl-23 {
	margin-bottom: 12rem
}
.mb-xl-24, .my-xl-24 {
	margin-bottom: 12.5rem
}
.ms-xl-1-6, .mx-xl-1-6 {
	margin-left: 1.6rem
}
.ms-xl-1-7, .mx-xl-1-7 {
	margin-left: 1.7rem
}
.ms-xl-1-8, .mx-xl-1-8 {
	margin-left: 1.8rem
}
.ms-xl-1-9, .mx-xl-1-9 {
	margin-left: 1.9rem
}
.ms-xl-2-0, .mx-xl-2-0 {
	margin-left: 2.0rem
}
.ms-xl-2-1, .mx-xl-2-1 {
	margin-left: 2.1rem
}
.ms-xl-2-2, .mx-xl-2-2 {
	margin-left: 2.2rem
}
.ms-xl-2-3, .mx-xl-2-3 {
	margin-left: 2.3rem
}
.ms-xl-2-4, .mx-xl-2-4 {
	margin-left: 2.4rem
}
.ms-xl-2-5, .mx-xl-2-5 {
	margin-left: 2.5rem
}
.ms-xl-2-6, .mx-xl-2-6 {
	margin-left: 2.6rem
}
.ms-xl-2-7, .mx-xl-2-7 {
	margin-left: 2.7rem
}
.ms-xl-2-8, .mx-xl-2-8 {
	margin-left: 2.8rem
}
.ms-xl-2-9, .mx-xl-2-9 {
	margin-left: 2.9rem
}
.ms-xl-6, .mx-xl-6 {
	margin-left: 3.5rem
}
.ms-xl-7, .mx-xl-7 {
	margin-left: 4rem
}
.ms-xl-8, .mx-xl-8 {
	margin-left: 4.5rem
}
.ms-xl-9, .mx-xl-9 {
	margin-left: 5rem
}
.ms-xl-10, .mx-xl-10 {
	margin-left: 5.5rem
}
.ms-xl-11, .mx-xl-11 {
	margin-left: 6rem
}
.ms-xl-12, .mx-xl-12 {
	margin-left: 6.5rem
}
.ms-xl-13, .mx-xl-13 {
	margin-left: 7rem
}
.ms-xl-14, .mx-xl-14 {
	margin-left: 7.5rem
}
.ms-xl-15, .mx-xl-15 {
	margin-left: 8rem
}
.ms-xl-16, .mx-xl-16 {
	margin-left: 8.5rem
}
.ms-xl-17, .mx-xl-17 {
	margin-left: 9rem
}
.ms-xl-18, .mx-xl-18 {
	margin-left: 9.5rem
}
.ms-xl-19, .mx-xl-19 {
	margin-left: 10rem
}
.ms-xl-20, .mx-xl-20 {
	margin-left: 10.5rem
}
.ms-xl-21, .mx-xl-21 {
	margin-left: 11rem
}
.ms-xl-22, .mx-xl-22 {
	margin-left: 11.5rem
}
.ms-xl-23, .mx-xl-23 {
	margin-left: 12rem
}
.ms-xl-24, .mx-xl-24 {
	margin-left: 12.5rem
}
.me-xl-1-6, .mx-xl-1-6 {
	margin-right: 1.6rem
}
.me-xl-1-7, .mx-xl-1-7 {
	margin-right: 1.7rem
}
.me-xl-1-8, .mx-xl-1-8 {
	margin-right: 1.8rem
}
.me-xl-1-9, .mx-xl-1-9 {
	margin-right: 1.9rem
}
.me-xl-2-0, .mx-xl-2-0 {
	margin-right: 2.0rem
}
.me-xl-2-1, .mx-xl-2-1 {
	margin-right: 2.1rem
}
.me-xl-2-2, .mx-xl-2-2 {
	margin-right: 2.2rem
}
.me-xl-2-3, .mx-xl-2-3 {
	margin-right: 2.3rem
}
.me-xl-2-4, .mx-xl-2-4 {
	margin-right: 2.4rem
}
.me-xl-2-5, .mx-xl-2-5 {
	margin-right: 2.5rem
}
.me-xl-2-6, .mx-xl-2-6 {
	margin-right: 2.6rem
}
.me-xl-2-7, .mx-xl-2-7 {
	margin-right: 2.7rem
}
.me-xl-2-8, .mx-xl-2-8 {
	margin-right: 2.8rem
}
.me-xl-2-9, .mx-xl-2-9 {
	margin-right: 2.9rem
}
.me-xl-6, .mx-xl-6 {
	margin-right: 3.5rem
}
.me-xl-7, .mx-xl-7 {
	margin-right: 4rem
}
.me-xl-8, .mx-xl-8 {
	margin-right: 4.5rem
}
.me-xl-9, .mx-xl-9 {
	margin-right: 5rem
}
.me-xl-10, .mx-xl-10 {
	margin-right: 5.5rem
}
.me-xl-11, .mx-xl-11 {
	margin-right: 6rem
}
.me-xl-12, .mx-xl-12 {
	margin-right: 6.5rem
}
.me-xl-13, .mx-xl-13 {
	margin-right: 7rem
}
.me-xl-14, .mx-xl-14 {
	margin-right: 7.5rem
}
.me-xl-15, .mx-xl-15 {
	margin-right: 8rem
}
.me-xl-16, .mx-xl-16 {
	margin-right: 8.5rem
}
.me-xl-17, .mx-xl-17 {
	margin-right: 9rem
}
.me-xl-18, .mx-xl-18 {
	margin-right: 9.5rem
}
.me-xl-19, .mx-xl-19 {
	margin-right: 10rem
}
.me-xl-20, .mx-xl-20 {
	margin-right: 10.5rem
}
.me-xl-21, .mx-xl-21 {
	margin-right: 11rem
}
.me-xl-22, .mx-xl-22 {
	margin-right: 11.5rem
}
.me-xl-23, .mx-xl-23 {
	margin-right: 12rem
}
.me-xl-24, .mx-xl-24 {
	margin-right: 12.5rem
}
.p-xl-1-6 {
	padding: 1.6rem
}
.p-xl-1-7 {
	padding: 1.7rem
}
.p-xl-1-8 {
	padding: 1.8rem
}
.p-xl-1-9 {
	padding: 1.9rem
}
.p-xl-2-0 {
	padding: 2.0rem
}
.p-xl-2-1 {
	padding: 2.1rem
}
.p-xl-2-2 {
	padding: 2.2rem
}
.p-xl-2-3 {
	padding: 2.3rem
}
.p-xl-2-4 {
	padding: 2.4rem
}
.p-xl-2-5 {
	padding: 2.5rem
}
.p-xl-2-6 {
	padding: 2.6rem
}
.p-xl-2-7 {
	padding: 2.7rem
}
.p-xl-2-8 {
	padding: 2.8rem
}
.p-xl-2-9 {
	padding: 2.9rem
}
.p-xl-6 {
	padding: 3.5rem
}
.p-xl-7 {
	padding: 4rem
}
.p-xl-8 {
	padding: 4.5rem
}
.p-xl-9 {
	padding: 5rem
}
.p-xl-10 {
	padding: 5.5rem
}
.p-xl-11 {
	padding: 6rem
}
.p-xl-12 {
	padding: 6.5rem
}
.p-xl-13 {
	padding: 7rem
}
.p-xl-14 {
	padding: 7.5rem
}
.p-xl-15 {
	padding: 8rem
}
.p-xl-16 {
	padding: 8.5rem
}
.p-xl-17 {
	padding: 9rem
}
.p-xl-18 {
	padding: 9.5rem
}
.p-xl-19 {
	padding: 10rem
}
.p-xl-20 {
	padding: 10.5rem
}
.p-xl-21 {
	padding: 11rem
}
.p-xl-22 {
	padding: 11.5rem
}
.p-xl-23 {
	padding: 12rem
}
.p-xl-24 {
	padding: 12.5rem
}
.pt-xl-1-6, .py-xl-1-6 {
	padding-top: 1.6rem
}
.pt-xl-1-7, .py-xl-1-7 {
	padding-top: 1.7rem
}
.pt-xl-1-8, .py-xl-1-8 {
	padding-top: 1.8rem
}
.pt-xl-1-9, .py-xl-1-9 {
	padding-top: 1.9rem
}
.pt-xl-2-0, .py-xl-2-0 {
	padding-top: 2.0rem
}
.pt-xl-2-1, .py-xl-2-1 {
	padding-top: 2.1rem
}
.pt-xl-2-2, .py-xl-2-2 {
	padding-top: 2.2rem
}
.pt-xl-2-3, .py-xl-2-3 {
	padding-top: 2.3rem
}
.pt-xl-2-4, .py-xl-2-4 {
	padding-top: 2.4rem
}
.pt-xl-2-5, .py-xl-2-5 {
	padding-top: 2.5rem
}
.pt-xl-2-6, .py-xl-2-6 {
	padding-top: 2.6rem
}
.pt-xl-2-7, .py-xl-2-7 {
	padding-top: 2.7rem
}
.pt-xl-2-8, .py-xl-2-8 {
	padding-top: 2.8rem
}
.pt-xl-2-9, .py-xl-2-9 {
	padding-top: 2.9rem
}
.pt-xl-6, .py-xl-6 {
	padding-top: 3.5rem
}
.pt-xl-7, .py-xl-7 {
	padding-top: 4rem
}
.pt-xl-8, .py-xl-8 {
	padding-top: 4.5rem
}
.pt-xl-9, .py-xl-9 {
	padding-top: 5rem
}
.pt-xl-10, .py-xl-10 {
	padding-top: 5.5rem
}
.pt-xl-11, .py-xl-11 {
	padding-top: 6rem
}
.pt-xl-12, .py-xl-12 {
	padding-top: 6.5rem
}
.pt-xl-13, .py-xl-13 {
	padding-top: 7rem
}
.pt-xl-14, .py-xl-14 {
	padding-top: 7.5rem
}
.pt-xl-15, .py-xl-15 {
	padding-top: 8rem
}
.pt-xl-16, .py-xl-16 {
	padding-top: 8.5rem
}
.pt-xl-17, .py-xl-17 {
	padding-top: 9rem
}
.pt-xl-18, .py-xl-18 {
	padding-top: 9.5rem
}
.pt-xl-19, .py-xl-19 {
	padding-top: 10rem
}
.pt-xl-20, .py-xl-20 {
	padding-top: 10.5rem
}
.pt-xl-21, .py-xl-21 {
	padding-top: 11rem
}
.pt-xl-22, .py-xl-22 {
	padding-top: 11.5rem
}
.pt-xl-23, .py-xl-23 {
	padding-top: 12rem
}
.pt-xl-24, .py-xl-24 {
	padding-top: 12.5rem
}
.pb-xl-1-6, .py-xl-1-6 {
	padding-bottom: 1.6rem
}
.pb-xl-1-7, .py-xl-1-7 {
	padding-bottom: 1.7rem
}
.pb-xl-1-8, .py-xl-1-8 {
	padding-bottom: 1.8rem
}
.pb-xl-1-9, .py-xl-1-9 {
	padding-bottom: 1.9rem
}
.pb-xl-2-0, .py-xl-2-0 {
	padding-bottom: 2.0rem
}
.pb-xl-2-1, .py-xl-2-1 {
	padding-bottom: 2.1rem
}
.pb-xl-2-2, .py-xl-2-2 {
	padding-bottom: 2.2rem
}
.pb-xl-2-3, .py-xl-2-3 {
	padding-bottom: 2.3rem
}
.pb-xl-2-4, .py-xl-2-4 {
	padding-bottom: 2.4rem
}
.pb-xl-2-5, .py-xl-2-5 {
	padding-bottom: 2.5rem
}
.pb-xl-2-6, .py-xl-2-6 {
	padding-bottom: 2.6rem
}
.pb-xl-2-7, .py-xl-2-7 {
	padding-bottom: 2.7rem
}
.pb-xl-2-8, .py-xl-2-8 {
	padding-bottom: 2.8rem
}
.pb-xl-2-9, .py-xl-2-9 {
	padding-bottom: 2.9rem
}
.pb-xl-6, .py-xl-6 {
	padding-bottom: 3.5rem
}
.pb-xl-7, .py-xl-7 {
	padding-bottom: 4rem
}
.pb-xl-8, .py-xl-8 {
	padding-bottom: 4.5rem
}
.pb-xl-9, .py-xl-9 {
	padding-bottom: 5rem
}
.pb-xl-10, .py-xl-10 {
	padding-bottom: 5.5rem
}
.pb-xl-11, .py-xl-11 {
	padding-bottom: 6rem
}
.pb-xl-12, .py-xl-12 {
	padding-bottom: 6.5rem
}
.pb-xl-13, .py-xl-13 {
	padding-bottom: 7rem
}
.pb-xl-14, .py-xl-14 {
	padding-bottom: 7.5rem
}
.pb-xl-15, .py-xl-15 {
	padding-bottom: 8rem
}
.pb-xl-16, .py-xl-16 {
	padding-bottom: 8.5rem
}
.pb-xl-17, .py-xl-17 {
	padding-bottom: 9rem
}
.pb-xl-18, .py-xl-18 {
	padding-bottom: 9.5rem
}
.pb-xl-19, .py-xl-19 {
	padding-bottom: 10rem
}
.pb-xl-20, .py-xl-20 {
	padding-bottom: 10.5rem
}
.pb-xl-21, .py-xl-21 {
	padding-bottom: 11rem
}
.pb-xl-22, .py-xl-22 {
	padding-bottom: 11.5rem
}
.pb-xl-23, .py-xl-23 {
	padding-bottom: 12rem
}
.pb-xl-24, .py-xl-24 {
	padding-bottom: 12.5rem
}
.ps-xl-1-6, .px-xl-1-6 {
	padding-left: 1.6rem
}
.ps-xl-1-7, .px-xl-1-7 {
	padding-left: 1.7rem
}
.ps-xl-1-8, .px-xl-1-8 {
	padding-left: 1.8rem
}
.ps-xl-1-9, .px-xl-1-9 {
	padding-left: 1.9rem
}
.ps-xl-2-0, .px-xl-2-0 {
	padding-left: 2.0rem
}
.ps-xl-2-1, .px-xl-2-1 {
	padding-left: 2.1rem
}
.ps-xl-2-2, .px-xl-2-2 {
	padding-left: 2.2rem
}
.ps-xl-2-3, .px-xl-2-3 {
	padding-left: 2.3rem
}
.ps-xl-2-4, .px-xl-2-4 {
	padding-left: 2.4rem
}
.ps-xl-2-5, .px-xl-2-5 {
	padding-left: 2.5rem
}
.ps-xl-2-6, .px-xl-2-6 {
	padding-left: 2.6rem
}
.ps-xl-2-7, .px-xl-2-7 {
	padding-left: 2.7rem
}
.ps-xl-2-8, .px-xl-2-8 {
	padding-left: 2.8rem
}
.ps-xl-2-9, .px-xl-2-9 {
	padding-left: 2.9rem
}
.ps-xl-6, .px-xl-6 {
	padding-left: 3.5rem
}
.ps-xl-7, .px-xl-7 {
	padding-left: 4rem
}
.ps-xl-8, .px-xl-8 {
	padding-left: 4.5rem
}
.ps-xl-9, .px-xl-9 {
	padding-left: 5rem
}
.ps-xl-10, .px-xl-10 {
	padding-left: 5.5rem
}
.ps-xl-11, .px-xl-11 {
	padding-left: 6rem
}
.ps-xl-12, .px-xl-12 {
	padding-left: 6.5rem
}
.ps-xl-13, .px-xl-13 {
	padding-left: 7rem
}
.ps-xl-14, .px-xl-14 {
	padding-left: 7.5rem
}
.ps-xl-15, .px-xl-15 {
	padding-left: 8rem
}
.ps-xl-16, .px-xl-16 {
	padding-left: 8.5rem
}
.ps-xl-17, .px-xl-17 {
	padding-left: 9rem
}
.ps-xl-18, .px-xl-18 {
	padding-left: 9.5rem
}
.ps-xl-19, .px-xl-19 {
	padding-left: 10rem
}
.ps-xl-20, .px-xl-20 {
	padding-left: 10.5rem
}
.ps-xl-21, .px-xl-21 {
	padding-left: 11rem
}
.ps-xl-22, .px-xl-22 {
	padding-left: 11.5rem
}
.ps-xl-23, .px-xl-23 {
	padding-left: 12rem
}
.ps-xl-24, .px-xl-24 {
	padding-left: 12.5rem
}
.pe-xl-1-6, .px-xl-1-6 {
	padding-right: 1.6rem
}
.pe-xl-1-7, .px-xl-1-7 {
	padding-right: 1.7rem
}
.pe-xl-1-8, .px-xl-1-8 {
	padding-right: 1.8rem
}
.pe-xl-1-9, .px-xl-1-9 {
	padding-right: 1.9rem
}
.pe-xl-2-0, .px-xl-2-0 {
	padding-right: 2.0rem
}
.pe-xl-2-1, .px-xl-2-1 {
	padding-right: 2.1rem
}
.pe-xl-2-2, .px-xl-2-2 {
	padding-right: 2.2rem
}
.pe-xl-2-3, .px-xl-2-3 {
	padding-right: 2.3rem
}
.pe-xl-2-4, .px-xl-2-4 {
	padding-right: 2.4rem
}
.pe-xl-2-5, .px-xl-2-5 {
	padding-right: 2.5rem
}
.pe-xl-2-6, .px-xl-2-6 {
	padding-right: 2.6rem
}
.pe-xl-2-7, .px-xl-2-7 {
	padding-right: 2.7rem
}
.pe-xl-2-8, .px-xl-2-8 {
	padding-right: 2.8rem
}
.pe-xl-2-9, .px-xl-2-9 {
	padding-right: 2.9rem
}
.pe-xl-6, .px-xl-6 {
	padding-right: 3.5rem
}
.pe-xl-7, .px-xl-7 {
	padding-right: 4rem
}
.pe-xl-8, .px-xl-8 {
	padding-right: 4.5rem
}
.pe-xl-9, .px-xl-9 {
	padding-right: 5rem
}
.pe-xl-10, .px-xl-10 {
	padding-right: 5.5rem
}
.pe-xl-11, .px-xl-11 {
	padding-right: 6rem
}
.pe-xl-12, .px-xl-12 {
	padding-right: 6.5rem
}
.pe-xl-13, .px-xl-13 {
	padding-right: 7rem
}
.pe-xl-14, .px-xl-14 {
	padding-right: 7.5rem
}
.pe-xl-15, .px-xl-15 {
	padding-right: 8rem
}
.pe-xl-16, .px-xl-16 {
	padding-right: 8.5rem
}
.pe-xl-17, .px-xl-17 {
	padding-right: 9rem
}
.pe-xl-18, .px-xl-18 {
	padding-right: 9.5rem
}
.pe-xl-19, .px-xl-19 {
	padding-right: 10rem
}
.pe-xl-20, .px-xl-20 {
	padding-right: 10.5rem
}
.pe-xl-21, .px-xl-21 {
	padding-right: 11rem
}
.pe-xl-22, .px-xl-22 {
	padding-right: 11.5rem
}
.pe-xl-23, .px-xl-23 {
	padding-right: 12rem
}
.pe-xl-24, .px-xl-24 {
	padding-right: 12.5rem
}
}

@media screen and (min-width: 1400px) {
.w-xxl-1px {
	width: 1px
}
.w-xxl-2px {
	width: 2px
}
.w-xxl-3px {
	width: 3px
}
.w-xxl-4px {
	width: 4px
}
.w-xxl-5px {
	width: 5px
}
.w-xxl-6px {
	width: 6px
}
.w-xxl-7px {
	width: 7px
}
.w-xxl-8px {
	width: 8px
}
.w-xxl-9px {
	width: 9px
}
.w-xxl-10px {
	width: 10px
}
.w-xxl-15px {
	width: 15px
}
.w-xxl-20px {
	width: 20px
}
.w-xxl-25px {
	width: 25px
}
.w-xxl-30px {
	width: 30px
}
.w-xxl-35px {
	width: 35px
}
.w-xxl-40px {
	width: 40px
}
.w-xxl-50px {
	width: 50px
}
.w-xxl-55px {
	width: 55px
}
.w-xxl-60px {
	width: 60px
}
.w-xxl-65px {
	width: 65px
}
.w-xxl-70px {
	width: 70px
}
.w-xxl-75px {
	width: 75px
}
.w-xxl-80px {
	width: 80px
}
.w-xxl-85px {
	width: 85px
}
.w-xxl-90px {
	width: 90px
}
.w-xxl-100px {
	width: 100px
}
.w-xxl-1 {
	width: 1%
}
.w-xxl-2 {
	width: 2%
}
.w-xxl-3 {
	width: 3%
}
.w-xxl-4 {
	width: 4%
}
.w-xxl-5 {
	width: 5%
}
.w-xxl-6 {
	width: 6%
}
.w-xxl-7 {
	width: 7%
}
.w-xxl-8 {
	width: 8%
}
.w-xxl-9 {
	width: 9%
}
.w-xxl-10 {
	width: 10%
}
.w-xxl-20 {
	width: 20%
}
.w-xxl-25 {
	width: 25%
}
.w-xxl-30 {
	width: 30%
}
.w-xxl-35 {
	width: 35%
}
.w-xxl-40 {
	width: 40%
}
.w-xxl-45 {
	width: 45%
}
.w-xxl-50 {
	width: 50%
}
.w-xxl-55 {
	width: 55%
}
.w-xxl-60 {
	width: 60%
}
.w-xxl-65 {
	width: 65%
}
.w-xxl-70 {
	width: 70%
}
.w-xxl-75 {
	width: 75%
}
.w-xxl-80 {
	width: 80%
}
.w-xxl-85 {
	width: 85%
}
.w-xxl-90 {
	width: 90%
}
.w-xxl-95 {
	width: 95%
}
.w-xxl-100 {
	width: 100%
}
.w-xxl-auto {
	width: auto
}
.display-xxl-1 {
	font-size: 6rem
}
.display-xxl-2 {
	font-size: 5.5rem
}
.display-xxl-3 {
	font-size: 4.5rem
}
.display-xxl-4 {
	font-size: 3.5rem
}
.display-xxl-5 {
	font-size: 3.4rem
}
.display-xxl-6 {
	font-size: 3.3rem
}
.display-xxl-7 {
	font-size: 3.2rem
}
.display-xxl-8 {
	font-size: 3.1rem
}
.display-xxl-9 {
	font-size: 3.0rem
}
.display-xxl-10 {
	font-size: 2.9rem
}
.display-xxl-11 {
	font-size: 2.8rem
}
.display-xxl-12 {
	font-size: 2.7rem
}
.display-xxl-13 {
	font-size: 2.6rem
}
.display-xxl-14 {
	font-size: 2.5rem
}
.display-xxl-15 {
	font-size: 2.4rem
}
.display-xxl-16 {
	font-size: 2.3rem
}
.display-xxl-17 {
	font-size: 2.2rem
}
.display-xxl-18 {
	font-size: 2.1rem
}
.display-xxl-19 {
	font-size: 2.0rem
}
.display-xxl-20 {
	font-size: 1.9rem
}
.display-xxl-21 {
	font-size: 1.8rem
}
.display-xxl-22 {
	font-size: 1.7rem
}
.display-xxl-23 {
	font-size: 1.6rem
}
.display-xxl-24 {
	font-size: 1.5rem
}
.display-xxl-25 {
	font-size: 1.4rem
}
.display-xxl-26 {
	font-size: 1.3rem
}
.display-xxl-27 {
	font-size: 1.2rem
}
.display-xxl-28 {
	font-size: 1.1rem
}
.display-xxl-29 {
	font-size: 1.0rem
}
.display-xxl-30 {
	font-size: 0.9rem
}
.display-xxl-31 {
	font-size: 0.8rem
}
.display-xxl-32 {
	font-size: 0.7rem
}
.display-xxl-33 {
	font-size: 0.6rem
}
.display-xxl-34 {
	font-size: 0.5rem
}
.border-xxl-0 {
	border: none
}
.border-xxl {
	border: 1px solid #dee2e6
}
.border-xxl-top {
	border-top: 1px solid #dee2e6
}
.border-xxl-end {
	border-right: 1px solid #dee2e6
}
.border-xxl-bottom {
	border-bottom: 1px solid #dee2e6
}
.border-xxl-start {
	border-left: 1px solid #dee2e6
}
.border-xxl-top-0 {
	border-top: none
}
.border-xxl-end-0 {
	border-right: none
}
.border-xxl-bottom-0 {
	border-bottom: none
}
.border-xxl-start-0 {
	border-left: none
}
.border-xxl-color-light-white {
	border-color: rgba(255,255,255,0.1) !important
}
.rounded-xxl {
	border-radius: .25rem
}
.top-xxl-5 {
	top: 5%;
	bottom: inherit
}
.top-xxl-10 {
	top: 10%;
	bottom: inherit
}
.top-xxl-15 {
	top: 15%;
	bottom: inherit
}
.top-xxl-20 {
	top: 20%;
	bottom: inherit
}
.top-xxl-25 {
	top: 25%;
	bottom: inherit
}
.top-xxl-30 {
	top: 30%;
	bottom: inherit
}
.top-xxl-35 {
	top: 35%;
	bottom: inherit
}
.top-xxl-40 {
	top: 40%;
	bottom: inherit
}
.top-xxl-45 {
	top: 45%;
	bottom: inherit
}
.top-xxl-50 {
	top: 50%;
	bottom: inherit
}
.top-xxl-55 {
	top: 55%;
	bottom: inherit
}
.top-xxl-60 {
	top: 60%;
	bottom: inherit
}
.top-xxl-65 {
	top: 65%;
	bottom: inherit
}
.top-xxl-70 {
	top: 70%;
	bottom: inherit
}
.top-xxl-75 {
	top: 75%;
	bottom: inherit
}
.top-xxl-80 {
	top: 80%;
	bottom: inherit
}
.top-xxl-85 {
	top: 85%;
	bottom: inherit
}
.top-xxl-90 {
	top: 90%;
	bottom: inherit
}
.top-xxl-95 {
	top: 95%;
	bottom: inherit
}
.top-xxl-100 {
	top: 100%;
	bottom: inherit
}
.top-xxl-n5 {
	top: -5%;
	bottom: inherit
}
.top-xxl-n10 {
	top: -10%;
	bottom: inherit
}
.top-xxl-n15 {
	top: -15%;
	bottom: inherit
}
.top-xxl-n20 {
	top: -20%;
	bottom: inherit
}
.top-xxl-n25 {
	top: -25%;
	bottom: inherit
}
.top-xxl-n30 {
	top: -30%;
	bottom: inherit
}
.top-xxl-n35 {
	top: -35%;
	bottom: inherit
}
.top-xxl-n40 {
	top: -40%;
	bottom: inherit
}
.top-xxl-n45 {
	top: -45%;
	bottom: inherit
}
.top-xxl-n50 {
	top: -50%;
	bottom: inherit
}
.top-xxl-n55 {
	top: -55%;
	bottom: inherit
}
.top-xxl-n60 {
	top: -60%;
	bottom: inherit
}
.top-xxl-n65 {
	top: -65%;
	bottom: inherit
}
.top-xxl-n70 {
	top: -70%;
	bottom: inherit
}
.top-xxl-n75 {
	top: -75%;
	bottom: inherit
}
.top-xxl-n80 {
	top: -80%;
	bottom: inherit
}
.top-xxl-n85 {
	top: -85%;
	bottom: inherit
}
.top-xxl-n90 {
	top: -90%;
	bottom: inherit
}
.top-xxl-n95 {
	top: -95%;
	bottom: inherit
}
.top-xxl-n100 {
	top: -100%;
	bottom: inherit
}
.bottom-xxl-5 {
	bottom: 5%;
	top: inherit
}
.bottom-xxl-10 {
	bottom: 10%;
	top: inherit
}
.bottom-xxl-15 {
	bottom: 15%;
	top: inherit
}
.bottom-xxl-20 {
	bottom: 20%;
	top: inherit
}
.bottom-xxl-25 {
	bottom: 25%;
	top: inherit
}
.bottom-xxl-30 {
	bottom: 30%;
	top: inherit
}
.bottom-xxl-35 {
	bottom: 35%;
	top: inherit
}
.bottom-xxl-40 {
	bottom: 40%;
	top: inherit
}
.bottom-xxl-45 {
	bottom: 45%;
	top: inherit
}
.bottom-xxl-50 {
	bottom: 50%;
	top: inherit
}
.bottom-xxl-55 {
	bottom: 55%;
	top: inherit
}
.bottom-xxl-60 {
	bottom: 60%;
	top: inherit
}
.bottom-xxl-65 {
	bottom: 65%;
	top: inherit
}
.bottom-xxl-70 {
	bottom: 70%;
	top: inherit
}
.bottom-xxl-75 {
	bottom: 75%;
	top: inherit
}
.bottom-xxl-80 {
	bottom: 80%;
	top: inherit
}
.bottom-xxl-85 {
	bottom: 85%;
	top: inherit
}
.bottom-xxl-90 {
	bottom: 90%;
	top: inherit
}
.bottom-xxl-95 {
	bottom: 95%;
	top: inherit
}
.bottom-xxl-100 {
	bottom: 100%;
	top: inherit
}
.bottom-xxl-n5 {
	bottom: -5%;
	top: inherit
}
.bottom-xxl-n10 {
	bottom: -10%;
	top: inherit
}
.bottom-xxl-n15 {
	bottom: -15%;
	top: inherit
}
.bottom-xxl-n20 {
	bottom: -20%;
	top: inherit
}
.bottom-xxl-n25 {
	bottom: -25%;
	top: inherit
}
.bottom-xxl-n30 {
	bottom: -30%;
	top: inherit
}
.bottom-xxl-n35 {
	bottom: -35%;
	top: inherit
}
.bottom-xxl-n40 {
	bottom: -40%;
	top: inherit
}
.bottom-xxl-n45 {
	bottom: -45%;
	top: inherit
}
.bottom-xxl-n50 {
	bottom: -50%;
	top: inherit
}
.bottom-xxl-n55 {
	bottom: -55%;
	top: inherit
}
.bottom-xxl-n60 {
	bottom: -60%;
	top: inherit
}
.bottom-xxl-n65 {
	bottom: -65%;
	top: inherit
}
.bottom-xxl-n70 {
	bottom: -70%;
	top: inherit
}
.bottom-xxl-n75 {
	bottom: -75%;
	top: inherit
}
.bottom-xxl-n80 {
	bottom: -80%;
	top: inherit
}
.bottom-xxl-n85 {
	bottom: -85%;
	top: inherit
}
.bottom-xxl-n90 {
	bottom: -90%;
	top: inherit
}
.bottom-xxl-n95 {
	bottom: -95%;
	top: inherit
}
.bottom-xxl-n100 {
	bottom: -100%;
	top: inherit
}
.left-xxl-5 {
	left: 5%;
	right: inherit
}
.left-xxl-10 {
	left: 10%;
	right: inherit
}
.left-xxl-15 {
	left: 15%;
	right: inherit
}
.left-xxl-20 {
	left: 20%;
	right: inherit
}
.left-xxl-25 {
	left: 25%;
	right: inherit
}
.left-xxl-30 {
	left: 30%;
	right: inherit
}
.left-xxl-35 {
	left: 35%;
	right: inherit
}
.left-xxl-40 {
	left: 40%;
	right: inherit
}
.left-xxl-45 {
	left: 45%;
	right: inherit
}
.left-xxl-50 {
	left: 50%;
	right: inherit
}
.left-xxl-55 {
	left: 55%;
	right: inherit
}
.left-xxl-60 {
	left: 60%;
	right: inherit
}
.left-xxl-65 {
	left: 65%;
	right: inherit
}
.left-xxl-70 {
	left: 70%;
	right: inherit
}
.left-xxl-75 {
	left: 75%;
	right: inherit
}
.left-xxl-80 {
	left: 80%;
	right: inherit
}
.left-xxl-85 {
	left: 85%;
	right: inherit
}
.left-xxl-90 {
	left: 90%;
	right: inherit
}
.left-xxl-95 {
	left: 95%;
	right: inherit
}
.left-xxl-100 {
	left: 100%;
	right: inherit
}
.left-xxl-n5 {
	left: -5%;
	right: inherit
}
.left-xxl-n10 {
	left: -10%;
	right: inherit
}
.left-xxl-n15 {
	left: -15%;
	right: inherit
}
.left-xxl-n20 {
	left: -20%;
	right: inherit
}
.left-xxl-n25 {
	left: -25%;
	right: inherit
}
.left-xxl-n30 {
	left: -30%;
	right: inherit
}
.left-xxl-n35 {
	left: -35%;
	right: inherit
}
.left-xxl-n40 {
	left: -40%;
	right: inherit
}
.left-xxl-n45 {
	left: -45%;
	right: inherit
}
.left-xxl-n50 {
	left: -50%;
	right: inherit
}
.left-xxl-n55 {
	left: -55%;
	right: inherit
}
.left-xxl-n60 {
	left: -60%;
	right: inherit
}
.left-xxl-n65 {
	left: -65%;
	right: inherit
}
.left-xxl-n70 {
	left: -70%;
	right: inherit
}
.left-xxl-n75 {
	left: -75%;
	right: inherit
}
.left-xxl-n80 {
	left: -80%;
	right: inherit
}
.left-xxl-n85 {
	left: -85%;
	right: inherit
}
.left-xxl-n90 {
	left: -90%;
	right: inherit
}
.left-xxl-n95 {
	left: -95%;
	right: inherit
}
.left-xxl-n100 {
	left: -100%;
	right: inherit
}
.right-xxl-5 {
	right: 5%;
	left: inherit
}
.right-xxl-10 {
	right: 10%;
	left: inherit
}
.right-xxl-15 {
	right: 15%;
	left: inherit
}
.right-xxl-20 {
	right: 20%;
	left: inherit
}
.right-xxl-25 {
	right: 25%;
	left: inherit
}
.right-xxl-30 {
	right: 30%;
	left: inherit
}
.right-xxl-35 {
	right: 35%;
	left: inherit
}
.right-xxl-40 {
	right: 40%;
	left: inherit
}
.right-xxl-45 {
	right: 45%;
	left: inherit
}
.right-xxl-50 {
	right: 50%;
	left: inherit
}
.right-xxl-55 {
	right: 55%;
	left: inherit
}
.right-xxl-60 {
	right: 60%;
	left: inherit
}
.right-xxl-65 {
	right: 65%;
	left: inherit
}
.right-xxl-70 {
	right: 70%;
	left: inherit
}
.right-xxl-75 {
	right: 75%;
	left: inherit
}
.right-xxl-80 {
	right: 80%;
	left: inherit
}
.right-xxl-85 {
	right: 85%;
	left: inherit
}
.right-xxl-90 {
	right: 90%;
	left: inherit
}
.right-xxl-95 {
	right: 95%;
	left: inherit
}
.right-xxl-100 {
	right: 100%;
	left: inherit
}
.right-xxl-n5 {
	right: -5%;
	left: inherit
}
.right-xxl-n10 {
	right: -10%;
	left: inherit
}
.right-xxl-n15 {
	right: -15%;
	left: inherit
}
.right-xxl-n20 {
	right: -20%;
	left: inherit
}
.right-xxl-n25 {
	right: -25%;
	left: inherit
}
.right-xxl-n30 {
	right: -30%;
	left: inherit
}
.right-xxl-n35 {
	right: -35%;
	left: inherit
}
.right-xxl-n40 {
	right: -40%;
	left: inherit
}
.right-xxl-n45 {
	right: -45%;
	left: inherit
}
.right-xxl-n50 {
	right: -50%;
	left: inherit
}
.right-xxl-n55 {
	right: -55%;
	left: inherit
}
.right-xxl-n60 {
	right: -60%;
	left: inherit
}
.right-xxl-n65 {
	right: -65%;
	left: inherit
}
.right-xxl-n70 {
	right: -70%;
	left: inherit
}
.right-xxl-n75 {
	right: -75%;
	left: inherit
}
.right-xxl-n80 {
	right: -80%;
	left: inherit
}
.right-xxl-n85 {
	right: -85%;
	left: inherit
}
.right-xxl-n90 {
	right: -90%;
	left: inherit
}
.right-xxl-n95 {
	right: -95%;
	left: inherit
}
.right-xxl-n100 {
	right: -100%;
	left: inherit
}
.m-xxl-1-6 {
	margin: 1.6rem
}
.m-xxl-1-7 {
	margin: 1.7rem
}
.m-xxl-1-8 {
	margin: 1.8rem
}
.m-xxl-1-9 {
	margin: 1.9rem
}
.m-xxl-2-0 {
	margin: 2.0rem
}
.m-xxl-2-1 {
	margin: 2.1rem
}
.m-xxl-2-2 {
	margin: 2.2rem
}
.m-xxl-2-3 {
	margin: 2.3rem
}
.m-xxl-2-4 {
	margin: 2.4rem
}
.m-xxl-2-5 {
	margin: 2.5rem
}
.m-xxl-2-6 {
	margin: 2.6rem
}
.m-xxl-2-7 {
	margin: 2.7rem
}
.m-xxl-2-8 {
	margin: 2.8rem
}
.m-xxl-2-9 {
	margin: 2.9rem
}
.m-xxl-6 {
	margin: 3.5rem
}
.m-xxl-7 {
	margin: 4rem
}
.m-xxl-8 {
	margin: 4.5rem
}
.m-xxl-9 {
	margin: 5rem
}
.m-xxl-10 {
	margin: 5.5rem
}
.m-xxl-11 {
	margin: 6rem
}
.m-xxl-12 {
	margin: 6.5rem
}
.m-xxl-13 {
	margin: 7rem
}
.m-xxl-14 {
	margin: 7.5rem
}
.m-xxl-15 {
	margin: 8rem
}
.m-xxl-16 {
	margin: 8.5rem
}
.m-xxl-17 {
	margin: 9rem
}
.m-xxl-18 {
	margin: 9.5rem
}
.m-xxl-19 {
	margin: 10rem
}
.m-xxl-20 {
	margin: 10.5rem
}
.m-xxl-21 {
	margin: 11rem
}
.m-xxl-22 {
	margin: 11.5rem
}
.m-xxl-23 {
	margin: 12rem
}
.m-xxl-24 {
	margin: 12.5rem
}
.mt-xxl-1-6, .my-xxl-1-6 {
	margin-top: 1.6rem
}
.mt-xxl-1-7, .my-xxl-1-7 {
	margin-top: 1.7rem
}
.mt-xxl-1-8, .my-xxl-1-8 {
	margin-top: 1.8rem
}
.mt-xxl-1-9, .my-xxl-1-9 {
	margin-top: 1.9rem
}
.mt-xxl-2-0, .my-xxl-2-0 {
	margin-top: 2.0rem
}
.mt-xxl-2-1, .my-xxl-2-1 {
	margin-top: 2.1rem
}
.mt-xxl-2-2, .my-xxl-2-2 {
	margin-top: 2.2rem
}
.mt-xxl-2-3, .my-xxl-2-3 {
	margin-top: 2.3rem
}
.mt-xxl-2-4, .my-xxl-2-4 {
	margin-top: 2.4rem
}
.mt-xxl-2-5, .my-xxl-2-5 {
	margin-top: 2.5rem
}
.mt-xxl-2-6, .my-xxl-2-6 {
	margin-top: 2.6rem
}
.mt-xxl-2-7, .my-xxl-2-7 {
	margin-top: 2.7rem
}
.mt-xxl-2-8, .my-xxl-2-8 {
	margin-top: 2.8rem
}
.mt-xxl-2-9, .my-xxl-2-9 {
	margin-top: 2.9rem
}
.mt-xxl-6, .my-xxl-6 {
	margin-top: 3.5rem
}
.mt-xxl-7, .my-xxl-7 {
	margin-top: 4rem
}
.mt-xxl-8, .my-xxl-8 {
	margin-top: 4.5rem
}
.mt-xxl-9, .my-xxl-9 {
	margin-top: 5rem
}
.mt-xxl-10, .my-xxl-10 {
	margin-top: 5.5rem
}
.mt-xxl-11, .my-xxl-11 {
	margin-top: 6rem
}
.mt-xxl-12, .my-xxl-12 {
	margin-top: 6.5rem
}
.mt-xxl-13, .my-xxl-13 {
	margin-top: 7rem
}
.mt-xxl-14, .my-xxl-14 {
	margin-top: 7.5rem
}
.mt-xxl-15, .my-xxl-15 {
	margin-top: 8rem
}
.mt-xxl-16, .my-xxl-16 {
	margin-top: 8.5rem
}
.mt-xxl-17, .my-xxl-17 {
	margin-top: 9rem
}
.mt-xxl-18, .my-xxl-18 {
	margin-top: 9.5rem
}
.mt-xxl-19, .my-xxl-19 {
	margin-top: 10rem
}
.mt-xxl-20, .my-xxl-20 {
	margin-top: 10.5rem
}
.mt-xxl-21, .my-xxl-21 {
	margin-top: 11rem
}
.mt-xxl-22, .my-xxl-22 {
	margin-top: 11.5rem
}
.mt-xxl-23, .my-xxl-23 {
	margin-top: 12rem
}
.mt-xxl-24, .my-xxl-24 {
	margin-top: 12.5rem
}
.mb-xxl-1-6, .my-xxl-1-6 {
	margin-bottom: 1.6rem
}
.mb-xxl-1-7, .my-xxl-1-7 {
	margin-bottom: 1.7rem
}
.mb-xxl-1-8, .my-xxl-1-8 {
	margin-bottom: 1.8rem
}
.mb-xxl-1-9, .my-xxl-1-9 {
	margin-bottom: 1.9rem
}
.mb-xxl-2-0, .my-xxl-2-0 {
	margin-bottom: 2.0rem
}
.mb-xxl-2-1, .my-xxl-2-1 {
	margin-bottom: 2.1rem
}
.mb-xxl-2-2, .my-xxl-2-2 {
	margin-bottom: 2.2rem
}
.mb-xxl-2-3, .my-xxl-2-3 {
	margin-bottom: 2.3rem
}
.mb-xxl-2-4, .my-xxl-2-4 {
	margin-bottom: 2.4rem
}
.mb-xxl-2-5, .my-xxl-2-5 {
	margin-bottom: 2.5rem
}
.mb-xxl-2-6, .my-xxl-2-6 {
	margin-bottom: 2.6rem
}
.mb-xxl-2-7, .my-xxl-2-7 {
	margin-bottom: 2.7rem
}
.mb-xxl-2-8, .my-xxl-2-8 {
	margin-bottom: 2.8rem
}
.mb-xxl-2-9, .my-xxl-2-9 {
	margin-bottom: 2.9rem
}
.mb-xxl-6, .my-xxl-6 {
	margin-bottom: 3.5rem
}
.mb-xxl-7, .my-xxl-7 {
	margin-bottom: 4rem
}
.mb-xxl-8, .my-xxl-8 {
	margin-bottom: 4.5rem
}
.mb-xxl-9, .my-xxl-9 {
	margin-bottom: 5rem
}
.mb-xxl-10, .my-xxl-10 {
	margin-bottom: 5.5rem
}
.mb-xxl-11, .my-xxl-11 {
	margin-bottom: 6rem
}
.mb-xxl-12, .my-xxl-12 {
	margin-bottom: 6.5rem
}
.mb-xxl-13, .my-xxl-13 {
	margin-bottom: 7rem
}
.mb-xxl-14, .my-xxl-14 {
	margin-bottom: 7.5rem
}
.mb-xxl-15, .my-xxl-15 {
	margin-bottom: 8rem
}
.mb-xxl-16, .my-xxl-16 {
	margin-bottom: 8.5rem
}
.mb-xxl-17, .my-xxl-17 {
	margin-bottom: 9rem
}
.mb-xxl-18, .my-xxl-18 {
	margin-bottom: 9.5rem
}
.mb-xxl-19, .my-xxl-19 {
	margin-bottom: 10rem
}
.mb-xxl-20, .my-xxl-20 {
	margin-bottom: 10.5rem
}
.mb-xxl-21, .my-xxl-21 {
	margin-bottom: 11rem
}
.mb-xxl-22, .my-xxl-22 {
	margin-bottom: 11.5rem
}
.mb-xxl-23, .my-xxl-23 {
	margin-bottom: 12rem
}
.mb-xxl-24, .my-xxl-24 {
	margin-bottom: 12.5rem
}
.ms-xxl-1-6, .mx-xxl-1-6 {
	margin-left: 1.6rem
}
.ms-xxl-1-7, .mx-xxl-1-7 {
	margin-left: 1.7rem
}
.ms-xxl-1-8, .mx-xxl-1-8 {
	margin-left: 1.8rem
}
.ms-xxl-1-9, .mx-xxl-1-9 {
	margin-left: 1.9rem
}
.ms-xxl-2-0, .mx-xxl-2-0 {
	margin-left: 2.0rem
}
.ms-xxl-2-1, .mx-xxl-2-1 {
	margin-left: 2.1rem
}
.ms-xxl-2-2, .mx-xxl-2-2 {
	margin-left: 2.2rem
}
.ms-xxl-2-3, .mx-xxl-2-3 {
	margin-left: 2.3rem
}
.ms-xxl-2-4, .mx-xxl-2-4 {
	margin-left: 2.4rem
}
.ms-xxl-2-5, .mx-xxl-2-5 {
	margin-left: 2.5rem
}
.ms-xxl-2-6, .mx-xxl-2-6 {
	margin-left: 2.6rem
}
.ms-xxl-2-7, .mx-xxl-2-7 {
	margin-left: 2.7rem
}
.ms-xxl-2-8, .mx-xxl-2-8 {
	margin-left: 2.8rem
}
.ms-xxl-2-9, .mx-xxl-2-9 {
	margin-left: 2.9rem
}
.ms-xxl-6, .mx-xxl-6 {
	margin-left: 3.5rem
}
.ms-xxl-7, .mx-xxl-7 {
	margin-left: 4rem
}
.ms-xxl-8, .mx-xxl-8 {
	margin-left: 4.5rem
}
.ms-xxl-9, .mx-xxl-9 {
	margin-left: 5rem
}
.ms-xxl-10, .mx-xxl-10 {
	margin-left: 5.5rem
}
.ms-xxl-11, .mx-xxl-11 {
	margin-left: 6rem
}
.ms-xxl-12, .mx-xxl-12 {
	margin-left: 6.5rem
}
.ms-xxl-13, .mx-xxl-13 {
	margin-left: 7rem
}
.ms-xxl-14, .mx-xxl-14 {
	margin-left: 7.5rem
}
.ms-xxl-15, .mx-xxl-15 {
	margin-left: 8rem
}
.ms-xxl-16, .mx-xxl-16 {
	margin-left: 8.5rem
}
.ms-xxl-17, .mx-xxl-17 {
	margin-left: 9rem
}
.ms-xxl-18, .mx-xxl-18 {
	margin-left: 9.5rem
}
.ms-xxl-19, .mx-xxl-19 {
	margin-left: 10rem
}
.ms-xxl-20, .mx-xxl-20 {
	margin-left: 10.5rem
}
.ms-xxl-21, .mx-xxl-21 {
	margin-left: 11rem
}
.ms-xxl-22, .mx-xxl-22 {
	margin-left: 11.5rem
}
.ms-xxl-23, .mx-xxl-23 {
	margin-left: 12rem
}
.ms-xxl-24, .mx-xxl-24 {
	margin-left: 12.5rem
}
.me-xxl-1-6, .mx-xxl-1-6 {
	margin-right: 1.6rem
}
.me-xxl-1-7, .mx-xxl-1-7 {
	margin-right: 1.7rem
}
.me-xxl-1-8, .mx-xxl-1-8 {
	margin-right: 1.8rem
}
.me-xxl-1-9, .mx-xxl-1-9 {
	margin-right: 1.9rem
}
.me-xxl-2-0, .mx-xxl-2-0 {
	margin-right: 2.0rem
}
.me-xxl-2-1, .mx-xxl-2-1 {
	margin-right: 2.1rem
}
.me-xxl-2-2, .mx-xxl-2-2 {
	margin-right: 2.2rem
}
.me-xxl-2-3, .mx-xxl-2-3 {
	margin-right: 2.3rem
}
.me-xxl-2-4, .mx-xxl-2-4 {
	margin-right: 2.4rem
}
.me-xxl-2-5, .mx-xxl-2-5 {
	margin-right: 2.5rem
}
.me-xxl-2-6, .mx-xxl-2-6 {
	margin-right: 2.6rem
}
.me-xxl-2-7, .mx-xxl-2-7 {
	margin-right: 2.7rem
}
.me-xxl-2-8, .mx-xxl-2-8 {
	margin-right: 2.8rem
}
.me-xxl-2-9, .mx-xxl-2-9 {
	margin-right: 2.9rem
}
.me-xxl-6, .mx-xxl-6 {
	margin-right: 3.5rem
}
.me-xxl-7, .mx-xxl-7 {
	margin-right: 4rem
}
.me-xxl-8, .mx-xxl-8 {
	margin-right: 4.5rem
}
.me-xxl-9, .mx-xxl-9 {
	margin-right: 5rem
}
.me-xxl-10, .mx-xxl-10 {
	margin-right: 5.5rem
}
.me-xxl-11, .mx-xxl-11 {
	margin-right: 6rem
}
.me-xxl-12, .mx-xxl-12 {
	margin-right: 6.5rem
}
.me-xxl-13, .mx-xxl-13 {
	margin-right: 7rem
}
.me-xxl-14, .mx-xxl-14 {
	margin-right: 7.5rem
}
.me-xxl-15, .mx-xxl-15 {
	margin-right: 8rem
}
.me-xxl-16, .mx-xxl-16 {
	margin-right: 8.5rem
}
.me-xxl-17, .mx-xxl-17 {
	margin-right: 9rem
}
.me-xxl-18, .mx-xxl-18 {
	margin-right: 9.5rem
}
.me-xxl-19, .mx-xxl-19 {
	margin-right: 10rem
}
.me-xxl-20, .mx-xxl-20 {
	margin-right: 10.5rem
}
.me-xxl-21, .mx-xxl-21 {
	margin-right: 11rem
}
.me-xxl-22, .mx-xxl-22 {
	margin-right: 11.5rem
}
.me-xxl-23, .mx-xxl-23 {
	margin-right: 12rem
}
.me-xxl-24, .mx-xxl-24 {
	margin-right: 12.5rem
}
.p-xxl-1-6 {
	padding: 1.6rem
}
.p-xxl-1-7 {
	padding: 1.7rem
}
.p-xxl-1-8 {
	padding: 1.8rem
}
.p-xxl-1-9 {
	padding: 1.9rem
}
.p-xxl-2-0 {
	padding: 2.0rem
}
.p-xxl-2-1 {
	padding: 2.1rem
}
.p-xxl-2-2 {
	padding: 2.2rem
}
.p-xxl-2-3 {
	padding: 2.3rem
}
.p-xxl-2-4 {
	padding: 2.4rem
}
.p-xxl-2-5 {
	padding: 2.5rem
}
.p-xxl-2-6 {
	padding: 2.6rem
}
.p-xxl-2-7 {
	padding: 2.7rem
}
.p-xxl-2-8 {
	padding: 2.8rem
}
.p-xxl-2-9 {
	padding: 2.9rem
}
.p-xxl-6 {
	padding: 3.5rem
}
.p-xxl-7 {
	padding: 4rem
}
.p-xxl-8 {
	padding: 4.5rem
}
.p-xxl-9 {
	padding: 5rem
}
.p-xxl-10 {
	padding: 5.5rem
}
.p-xxl-11 {
	padding: 6rem
}
.p-xxl-12 {
	padding: 6.5rem
}
.p-xxl-13 {
	padding: 7rem
}
.p-xxl-14 {
	padding: 7.5rem
}
.p-xxl-15 {
	padding: 8rem
}
.p-xxl-16 {
	padding: 8.5rem
}
.p-xxl-17 {
	padding: 9rem
}
.p-xxl-18 {
	padding: 9.5rem
}
.p-xxl-19 {
	padding: 10rem
}
.p-xxl-20 {
	padding: 10.5rem
}
.p-xxl-21 {
	padding: 11rem
}
.p-xxl-22 {
	padding: 11.5rem
}
.p-xxl-23 {
	padding: 12rem
}
.p-xxl-24 {
	padding: 12.5rem
}
.pt-xxl-1-6, .py-xxl-1-6 {
	padding-top: 1.6rem
}
.pt-xxl-1-7, .py-xxl-1-7 {
	padding-top: 1.7rem
}
.pt-xxl-1-8, .py-xxl-1-8 {
	padding-top: 1.8rem
}
.pt-xxl-1-9, .py-xxl-1-9 {
	padding-top: 1.9rem
}
.pt-xxl-2-0, .py-xxl-2-0 {
	padding-top: 2.0rem
}
.pt-xxl-2-1, .py-xxl-2-1 {
	padding-top: 2.1rem
}
.pt-xxl-2-2, .py-xxl-2-2 {
	padding-top: 2.2rem
}
.pt-xxl-2-3, .py-xxl-2-3 {
	padding-top: 2.3rem
}
.pt-xxl-2-4, .py-xxl-2-4 {
	padding-top: 2.4rem
}
.pt-xxl-2-5, .py-xxl-2-5 {
	padding-top: 2.5rem
}
.pt-xxl-2-6, .py-xxl-2-6 {
	padding-top: 2.6rem
}
.pt-xxl-2-7, .py-xxl-2-7 {
	padding-top: 2.7rem
}
.pt-xxl-2-8, .py-xxl-2-8 {
	padding-top: 2.8rem
}
.pt-xxl-2-9, .py-xxl-2-9 {
	padding-top: 2.9rem
}
.pt-xxl-6, .py-xxl-6 {
	padding-top: 3.5rem
}
.pt-xxl-7, .py-xxl-7 {
	padding-top: 4rem
}
.pt-xxl-8, .py-xxl-8 {
	padding-top: 4.5rem
}
.pt-xxl-9, .py-xxl-9 {
	padding-top: 5rem
}
.pt-xxl-10, .py-xxl-10 {
	padding-top: 5.5rem
}
.pt-xxl-11, .py-xxl-11 {
	padding-top: 6rem
}
.pt-xxl-12, .py-xxl-12 {
	padding-top: 6.5rem
}
.pt-xxl-13, .py-xxl-13 {
	padding-top: 7rem
}
.pt-xxl-14, .py-xxl-14 {
	padding-top: 7.5rem
}
.pt-xxl-15, .py-xxl-15 {
	padding-top: 8rem
}
.pt-xxl-16, .py-xxl-16 {
	padding-top: 8.5rem
}
.pt-xxl-17, .py-xxl-17 {
	padding-top: 9rem
}
.pt-xxl-18, .py-xxl-18 {
	padding-top: 9.5rem
}
.pt-xxl-19, .py-xxl-19 {
	padding-top: 10rem
}
.pt-xxl-20, .py-xxl-20 {
	padding-top: 10.5rem
}
.pt-xxl-21, .py-xxl-21 {
	padding-top: 11rem
}
.pt-xxl-22, .py-xxl-22 {
	padding-top: 11.5rem
}
.pt-xxl-23, .py-xxl-23 {
	padding-top: 12rem
}
.pt-xxl-24, .py-xxl-24 {
	padding-top: 12.5rem
}
.pb-xxl-1-6, .py-xxl-1-6 {
	padding-bottom: 1.6rem
}
.pb-xxl-1-7, .py-xxl-1-7 {
	padding-bottom: 1.7rem
}
.pb-xxl-1-8, .py-xxl-1-8 {
	padding-bottom: 1.8rem
}
.pb-xxl-1-9, .py-xxl-1-9 {
	padding-bottom: 1.9rem
}
.pb-xxl-2-0, .py-xxl-2-0 {
	padding-bottom: 2.0rem
}
.pb-xxl-2-1, .py-xxl-2-1 {
	padding-bottom: 2.1rem
}
.pb-xxl-2-2, .py-xxl-2-2 {
	padding-bottom: 2.2rem
}
.pb-xxl-2-3, .py-xxl-2-3 {
	padding-bottom: 2.3rem
}
.pb-xxl-2-4, .py-xxl-2-4 {
	padding-bottom: 2.4rem
}
.pb-xxl-2-5, .py-xxl-2-5 {
	padding-bottom: 2.5rem
}
.pb-xxl-2-6, .py-xxl-2-6 {
	padding-bottom: 2.6rem
}
.pb-xxl-2-7, .py-xxl-2-7 {
	padding-bottom: 2.7rem
}
.pb-xxl-2-8, .py-xxl-2-8 {
	padding-bottom: 2.8rem
}
.pb-xxl-2-9, .py-xxl-2-9 {
	padding-bottom: 2.9rem
}
.pb-xxl-6, .py-xxl-6 {
	padding-bottom: 3.5rem
}
.pb-xxl-7, .py-xxl-7 {
	padding-bottom: 4rem
}
.pb-xxl-8, .py-xxl-8 {
	padding-bottom: 4.5rem
}
.pb-xxl-9, .py-xxl-9 {
	padding-bottom: 5rem
}
.pb-xxl-10, .py-xxl-10 {
	padding-bottom: 5.5rem
}
.pb-xxl-11, .py-xxl-11 {
	padding-bottom: 6rem
}
.pb-xxl-12, .py-xxl-12 {
	padding-bottom: 6.5rem
}
.pb-xxl-13, .py-xxl-13 {
	padding-bottom: 7rem
}
.pb-xxl-14, .py-xxl-14 {
	padding-bottom: 7.5rem
}
.pb-xxl-15, .py-xxl-15 {
	padding-bottom: 8rem
}
.pb-xxl-16, .py-xxl-16 {
	padding-bottom: 8.5rem
}
.pb-xxl-17, .py-xxl-17 {
	padding-bottom: 9rem
}
.pb-xxl-18, .py-xxl-18 {
	padding-bottom: 9.5rem
}
.pb-xxl-19, .py-xxl-19 {
	padding-bottom: 10rem
}
.pb-xxl-20, .py-xxl-20 {
	padding-bottom: 10.5rem
}
.pb-xxl-21, .py-xxl-21 {
	padding-bottom: 11rem
}
.pb-xxl-22, .py-xxl-22 {
	padding-bottom: 11.5rem
}
.pb-xxl-23, .py-xxl-23 {
	padding-bottom: 12rem
}
.pb-xxl-24, .py-xxl-24 {
	padding-bottom: 12.5rem
}
.ps-xxl-1-6, .px-xxl-1-6 {
	padding-left: 1.6rem
}
.ps-xxl-1-7, .px-xxl-1-7 {
	padding-left: 1.7rem
}
.ps-xxl-1-8, .px-xxl-1-8 {
	padding-left: 1.8rem
}
.ps-xxl-1-9, .px-xxl-1-9 {
	padding-left: 1.9rem
}
.ps-xxl-2-0, .px-xxl-2-0 {
	padding-left: 2.0rem
}
.ps-xxl-2-1, .px-xxl-2-1 {
	padding-left: 2.1rem
}
.ps-xxl-2-2, .px-xxl-2-2 {
	padding-left: 2.2rem
}
.ps-xxl-2-3, .px-xxl-2-3 {
	padding-left: 2.3rem
}
.ps-xxl-2-4, .px-xxl-2-4 {
	padding-left: 2.4rem
}
.ps-xxl-2-5, .px-xxl-2-5 {
	padding-left: 2.5rem
}
.ps-xxl-2-6, .px-xxl-2-6 {
	padding-left: 2.6rem
}
.ps-xxl-2-7, .px-xxl-2-7 {
	padding-left: 2.7rem
}
.ps-xxl-2-8, .px-xxl-2-8 {
	padding-left: 2.8rem
}
.ps-xxl-2-9, .px-xxl-2-9 {
	padding-left: 2.9rem
}
.ps-xxl-6, .px-xxl-6 {
	padding-left: 3.5rem
}
.ps-xxl-7, .px-xxl-7 {
	padding-left: 4rem
}
.ps-xxl-8, .px-xxl-8 {
	padding-left: 4.5rem
}
.ps-xxl-9, .px-xxl-9 {
	padding-left: 5rem
}
.ps-xxl-10, .px-xxl-10 {
	padding-left: 5.5rem
}
.ps-xxl-11, .px-xxl-11 {
	padding-left: 6rem
}
.ps-xxl-12, .px-xxl-12 {
	padding-left: 6.5rem
}
.ps-xxl-13, .px-xxl-13 {
	padding-left: 7rem
}
.ps-xxl-14, .px-xxl-14 {
	padding-left: 7.5rem
}
.ps-xxl-15, .px-xxl-15 {
	padding-left: 8rem
}
.ps-xxl-16, .px-xxl-16 {
	padding-left: 8.5rem
}
.ps-xxl-17, .px-xxl-17 {
	padding-left: 9rem
}
.ps-xxl-18, .px-xxl-18 {
	padding-left: 9.5rem
}
.ps-xxl-19, .px-xxl-19 {
	padding-left: 10rem
}
.ps-xxl-20, .px-xxl-20 {
	padding-left: 10.5rem
}
.ps-xxl-21, .px-xxl-21 {
	padding-left: 11rem
}
.ps-xxl-22, .px-xxl-22 {
	padding-left: 11.5rem
}
.ps-xxl-23, .px-xxl-23 {
	padding-left: 12rem
}
.ps-xxl-24, .px-xxl-24 {
	padding-left: 12.5rem
}
.pe-xxl-1-6, .px-xxl-1-6 {
	padding-right: 1.6rem
}
.pe-xxl-1-7, .px-xxl-1-7 {
	padding-right: 1.7rem
}
.pe-xxl-1-8, .px-xxl-1-8 {
	padding-right: 1.8rem
}
.pe-xxl-1-9, .px-xxl-1-9 {
	padding-right: 1.9rem
}
.pe-xxl-2-0, .px-xxl-2-0 {
	padding-right: 2.0rem
}
.pe-xxl-2-1, .px-xxl-2-1 {
	padding-right: 2.1rem
}
.pe-xxl-2-2, .px-xxl-2-2 {
	padding-right: 2.2rem
}
.pe-xxl-2-3, .px-xxl-2-3 {
	padding-right: 2.3rem
}
.pe-xxl-2-4, .px-xxl-2-4 {
	padding-right: 2.4rem
}
.pe-xxl-2-5, .px-xxl-2-5 {
	padding-right: 2.5rem
}
.pe-xxl-2-6, .px-xxl-2-6 {
	padding-right: 2.6rem
}
.pe-xxl-2-7, .px-xxl-2-7 {
	padding-right: 2.7rem
}
.pe-xxl-2-8, .px-xxl-2-8 {
	padding-right: 2.8rem
}
.pe-xxl-2-9, .px-xxl-2-9 {
	padding-right: 2.9rem
}
.pe-xxl-6, .px-xxl-6 {
	padding-right: 3.5rem
}
.pe-xxl-7, .px-xxl-7 {
	padding-right: 4rem
}
.pe-xxl-8, .px-xxl-8 {
	padding-right: 4.5rem
}
.pe-xxl-9, .px-xxl-9 {
	padding-right: 5rem
}
.pe-xxl-10, .px-xxl-10 {
	padding-right: 5.5rem
}
.pe-xxl-11, .px-xxl-11 {
	padding-right: 6rem
}
.pe-xxl-12, .px-xxl-12 {
	padding-right: 6.5rem
}
.pe-xxl-13, .px-xxl-13 {
	padding-right: 7rem
}
.pe-xxl-14, .px-xxl-14 {
	padding-right: 7.5rem
}
.pe-xxl-15, .px-xxl-15 {
	padding-right: 8rem
}
.pe-xxl-16, .px-xxl-16 {
	padding-right: 8.5rem
}
.pe-xxl-17, .px-xxl-17 {
	padding-right: 9rem
}
.pe-xxl-18, .px-xxl-18 {
	padding-right: 9.5rem
}
.pe-xxl-19, .px-xxl-19 {
	padding-right: 10rem
}
.pe-xxl-20, .px-xxl-20 {
	padding-right: 10.5rem
}
.pe-xxl-21, .px-xxl-21 {
	padding-right: 11rem
}
.pe-xxl-22, .px-xxl-22 {
	padding-right: 11.5rem
}
.pe-xxl-23, .px-xxl-23 {
	padding-right: 12rem
}
.pe-xxl-24, .px-xxl-24 {
	padding-right: 12.5rem
}
}

@media screen and (max-width: 1199px) {
section {
	padding: 140px 0
}
section.md {
	padding: 120px 0
}
.md-height-auto {
	height: auto
}
.md-vertical-align-middle {
	vertical-align: middle
}
.md-vertical-align-top {
	vertical-align: top
}
.md-vertical-align-bottom {
	vertical-align: bottom
}
.md-absolute-middle-inherit {
	left: 0;
	top: 0;
	position: relative;
	-ms-transform: translateX(0) translateY(0);
	-moz-transform: translateX(0) translateY(0);
	-webkit-transform: translateX(0) translateY(0);
	transform: translateX(0) translateY(0);
	-o-transform: translateX(0) translateY(0)
}
.md-background-image-left {
	background-position: left
}
.md-background-image-right {
	background-position: right
}
.md-background-image-center {
	background-position: center
}
.md-overflow-hidden {
	overflow: hidden !important
}
.md-overflow-auto {
	overflow: auto !important
}
.md-display-table {
	display: table !important
}
.md-display-table-cell {
	display: table-cell !important
}
.md-display-flex-inherit {
	-ms-box-orient: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	flex-flow: inherit;
	-webkit-flex-flow: inherit;
	-moz-flex-flow: inherit;
	-ms-flex-flow: inherit;
	-o-flex-flow: inherit
}
.md-position-inherit {
	position: inherit
}
.md-position-relative {
	position: relative
}
.md-position-absolute {
	position: absolute
}
.md-position-fixed {
	position: fixed
}
}

@media screen and (max-width: 1050px) {
.parallax {
	background-attachment: inherit
}
}

@media screen and (max-width: 991px) {
.sm-height-auto {
	height: auto
}
section {
	padding: 120px 0
}
section.md {
	padding: 100px 0
}
.sm-vertical-align-middle {
	vertical-align: middle
}
.sm-vertical-align-top {
	vertical-align: top
}
.sm-vertical-align-bottom {
	vertical-align: bottom
}
.sm-absolute-middle-inherit {
	left: 0;
	top: 0;
	position: relative;
	-ms-transform: translateX(0) translateY(0);
	-moz-transform: translateX(0) translateY(0);
	-webkit-transform: translateX(0) translateY(0);
	transform: translateX(0) translateY(0);
	-o-transform: translateX(0) translateY(0)
}
.sm-background-image-left {
	background-position: left
}
.sm-background-image-right {
	background-position: right
}
.sm-background-image-center {
	background-position: center
}
.sm-overflow-hidden {
	overflow: hidden !important
}
.sm-overflow-auto {
	overflow: auto !important
}
.sm-display-table {
	display: table !important
}
.sm-display-table-cell {
	display: table-cell !important
}
.sm-display-flex-inherit {
	-ms-box-orient: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	flex-flow: inherit;
	-webkit-flex-flow: inherit;
	-moz-flex-flow: inherit;
	-ms-flex-flow: inherit;
	-o-flex-flow: inherit
}
.sm-clear-both {
	clear: both
}
.sm-position-inherit {
	position: inherit !important
}
.sm-position-initial {
	position: initial !important
}
.sm-position-relative {
	position: relative !important
}
.sm-position-absolute {
	position: absolute !important
}
.sm-position-fixed {
	position: fixed !important
}
.parallax {
	background-position: center
}
.sm-opacity1 {
	opacity: .1
}
.sm-opacity2 {
	opacity: .2
}
.sm-opacity3 {
	opacity: .3
}
.sm-opacity4 {
	opacity: .4
}
.sm-opacity5 {
	opacity: .5
}
.sm-opacity6 {
	opacity: .6
}
.sm-opacity7 {
	opacity: .7
}
.sm-opacity8 {
	opacity: .8
}
.sm-opacity9 {
	opacity: .9
}
.sm-opacity10 {
	opacity: 1
}
}

@media screen and (max-width: 767px) {
body {
	font-size: 16px
}
.xs-height-auto {
	height: auto
}
.xs-opacity1 {
	opacity: .1
}
.xs-opacity2 {
	opacity: .2
}
.xs-opacity3 {
	opacity: .3
}
.xs-opacity4 {
	opacity: .4
}
.xs-opacity5 {
	opacity: .5
}
.xs-opacity6 {
	opacity: .6
}
.xs-opacity7 {
	opacity: .7
}
.xs-opacity8 {
	opacity: .8
}
.xs-opacity9 {
	opacity: .9
}
.xs-opacity10 {
	opacity: 1
}
.xs-vertical-align-middle {
	vertical-align: middle
}
.xs-vertical-align-top {
	vertical-align: top
}
.xs-vertical-align-bottom {
	vertical-align: bottom
}
.xs-absolute-middle-inherit {
	left: 0;
	top: 0;
	position: relative;
	-ms-transform: translateX(0) translateY(0);
	-moz-transform: translateX(0) translateY(0);
	-webkit-transform: translateX(0) translateY(0);
	transform: translateX(0) translateY(0);
	-o-transform: translateX(0) translateY(0)
}
.xs-background-image-left {
	background-position: left !important
}
.xs-background-image-right {
	background-position: right !important
}
.xs-background-image-center {
	background-position: center !important
}
.xs-overflow-hidden {
	overflow: hidden !important
}
.xs-overflow-auto {
	overflow: auto !important
}
.xs-display-table {
	display: table !important
}
.xs-display-table-cell {
	display: table-cell !important
}
.xs-display-flex-inherit {
	-ms-box-orient: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	display: inherit;
	flex-flow: inherit;
	-webkit-flex-flow: inherit;
	-moz-flex-flow: inherit;
	-ms-flex-flow: inherit;
	-o-flex-flow: inherit
}
.xs-position-inherit {
	position: inherit
}
.xs-position-relative {
	position: relative
}
.xs-position-absolute {
	position: absolute
}
.xs-position-fixed {
	position: fixed
}
}

@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) and (orientation: portrait) and (-webkit-min-device-pixel-ratio: 1) {
.parallax {
	background-attachment: inherit;
	background-position: center
}
}

@media only screen and (min-device-width: 768px) and (max-device-width: 1024px) and (orientation: landscape) and (-webkit-min-device-pixel-ratio: 1) {
.parallax {
	background-attachment: inherit;
	background-position: center
}
}
header {
	transition: all 0.5s ease 0s;
	position: relative;
	z-index: 99999
}
.navbar-brand img {
	max-height: 53px;
	transition-duration: 0.5s
}
.navbar-header-custom {
	padding: 17px 0 15px 0
}
.navbar-default {
	transition: all 0.5s ease 0s;
	-webkit-box-shadow: 0 0 3px rgba(0,0,0,0.2);
	-ms-box-shadow: 0 0 3px rgba(0,0,0,0.2);
	box-shadow: 0 0 3px rgba(0,0,0,0.2)
}
.navbar-default .container, .navbar-default .container-fluid {
	position: relative
}
.menu_area {
	position: relative;
	z-index: 2
}
.menu_area .navbar-brand {
	transition: all 0.5s ease 0s;
	display: inline-block
}
.navbar-nav li {
	list-style: none;
	-webkit-transition: background .3s ease;
	-ms-transition: background .3s ease;
	transition: background .3s ease
}
.navbar-nav li.has-sub>a {
	position: relative
}
.navbar-nav li.has-sub a:hover {
	color: #fff
}
.navbar-nav li a {
	display: block;
	color: #9d9d9d;
	font-size: 16px;
	font-weight: 600;
	padding: 8px 42px 8px 32px;
	text-transform: uppercase;
	letter-spacing: 1px
}
.navbar-nav>li {
	margin-left: 10px;
	float: left;
	text-align: center
}
.navbar-nav>li.has-sub {
	padding-right: 13px
}
.navbar-nav>li>a {
	position: relative;
	display: block;
	font-size: 18px;
	font-weight: 500;
	padding: 21px 0.5rem;
	color: #282b2d;
	letter-spacing: 1px;
	text-transform: uppercase;
	-webkit-transition-duration: 500ms;
	-o-transition-duration: 500ms;
	transition-duration: 500ms
}
.navbar-nav li.current>a, .navbar-nav li.active>a {
	color: #229f72
}
.navbar-nav>li.has-sub>a:hover {
	color: #000
}
.navbar>ul>li.has-sub>a:hover:after {
	border-color: transparent #000 #000 transparent
}
.navbar>ul>li.has-sub>a:after {
	position: absolute;
	top: 32px;
	right: -8px;
	content: "";
	border-color: transparent #282b2d #282b2d transparent;
	border-style: solid;
	border-width: 0 1px 1px 0;
	display: block;
	height: 6px;
	transform: rotate(45deg);
	transition: border 0.3s ease 0s;
	width: 6px
}
.navbar>ul>li.current>a:after {
	border-color: transparent #229f72 #229f72 transparent
}
.navbar-nav ul {
	position: absolute;
	left: -9999px
}
.navbar ul ul li {
	-webkit-transition: all .25s ease;
	-ms-transition: all .25s ease;
	transition: all .25s ease
}
.navbar ul ul li:last-child {
	margin-bottom: 0
}
.navbar-nav li>ul {
	padding: 15px 0;
	margin: 0 0 0 10px;
	background: #282b2d;
	min-width: 225px;
	-webkit-box-shadow: 9px 11px 29px rgba(125,138,152,0.15);
	-ms-box-shadow: 9px 11px 29px rgba(125,138,152,0.15);
	-moz-box-shadow: 9px 11px 29px rgba(125,138,152,0.15);
	box-shadow: 9px 11px 29px rgba(125,138,152,0.15)
}
.navbar-nav li:hover>ul {
	left: auto
}
.navbar-nav>li.has-sub>ul {
	text-align: left;
	opacity: 0;
	margin-top: 10px;
	-webkit-transition: all .5s ease;
	-ms-transition: all .5s ease;
	-moz-transition: all .5s ease;
	-o-transition: all .5s ease;
	transition: all .5s ease
}
.navbar-nav>li.has-sub:hover>ul {
	margin-top: 0;
	opacity: 1
}
.navbar li>ul ul {
	margin-top: -39px;
	margin-left: 240px;
	min-width: 300px;
	max-width: 100%;
	z-index: 1
}
.navbar li>ul ul ul {
	margin-left: 175px;
	min-width: 130px
}
.navbar ul ul li:last-child>a, .navbar ul ul li.last-item>a {
	border-bottom: 0
}
.navbar ul ul li.has-sub>a:after {
	position: absolute;
	top: 22px;
	right: 17px;
	width: 8px;
	height: 2px;
	display: block;
	background: #9d9d9d;
	content: ""
}
.navbar ul ul li.has-sub>a:before {
	position: absolute;
	top: 19px;
	right: 20px;
	display: block;
	width: 2px;
	height: 8px;
	background: #9d9d9d;
	content: '';
	-webkit-transition: all .25s ease;
	-ms-transition: all .25s ease;
	transition: all 0.25s ease
}
.navbar ul ul>li.has-sub:hover>a:before {
	top: 17px;
	height: 0
}
.attr-nav {
	float: right;
	margin-left: 11px
}
.attr-nav .dropdown-toggle:after {
	content: none
}
.attr-nav>ul {
	padding: 0;
	margin: 0 0 -5px 0;
	list-style: none;
	display: inline-block
}
.attr-nav>ul>li {
	float: none;
	display: inline-block;
	vertical-align: middle
}
.attr-nav>ul>li>a {
	color: #282b2d;
	display: block;
	padding: 21px 12px;
	position: relative;
	font-size: 17px
}
.attr-nav>ul>li>a span.badge {
	position: absolute;
	top: 50%;
	margin-top: -15px;
	right: 5px;
	font-size: 10px;
	padding: 2px 0 0 1px;
	width: 15px;
	height: 15px;
	color: #fff;
	border-radius: 15px;
	line-height: 12px;
	font-weight: 400
}
.attr-nav>ul>li.dropdown ul.dropdown-menu {
	position: absolute;
	border: none;
	border-radius: 0;
	padding: 0;
	background: #282b2d;
	min-width: 225px;
	margin: 10px 0 0 10px;
	-webkit-box-shadow: 0px 2px 3px rgba(0,0,0,0.2);
	-ms-box-shadow: 0px 2px 3px rgba(0,0,0,0.2);
	-moz-box-shadow: 0px 2px 3px rgba(0,0,0,0.2);
	box-shadow: 0px 2px 3px rgba(0,0,0,0.2);
	-webkit-transition: all .5s ease;
	-ms-transition: all .5s ease;
	-moz-transition: all .5s ease;
	-o-transition: all .5s ease;
	transition: all .5s ease
}
.top-search {
	padding: 10px 0;
	display: none
}
.top-search input.form-control {
	background-color: transparent;
	border: none;
	-moz-box-shadow: 0px 0px 0px;
	-webkit-box-shadow: 0px 0px 0px;
	-o-box-shadow: 0px 0px 0px;
	box-shadow: 0px 0px 0px;
	color: #fff;
	height: 40px;
	padding: 0 15px;
	min-height: auto
}
.top-search input.form-control::placeholder {
color:#f1f1f1;
opacity:1
}
.top-search input.form-control::-ms-input-placeholder, .top-search input.form-control::-moz-input-placeholder {
color:#f1f1f1
}
.top-search .input-group-addon {
	background-color: transparent;
	border: none;
	color: #fff;
	padding-left: 0;
	padding-right: 0;
	line-height: 1.7;
	font-size: 18px
}
.top-search .input-group-addon.close-search {
	cursor: pointer
}
.top-search.white {
	background: #fff
}
.top-search.white input.form-control {
	color: #282b2d
}
.top-search.white input.form-control::placeholder {
color:#0c3246;
opacity:1
}
.top-search.white input.form-control::-ms-input-placeholder {
color:#0c3246
}
.top-search.white .input-group-addon {
	color: #282b2d
}

@media screen and (min-width: 992px) {
header.scrollHeader .navbar-default {
	position: fixed;
	top: 0;
	z-index: 99;
	width: 100%;
	background: #fff;
	left: 0;
	transition: all 0.2s ease 0s;
	-webkit-box-shadow: 0 0 3px rgba(0,0,0,0.2);
	-ms-box-shadow: 0 0 3px rgba(0,0,0,0.2);
	box-shadow: 0 0 3px rgba(0,0,0,0.2);
	animation: .95s ease 0s normal forwards 1 running headerAnimate
}
@keyframes headerAnimate {
0% {
margin-top:-150px
}
100% {
margin-top:-1px
}
}
.wrapper-boxed .scrollHeader .navbar-default {
	left: 0;
	margin: 0 auto;
	max-width: 1200px;
	right: 0
}
.scrollHeader .navbar-brand img {
	transition-duration: 0.5s
}
.scrollHeader .navbar-header-custom {
	padding: 8px 0;
	transition-duration: 0.5s
}
.navbar-nav .megamenu {
	margin: 0;
	padding: 30px 15px;
	right: 0;
	width: 100%
}
.navbar .megamenu>li {
	margin: 0;
	float: left
}
.navbar .sub-title {
	color: #fff
}
.megamenu>li>ul {
	left: 0;
	margin: 0;
	min-width: auto;
	position: static;
	width: 100%
}
.navbar .megamenu li>ul {
	margin: 0;
	min-width: auto;
	padding: 0;
	-webkit-box-shadow: none;
	-ms-box-shadow: none;
	-moz-box-shadow: none;
	box-shadow: none
}
.navbar .megamenu ul li {
	padding: 0
}
.navbar .megamenu ul li a {
	padding-left: 0;
	padding-right: 0
}
.navbar .megamenu li.has-sub>a:after, .navbar .megamenu li.has-sub>a:before {
	background: none
}
.navbar-nav li>ul {
	min-width: 270px
}
.scrollHeader .attr-nav>ul>li>a {
	padding: 21px 12px
}
.attr-nav>ul>li.dropdown ul.dropdown-menu {
	visibility: hidden;
	top: 66px;
	border-radius: 0;
	opacity: 0;
	left: -225px
}
.attr-nav>ul>li.dropdown:hover ul.dropdown-menu {
	margin-top: 0;
	opacity: 1;
	visibility: visible
}
.scrollHeader .attr-nav>ul>li.dropdown ul.dropdown-menu {
	top: 67px
}
.top-position {
	margin-top: -95px
}
.top-position1 {
	margin-top: -96px
}
.header-style1 {
	box-shadow: none
}
.header-style1 #top-bar {
	background: none;
	border-bottom: 1px solid rgba(255,255,255,0.2)
}
.header-style1 .navbar-default {
	-webkit-box-shadow: none;
	-ms-box-shadow: none;
	box-shadow: none
}
.header-style1 .navbar-nav li.has-sub a:hover {
	color: #fff
}
.header-style1 .navbar-nav>li>a {
	color: #fff
}
.header-style1 .navbar-nav li.current>a {
	color: #229f72
}
.header-style1 .navbar-nav>li.has-sub>a:hover {
	color: #fff
}
.header-style1 .navbar>ul>li.has-sub>a:hover:after {
	border-color: transparent #fff #fff transparent
}
.header-style1 .navbar>ul>li.has-sub>a:after {
	border-color: transparent #fff #fff transparent
}
.header-style1 .navbar>ul>li.current>a:after {
	border-color: transparent #229f72 #229f72 transparent
}
.header-style1.scrollHeader .navbar-nav>li>a {
	color: #282b2d
}
.header-style1.scrollHeader .navbar-nav>li.has-sub>a:hover {
	color: #000
}
.header-style1.scrollHeader .navbar>ul>li.has-sub>a:after {
	border-color: transparent #282b2d #282b2d transparent
}
.header-style1.scrollHeader .navbar-nav li.current>a {
	color: #229f72
}
.header-style1.scrollHeader .navbar-nav li.current>a:hover {
	color: #229f72
}
.header-style1.scrollHeader .navbar>ul>li.current>a:after {
	border-color: transparent #229f72 #229f72 transparent
}
.header-style1 .attr-nav>ul>li>a {
	color: #fff
}
.header-style1.scrollHeader .attr-nav>ul>li>a {
	color: #282b2d
}
.header-style2 .navbar-default {
	box-shadow: none
}
.header-style2 .navbar-nav li a {
	color: #0c3246
}
.header-style2 .navbar-nav>li>a {
	color: #20252d
}
.header-style2 .navbar-nav li>ul {
	background: #fff
}
.header-style2 .navbar ul ul li.active>a {
	color: #20252d
}
.header-style2 .navbar-nav li.has-sub a:hover {
	color: #20252d
}
.header-style2 .navbar-nav li.current>a {
	color: #229f72
}
.header-style2 .navbar .sub-title {
	color: #0c3246;
	font-weight: 800
}
.header-style2 .navbar-nav>li.has-sub>a:hover {
	color: #000
}
.header-style2 .navbar>ul>li.has-sub>a:hover:after {
	border-color: transparent #000 #000 transparent
}
.header-style2 .navbar>ul>li.has-sub>a:after {
	border-color: transparent #000 #000 transparent
}
.header-style2 .navbar>ul>li.current>a:after {
	border-color: transparent #229f72 #229f72 transparent
}
.header-style2.scrollHeader .navbar-nav>li>a {
	color: #20252d
}
.header-style2.scrollHeader .navbar-nav>li.has-sub>a:hover {
	color: #000
}
.header-style2.scrollHeader .navbar>ul>li.has-sub>a:after {
	border-color: transparent #20252d #20252d transparent
}
.header-style2.scrollHeader .navbar-nav li.current>a {
	color: #229f72
}
.header-style2.scrollHeader .navbar-nav li.current>a:hover {
	color: #229f72
}
.header-style2.scrollHeader .navbar>ul>li.current>a:after {
	border-color: transparent #229f72 #229f72 transparent
}
.menu_area-light .navbar-nav li a {
	color: #0c3246
}
.menu_area-light .navbar-nav>li>a {
	color: #fff
}
.menu_area-light .navbar-nav li>ul {
	background: #fff
}
.menu_area-light .navbar ul ul li.active>a {
	color: #282b2d
}
.menu_area-light .navbar-nav li.has-sub a:hover {
	color: #282b2d
}
.menu_area-light .navbar-nav li.current>a {
	color: #229f72
}
.menu_area-light .navbar .sub-title {
	color: #282b2d
}
.menu_area-light .navbar-nav>li.has-sub>a:hover {
	color: #fff
}
.menu_area-light .navbar>ul>li.has-sub>a:hover:after {
	border-color: transparent #fff #fff transparent
}
.menu_area-light .navbar>ul>li.has-sub>a:after {
	border-color: transparent #fff #fff transparent
}
.menu_area-light .navbar>ul>li.current>a:after {
	border-color: transparent #229f72 #229f72 transparent
}
.menu_area-light.scrollHeader .navbar-nav>li>a {
	color: #282b2d
}
.menu_area-light.scrollHeader .navbar-nav>li.has-sub>a:hover {
	color: #000
}
.menu_area-light.scrollHeader .navbar>ul>li.has-sub>a:after {
	border-color: transparent #282b2d #282b2d transparent
}
.menu_area-light.scrollHeader .navbar-nav li.current>a {
	color: #229f72
}
.menu_area-light.scrollHeader .navbar-nav li.current>a:hover {
	color: #229f72
}
.menu_area-light.scrollHeader .navbar>ul>li.current>a:after {
	border-color: transparent #229f72 #229f72 transparent
}
}

@media screen and (max-width: 1399px) {
.navbar li>ul ul {
	margin-left: -290px
}
}

@media screen and (max-width: 1199px) {
.navbar-nav>li {
	margin-left: 2px
}
}

@media screen and (max-width: 991px) {
.navbar-header-custom {
	padding: 6px 0
}
.navbar-brand img {
	max-height: 47px
}
.navbar-nav li>ul {
	-webkit-box-shadow: none;
	-ms-box-shadow: none;
	-moz-box-shadow: none;
	box-shadow: none
}
.navbar-nav>li.has-sub>ul {
	opacity: 1;
	margin: 0;
	-webkit-box-shadow: none;
	-ms-box-shadow: none;
	-moz-box-shadow: none;
	box-shadow: none;
	-webkit-transition: all 0s ease;
	-ms-transition: all 0s ease;
	-moz-transition: all 0s ease;
	-o-transition: all 0s ease;
	transition: all 0s ease
}
.navbar li>ul ul {
	margin: 0;
	min-width: auto
}
.navbar-nav>li.has-sub {
	padding-right: 0
}
.navbar-nav>li>a {
	padding: 14px 20px;
	color: #282b2d;
	font-size: 16px;
	font-weight: 600
}
.navbar-nav>li>a:hover {
	opacity: 1
}
.navbar-nav li.has-sub a:hover {
	color: #282b2d
}
.navbar .sub-title {
	color: #282b2d
}
.navbar-nav {
	background: #fff;
	-webkit-box-shadow: 0 2px 3px rgba(0,0,0,0.2);
	-ms-box-shadow: 0 2px 3px rgba(0,0,0,0.2);
	-moz-box-shadow: 0 2px 3px rgba(0,0,0,0.2);
	box-shadow: 0 2px 3px rgba(0,0,0,0.2);
	position: absolute;
	top: 70px;
	left: 0;
	width: 100%;
	transition-duration: 0;
	-ms-transition-duration: 0;
	-moz-transition-duration: 0;
	-webkit-transition-duration: 0;
	-o-transition-duration: 0;
	width: 100%;
	display: none;
	transition: none;
	-ms-transition: none;
	-moz-transition: none;
	-webkit-transition: none;
	-o-transition: none
}
.navbar-nav li.active>a {
	opacity: 1
}
.navbar-nav ul {
	width: 100%;
	display: none;
	transition: none;
	-ms-transition: none;
	-moz-transition: none;
	-webkit-transition: none;
	-o-transition: none
}
.navbar-nav li {
	width: 100%;
	border-top: 1px solid #e6e6e6;
	position: relative;
	padding: 0;
	margin: 0;
	text-align: left
}
.navbar-nav ul li:hover {
	background: #f5f5f5
}
.navbar-nav ul ul li {
	height: auto
}
.navbar-nav li:hover>ul>li {
	height: auto
}
.navbar ul li a {
	width: 100%;
	border-bottom: 0
}
.navbar ul ul {
	position: relative;
	left: 0;
	width: 100%;
	margin: 0;
	text-align: left;
	background: #f5f5f5;
	padding: 0
}
.navbar ul ul li {
	margin-bottom: 0;
	padding: 0;
	border-color: #e6e6e6
}
.navbar ul ul li a {
	width: 100%;
	border-bottom: 0;
	color: #0c3246;
	background: none;
	padding: 10px 35px 10px 30px;
	font-size: 15px
}
.navbar ul ul ul li a {
	padding-left: 45px
}
.navbar>ul>li {
	float: none
}
.navbar-nav ul ul {
	position: relative;
	left: 0;
	width: 100%;
	margin: 0;
	text-align: left;
	background: #f5f5f5;
	padding: 0
}
.navbar>ul>li.has-sub>a:after, .navbar>ul>li.has-sub>a:before {
	display: none
}
.navbar ul ul>li.has-sub>a:after, .navbar ul ul>li.has-sub>a:before {
	display: none
}
.navbar-nav ul ul ul li.active a {
	border-left: none
}
.navbar-nav>ul>li.has-sub>ul>li.active>a, .navbar-nav>ul ul>li.has-sub>ul>li.active>a {
	border-top: none
}
.navbar li>ul ul ul {
	margin-left: 0;
	background: #fff
}
.navbar ul ul ul ul li a {
	padding-left: 55px
}
.navbar-nav .has-sub .has-sub .submenu-button {
	height: 43px
}
.navbar-nav .has-sub .has-sub .submenu-button:after {
	top: 19px
}
.navbar-nav .has-sub .has-sub .submenu-button:before {
	top: 15px
}
.navbar-toggler {
	background: #282b2d;
	width: 50px;
	height: 45px;
	padding: 0;
	border-radius: 0;
	position: absolute;
	right: 0;
	top: 13px;
	cursor: pointer;
	z-index: 12399994;
	border: none
}
.navbar-toggler:after {
	position: absolute;
	top: 22px;
	right: 15px;
	display: block;
	height: 8px;
	width: 20px;
	border-top: 2px solid #fff;
	border-bottom: 2px solid #fff;
	content: ""
}
.navbar-toggler:before {
	-webkit-transition: all .3s ease;
	-ms-transition: all .3s ease;
	transition: all .3s ease;
	position: absolute;
	top: 16px;
	right: 15px;
	display: block;
	height: 2px;
	width: 20px;
	background: #fff;
	content: ""
}
.navbar-toggler.menu-opened:after {
	-webkit-transition: all .3s ease;
	-ms-transition: all .3s ease;
	transition: all .3s ease;
	top: 23px;
	border: 0;
	height: 2px;
	width: 19px;
	background: #fff;
	-webkit-transform: rotate(45deg);
	-moz-transform: rotate(45deg);
	-ms-transform: rotate(45deg);
	-o-transform: rotate(45deg);
	transform: rotate(45deg)
}
.navbar-toggler.menu-opened:before {
	top: 23px;
	background: #fff;
	width: 19px;
	-webkit-transform: rotate(-45deg);
	-moz-transform: rotate(-45deg);
	-ms-transform: rotate(-45deg);
	-o-transform: rotate(-45deg);
	transform: rotate(-45deg)
}
.navbar-nav .submenu-button {
	position: absolute;
	z-index: 99;
	right: 0;
	top: 0;
	display: block;
	height: 51px;
	width: 100%;
	cursor: pointer
}
.navbar-nav .submenu-button:after {
	position: absolute;
	top: 24px;
	right: 16px;
	width: 10px;
	height: 2px;
	display: block;
	background: #282b2d;
	content: ""
}
.navbar-nav .submenu-button:before {
	position: absolute;
	top: 20px;
	right: 20px;
	display: block;
	width: 2px;
	height: 10px;
	background: #282b2d;
	content: ""
}
.navbar-nav .has-sub.active>.submenu-button:before {
	display: none
}
.attr-nav {
	float: left;
	margin-right: 70px
}
.attr-nav>ul>li {
	display: inline-block
}
.attr-nav>ul>li.dropdown ul.dropdown-menu {
	left: -193px;
	top: 38px;
	display: none !important
}
.attr-nav>ul>li.dropdown.show ul.dropdown-menu {
	display: block !important
}
.attr-nav>ul>li>a {
	padding: 0
}
.attr-nav>ul>li>a span.badge {
	right: -8px
}
.top-position {
	margin-top: -72px
}
.top-position1 {
	margin-top: -73px
}
.header-style1 {
	box-shadow: none
}
.header-style1 #top-bar {
	display: none;
	background: none;
	border-bottom: 1px solid rgba(255,255,255,0.35)
}
.header-style1 .navbar-default {
	-webkit-box-shadow: none;
	-ms-box-shadow: none;
	box-shadow: none;
	border-bottom: 1px solid rgba(255,255,255,0.35)
}
.header-style1 .navbar-toggler {
	background: #fff
}
.header-style1 .navbar-toggler:after {
	border-top: 2px solid #fff;
	border-bottom: 2px solid #fff
}
.header-style1 .navbar-toggler:before {
	background: #fff
}
.header-style1 .navbar-toggler.menu-opened:after {
	background: #fff;
	border-bottom: none
}
.header-style1 .navbar-toggler.menu-opened:before {
	background: #fff
}
.header-style1 .attr-nav>ul>li>a {
	color: #fff
}
}